[python] added skeleton for python interface
This commit is contained in:
@@ -3,6 +3,10 @@ project(triton)
|
|||||||
include(CTest)
|
include(CTest)
|
||||||
list(APPEND CMAKE_MODULE_PATH "${CMAKE_CURRENT_SOURCE_DIR}/cmake")
|
list(APPEND CMAKE_MODULE_PATH "${CMAKE_CURRENT_SOURCE_DIR}/cmake")
|
||||||
|
|
||||||
|
# Options
|
||||||
|
option(BUILD_EXAMPLES "Build C++ Triton examples" ON)
|
||||||
|
option(BUILD_PYTHON_MODULE "Build Python Triton bindings" OFF)
|
||||||
|
|
||||||
# FLEX/YACC
|
# FLEX/YACC
|
||||||
find_package(BISON)
|
find_package(BISON)
|
||||||
find_package(FLEX)
|
find_package(FLEX)
|
||||||
@@ -35,15 +39,24 @@ add_custom_target( ALL SOURCES ${ALL_SRC} )
|
|||||||
include_directories(${CMAKE_CURRENT_SOURCE_DIR}/include)
|
include_directories(${CMAKE_CURRENT_SOURCE_DIR}/include)
|
||||||
set(CMAKE_CXX_FLAGS "${CMAKE_CXX_FLAGS} ${LLVM_CXXFLAGS} -std=c++11")
|
set(CMAKE_CXX_FLAGS "${CMAKE_CXX_FLAGS} ${LLVM_CXXFLAGS} -std=c++11")
|
||||||
|
|
||||||
|
# Examples
|
||||||
|
if(BUILD_EXAMPLES)
|
||||||
|
message(STATUS "Adding C++ examples")
|
||||||
|
add_subdirectory(examples)
|
||||||
|
endif()
|
||||||
|
|
||||||
|
# Python module
|
||||||
|
if(BUILD_PYTHON_MODULE)
|
||||||
|
message(STATUS "Adding Python module")
|
||||||
|
file(GLOB_RECURSE PYTHON_SRC python/src/*.cpp)
|
||||||
|
include_directories(python/src/ ${PYTHON_INCLUDE_DIRS})
|
||||||
|
set(PYTHON_LIBS )
|
||||||
|
endif()
|
||||||
|
|
||||||
|
|
||||||
# Triton
|
# Triton
|
||||||
file(GLOB_RECURSE LIBTRITON_SRC lib/*.cpp)
|
file(GLOB_RECURSE LIBTRITON_SRC lib/*.cpp)
|
||||||
add_library(triton SHARED ${LIBTRITON_SRC} ${BISON_Parser_OUTPUTS} ${FLEX_Lexer_OUTPUTS})
|
add_library(triton SHARED ${LIBTRITON_SRC} ${PYTHON_SRC} ${BISON_Parser_OUTPUTS} ${FLEX_Lexer_OUTPUTS})
|
||||||
target_link_libraries(triton LLVM)
|
target_link_libraries(triton LLVM)
|
||||||
|
|
||||||
# Examples
|
|
||||||
add_subdirectory(examples)
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
@@ -1,2 +1 @@
|
|||||||
add_subdirectory(cpp)
|
add_subdirectory(cpp)
|
||||||
add_subdirectory(python)
|
|
||||||
|
@@ -1,2 +0,0 @@
|
|||||||
add_subdirectory(tensorflow)
|
|
||||||
add_subdirectory(pytorch)
|
|
@@ -1,10 +0,0 @@
|
|||||||
find_package(Torch)
|
|
||||||
if(${TORCH_FOUND})
|
|
||||||
set(CUDA_HOME "/usr/local/cuda")
|
|
||||||
include_directories(${TORCH_INCLUDE_DIRS})
|
|
||||||
include_directories("${CUDA_HOME}/include")
|
|
||||||
link_directories(${TORCH_LIBRARY_DIRS})
|
|
||||||
add_definitions(-D_GLIBCXX_USE_CXX11_ABI=1)
|
|
||||||
add_library(torch_triton SHARED conv.cpp shift.cpp batchnorm.cpp)
|
|
||||||
target_link_libraries(torch_triton torch triton)
|
|
||||||
endif()
|
|
@@ -1,90 +0,0 @@
|
|||||||
#include <torch/torch.h>
|
|
||||||
#include <torch/script.h>
|
|
||||||
#include "ATen/cuda/CUDAContext.h"
|
|
||||||
#include "triton/driver/stream.h"
|
|
||||||
#include "triton/dnn/batchnorm.h"
|
|
||||||
|
|
||||||
#define CHECK_CUDA(x) AT_CHECK(x.type().is_cuda(), #x " must be a CUDA tensor")
|
|
||||||
#define CHECK_CONTIGUOUS(x) AT_CHECK(x.is_contiguous(), #x " must be contiguous")
|
|
||||||
#define CHECK_INPUT(x) CHECK_CUDA(x); CHECK_CONTIGUOUS(x)
|
|
||||||
|
|
||||||
std::vector<torch::Tensor>
|
|
||||||
batchnorm_ymv(const torch::Tensor fw_x,
|
|
||||||
const torch::Tensor fw_g,
|
|
||||||
const torch::Tensor fw_b,
|
|
||||||
double eps) {
|
|
||||||
CHECK_INPUT(fw_x);
|
|
||||||
CHECK_INPUT(fw_g);
|
|
||||||
CHECK_INPUT(fw_b);
|
|
||||||
// Wrap CUDA handles
|
|
||||||
c10::DeviceIndex device = fw_x.storage().device().index();
|
|
||||||
CUstream custream = (CUstream)at::cuda::getCurrentCUDAStream(device).stream();
|
|
||||||
triton::driver::cu_stream stream(custream, false);
|
|
||||||
triton::driver::context* ctx = stream.context();
|
|
||||||
// get sizes
|
|
||||||
int C = fw_x.size(0);
|
|
||||||
int H = fw_x.size(1);
|
|
||||||
int W = fw_x.size(2);
|
|
||||||
int B = fw_x.size(3);
|
|
||||||
// allocate outputs
|
|
||||||
torch::Tensor fw_y = torch::empty(fw_x.sizes()).cuda();
|
|
||||||
torch::Tensor fw_m = torch::empty(fw_g.sizes()).cuda();
|
|
||||||
torch::Tensor fw_v = torch::empty(fw_g.sizes()).cuda();
|
|
||||||
triton::driver::cu_buffer x(ctx, (CUdeviceptr)fw_x.storage().data(), false);
|
|
||||||
triton::driver::cu_buffer g(ctx, (CUdeviceptr)fw_g.storage().data(), false);
|
|
||||||
triton::driver::cu_buffer b(ctx, (CUdeviceptr)fw_b.storage().data(), false);
|
|
||||||
triton::driver::cu_buffer y(ctx, (CUdeviceptr)fw_y.storage().data(), false);
|
|
||||||
triton::driver::cu_buffer m(ctx, (CUdeviceptr)fw_m.storage().data(), false);
|
|
||||||
triton::driver::cu_buffer v(ctx, (CUdeviceptr)fw_v.storage().data(), false);
|
|
||||||
// create template
|
|
||||||
triton::dnn::batchnorm_forward batchnorm(C, 1, H, W, B, "float");
|
|
||||||
batchnorm.enqueue(&stream, {&y, &m, &v, &x, &g, &b});
|
|
||||||
stream.synchronize();
|
|
||||||
return {fw_y, fw_m, fw_v};
|
|
||||||
}
|
|
||||||
|
|
||||||
std::vector<torch::Tensor>
|
|
||||||
batchnorm_dxdgdb(const torch::Tensor fw_dy,
|
|
||||||
const torch::Tensor fw_x,
|
|
||||||
const torch::Tensor fw_g,
|
|
||||||
const torch::Tensor fw_m,
|
|
||||||
const torch::Tensor fw_v,
|
|
||||||
double eps) {
|
|
||||||
CHECK_INPUT(fw_dy);
|
|
||||||
CHECK_INPUT(fw_x);
|
|
||||||
CHECK_INPUT(fw_g);
|
|
||||||
CHECK_INPUT(fw_m);
|
|
||||||
CHECK_INPUT(fw_v);
|
|
||||||
// Wrap CUDA handles
|
|
||||||
c10::DeviceIndex device = fw_x.storage().device().index();
|
|
||||||
CUstream custream = (CUstream)at::cuda::getCurrentCUDAStream(device).stream();
|
|
||||||
triton::driver::cu_stream stream(custream, false);
|
|
||||||
triton::driver::context* ctx = stream.context();
|
|
||||||
// get sizes
|
|
||||||
int C = fw_x.size(0);
|
|
||||||
int H = fw_x.size(1);
|
|
||||||
int W = fw_x.size(2);
|
|
||||||
int B = fw_x.size(3);
|
|
||||||
// allocate outputs
|
|
||||||
torch::Tensor fw_dx = torch::empty(fw_x.sizes()).cuda();
|
|
||||||
torch::Tensor fw_dg = torch::empty(fw_g.sizes()).cuda();
|
|
||||||
torch::Tensor fw_db = torch::empty(fw_g.sizes()).cuda();
|
|
||||||
// triton handles
|
|
||||||
triton::driver::cu_buffer dy(ctx, (CUdeviceptr)fw_dy.storage().data(), false);
|
|
||||||
triton::driver::cu_buffer x(ctx, (CUdeviceptr) fw_x.storage().data(), false);
|
|
||||||
triton::driver::cu_buffer g(ctx, (CUdeviceptr) fw_g.storage().data(), false);
|
|
||||||
triton::driver::cu_buffer m(ctx, (CUdeviceptr) fw_m.storage().data(), false);
|
|
||||||
triton::driver::cu_buffer v(ctx, (CUdeviceptr) fw_v.storage().data(), false);
|
|
||||||
triton::driver::cu_buffer dx(ctx, (CUdeviceptr)fw_dx.storage().data(), false);
|
|
||||||
triton::driver::cu_buffer dg(ctx, (CUdeviceptr)fw_dg.storage().data(), false);
|
|
||||||
triton::driver::cu_buffer db(ctx, (CUdeviceptr)fw_db.storage().data(), false);
|
|
||||||
// create config
|
|
||||||
triton::dnn::batchnorm_backward batchnorm(C, 1, H, W, B, "float", eps);
|
|
||||||
batchnorm.enqueue(&stream, {&dx, &dg, &db, &dy, &x, &g, &m, &v});
|
|
||||||
stream.synchronize();
|
|
||||||
return {fw_dx, fw_dg, fw_db};
|
|
||||||
}
|
|
||||||
|
|
||||||
static auto registry =
|
|
||||||
torch::jit::RegisterOperators("triton::batchnorm_ymv", &batchnorm_ymv)
|
|
||||||
.op("triton::batchnorm_dxdgdb", &batchnorm_dxdgdb);
|
|
@@ -1,148 +0,0 @@
|
|||||||
#include <vector>
|
|
||||||
#include <torch/torch.h>
|
|
||||||
#include <torch/script.h>
|
|
||||||
#include "ATen/cuda/CUDAContext.h"
|
|
||||||
#include "triton/driver/stream.h"
|
|
||||||
#include "triton/dnn/conv.h"
|
|
||||||
|
|
||||||
#define CHECK_CUDA(x) AT_CHECK(x.type().is_cuda(), #x " must be a CUDA tensor")
|
|
||||||
#define CHECK_CONTIGUOUS(x) AT_CHECK(x.is_contiguous(), #x " must be contiguous")
|
|
||||||
#define CHECK_INPUT(x) CHECK_CUDA(x); CHECK_CONTIGUOUS(x)
|
|
||||||
|
|
||||||
torch::Tensor conv_common(
|
|
||||||
int32_t B, int32_t C, int32_t D, int32_t H, int32_t W,
|
|
||||||
int32_t T, int32_t R, int32_t S, int32_t NF,
|
|
||||||
int32_t stride_d, int32_t stride_h, int32_t stride_w,
|
|
||||||
int32_t pad_d, int32_t pad_h, int32_t pad_w,
|
|
||||||
triton::dnn::conv::type ty,
|
|
||||||
torch::Tensor torcha, torch::Tensor torchb, torch::Tensor torchbias,
|
|
||||||
bool autotune = false
|
|
||||||
) {
|
|
||||||
// Wrap CUDA handles
|
|
||||||
c10::DeviceIndex device = torcha.storage().device().index();
|
|
||||||
// Get stream
|
|
||||||
CUstream custream = (CUstream)at::cuda::getCurrentCUDAStream(device).stream();
|
|
||||||
triton::driver::cu_stream stream(custream, false);
|
|
||||||
triton::driver::context* ctx = stream.context();
|
|
||||||
// Get template
|
|
||||||
bool has_bias = torchbias.storage().size() > 0;
|
|
||||||
triton::dnn::conv conv(B, C, D, H, W, T, R, S, NF,
|
|
||||||
stride_d, stride_h, stride_w,
|
|
||||||
pad_d, pad_h, pad_w,
|
|
||||||
1, 1, 1,
|
|
||||||
"float", "float", ty, has_bias);
|
|
||||||
// Bind memory
|
|
||||||
triton::driver::cu_buffer a(ctx, (CUdeviceptr)torcha.storage().data(), false);
|
|
||||||
triton::driver::cu_buffer b(ctx, (CUdeviceptr)torchb.storage().data(), false);
|
|
||||||
triton::driver::cu_buffer cubias(ctx, (CUdeviceptr)torchbias.storage().data(), false);
|
|
||||||
triton::driver::buffer* bias = has_bias ? &cubias : nullptr;
|
|
||||||
// Allocate output
|
|
||||||
std::vector<int32_t> c_shapes = conv.c_shapes();
|
|
||||||
torch::Tensor torchc;
|
|
||||||
if(ty == triton::dnn::conv::WGRAD)
|
|
||||||
torchc = torch::empty({c_shapes[0], c_shapes[2], c_shapes[3], c_shapes[4]}, torch::kFloat).cuda();
|
|
||||||
else
|
|
||||||
torchc = torch::empty({c_shapes[0], c_shapes[1], c_shapes[3], c_shapes[4]}, torch::kFloat).cuda();
|
|
||||||
triton::driver::cu_buffer c(ctx, (CUdeviceptr)torchc.storage().data(), false);
|
|
||||||
// Enqueue
|
|
||||||
conv.enqueue(&stream, {&a, &b, &c, bias});
|
|
||||||
return torchc;
|
|
||||||
}
|
|
||||||
|
|
||||||
torch::Tensor conv_fprop(
|
|
||||||
const torch::Tensor data,
|
|
||||||
const torch::Tensor weight,
|
|
||||||
const torch::Tensor bias,
|
|
||||||
int64_t stride_h, int64_t stride_w,
|
|
||||||
int64_t pad_h, int64_t pad_w) {
|
|
||||||
// Check
|
|
||||||
CHECK_INPUT(data);
|
|
||||||
CHECK_INPUT(weight);
|
|
||||||
// Unpack data shapes
|
|
||||||
const int32_t B = data.size(0);
|
|
||||||
const int32_t Ci = data.size(1);
|
|
||||||
const int32_t D = 1;
|
|
||||||
const int32_t H = data.size(2);
|
|
||||||
const int32_t W = data.size(3);
|
|
||||||
// Unpack weight shapes
|
|
||||||
const int32_t Cf = weight.size(0);
|
|
||||||
const int32_t T = 1;
|
|
||||||
const int32_t R = weight.size(1);
|
|
||||||
const int32_t S = weight.size(2);
|
|
||||||
const int32_t NF = weight.size(3);
|
|
||||||
// Configuration
|
|
||||||
const int32_t stride_d = 1;
|
|
||||||
const int32_t pad_d = 0;
|
|
||||||
// Check
|
|
||||||
AT_CHECK(Ci == Cf, "Number of channels in data and weights must match");
|
|
||||||
return conv_common(B, Ci, D, H, W, T, R, S, NF, stride_d, stride_h, stride_w, pad_d, pad_h, pad_w, triton::dnn::conv::FPROP, data, weight, bias);
|
|
||||||
}
|
|
||||||
|
|
||||||
torch::Tensor conv_bprop(
|
|
||||||
const torch::Tensor derror,
|
|
||||||
const torch::Tensor weight,
|
|
||||||
const torch::Tensor bias,
|
|
||||||
int64_t H, int64_t W,
|
|
||||||
int64_t stride_h, int64_t stride_w,
|
|
||||||
int64_t pad_h, int64_t pad_w){
|
|
||||||
// Check
|
|
||||||
CHECK_INPUT(derror);
|
|
||||||
CHECK_INPUT(weight);
|
|
||||||
// Unpack data shapes
|
|
||||||
const int32_t B = derror.size(0);
|
|
||||||
const int32_t Ki = derror.size(1);
|
|
||||||
const int32_t M = 1;
|
|
||||||
const int32_t P = derror.size(2);
|
|
||||||
const int32_t Q = derror.size(3);
|
|
||||||
// Unpack weight shapes
|
|
||||||
const int32_t C = weight.size(0);
|
|
||||||
const int32_t T = 1;
|
|
||||||
const int32_t R = weight.size(1);
|
|
||||||
const int32_t S = weight.size(2);
|
|
||||||
const int32_t Kw = weight.size(3);
|
|
||||||
// Compute M, P, Q
|
|
||||||
const int32_t stride_d = 1;
|
|
||||||
int32_t pad_d = 0;
|
|
||||||
int32_t D = 1;
|
|
||||||
// Check
|
|
||||||
AT_CHECK(Ki == Kw, "Number of channels in error and weights must match");
|
|
||||||
return conv_common(B, C, D, H, W, T, R, S, Kw, stride_d, stride_h, stride_w, pad_d, pad_h, pad_w, triton::dnn::conv::BPROP, derror, weight, bias);
|
|
||||||
}
|
|
||||||
|
|
||||||
torch::Tensor conv_wgrad(
|
|
||||||
const torch::Tensor data,
|
|
||||||
const torch::Tensor derror,
|
|
||||||
const torch::Tensor bias,
|
|
||||||
int64_t R, int64_t S,
|
|
||||||
int64_t stride_h, int64_t stride_w,
|
|
||||||
int64_t pad_h, int64_t pad_w
|
|
||||||
){
|
|
||||||
// Check
|
|
||||||
CHECK_INPUT(data);
|
|
||||||
CHECK_INPUT(derror);
|
|
||||||
// Unpack data shapes
|
|
||||||
const int32_t Ba = data.size(0);
|
|
||||||
const int32_t C = data.size(1);
|
|
||||||
const int32_t D = 1;
|
|
||||||
const int32_t H = data.size(2);
|
|
||||||
const int32_t W = data.size(3);
|
|
||||||
// Unpack error shapes
|
|
||||||
const int32_t Bb = derror.size(0);
|
|
||||||
const int32_t K = derror.size(1);
|
|
||||||
const int32_t M = 1;
|
|
||||||
const int32_t P = derror.size(2);
|
|
||||||
const int32_t Q = derror.size(3);
|
|
||||||
// Compute M, P, Q
|
|
||||||
const int32_t upsample_d = 1, upsample_h = 1, upsample_w = 1;
|
|
||||||
const int32_t stride_d = 1;
|
|
||||||
const int32_t pad_d = 0;
|
|
||||||
const int32_t T = 1;
|
|
||||||
// Check
|
|
||||||
AT_CHECK(Ba == Bb, "Number of channels in error and weights must match");
|
|
||||||
return conv_common(Ba, C, D, H, W, T, R, S, K, stride_d, stride_h, stride_w, pad_d, pad_h, pad_w, triton::dnn::conv::WGRAD, data, derror, bias);
|
|
||||||
}
|
|
||||||
|
|
||||||
static auto registry =
|
|
||||||
torch::jit::RegisterOperators("triton::conv_fprop", &conv_fprop)
|
|
||||||
.op("triton::conv_bprop", &conv_bprop)
|
|
||||||
.op("triton::conv_wgrad", &conv_wgrad);
|
|
@@ -1,183 +0,0 @@
|
|||||||
from __future__ import print_function
|
|
||||||
import argparse
|
|
||||||
import torch
|
|
||||||
import torch.nn as nn
|
|
||||||
import torch.nn.functional as F
|
|
||||||
import torch.optim as optim
|
|
||||||
from torchvision import datasets, transforms
|
|
||||||
import triton
|
|
||||||
from torch.utils.cpp_extension import load
|
|
||||||
from torch.distributions import categorical
|
|
||||||
|
|
||||||
shift_cuda = load(
|
|
||||||
'shift_cuda', ['/home/philippe/development/shiftnet/kernels/shift_cuda.cpp',
|
|
||||||
'/home/philippe/development/shiftnet/kernels/shift_cuda_kernel.cu'], extra_cflags=['-O3'])
|
|
||||||
|
|
||||||
class shift(torch.autograd.Function):
|
|
||||||
@staticmethod
|
|
||||||
def forward(ctx, x, shift):
|
|
||||||
ctx.save_for_backward(shift)
|
|
||||||
return shift_cuda.forward(x, shift)
|
|
||||||
|
|
||||||
@staticmethod
|
|
||||||
def backward(ctx, grad_output):
|
|
||||||
shift, = ctx.saved_tensors
|
|
||||||
grad_output = shift_cuda.backward(grad_output, shift)
|
|
||||||
|
|
||||||
return grad_output, None
|
|
||||||
|
|
||||||
|
|
||||||
class Shift(nn.Module):
|
|
||||||
def __init__(self, in_channels, kernel_size):
|
|
||||||
super(Shift, self).__init__()
|
|
||||||
self.channels = in_channels
|
|
||||||
self.kernel_size = kernel_size
|
|
||||||
if kernel_size == 3:
|
|
||||||
p = torch.Tensor([0.3, 0.4, 0.3])
|
|
||||||
elif kernel_size == 5:
|
|
||||||
p = torch.Tensor([0.1, 0.25, 0.3, 0.25, 0.1])
|
|
||||||
elif kernel_size == 7:
|
|
||||||
p = torch.Tensor([0.075, 0.1, 0.175, 0.3, 0.175, 0.1, 0.075])
|
|
||||||
elif kernel_size == 9:
|
|
||||||
p = torch.Tensor([0.05, 0.075, 0.1, 0.175, 0.2, 0.175, 0.1, 0.075, 0.05])
|
|
||||||
else:
|
|
||||||
raise RuntimeError('Unsupported kernel size')
|
|
||||||
shift_t = categorical.Categorical(p).sample((in_channels, 2)) - (kernel_size // 2)
|
|
||||||
self.register_buffer('shift_t', shift_t.int())
|
|
||||||
|
|
||||||
def forward(self, x):
|
|
||||||
if x.is_cuda:
|
|
||||||
return shift.apply(x, self.shift_t)
|
|
||||||
else:
|
|
||||||
print('Shift only supports GPU for now..')
|
|
||||||
assert False
|
|
||||||
|
|
||||||
def extra_repr(self):
|
|
||||||
s = ('{channels}, kernel_size={kernel_size}')
|
|
||||||
return s.format(**self.__dict__)
|
|
||||||
|
|
||||||
|
|
||||||
def ShiftConv2d(in_planes, out_planes, kernel_size=3, stride=1, groups=1, dilation=1):
|
|
||||||
return nn.Sequential(
|
|
||||||
Shift(in_planes, kernel_size),
|
|
||||||
nn.Conv2d(in_planes, out_planes, kernel_size=1, stride=stride,
|
|
||||||
padding=0, groups=groups, bias=False)
|
|
||||||
)
|
|
||||||
|
|
||||||
|
|
||||||
class Net(nn.Module):
|
|
||||||
def __init__(self):
|
|
||||||
super(Net, self).__init__()
|
|
||||||
self.conv1 = ShiftConv2d(1, 32, 3, 1)
|
|
||||||
self.conv2 = ShiftConv2d(32, 128, 3, 1)
|
|
||||||
self.conv3 = ShiftConv2d(128, 128, 3, 2)
|
|
||||||
self.bn1 = nn.BatchNorm2d(128)
|
|
||||||
self.conv4 = ShiftConv2d(128, 256, 3, 2)
|
|
||||||
self.bn2 = nn.BatchNorm2d(256)
|
|
||||||
self.fc1 = nn.Linear(256*7*7, 500)
|
|
||||||
self.fc2 = nn.Linear(500, 10)
|
|
||||||
|
|
||||||
def forward(self, x):
|
|
||||||
x = self.conv1(x)
|
|
||||||
x = self.conv2(x)
|
|
||||||
x = self.conv3(x)
|
|
||||||
x = self.bn1(x)
|
|
||||||
x = F.relu(x)
|
|
||||||
x = self.conv4(x)
|
|
||||||
x = self.bn2(x)
|
|
||||||
x = F.relu(x)
|
|
||||||
x = x.view(-1, 256*7*7)
|
|
||||||
x = F.relu(self.fc1(x))
|
|
||||||
x = self.fc2(x)
|
|
||||||
return F.log_softmax(x, dim=1)
|
|
||||||
|
|
||||||
Net = Net()
|
|
||||||
|
|
||||||
def train(args, model, device, train_loader, optimizer, epoch):
|
|
||||||
model.train()
|
|
||||||
for batch_idx, (data, target) in enumerate(train_loader):
|
|
||||||
data, target = data.to(device), target.to(device)
|
|
||||||
optimizer.zero_grad()
|
|
||||||
output = model(data)
|
|
||||||
loss = F.nll_loss(output, target)
|
|
||||||
loss.backward()
|
|
||||||
optimizer.step()
|
|
||||||
if batch_idx % args.log_interval == 0:
|
|
||||||
print('Train Epoch: {} [{}/{} ({:.0f}%)]\tLoss: {:.6f}'.format(
|
|
||||||
epoch, batch_idx * len(data), len(train_loader.dataset),
|
|
||||||
100. * batch_idx / len(train_loader), loss.item()))
|
|
||||||
|
|
||||||
def test(args, model, device, test_loader):
|
|
||||||
model.eval()
|
|
||||||
test_loss = 0
|
|
||||||
correct = 0
|
|
||||||
with torch.no_grad():
|
|
||||||
for data, target in test_loader:
|
|
||||||
data, target = data.to(device), target.to(device)
|
|
||||||
output = model(data)
|
|
||||||
test_loss += F.nll_loss(output, target, reduction='sum').item() # sum up batch loss
|
|
||||||
pred = output.argmax(dim=1, keepdim=True) # get the index of the max log-probability
|
|
||||||
correct += pred.eq(target.view_as(pred)).sum().item()
|
|
||||||
|
|
||||||
test_loss /= len(test_loader.dataset)
|
|
||||||
|
|
||||||
print('\nTest set: Average loss: {:.4f}, Accuracy: {}/{} ({:.0f}%)\n'.format(
|
|
||||||
test_loss, correct, len(test_loader.dataset),
|
|
||||||
100. * correct / len(test_loader.dataset)))
|
|
||||||
|
|
||||||
def main():
|
|
||||||
# Training settings
|
|
||||||
parser = argparse.ArgumentParser(description='PyTorch MNIST Example')
|
|
||||||
parser.add_argument('--batch-size', type=int, default=64, metavar='N',
|
|
||||||
help='input batch size for training (default: 64)')
|
|
||||||
parser.add_argument('--test-batch-size', type=int, default=1000, metavar='N',
|
|
||||||
help='input batch size for testing (default: 1000)')
|
|
||||||
parser.add_argument('--epochs', type=int, default=10, metavar='N',
|
|
||||||
help='number of epochs to train (default: 10)')
|
|
||||||
parser.add_argument('--lr', type=float, default=0.01, metavar='LR',
|
|
||||||
help='learning rate (default: 0.01)')
|
|
||||||
parser.add_argument('--momentum', type=float, default=0.5, metavar='M',
|
|
||||||
help='SGD momentum (default: 0.5)')
|
|
||||||
parser.add_argument('--no-cuda', action='store_true', default=False,
|
|
||||||
help='disables CUDA training')
|
|
||||||
parser.add_argument('--seed', type=int, default=1, metavar='S',
|
|
||||||
help='random seed (default: 1)')
|
|
||||||
parser.add_argument('--log-interval', type=int, default=10, metavar='N',
|
|
||||||
help='how many batches to wait before logging training status')
|
|
||||||
|
|
||||||
parser.add_argument('--save-model', action='store_true', default=False,
|
|
||||||
help='For Saving the current Model')
|
|
||||||
args = parser.parse_args()
|
|
||||||
use_cuda = not args.no_cuda and torch.cuda.is_available()
|
|
||||||
|
|
||||||
torch.manual_seed(args.seed)
|
|
||||||
|
|
||||||
device = torch.device("cuda" if use_cuda else "cpu")
|
|
||||||
|
|
||||||
kwargs = {'num_workers': 1, 'pin_memory': True} if use_cuda else {}
|
|
||||||
train_loader = torch.utils.data.DataLoader(
|
|
||||||
datasets.MNIST('../data', train=True, download=True,
|
|
||||||
transform=transforms.Compose([
|
|
||||||
transforms.ToTensor(),
|
|
||||||
transforms.Normalize((0.1307,), (0.3081,))
|
|
||||||
])),
|
|
||||||
batch_size=args.batch_size, shuffle=True, **kwargs)
|
|
||||||
test_loader = torch.utils.data.DataLoader(
|
|
||||||
datasets.MNIST('../data', train=False, transform=transforms.Compose([
|
|
||||||
transforms.ToTensor(),
|
|
||||||
transforms.Normalize((0.1307,), (0.3081,))
|
|
||||||
])),
|
|
||||||
batch_size=args.test_batch_size, shuffle=True, **kwargs)
|
|
||||||
|
|
||||||
|
|
||||||
model = Net.to(device)
|
|
||||||
optimizer = optim.SGD(model.parameters(), lr=args.lr, momentum=args.momentum)
|
|
||||||
|
|
||||||
for epoch in range(1, args.epochs + 1):
|
|
||||||
train(args, model, device, train_loader, optimizer, epoch)
|
|
||||||
test(args, model, device, test_loader)
|
|
||||||
|
|
||||||
if (args.save_model):
|
|
||||||
torch.save(model.state_dict(),"mnist_cnn.pt")
|
|
||||||
|
|
||||||
main()
|
|
@@ -1,165 +0,0 @@
|
|||||||
#include <vector>
|
|
||||||
#include <torch/torch.h>
|
|
||||||
#include <torch/script.h>
|
|
||||||
#include "ATen/cuda/CUDAContext.h"
|
|
||||||
#include "triton/driver/stream.h"
|
|
||||||
#include "triton/dnn/shift.h"
|
|
||||||
|
|
||||||
#define CHECK_CUDA(x) AT_CHECK(x.type().is_cuda(), #x " must be a CUDA tensor")
|
|
||||||
#define CHECK_CONTIGUOUS(x) AT_CHECK(x.is_contiguous(), #x " must be contiguous")
|
|
||||||
#define CHECK_INPUT(x) CHECK_CUDA(x); CHECK_CONTIGUOUS(x)
|
|
||||||
|
|
||||||
void extract_shapes(const torch::Tensor &x,
|
|
||||||
int64_t &C, int64_t &H, int64_t &W, int64_t &B,
|
|
||||||
triton::dnn::layout_t layout) {
|
|
||||||
if(layout == triton::dnn::CHWN){
|
|
||||||
C = x.size(0);
|
|
||||||
H = x.size(1);
|
|
||||||
W = x.size(2);
|
|
||||||
B = x.size(3);
|
|
||||||
}
|
|
||||||
else if(layout == triton::dnn::NCHW){
|
|
||||||
B = x.size(0);
|
|
||||||
C = x.size(1);
|
|
||||||
H = x.size(2);
|
|
||||||
W = x.size(3);
|
|
||||||
}
|
|
||||||
else{
|
|
||||||
throw std::runtime_error("unsupported layout");
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
static const triton::dnn::layout_t layout = triton::dnn::NCHW;
|
|
||||||
|
|
||||||
torch::Tensor shift_common(
|
|
||||||
int32_t B, int32_t C, int32_t D, int32_t H, int32_t W,
|
|
||||||
int32_t T, int32_t R, int32_t S, int32_t F,
|
|
||||||
int32_t stride_h, int32_t stride_w,
|
|
||||||
int32_t* shift_h, int32_t* shift_w,
|
|
||||||
triton::dnn::op_t op, triton::dnn::layout_t layout,
|
|
||||||
torch::Tensor torcha, torch::Tensor torchb, torch::Tensor torchbias,
|
|
||||||
bool autotune = false
|
|
||||||
) {
|
|
||||||
// Wrap CUDA handles
|
|
||||||
c10::DeviceIndex device = torcha.storage().device().index();
|
|
||||||
CUstream custream = (CUstream)at::cuda::getCurrentCUDAStream(device).stream();
|
|
||||||
triton::driver::cu_stream stream(custream, false);
|
|
||||||
triton::driver::context* ctx = stream.context();
|
|
||||||
// Data-type
|
|
||||||
std::string dtype;
|
|
||||||
at::ScalarType type = torcha.scalar_type();
|
|
||||||
switch(type){
|
|
||||||
case at::ScalarType::Double: dtype = "double"; break;
|
|
||||||
case at::ScalarType::Float: dtype = "float"; break;
|
|
||||||
case at::ScalarType::Half: dtype = "half"; break;
|
|
||||||
default: AT_ERROR("unknown data-type for shift-conv");
|
|
||||||
}
|
|
||||||
// Get configuration
|
|
||||||
bool has_bias = torchbias.storage().size() > 0;
|
|
||||||
triton::dnn::shift shift(B, C, D, H, W, T, R, S, F,
|
|
||||||
stride_h, stride_w,
|
|
||||||
shift_h, shift_w, dtype, dtype,
|
|
||||||
op, has_bias, layout);
|
|
||||||
// Bind memory
|
|
||||||
triton::driver::cu_buffer a(ctx, (CUdeviceptr)torcha.storage().data(), false);
|
|
||||||
triton::driver::cu_buffer b(ctx, (CUdeviceptr)torchb.storage().data(), false);
|
|
||||||
triton::driver::cu_buffer cubias(ctx, (CUdeviceptr)torchbias.storage().data(), false);
|
|
||||||
triton::driver::buffer* bias = has_bias ? &cubias : nullptr;
|
|
||||||
// Allocate output
|
|
||||||
std::vector<int32_t> _c_shapes = shift.c_shapes();
|
|
||||||
std::vector<long int> c_shapes;
|
|
||||||
for(auto x: _c_shapes)
|
|
||||||
c_shapes.push_back(x);
|
|
||||||
torch::Tensor torchc = torch::empty(c_shapes, type).cuda();
|
|
||||||
|
|
||||||
|
|
||||||
triton::driver::cu_buffer c(ctx, (CUdeviceptr)torchc.storage().data(), false);
|
|
||||||
std::cout << B << ", " << C << ", " << H << ", " << W << ", " << T << ", " << R << ", " << S << ", " << F << ", " << stride_h << ", " << stride_w << ", " << op << ", " << layout << std::endl;
|
|
||||||
// Enqueue
|
|
||||||
shift.enqueue(&stream, {&a, &b, &c}, triton::dnn::NO_TUNING);
|
|
||||||
return torchc;
|
|
||||||
}
|
|
||||||
|
|
||||||
torch::Tensor shift_y(
|
|
||||||
const torch::Tensor x,
|
|
||||||
const torch::Tensor w,
|
|
||||||
const torch::Tensor bias,
|
|
||||||
int64_t R, int64_t S,
|
|
||||||
int64_t stride_h, int64_t stride_w,
|
|
||||||
const torch::Tensor shift_h, const torch::Tensor shift_w) {
|
|
||||||
CHECK_INPUT(x);
|
|
||||||
CHECK_INPUT(w);
|
|
||||||
// shapes for a
|
|
||||||
int64_t Ca, H, W, B;
|
|
||||||
extract_shapes(x, Ca, H, W, B, layout);
|
|
||||||
// shapes for b
|
|
||||||
int64_t Cb = w.size(0);
|
|
||||||
int64_t F = w.size(1);
|
|
||||||
AT_CHECK(Ca == Cb, "operands must have the same number of channels");
|
|
||||||
int64_t C = Ca;
|
|
||||||
// run
|
|
||||||
return shift_common(B, C, 1, H, W, 1, R, S, F, stride_h, stride_w,
|
|
||||||
(int32_t*)shift_h.storage().data(), (int32_t*)shift_w.storage().data(),
|
|
||||||
triton::dnn::FPROP, layout, x, w, bias);
|
|
||||||
}
|
|
||||||
|
|
||||||
torch::Tensor shift_dx(
|
|
||||||
const torch::Tensor dy,
|
|
||||||
const torch::Tensor w,
|
|
||||||
const torch::Tensor bias,
|
|
||||||
int64_t R, int64_t S,
|
|
||||||
int64_t stride_h, int64_t stride_w,
|
|
||||||
const torch::Tensor shift_h, const torch::Tensor shift_w) {
|
|
||||||
CHECK_INPUT(dy);
|
|
||||||
CHECK_INPUT(w);
|
|
||||||
// shapes for a
|
|
||||||
int64_t Ca, H, W, B;
|
|
||||||
extract_shapes(dy, Ca, H, W, B, layout);
|
|
||||||
H *= stride_h;
|
|
||||||
W *= stride_w;
|
|
||||||
// shapes for b
|
|
||||||
int64_t Cb = w.size(0);
|
|
||||||
int64_t F = w.size(1);
|
|
||||||
std::swap(Cb, F);
|
|
||||||
// checks
|
|
||||||
AT_CHECK(Ca == Cb, "operands must have the same number of channels");
|
|
||||||
int64_t C = Ca;
|
|
||||||
std::swap(C, F);
|
|
||||||
// run
|
|
||||||
return shift_common(B, C, 1, H, W, 1, R, S, F, stride_h, stride_w,
|
|
||||||
(int32_t*)shift_h.storage().data(), (int32_t*)shift_w.storage().data(),
|
|
||||||
triton::dnn::BPROP, layout, dy, w, bias);
|
|
||||||
}
|
|
||||||
|
|
||||||
torch::Tensor shift_dw(
|
|
||||||
const torch::Tensor dy,
|
|
||||||
const torch::Tensor x,
|
|
||||||
const torch::Tensor bias,
|
|
||||||
int64_t R, int64_t S,
|
|
||||||
int64_t stride_h, int64_t stride_w,
|
|
||||||
const torch::Tensor shift_h, const torch::Tensor shift_w) {
|
|
||||||
CHECK_INPUT(dy);
|
|
||||||
CHECK_INPUT(x);
|
|
||||||
// shapes for a
|
|
||||||
int64_t F, Ha, Wa, Ba;
|
|
||||||
extract_shapes(dy, F, Ha, Wa, Ba, layout);
|
|
||||||
// shapes for b
|
|
||||||
int64_t C, Hb, Wb, Bb;
|
|
||||||
extract_shapes(x, C, Hb, Wb, Bb, layout);
|
|
||||||
// check
|
|
||||||
AT_CHECK(Ha*stride_h == Hb, "operands must have the same image height");
|
|
||||||
AT_CHECK(Wa*stride_w == Wb, "operands must have the same image width");
|
|
||||||
AT_CHECK(Ba == Bb, "operands must have the same batch size");
|
|
||||||
int64_t H = Hb;
|
|
||||||
int64_t W = Wb;
|
|
||||||
int64_t B = Bb;
|
|
||||||
// run
|
|
||||||
return shift_common(B, C, 1, H, W, 1, R, S, F, stride_h, stride_w,
|
|
||||||
(int32_t*)shift_h.storage().data(), (int32_t*)shift_w.storage().data(),
|
|
||||||
triton::dnn::WGRAD, layout, dy, x, bias);
|
|
||||||
}
|
|
||||||
|
|
||||||
static auto registry =
|
|
||||||
torch::jit::RegisterOperators("triton::shift_conv_y", &shift_y)
|
|
||||||
.op("triton::shift_conv_dx", &shift_dx)
|
|
||||||
.op("triton::shift_conv_dw", &shift_dw);
|
|
@@ -1,30 +0,0 @@
|
|||||||
import torch
|
|
||||||
import triton
|
|
||||||
|
|
||||||
torch.manual_seed(0)
|
|
||||||
torch.set_printoptions(precision=4)
|
|
||||||
|
|
||||||
x = torch.autograd.Variable(torch.randn(64, 3, 8, 8).cuda(), requires_grad=True)
|
|
||||||
bias = torch.autograd.Variable(torch.randn(6).cuda(), requires_grad=True)
|
|
||||||
w = torch.autograd.Variable(torch.randn(3, 3, 3, 6).cuda(), requires_grad=True)
|
|
||||||
cuw = torch.autograd.Variable(w.permute(3,0,1,2).cuda(), requires_grad=True)
|
|
||||||
y_target = torch.autograd.Variable(torch.randn(64, 6, 8, 8).cuda(), requires_grad=True)
|
|
||||||
|
|
||||||
def run(x, w, conv):
|
|
||||||
y = conv(x, w)
|
|
||||||
loss = (y - y_target).norm(2)
|
|
||||||
loss.backward()
|
|
||||||
return loss, y.clone(), x.grad.clone(), w.grad.clone(), bias.grad.clone()
|
|
||||||
|
|
||||||
ttyloss, tty, ttdx, ttdw, ttbias = run(x, w, lambda x, w: triton.ConvFunction.apply(x, w, bias, (1,1), (1,1)))
|
|
||||||
x.grad.zero_()
|
|
||||||
w.grad.zero_()
|
|
||||||
bias.grad.zero_()
|
|
||||||
culoss, cuy, cudx, cudw, cubias = run(x, cuw, lambda x, w: torch.nn.functional.conv2d(x, w, bias=bias, stride=1, padding=1))
|
|
||||||
|
|
||||||
print(ttdx[0,0,:,:])
|
|
||||||
print(cudx[0,0,:,:])
|
|
||||||
print((tty - cuy).norm(2))
|
|
||||||
print((ttdx - cudx).norm(2))
|
|
||||||
print((ttdw.permute(3,0,1,2) - cudw).norm(2))
|
|
||||||
print((ttbias - cubias).norm(2))
|
|
@@ -1,221 +0,0 @@
|
|||||||
import torch
|
|
||||||
import math
|
|
||||||
import numpy as np
|
|
||||||
from torch.nn.modules.utils import _single, _pair, _triple
|
|
||||||
from torch.distributions import categorical
|
|
||||||
|
|
||||||
torch.ops.load_library("/home/philippe/development/triton/build/examples/python/pytorch/libtorch_triton.so")
|
|
||||||
|
|
||||||
#################################
|
|
||||||
####### Convolutions ##########
|
|
||||||
#################################
|
|
||||||
|
|
||||||
class ConvFunction(torch.autograd.Function):
|
|
||||||
|
|
||||||
@staticmethod
|
|
||||||
def forward(ctx, input, weight, bias, stride, padding):
|
|
||||||
if bias is None:
|
|
||||||
bias = torch.empty(0)
|
|
||||||
ctx.save_for_backward(input, weight, bias)
|
|
||||||
ctx.stride = stride
|
|
||||||
ctx.padding = padding
|
|
||||||
output = torch.ops.triton.conv_fprop(input, weight, bias, stride[0], stride[1], padding[0], padding[1])
|
|
||||||
return output
|
|
||||||
|
|
||||||
@staticmethod
|
|
||||||
def backward(ctx, grad_output):
|
|
||||||
input, weight, bias = ctx.saved_tensors
|
|
||||||
stride = ctx.stride
|
|
||||||
padding = ctx.padding
|
|
||||||
grad_input = grad_weight = grad_bias = None
|
|
||||||
if ctx.needs_input_grad[0]:
|
|
||||||
grad_input = torch.ops.triton.conv_bprop(grad_output, weight, bias, input.shape[2], input.shape[3], stride[0], stride[1], padding[0], padding[1])
|
|
||||||
if ctx.needs_input_grad[1]:
|
|
||||||
grad_weight = torch.ops.triton.conv_wgrad(input, grad_output, bias, weight.shape[1], weight.shape[2], stride[0], stride[1], padding[0], padding[1])
|
|
||||||
if ctx.needs_input_grad[2]:
|
|
||||||
grad_bias = torch.sum(grad_output, (0, 2, 3))
|
|
||||||
return grad_input, grad_weight, grad_bias, None, None
|
|
||||||
|
|
||||||
|
|
||||||
class _ConvNd(torch.nn.Module):
|
|
||||||
|
|
||||||
def __init__(self, in_channels, out_channels, kernel_size, stride,
|
|
||||||
padding, dilation, transposed, output_padding, groups, bias):
|
|
||||||
super(_ConvNd, self).__init__()
|
|
||||||
# not everything is supported by Triton
|
|
||||||
assert all(x==1 or x==2 for x in stride)
|
|
||||||
assert all(x==1 for x in dilation)
|
|
||||||
assert transposed == False
|
|
||||||
assert all(x==0 for x in output_padding)
|
|
||||||
assert groups == 1
|
|
||||||
# initialize
|
|
||||||
self.in_channels = in_channels
|
|
||||||
self.out_channels = out_channels
|
|
||||||
self.kernel_size = kernel_size
|
|
||||||
self.stride = stride
|
|
||||||
self.padding = padding
|
|
||||||
self.weight = torch.nn.Parameter(torch.Tensor(
|
|
||||||
in_channels, kernel_size[0], kernel_size[1], out_channels))
|
|
||||||
if bias:
|
|
||||||
self.bias = torch.nn.Parameter(torch.Tensor(out_channels))
|
|
||||||
else:
|
|
||||||
self.register_parameter('bias', None)
|
|
||||||
self.reset_parameters()
|
|
||||||
|
|
||||||
def forward(self, input):
|
|
||||||
return ConvFunction.apply(input, self.weight, self.bias, self.stride, self.padding)
|
|
||||||
|
|
||||||
def reset_parameters(self):
|
|
||||||
n = self.in_channels
|
|
||||||
for k in self.kernel_size:
|
|
||||||
n *= k
|
|
||||||
stdv = 1. / math.sqrt(n)
|
|
||||||
self.weight.data.uniform_(-stdv, stdv)
|
|
||||||
if self.bias is not None:
|
|
||||||
self.bias.data.uniform_(-stdv, stdv)
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
class Conv2d(_ConvNd):
|
|
||||||
|
|
||||||
def __init__(self, in_channels, out_channels, kernel_size, stride=1,
|
|
||||||
padding=0, dilation=1, groups=1, bias=True):
|
|
||||||
kernel_size = _pair(kernel_size)
|
|
||||||
stride = _pair(stride)
|
|
||||||
padding = _pair(padding)
|
|
||||||
dilation = _pair(dilation)
|
|
||||||
super(Conv2d, self).__init__(
|
|
||||||
in_channels, out_channels, kernel_size, stride, padding, dilation,
|
|
||||||
False, _pair(0), groups, bias)
|
|
||||||
|
|
||||||
#################################
|
|
||||||
#### Shift-Convolutions #######
|
|
||||||
#################################
|
|
||||||
|
|
||||||
class ShiftConvFunction(torch.autograd.Function):
|
|
||||||
|
|
||||||
@staticmethod
|
|
||||||
def forward(ctx, input, weight, bias, stride, width, shift_h, shift_w):
|
|
||||||
if bias is None:
|
|
||||||
bias = torch.empty(0)
|
|
||||||
ctx.save_for_backward(input, weight, bias)
|
|
||||||
ctx.stride = stride
|
|
||||||
ctx.width = width
|
|
||||||
ctx.shift_h = shift_h
|
|
||||||
ctx.shift_w = shift_w
|
|
||||||
output = torch.ops.triton.shift_conv_y(input, weight, bias,
|
|
||||||
width[0], width[1],
|
|
||||||
stride[0], stride[1],
|
|
||||||
shift_h, shift_w)
|
|
||||||
return output
|
|
||||||
|
|
||||||
@staticmethod
|
|
||||||
def backward(ctx, dy):
|
|
||||||
input, weight, bias = ctx.saved_tensors
|
|
||||||
stride = ctx.stride
|
|
||||||
width = ctx.width
|
|
||||||
shift_h = ctx.shift_h
|
|
||||||
shift_w = ctx.shift_w
|
|
||||||
dx = dw = dbias = None
|
|
||||||
if ctx.needs_input_grad[0]:
|
|
||||||
dx = torch.ops.triton.shift_conv_dx(dy.contiguous(), weight, bias, width[0], width[1], stride[0], stride[1], shift_h, shift_w)
|
|
||||||
if ctx.needs_input_grad[1]:
|
|
||||||
dw = torch.ops.triton.shift_conv_dw(dy.contiguous(), input, bias, width[0], width[1], stride[0], stride[1], shift_h, shift_w)
|
|
||||||
if ctx.needs_input_grad[2]:
|
|
||||||
dbias = torch.sum(dy, (1, 2, 3))
|
|
||||||
return dx, dw, dbias, None, None, None, None
|
|
||||||
|
|
||||||
|
|
||||||
class _ShiftConvNd(torch.nn.Module):
|
|
||||||
|
|
||||||
def __init__(self, in_channels, out_channels, kernel_size, stride, bias):
|
|
||||||
super(_ShiftConvNd, self).__init__()
|
|
||||||
# initialize
|
|
||||||
self.in_channels = in_channels
|
|
||||||
self.out_channels = out_channels
|
|
||||||
self.kernel_size = kernel_size
|
|
||||||
self.stride = stride
|
|
||||||
self.weight = torch.nn.Parameter(torch.Tensor(in_channels, out_channels))
|
|
||||||
if bias:
|
|
||||||
self.bias = torch.nn.Parameter(torch.Tensor(out_channels))
|
|
||||||
else:
|
|
||||||
self.register_parameter('bias', None)
|
|
||||||
self.shift_h = self.make_shift(kernel_size[0])
|
|
||||||
self.shift_w = self.make_shift(kernel_size[1])
|
|
||||||
self.reset_parameters()
|
|
||||||
|
|
||||||
def forward(self, input):
|
|
||||||
return ShiftConvFunction.apply(input, self.weight, self.bias, self.stride,
|
|
||||||
self.kernel_size, self.shift_h, self.shift_w)
|
|
||||||
|
|
||||||
def make_shift(self, kernel_size):
|
|
||||||
if kernel_size == 3:
|
|
||||||
p = torch.Tensor([0.3, 0.4, 0.3])
|
|
||||||
elif kernel_size == 5:
|
|
||||||
p = torch.Tensor([0.1, 0.25, 0.3, 0.25, 0.1])
|
|
||||||
elif kernel_size == 7:
|
|
||||||
p = torch.Tensor([0.075, 0.1, 0.175, 0.3, 0.175, 0.1, 0.075])
|
|
||||||
elif kernel_size == 9:
|
|
||||||
p = torch.Tensor([0.05, 0.075, 0.1, 0.175, 0.2, 0.175, 0.1, 0.075, 0.05])
|
|
||||||
else:
|
|
||||||
raise RuntimeError('Unsupported kernel size')
|
|
||||||
return categorical.Categorical(p).sample((self.in_channels,)) - (kernel_size // 2)
|
|
||||||
|
|
||||||
def reset_parameters(self):
|
|
||||||
n = self.in_channels
|
|
||||||
for k in self.kernel_size:
|
|
||||||
n *= k
|
|
||||||
stdv = 1. / math.sqrt(n)
|
|
||||||
self.weight.data.uniform_(-stdv, stdv)
|
|
||||||
if self.bias is not None:
|
|
||||||
self.bias.data.uniform_(-stdv, stdv)
|
|
||||||
|
|
||||||
class ShiftConv2d(_ShiftConvNd):
|
|
||||||
|
|
||||||
def __init__(self, in_channels, out_channels, kernel_size, stride=1, bias=False):
|
|
||||||
kernel_size = _pair(kernel_size)
|
|
||||||
stride = _pair(stride)
|
|
||||||
super(ShiftConv2d, self).__init__(
|
|
||||||
in_channels, out_channels, kernel_size, stride, bias)
|
|
||||||
|
|
||||||
#################################
|
|
||||||
######### BatchNorm ###########
|
|
||||||
#################################
|
|
||||||
|
|
||||||
class BatchNormFunction(torch.autograd.Function):
|
|
||||||
|
|
||||||
@staticmethod
|
|
||||||
def forward(ctx, x, gamma, beta, eps):
|
|
||||||
ctx.eps = eps
|
|
||||||
y, mean, var = torch.ops.triton.batchnorm_ymv(x, gamma, beta, eps)
|
|
||||||
ctx.save_for_backward(x, gamma, beta, mean, var)
|
|
||||||
return y
|
|
||||||
|
|
||||||
@staticmethod
|
|
||||||
def backward(ctx, dy):
|
|
||||||
eps = ctx.eps
|
|
||||||
x, gamma, beta, mean, var = ctx.saved_tensors
|
|
||||||
dx, dg, db = torch.ops.triton.batchnorm_dxdgdb(dy.contiguous(), x, gamma, mean, var, eps)
|
|
||||||
return dx, dg, db, None
|
|
||||||
|
|
||||||
|
|
||||||
class _BatchNorm(torch.nn.Module):
|
|
||||||
|
|
||||||
def __init__(self, num_features, eps=1e-5):
|
|
||||||
super(_BatchNorm, self).__init__()
|
|
||||||
self.num_features = num_features
|
|
||||||
self.eps = eps
|
|
||||||
self.weight = torch.nn.Parameter(torch.Tensor(num_features))
|
|
||||||
self.bias = torch.nn.Parameter(torch.Tensor(num_features))
|
|
||||||
self.reset_parameters()
|
|
||||||
|
|
||||||
def reset_parameters(self):
|
|
||||||
torch.nn.init.uniform_(self.weight)
|
|
||||||
torch.nn.init.zeros_(self.bias)
|
|
||||||
|
|
||||||
def forward(self, input):
|
|
||||||
return BatchNormFunction.apply(input, self.weight, self.bias, self.eps)
|
|
||||||
|
|
||||||
class BatchNorm2d(_BatchNorm):
|
|
||||||
|
|
||||||
pass
|
|
@@ -1,13 +0,0 @@
|
|||||||
find_package(TensorFlow)
|
|
||||||
if(${TensorFlow_FOUND})
|
|
||||||
set(CUDA_HOME "/usr/local/cuda")
|
|
||||||
include_directories("${TF_INC}/tensorflow/include")
|
|
||||||
include_directories("${CUDA_HOME}/include")
|
|
||||||
link_directories(${TF_LIB})
|
|
||||||
add_definitions(-D_GLIBCXX_USE_CXX11_ABI=${TF_ABI})
|
|
||||||
add_library(tf_blocksparse SHARED blocksparse.cpp dot.cpp conv.cpp shift.cpp batchnorm.cpp)
|
|
||||||
target_link_libraries(tf_blocksparse tensorflow_framework triton)
|
|
||||||
configure_file(${CMAKE_CURRENT_SOURCE_DIR}/run.py
|
|
||||||
${CMAKE_CURRENT_BINARY_DIR}/run.py
|
|
||||||
COPYONLY)
|
|
||||||
endif()
|
|
@@ -1,157 +0,0 @@
|
|||||||
#include <iostream>
|
|
||||||
|
|
||||||
#include "triton/driver/buffer.h"
|
|
||||||
#include "triton/driver/backend.h"
|
|
||||||
#include "triton/driver/stream.h"
|
|
||||||
#include "triton/runtime/jit.h"
|
|
||||||
#include "triton/tools/bench.hpp"
|
|
||||||
#include "triton/dnn/batchnorm.h"
|
|
||||||
|
|
||||||
#define EIGEN_USE_GPU
|
|
||||||
#include "tensorflow/core/framework/op.h"
|
|
||||||
#include "tensorflow/core/framework/shape_inference.h"
|
|
||||||
#include "tensorflow/core/framework/op_kernel.h"
|
|
||||||
#include "tensorflow/core/util/cuda_kernel_helper.h"
|
|
||||||
#include "tensorflow/core/util/padding.h"
|
|
||||||
#include "tensorflow/core/util/tensor_format.h"
|
|
||||||
#include "tensorflow/core/framework/common_shape_fns.h"
|
|
||||||
|
|
||||||
using namespace tensorflow;
|
|
||||||
using shape_inference::DimensionHandle;
|
|
||||||
using shape_inference::InferenceContext;
|
|
||||||
using shape_inference::ShapeHandle;
|
|
||||||
using GPUDevice = Eigen::GpuDevice;
|
|
||||||
|
|
||||||
class BatchnormForwardOp : public OpKernel {
|
|
||||||
public:
|
|
||||||
explicit BatchnormForwardOp(OpKernelConstruction* context): OpKernel(context) {
|
|
||||||
context->GetAttr("eps", &eps_);
|
|
||||||
}
|
|
||||||
|
|
||||||
void Compute(OpKernelContext* context){
|
|
||||||
// get device/stream
|
|
||||||
GPUDevice device = context->eigen_device<GPUDevice>();
|
|
||||||
triton::driver::cu_stream sstream(device.stream(), false);
|
|
||||||
triton::driver::context* ctx = sstream.context();
|
|
||||||
triton::driver::stream* stream = &sstream;
|
|
||||||
// get inputs
|
|
||||||
const Tensor& fw_x = context->input(0);
|
|
||||||
const Tensor& fw_g = context->input(1);
|
|
||||||
const Tensor& fw_b = context->input(2);
|
|
||||||
// get sizes
|
|
||||||
int C = fw_x.dim_size(0);
|
|
||||||
int H = fw_x.dim_size(1);
|
|
||||||
int W = fw_x.dim_size(2);
|
|
||||||
int B = fw_x.dim_size(3);
|
|
||||||
// allocate outputs
|
|
||||||
Tensor* fw_y = nullptr;
|
|
||||||
Tensor* fw_m = nullptr;
|
|
||||||
Tensor* fw_v = nullptr;
|
|
||||||
OP_REQUIRES_OK(context, context->allocate_output(0, fw_x.shape(), &fw_y));
|
|
||||||
OP_REQUIRES_OK(context, context->allocate_output(1, fw_g.shape(), &fw_m));
|
|
||||||
OP_REQUIRES_OK(context, context->allocate_output(2, fw_g.shape(), &fw_v));
|
|
||||||
// triton handles
|
|
||||||
triton::driver::cu_buffer x(ctx, fw_x.tensor_data().size(), (CUdeviceptr)fw_x.tensor_data().data(), false);
|
|
||||||
triton::driver::cu_buffer g(ctx, fw_g.tensor_data().size(), (CUdeviceptr)fw_g.tensor_data().data(), false);
|
|
||||||
triton::driver::cu_buffer b(ctx, fw_b.tensor_data().size(), (CUdeviceptr)fw_b.tensor_data().data(), false);
|
|
||||||
triton::driver::cu_buffer y(ctx, fw_y->tensor_data().size(), (CUdeviceptr)fw_y->tensor_data().data(), false);
|
|
||||||
triton::driver::cu_buffer m(ctx, fw_m->tensor_data().size(), (CUdeviceptr)fw_m->tensor_data().data(), false);
|
|
||||||
triton::driver::cu_buffer v(ctx, fw_v->tensor_data().size(), (CUdeviceptr)fw_v->tensor_data().data(), false);
|
|
||||||
// create config
|
|
||||||
triton::dnn::batchnorm_forward batchnorm(C, 1, H, W, B, "float", triton::dnn::FULL_TUNING);
|
|
||||||
batchnorm.enqueue(stream, {&y, &m, &v, &x, &g, &b});
|
|
||||||
}
|
|
||||||
|
|
||||||
private:
|
|
||||||
float eps_;
|
|
||||||
};
|
|
||||||
|
|
||||||
|
|
||||||
REGISTER_KERNEL_BUILDER(Name("BatchnormForward").Device(DEVICE_GPU), BatchnormForwardOp);
|
|
||||||
REGISTER_OP("BatchnormForward")
|
|
||||||
.Input("x: T")
|
|
||||||
.Input("g: float")
|
|
||||||
.Input("b: float")
|
|
||||||
.Output("y: T")
|
|
||||||
.Output("m: float")
|
|
||||||
.Output("v: float")
|
|
||||||
.Attr("T: {float}")
|
|
||||||
.Attr("eps: float")
|
|
||||||
.SetShapeFn([](InferenceContext* ctx) {
|
|
||||||
ctx->set_output(0, ctx->input(0));
|
|
||||||
ctx->set_output(1, ctx->input(1));
|
|
||||||
ctx->set_output(2, ctx->input(1));
|
|
||||||
return Status::OK();
|
|
||||||
})
|
|
||||||
;
|
|
||||||
|
|
||||||
|
|
||||||
class BatchnormBackwardOp : public OpKernel {
|
|
||||||
public:
|
|
||||||
explicit BatchnormBackwardOp(OpKernelConstruction* context): OpKernel(context) {
|
|
||||||
context->GetAttr("eps", &eps_);
|
|
||||||
}
|
|
||||||
|
|
||||||
void Compute(OpKernelContext* context){
|
|
||||||
// get device/stream
|
|
||||||
GPUDevice device = context->eigen_device<GPUDevice>();
|
|
||||||
triton::driver::cu_stream sstream(device.stream(), false);
|
|
||||||
triton::driver::context* ctx = sstream.context();
|
|
||||||
triton::driver::stream* stream = &sstream;
|
|
||||||
// get inputs
|
|
||||||
const Tensor& fw_dy = context->input(0);
|
|
||||||
const Tensor& fw_x = context->input(1);
|
|
||||||
const Tensor& fw_g = context->input(2);
|
|
||||||
const Tensor& fw_m = context->input(3);
|
|
||||||
const Tensor& fw_v = context->input(4);
|
|
||||||
// get sizes
|
|
||||||
int C = fw_x.dim_size(0);
|
|
||||||
int H = fw_x.dim_size(1);
|
|
||||||
int W = fw_x.dim_size(2);
|
|
||||||
int B = fw_x.dim_size(3);
|
|
||||||
// allocate outputs
|
|
||||||
Tensor* fw_dx = nullptr;
|
|
||||||
Tensor* fw_dg = nullptr;
|
|
||||||
Tensor* fw_db = nullptr;
|
|
||||||
OP_REQUIRES_OK(context, context->allocate_output(0, fw_x.shape(), &fw_dx));
|
|
||||||
OP_REQUIRES_OK(context, context->allocate_output(1, fw_g.shape(), &fw_dg));
|
|
||||||
OP_REQUIRES_OK(context, context->allocate_output(2, fw_g.shape(), &fw_db));
|
|
||||||
// triton handles
|
|
||||||
triton::driver::cu_buffer dy(ctx, fw_dy.tensor_data().size(), (CUdeviceptr)fw_dy.tensor_data().data(), false);
|
|
||||||
triton::driver::cu_buffer x(ctx, fw_x.tensor_data().size(), (CUdeviceptr)fw_x.tensor_data().data(), false);
|
|
||||||
triton::driver::cu_buffer g(ctx, fw_g.tensor_data().size(), (CUdeviceptr)fw_g.tensor_data().data(), false);
|
|
||||||
triton::driver::cu_buffer m(ctx, fw_m.tensor_data().size(), (CUdeviceptr)fw_m.tensor_data().data(), false);
|
|
||||||
triton::driver::cu_buffer v(ctx, fw_v.tensor_data().size(), (CUdeviceptr)fw_v.tensor_data().data(), false);
|
|
||||||
triton::driver::cu_buffer dx(ctx, fw_dx->tensor_data().size(), (CUdeviceptr)fw_dx->tensor_data().data(), false);
|
|
||||||
triton::driver::cu_buffer dg(ctx, fw_dg->tensor_data().size(), (CUdeviceptr)fw_dg->tensor_data().data(), false);
|
|
||||||
triton::driver::cu_buffer db(ctx, fw_db->tensor_data().size(), (CUdeviceptr)fw_db->tensor_data().data(), false);
|
|
||||||
// create config
|
|
||||||
triton::dnn::batchnorm_backward batchnorm(C, 1, H, W, B, "float", triton::dnn::FULL_TUNING);
|
|
||||||
batchnorm.enqueue(stream, {&dx, &dg, &db, &dy, &x, &g, &m, &v});
|
|
||||||
}
|
|
||||||
|
|
||||||
private:
|
|
||||||
float eps_;
|
|
||||||
};
|
|
||||||
|
|
||||||
|
|
||||||
REGISTER_KERNEL_BUILDER(Name("BatchnormBackward").Device(DEVICE_GPU), BatchnormBackwardOp);
|
|
||||||
REGISTER_OP("BatchnormBackward")
|
|
||||||
.Input("dy: TY")
|
|
||||||
.Input("x: TX")
|
|
||||||
.Input("g: float")
|
|
||||||
.Input("m: float")
|
|
||||||
.Input("v: float")
|
|
||||||
.Output("dx: TY")
|
|
||||||
.Output("dg: float")
|
|
||||||
.Output("db: float")
|
|
||||||
.Attr("TX: {float}")
|
|
||||||
.Attr("TY: {float}")
|
|
||||||
.Attr("eps: float")
|
|
||||||
.SetShapeFn([](InferenceContext* ctx) {
|
|
||||||
ctx->set_output(0, ctx->input(1));
|
|
||||||
ctx->set_output(1, ctx->input(2));
|
|
||||||
ctx->set_output(2, ctx->input(2));
|
|
||||||
return Status::OK();
|
|
||||||
})
|
|
||||||
;
|
|
@@ -1,304 +0,0 @@
|
|||||||
#include <iostream>
|
|
||||||
|
|
||||||
#include "triton/driver/buffer.h"
|
|
||||||
#include "triton/driver/backend.h"
|
|
||||||
#include "triton/driver/stream.h"
|
|
||||||
#include "triton/runtime/jit.h"
|
|
||||||
#include "triton/dnn/blocksparse/dot.h"
|
|
||||||
|
|
||||||
#define EIGEN_USE_GPU
|
|
||||||
#include "tensorflow/core/framework/op.h"
|
|
||||||
#include "tensorflow/core/framework/shape_inference.h"
|
|
||||||
#include "tensorflow/core/framework/op_kernel.h"
|
|
||||||
#include "tensorflow/core/util/cuda_kernel_helper.h"
|
|
||||||
#include "tensorflow/core/util/padding.h"
|
|
||||||
#include "tensorflow/core/util/tensor_format.h"
|
|
||||||
#include "tensorflow/core/framework/common_shape_fns.h"
|
|
||||||
#include "tensorflow/core/framework/allocation_description.pb.h"
|
|
||||||
|
|
||||||
using namespace tensorflow;
|
|
||||||
using shape_inference::DimensionHandle;
|
|
||||||
using shape_inference::InferenceContext;
|
|
||||||
using shape_inference::ShapeHandle;
|
|
||||||
using GPUDevice = Eigen::GpuDevice;
|
|
||||||
|
|
||||||
|
|
||||||
Status XpropShape(InferenceContext* ctx)
|
|
||||||
{
|
|
||||||
int K; TF_RETURN_IF_ERROR(ctx->GetAttr( "K", &K));
|
|
||||||
int axis; TF_RETURN_IF_ERROR(ctx->GetAttr("axis", &axis));
|
|
||||||
|
|
||||||
// C ==> K
|
|
||||||
ShapeHandle x = ctx->input(0);
|
|
||||||
int rank = ctx->Rank(x);
|
|
||||||
//printf("XpropShape: %d\n", rank);
|
|
||||||
if (rank > 0)
|
|
||||||
{
|
|
||||||
std::vector<DimensionHandle> shape;
|
|
||||||
shape.reserve(rank);
|
|
||||||
for (int i = 0; i < rank; i++)
|
|
||||||
shape.push_back(i == axis ? ctx->MakeDim(K) : ctx->Dim(x, i));
|
|
||||||
ctx->set_output(0, ctx->MakeShape(shape));
|
|
||||||
}
|
|
||||||
else
|
|
||||||
ctx->set_output(0, ctx->UnknownShape());
|
|
||||||
ctx->set_output(1, ctx->UnknownShape());
|
|
||||||
return Status::OK();
|
|
||||||
}
|
|
||||||
|
|
||||||
Status UpdatShape(InferenceContext* ctx)
|
|
||||||
{
|
|
||||||
//printf("UpdatShape: %d\n", ctx->Rank(ctx->input(0)));
|
|
||||||
|
|
||||||
int blocks, bsize;
|
|
||||||
TF_RETURN_IF_ERROR(ctx->GetAttr("blocks", &blocks));
|
|
||||||
TF_RETURN_IF_ERROR(ctx->GetAttr("bsize", &bsize));
|
|
||||||
|
|
||||||
// (blocks, block_size, block_size)
|
|
||||||
DimensionHandle bsize_dim = ctx->MakeDim(bsize);
|
|
||||||
ctx->set_output(0, ctx->MakeShape({ ctx->MakeDim(blocks), bsize_dim, bsize_dim }));
|
|
||||||
return Status::OK();
|
|
||||||
}
|
|
||||||
|
|
||||||
typedef struct bsmm_params
|
|
||||||
{
|
|
||||||
const int* Lut;
|
|
||||||
const float* Gate;
|
|
||||||
int* Lock;
|
|
||||||
int blocks;
|
|
||||||
int bsize;
|
|
||||||
int segments;
|
|
||||||
int locks;
|
|
||||||
int C;
|
|
||||||
int K;
|
|
||||||
int N;
|
|
||||||
int shared;
|
|
||||||
int pcount;
|
|
||||||
uint blk_a;
|
|
||||||
uint blk_A;
|
|
||||||
uint blk_b;
|
|
||||||
uint blk_B;
|
|
||||||
float alpha;
|
|
||||||
float beta;
|
|
||||||
CUstream stream;
|
|
||||||
} bsmm_params;
|
|
||||||
|
|
||||||
template<triton::dnn::blocksparse::op_t OP, typename T>
|
|
||||||
class BlocksparseMatmulOp : public OpKernel {
|
|
||||||
private:
|
|
||||||
void ComputeDw(OpKernelContext* context){
|
|
||||||
// get device/stream
|
|
||||||
GPUDevice device = context->eigen_device<GPUDevice>();
|
|
||||||
triton::driver::cu_stream sstream(device.stream(), false);
|
|
||||||
triton::driver::context* ctx = sstream.context();
|
|
||||||
triton::driver::stream* stream = &sstream;
|
|
||||||
// extract input
|
|
||||||
OpInputList x, dy, gate;
|
|
||||||
context->input_list( "x", &x);
|
|
||||||
context->input_list( "dy", &dy);
|
|
||||||
context->input_list("gate", &gate);
|
|
||||||
// sanity checks
|
|
||||||
params_.pcount = x.size();
|
|
||||||
if (params_.pcount > 1)
|
|
||||||
errors::Internal("No more than 1 input allowed.");
|
|
||||||
if (params_.beta != 0.0f || params_.alpha != 1.0f)
|
|
||||||
errors::Internal("Not supported yet");
|
|
||||||
// N
|
|
||||||
int N = 1;
|
|
||||||
int rank = x[0].dims();
|
|
||||||
for (int i = 0; i < rank; i++)
|
|
||||||
if (i != axis_)
|
|
||||||
N *= x[0].dim_size(i);
|
|
||||||
// allocate output
|
|
||||||
Tensor* C;
|
|
||||||
TensorShape shapeC({ params_.blocks, params_.bsize, params_.bsize });
|
|
||||||
OP_REQUIRES_OK(context, context->allocate_output(0, shapeC, &C));
|
|
||||||
// wrap tensorflow handles
|
|
||||||
triton::driver::cu_buffer da(ctx, x[0].tensor_data().size(), (CUdeviceptr)x[0].tensor_data().data(), false);
|
|
||||||
triton::driver::cu_buffer db(ctx, dy[0].tensor_data().size(), (CUdeviceptr)dy[0].tensor_data().data(), false);
|
|
||||||
triton::driver::cu_buffer dc(ctx, C->tensor_data().size(), (CUdeviceptr)C->tensor_data().data(), false);
|
|
||||||
triton::driver::cu_buffer dlut(ctx, context->input(params_.pcount*2).tensor_data().size(), (CUdeviceptr)context->input(params_.pcount*2).tensor_data().data(), false);
|
|
||||||
// create profile
|
|
||||||
triton::dnn::blocksparse::dot dot(N, params_.K, params_.segments, params_.C, "half", params_.bsize, params_.locks, params_.blocks, OP);
|
|
||||||
// enqueue
|
|
||||||
dot.enqueue(stream, {&da, &db, &dc, &dlut}, triton::dnn::FULL_TUNING);
|
|
||||||
}
|
|
||||||
|
|
||||||
void ComputeYDx(OpKernelContext* context){
|
|
||||||
// get device/stream
|
|
||||||
GPUDevice device = context->eigen_device<GPUDevice>();
|
|
||||||
triton::driver::cu_stream sstream(device.stream(), false);
|
|
||||||
triton::driver::context* ctx = sstream.context();
|
|
||||||
triton::driver::stream* stream = &sstream;
|
|
||||||
// get inputs
|
|
||||||
const Tensor& a = context->input(0);
|
|
||||||
const Tensor& b = context->input(1);
|
|
||||||
const Tensor& lut = context->input(2);
|
|
||||||
// allocate c
|
|
||||||
TensorShape shape_c;
|
|
||||||
int N = 1;
|
|
||||||
int rank_a = a.dims();
|
|
||||||
for (int i = 0; i < rank_a; i++)
|
|
||||||
if (i != axis_) {
|
|
||||||
shape_c.AddDim(a.dim_size(i));
|
|
||||||
N *= a.dim_size(i);
|
|
||||||
}
|
|
||||||
else
|
|
||||||
shape_c.AddDim(params_.K);
|
|
||||||
Tensor* c = nullptr;
|
|
||||||
OP_REQUIRES_OK(context, context->allocate_output(0, shape_c, &c));
|
|
||||||
// wrap tensorflow handles
|
|
||||||
triton::driver::cu_buffer da(ctx, a.tensor_data().size(), (CUdeviceptr)a.tensor_data().data(), false);
|
|
||||||
triton::driver::cu_buffer db(ctx, b.tensor_data().size(), (CUdeviceptr)b.tensor_data().data(), false);
|
|
||||||
triton::driver::cu_buffer dc(ctx, c->tensor_data().size(), (CUdeviceptr)c->tensor_data().data(), false);
|
|
||||||
triton::driver::cu_buffer dlut(ctx, lut.tensor_data().size(), (CUdeviceptr)lut.tensor_data().data(), false);
|
|
||||||
// create profile
|
|
||||||
triton::dnn::blocksparse::dot dot(N, params_.K, params_.segments, params_.C, "half", params_.bsize, params_.locks, params_.blocks, OP);
|
|
||||||
// enqueue
|
|
||||||
triton::dnn::base* op = dot.enqueue(stream, {&da, &db, &dc, &dlut}, triton::dnn::NO_TUNING);
|
|
||||||
triton::driver::buffer* locks_buffer = ((triton::dnn::blocksparse::dot*)op)->get_locks();
|
|
||||||
Tensor *tmp = nullptr;
|
|
||||||
TensorShape tmp_shapes;
|
|
||||||
tmp_shapes.AddDim(locks_buffer->size() / 4);
|
|
||||||
OP_REQUIRES_OK(context, context->allocate_output(1, tmp_shapes, &tmp));
|
|
||||||
}
|
|
||||||
|
|
||||||
public:
|
|
||||||
|
|
||||||
explicit BlocksparseMatmulOp(OpKernelConstruction* ctx) : OpKernel(ctx) {
|
|
||||||
OP_REQUIRES_OK(ctx, ctx->GetAttr("segments", ¶ms_.segments));
|
|
||||||
OP_REQUIRES_OK(ctx, ctx->GetAttr("locks", ¶ms_.locks ));
|
|
||||||
OP_REQUIRES_OK(ctx, ctx->GetAttr("blocks", ¶ms_.blocks ));
|
|
||||||
OP_REQUIRES_OK(ctx, ctx->GetAttr("bsize", ¶ms_.bsize ));
|
|
||||||
OP_REQUIRES_OK(ctx, ctx->GetAttr("C", ¶ms_.C ));
|
|
||||||
OP_REQUIRES_OK(ctx, ctx->GetAttr("K", ¶ms_.K ));
|
|
||||||
OP_REQUIRES_OK(ctx, ctx->GetAttr("shared", ¶ms_.shared ));
|
|
||||||
OP_REQUIRES_OK(ctx, ctx->GetAttr("alpha", ¶ms_.alpha ));
|
|
||||||
OP_REQUIRES_OK(ctx, ctx->GetAttr("beta", ¶ms_.beta ));
|
|
||||||
OP_REQUIRES_OK(ctx, ctx->GetAttr("gated_dw", &gated_dw_ ));
|
|
||||||
OP_REQUIRES_OK(ctx, ctx->GetAttr("axis", &axis_ ));
|
|
||||||
OP_REQUIRES_OK(ctx, ctx->GetAttr("bench", &bench_));
|
|
||||||
OP_REQUIRES(ctx, params_.K < params_.bsize*65536, errors::InvalidArgument("K < bsize*65536"));
|
|
||||||
OP_REQUIRES(ctx, params_.C < params_.bsize*65536, errors::InvalidArgument("C < bsize*65536"));
|
|
||||||
params_.pcount = 1;
|
|
||||||
params_.blk_A = 0;
|
|
||||||
is_gpu_ = ctx->device_type() == DEVICE_GPU;
|
|
||||||
if (bench_) {
|
|
||||||
repeat_ = bench_;
|
|
||||||
flops_ = (float)(params_.blocks * params_.bsize*params_.bsize);
|
|
||||||
const char* op = "FPROP";
|
|
||||||
sprintf(bench_string_, "%s %02d-%d C:%05d K:%05d blks:%d", op, params_.bsize, axis_, params_.C, params_.K, params_.blocks);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
void Compute(OpKernelContext* context) override{
|
|
||||||
if(OP == triton::dnn::blocksparse::WGRAD)
|
|
||||||
ComputeDw(context);
|
|
||||||
else
|
|
||||||
ComputeYDx(context);
|
|
||||||
}
|
|
||||||
|
|
||||||
private:
|
|
||||||
bsmm_params params_;
|
|
||||||
int axis_, bench_, repeat_, SMs_, major_, grid_n_;
|
|
||||||
float flops_;
|
|
||||||
bool gated_dw_, is_gpu_;
|
|
||||||
char bench_string_[256];
|
|
||||||
};
|
|
||||||
|
|
||||||
REGISTER_OP("TritonBlocksparseMatmul")
|
|
||||||
.Input("x: T")
|
|
||||||
.Input("w: T")
|
|
||||||
.Input("lut: int64")
|
|
||||||
.Input("lut_dx: int64")
|
|
||||||
.Input("lut_dw: int64")
|
|
||||||
.Input("gate: ngate * float")
|
|
||||||
.Output("y: T")
|
|
||||||
.Output("temp: int32")
|
|
||||||
.Attr("T: {half, float, bfloat16}")
|
|
||||||
.Attr("blocks: int >=0")
|
|
||||||
.Attr("bsize: int")
|
|
||||||
.Attr("segments: int = 0")
|
|
||||||
.Attr("segments_dx: int = 0")
|
|
||||||
.Attr("locks: int = 0")
|
|
||||||
.Attr("locks_dx: int = 0")
|
|
||||||
.Attr("axis: int = 1")
|
|
||||||
.Attr("C: int >=0")
|
|
||||||
.Attr("K: int >=0")
|
|
||||||
.Attr("shared: int = 0")
|
|
||||||
.Attr("shared_dx: int = 0")
|
|
||||||
.Attr("alpha: float = 1.0")
|
|
||||||
.Attr("beta: float = 0.0")
|
|
||||||
.Attr("gated_dw: bool = false")
|
|
||||||
.Attr("gate_grad: bool = false")
|
|
||||||
.Attr("bench: int = 0")
|
|
||||||
.Attr("ngate: int >= 0")
|
|
||||||
.SetShapeFn(XpropShape)
|
|
||||||
.Doc(R"doc(
|
|
||||||
Multiply the matrix "a" by the blocksparse matrix "b".
|
|
||||||
)doc");
|
|
||||||
|
|
||||||
REGISTER_KERNEL_BUILDER(Name("TritonBlocksparseMatmul").Device(DEVICE_GPU).TypeConstraint<float>("T"), BlocksparseMatmulOp<triton::dnn::blocksparse::FPROP, float>);
|
|
||||||
REGISTER_KERNEL_BUILDER(Name("TritonBlocksparseMatmul").Device(DEVICE_GPU).TypeConstraint<Eigen::half>("T"), BlocksparseMatmulOp<triton::dnn::blocksparse::FPROP, Eigen::half>);
|
|
||||||
|
|
||||||
|
|
||||||
REGISTER_OP("TritonBlocksparseMatmulDX")
|
|
||||||
.Input("dy: T")
|
|
||||||
.Input("w: T")
|
|
||||||
.Input("lut: int64")
|
|
||||||
.Input("gate: ngate * float")
|
|
||||||
.Output("dx: T")
|
|
||||||
.Output("temp: int32")
|
|
||||||
.Attr("T: {half, float, bfloat16}")
|
|
||||||
.Attr("blocks: int >=0")
|
|
||||||
.Attr("bsize: int")
|
|
||||||
.Attr("segments: int = 0")
|
|
||||||
.Attr("locks: int = 0")
|
|
||||||
.Attr("axis: int = 1")
|
|
||||||
.Attr("C: int >=0")
|
|
||||||
.Attr("K: int >=0")
|
|
||||||
.Attr("shared: int = 0")
|
|
||||||
.Attr("alpha: float = 1.0")
|
|
||||||
.Attr("beta: float = 0.0")
|
|
||||||
.Attr("gated_dw: bool = false")
|
|
||||||
.Attr("gate_grad: bool = false")
|
|
||||||
.Attr("bench: int = 0")
|
|
||||||
.Attr("ngate: int >= 0")
|
|
||||||
.SetShapeFn(XpropShape)
|
|
||||||
.Doc(R"doc(
|
|
||||||
Multiply the matrix "a" by the blocksparse matrix "b".
|
|
||||||
)doc");
|
|
||||||
|
|
||||||
REGISTER_KERNEL_BUILDER(Name("TritonBlocksparseMatmulDX").Device(DEVICE_GPU).TypeConstraint<float>("T"),BlocksparseMatmulOp<triton::dnn::blocksparse::BPROP, float>);
|
|
||||||
REGISTER_KERNEL_BUILDER(Name("TritonBlocksparseMatmulDX").Device(DEVICE_GPU).TypeConstraint<Eigen::half>("T"),BlocksparseMatmulOp<triton::dnn::blocksparse::BPROP, Eigen::half>);
|
|
||||||
|
|
||||||
|
|
||||||
REGISTER_OP("TritonBlocksparseMatmulDW")
|
|
||||||
.Input("x: params * T")
|
|
||||||
.Input("dy: params * T")
|
|
||||||
.Input("lut: int64")
|
|
||||||
.Input("gate: ngate * float")
|
|
||||||
.Output("dw: T")
|
|
||||||
.Attr("T: {half, float, bfloat16}")
|
|
||||||
.Attr("params: int")
|
|
||||||
.Attr("blocks: int >=0")
|
|
||||||
.Attr("bsize: int")
|
|
||||||
.Attr("segments: int = 0")
|
|
||||||
.Attr("locks: int = 0")
|
|
||||||
.Attr("axis: int = 1")
|
|
||||||
.Attr("C: int >=0")
|
|
||||||
.Attr("K: int >=0")
|
|
||||||
.Attr("shared: int = 0")
|
|
||||||
.Attr("alpha: float = 1.0")
|
|
||||||
.Attr("beta: float = 0.0")
|
|
||||||
.Attr("gated_dw: bool = false")
|
|
||||||
.Attr("gate_grad: bool = false")
|
|
||||||
.Attr("bench: int = 0")
|
|
||||||
.Attr("ngate: int >= 0")
|
|
||||||
.SetShapeFn(UpdatShape)
|
|
||||||
.Doc(R"doc(
|
|
||||||
Multiply the matrix "a" by the blocksparse matrix "b".
|
|
||||||
)doc");
|
|
||||||
|
|
||||||
REGISTER_KERNEL_BUILDER(Name("TritonBlocksparseMatmulDW").Device(DEVICE_GPU).TypeConstraint<float>("T"),BlocksparseMatmulOp<triton::dnn::blocksparse::WGRAD, float>);
|
|
||||||
REGISTER_KERNEL_BUILDER(Name("TritonBlocksparseMatmulDW").Device(DEVICE_GPU).TypeConstraint<Eigen::half>("T"),BlocksparseMatmulOp<triton::dnn::blocksparse::WGRAD, Eigen::half>);
|
|
@@ -1,82 +0,0 @@
|
|||||||
#include <iostream>
|
|
||||||
|
|
||||||
#include "triton/driver/buffer.h"
|
|
||||||
#include "triton/driver/backend.h"
|
|
||||||
#include "triton/driver/stream.h"
|
|
||||||
#include "triton/runtime/jit.h"
|
|
||||||
#include "triton/tools/bench.hpp"
|
|
||||||
#include "triton/dnn/conv.h"
|
|
||||||
|
|
||||||
#define EIGEN_USE_GPU
|
|
||||||
#include "tensorflow/core/framework/op.h"
|
|
||||||
#include "tensorflow/core/framework/shape_inference.h"
|
|
||||||
#include "tensorflow/core/framework/op_kernel.h"
|
|
||||||
#include "tensorflow/core/util/cuda_kernel_helper.h"
|
|
||||||
#include "tensorflow/core/util/padding.h"
|
|
||||||
#include "tensorflow/core/util/tensor_format.h"
|
|
||||||
#include "tensorflow/core/framework/common_shape_fns.h"
|
|
||||||
|
|
||||||
using namespace tensorflow;
|
|
||||||
using GPUDevice = Eigen::GpuDevice;
|
|
||||||
|
|
||||||
class Conv2dOp : public OpKernel {
|
|
||||||
public:
|
|
||||||
explicit Conv2dOp(OpKernelConstruction* context) : OpKernel(context) {
|
|
||||||
}
|
|
||||||
|
|
||||||
void Compute(OpKernelContext* context){
|
|
||||||
// get device/stream
|
|
||||||
GPUDevice device = context->eigen_device<GPUDevice>();
|
|
||||||
triton::driver::cu_stream sstream(device.stream(), false);
|
|
||||||
triton::driver::context* ctx = sstream.context();
|
|
||||||
triton::driver::stream* stream = &sstream;
|
|
||||||
// get inputs
|
|
||||||
const Tensor& tfa = context->input(0);
|
|
||||||
const Tensor& tfb = context->input(1);
|
|
||||||
// get shapes
|
|
||||||
int32_t B = tfa.dim_size(0);
|
|
||||||
int32_t Ca = tfa.dim_size(1);
|
|
||||||
int32_t D = 1;
|
|
||||||
int32_t H = tfa.dim_size(2);
|
|
||||||
int32_t W = tfa.dim_size(3);
|
|
||||||
int32_t Cb = tfb.dim_size(0);
|
|
||||||
int32_t T = 1;
|
|
||||||
int32_t R = tfb.dim_size(1);
|
|
||||||
int32_t S = tfb.dim_size(2);
|
|
||||||
int32_t NF = tfb.dim_size(3);
|
|
||||||
assert(Ca == Cb);
|
|
||||||
int32_t C = Ca;
|
|
||||||
int32_t stride_d = 1, stride_h = 1, stride_w = 1;
|
|
||||||
int32_t pad_d = 0, pad_h = 0, pad_w = 0;
|
|
||||||
bool has_bias = false;
|
|
||||||
// wrap buffers
|
|
||||||
triton::driver::cu_buffer a(ctx, tfa.tensor_data().size(), (CUdeviceptr)tfa.tensor_data().data(), false);
|
|
||||||
triton::driver::cu_buffer b(ctx, tfb.tensor_data().size(), (CUdeviceptr)tfb.tensor_data().data(), false);
|
|
||||||
triton::driver::buffer* bias = nullptr;
|
|
||||||
// template
|
|
||||||
triton::dnn::conv conv(B, C,
|
|
||||||
D, H, W,
|
|
||||||
T, R, S,
|
|
||||||
NF,
|
|
||||||
stride_d, stride_h, stride_w,
|
|
||||||
pad_d, pad_h, pad_w,
|
|
||||||
1, 1, 1,
|
|
||||||
"half", "half",
|
|
||||||
triton::dnn::conv::FPROP, has_bias);
|
|
||||||
// allocate output
|
|
||||||
auto c_shapes = conv.c_shapes();
|
|
||||||
Tensor* tfc = nullptr;
|
|
||||||
TensorShape out_shape({c_shapes[0], c_shapes[1], c_shapes[2], c_shapes[3]});
|
|
||||||
OP_REQUIRES_OK(context, context->allocate_output(0, out_shape, &tfc));
|
|
||||||
triton::driver::cu_buffer c(ctx, tfc->tensor_data().size(), (CUdeviceptr)tfc->tensor_data().data(), false);
|
|
||||||
// enqueue
|
|
||||||
conv.enqueue(stream, {&a, &b, &c, bias});
|
|
||||||
}
|
|
||||||
};
|
|
||||||
|
|
||||||
REGISTER_KERNEL_BUILDER(Name("Conv2d").Device(DEVICE_GPU), Conv2dOp);
|
|
||||||
REGISTER_OP("Conv2d")
|
|
||||||
.Input("a: float16")
|
|
||||||
.Input("b: float16")
|
|
||||||
.Output("c: float32")
|
|
||||||
;
|
|
@@ -1,64 +0,0 @@
|
|||||||
#include <iostream>
|
|
||||||
|
|
||||||
#include "triton/driver/buffer.h"
|
|
||||||
#include "triton/driver/backend.h"
|
|
||||||
#include "triton/driver/stream.h"
|
|
||||||
#include "triton/runtime/jit.h"
|
|
||||||
#include "triton/tools/bench.hpp"
|
|
||||||
#include "triton/dnn/dot.h"
|
|
||||||
|
|
||||||
#define EIGEN_USE_GPU
|
|
||||||
#include "tensorflow/core/framework/op.h"
|
|
||||||
#include "tensorflow/core/framework/shape_inference.h"
|
|
||||||
#include "tensorflow/core/framework/op_kernel.h"
|
|
||||||
#include "tensorflow/core/util/cuda_kernel_helper.h"
|
|
||||||
#include "tensorflow/core/util/padding.h"
|
|
||||||
#include "tensorflow/core/util/tensor_format.h"
|
|
||||||
#include "tensorflow/core/framework/common_shape_fns.h"
|
|
||||||
|
|
||||||
using namespace tensorflow;
|
|
||||||
using GPUDevice = Eigen::GpuDevice;
|
|
||||||
|
|
||||||
class DotOp : public OpKernel {
|
|
||||||
public:
|
|
||||||
explicit DotOp(OpKernelConstruction* context) : OpKernel(context) {
|
|
||||||
}
|
|
||||||
|
|
||||||
void Compute(OpKernelContext* context){
|
|
||||||
// get device/stream
|
|
||||||
GPUDevice device = context->eigen_device<GPUDevice>();
|
|
||||||
triton::driver::cu_stream sstream(device.stream(), false);
|
|
||||||
triton::driver::context* ctx = sstream.context();
|
|
||||||
triton::driver::stream* stream = &sstream;
|
|
||||||
// get inputs
|
|
||||||
const Tensor& a = context->input(0);
|
|
||||||
const Tensor& b = context->input(1);
|
|
||||||
// get shapes
|
|
||||||
const int32_t M = a.dim_size(0);
|
|
||||||
const int32_t N = b.dim_size(0);
|
|
||||||
const int32_t K = a.dim_size(1);
|
|
||||||
// allocate output
|
|
||||||
Tensor* c = nullptr;
|
|
||||||
TensorShape out_shape({(int64)M, (int64)N});
|
|
||||||
OP_REQUIRES_OK(context, context->allocate_output(0, out_shape, &c));
|
|
||||||
// return early if possible
|
|
||||||
if (out_shape.num_elements() == 0)
|
|
||||||
return;
|
|
||||||
// matrix multiplication parameters
|
|
||||||
triton::driver::cu_buffer da(ctx, a.tensor_data().size(), (CUdeviceptr)a.tensor_data().data(), false);
|
|
||||||
triton::driver::cu_buffer db(ctx, b.tensor_data().size(), (CUdeviceptr)b.tensor_data().data(), false);
|
|
||||||
triton::driver::cu_buffer dc(ctx, c->tensor_data().size(), (CUdeviceptr)c->tensor_data().data(), false);
|
|
||||||
// template
|
|
||||||
triton::dnn::dot dot(M, N, K, false, false, "half", "half", "float", 8, 8, 8);
|
|
||||||
dot.enqueue(stream, {&da, &db, &dc}, triton::dnn::autotuning_t::NO_TUNING);
|
|
||||||
}
|
|
||||||
|
|
||||||
private:
|
|
||||||
};
|
|
||||||
|
|
||||||
REGISTER_KERNEL_BUILDER(Name("Dot").Device(DEVICE_GPU), DotOp);
|
|
||||||
REGISTER_OP("Dot")
|
|
||||||
.Input("a: float16")
|
|
||||||
.Input("b: float16")
|
|
||||||
.Output("c: float32")
|
|
||||||
;
|
|
@@ -1,136 +0,0 @@
|
|||||||
import os
|
|
||||||
import tensorflow as tf
|
|
||||||
from tensorflow.python.framework import ops
|
|
||||||
import numpy as np
|
|
||||||
from time import time
|
|
||||||
|
|
||||||
data_files_path = tf.resource_loader.get_data_files_path()
|
|
||||||
library_dir = os.path.dirname(os.path.realpath(__file__))
|
|
||||||
module = tf.load_op_library(os.path.join(library_dir, 'libtf_blocksparse.so'))
|
|
||||||
|
|
||||||
def run_dot():
|
|
||||||
M, N, K = 128, 128, 128
|
|
||||||
a = tf.placeholder(tf.float16, shape=[M, K])
|
|
||||||
b = tf.placeholder(tf.float16, shape=[N, K])
|
|
||||||
# c = tf.matmul(a, b, transpose_a=True)
|
|
||||||
c = module.dot(a, b)
|
|
||||||
# Reference
|
|
||||||
ha = np.random.rand(M, K).astype(np.float16)
|
|
||||||
hb = np.random.rand(N, K).astype(np.float16)
|
|
||||||
# Run
|
|
||||||
sess = tf.InteractiveSession()
|
|
||||||
sess.run(tf.global_variables_initializer())
|
|
||||||
result = sess.run([c], feed_dict = {a: ha,
|
|
||||||
b: hb})[0]
|
|
||||||
# Test
|
|
||||||
hresult = np.dot(ha.T, hb.T).T
|
|
||||||
dif = np.abs(result - hresult)
|
|
||||||
np.savetxt('dif.dat', dif, '%2.4f')
|
|
||||||
print(hresult)
|
|
||||||
print(result)
|
|
||||||
print("dif: %f" % np.max(dif))
|
|
||||||
|
|
||||||
def run_conv():
|
|
||||||
B, C, H, W = 16, 32, 32, 32
|
|
||||||
R, S, NF = 3, 3, 32
|
|
||||||
a = tf.placeholder(tf.float32, shape=[B, C, H, W])
|
|
||||||
b = tf.placeholder(tf.float32, shape=[C, R, S, NF])
|
|
||||||
c = module.conv2d(a, b)
|
|
||||||
# Reference
|
|
||||||
ha = np.random.rand(B, C, H, W)
|
|
||||||
hb = np.random.rand(C, R, S, NF)
|
|
||||||
# Run
|
|
||||||
sess = tf.InteractiveSession()
|
|
||||||
sess.run(tf.global_variables_initializer())
|
|
||||||
result = sess.run([c], feed_dict = {a: ha,
|
|
||||||
b: hb})[0]
|
|
||||||
|
|
||||||
|
|
||||||
@ops.RegisterGradient('ShiftConv')
|
|
||||||
def blocksparse_matmul_grad(op, dy):
|
|
||||||
shift_h = op.get_attr('shift_h')
|
|
||||||
shift_w = op.get_attr('shift_w')
|
|
||||||
stride_h = op.get_attr('stride_h')
|
|
||||||
stride_w = op.get_attr('stride_w')
|
|
||||||
x = op.inputs[0]
|
|
||||||
w = op.inputs[1]
|
|
||||||
dx = module.shift_conv_dx(dy, w, stride_h=stride_h, stride_w=stride_w, shift_h=shift_h, shift_w=shift_w)
|
|
||||||
dw = module.shift_conv_dw(dy, x, stride_h=stride_h, stride_w=stride_w, shift_h=shift_h, shift_w=shift_w)
|
|
||||||
return (dx, dw)
|
|
||||||
|
|
||||||
def run_shift():
|
|
||||||
B, C, H, W = 2, 16, 4, 4
|
|
||||||
R, S, F = 3, 3, 16
|
|
||||||
stride_h, stride_w = 1, 1
|
|
||||||
np.random.seed(2)
|
|
||||||
a = tf.placeholder(tf.float16, shape=[B, C, H, W])
|
|
||||||
b = tf.placeholder(tf.float16, shape=[C, F])
|
|
||||||
hshift_h = np.random.randint(- (R//2), R//2 + 1, size=C, dtype=np.int32)
|
|
||||||
hshift_w = np.random.randint(- (S//2), R//2 + 1, size=C, dtype=np.int32)
|
|
||||||
c = module.shift_conv(a, b, stride_h=stride_h, stride_w=stride_w, shift_h=tf.make_tensor_proto(hshift_h), shift_w=tf.make_tensor_proto(hshift_w))
|
|
||||||
# feed values
|
|
||||||
ha = np.random.rand(B, C, H, W)*0.1
|
|
||||||
hb = np.random.rand(C, F)*0.1
|
|
||||||
sess = tf.InteractiveSession()
|
|
||||||
# check gradients
|
|
||||||
grads = tf.test.compute_gradient([a, b], [(B, C, H, W), (C, F)], c, (B, F, H//stride_h, W//stride_w),
|
|
||||||
extra_feed_dict = {a: ha, b: hb}, delta=1e-2)
|
|
||||||
dw_t, dw_n = grads[1]
|
|
||||||
dx_t, dx_n = grads[0]
|
|
||||||
#import sys
|
|
||||||
#np.set_printoptions(threshold=sys.maxsize)
|
|
||||||
print(dw_t)
|
|
||||||
print(dw_n)
|
|
||||||
print(np.max(np.abs(dw_t - dw_n)))
|
|
||||||
print(np.max(np.abs(dx_t - dx_n)))
|
|
||||||
# Run
|
|
||||||
sess.run(tf.global_variables_initializer())
|
|
||||||
result = sess.run([c], feed_dict = {a: ha,
|
|
||||||
b: hb})[0]
|
|
||||||
#print(result)
|
|
||||||
|
|
||||||
|
|
||||||
def batch_norm(x, g, b, epsilon=1e-6):
|
|
||||||
shape = x.shape
|
|
||||||
C = int(shape[1])
|
|
||||||
assert g.get_shape().num_elements() == C
|
|
||||||
assert b.get_shape().num_elements() == C
|
|
||||||
return module.batchnorm_forward(x, g, b, eps=epsilon)
|
|
||||||
|
|
||||||
@ops.RegisterGradient("BatchnormForward")
|
|
||||||
def batch_norm_grad(op, dy, mean, var):
|
|
||||||
eps = op.get_attr("eps")
|
|
||||||
return module.batchnorm_backward(dy, op.inputs[0], op.inputs[1],
|
|
||||||
op.outputs[1], op.outputs[2], eps=eps)
|
|
||||||
|
|
||||||
|
|
||||||
def run_batchnorm():
|
|
||||||
C, H, W, B = 8, 4, 4, 32
|
|
||||||
np.random.seed(0)
|
|
||||||
# Placeholders
|
|
||||||
x = tf.placeholder(tf.float32, shape=[C, H, W, B])
|
|
||||||
g = tf.placeholder(tf.float32, shape=[C])
|
|
||||||
b = tf.placeholder(tf.float32, shape=[C])
|
|
||||||
# Feed values
|
|
||||||
hx = np.random.rand(C, H, W, B)
|
|
||||||
hg = np.random.rand(C)
|
|
||||||
hb = np.random.rand(C)
|
|
||||||
# batchnorm
|
|
||||||
y, m, v = module.batchnorm_forward(x, g, b, eps=1e-5)
|
|
||||||
loss = np.sum(y)
|
|
||||||
# Run
|
|
||||||
sess = tf.InteractiveSession()
|
|
||||||
sess.run(tf.global_variables_initializer())
|
|
||||||
result = sess.run([y, m, v], feed_dict = {x: hx, g: hg, b: hb})
|
|
||||||
grads = tf.test.compute_gradient([x, g, b], [(C, H, W, B), (C, ), (C, )], y, (C, H, W, B),
|
|
||||||
extra_feed_dict = {x: hx, g: hg, b: hb})
|
|
||||||
dx_t, dx_n = grads[0]
|
|
||||||
dg_t, dg_n = grads[1]
|
|
||||||
db_t, db_n = grads[2]
|
|
||||||
print(np.max(np.abs(dx_t - dx_n)))
|
|
||||||
print(np.max(np.abs(dg_t - dg_n)))
|
|
||||||
print(np.max(np.abs(db_t - db_n)))
|
|
||||||
|
|
||||||
run_dot()
|
|
||||||
#run_shift()
|
|
||||||
#run_batchnorm()
|
|
@@ -1,167 +0,0 @@
|
|||||||
#include <iostream>
|
|
||||||
|
|
||||||
#include "triton/driver/buffer.h"
|
|
||||||
#include "triton/driver/backend.h"
|
|
||||||
#include "triton/driver/stream.h"
|
|
||||||
#include "triton/runtime/jit.h"
|
|
||||||
#include "triton/tools/bench.hpp"
|
|
||||||
#include "triton/dnn/shift.h"
|
|
||||||
|
|
||||||
#define EIGEN_USE_GPU
|
|
||||||
#include "tensorflow/core/framework/op.h"
|
|
||||||
#include "tensorflow/core/framework/shape_inference.h"
|
|
||||||
#include "tensorflow/core/framework/op_kernel.h"
|
|
||||||
#include "tensorflow/core/util/cuda_kernel_helper.h"
|
|
||||||
#include "tensorflow/core/util/padding.h"
|
|
||||||
#include "tensorflow/core/util/tensor_format.h"
|
|
||||||
#include "tensorflow/core/framework/common_shape_fns.h"
|
|
||||||
|
|
||||||
using namespace tensorflow;
|
|
||||||
using GPUDevice = Eigen::GpuDevice;
|
|
||||||
|
|
||||||
template<triton::dnn::op_t OP>
|
|
||||||
class ShiftConvOp : public OpKernel {
|
|
||||||
public:
|
|
||||||
explicit ShiftConvOp(OpKernelConstruction* context) : OpKernel(context), layout_(triton::dnn::NCHW) {
|
|
||||||
context->GetAttr("shift_h", &h_shift_h_);
|
|
||||||
context->GetAttr("shift_w", &h_shift_w_);
|
|
||||||
context->GetAttr("stride_h", &stride_h_);
|
|
||||||
context->GetAttr("stride_w", &stride_w_);
|
|
||||||
R_ = 3;
|
|
||||||
S_ = 3;
|
|
||||||
}
|
|
||||||
|
|
||||||
void ExtractShapes(const Tensor &x, int64_t &C, int64_t &H, int64_t &W, int64_t &B) {
|
|
||||||
if(layout_ == triton::dnn::CHWN){
|
|
||||||
C = x.dim_size(0);
|
|
||||||
H = x.dim_size(1);
|
|
||||||
W = x.dim_size(2);
|
|
||||||
B = x.dim_size(3);
|
|
||||||
}
|
|
||||||
else if(layout_ == triton::dnn::NCHW){
|
|
||||||
B = x.dim_size(0);
|
|
||||||
C = x.dim_size(1);
|
|
||||||
H = x.dim_size(2);
|
|
||||||
W = x.dim_size(3);
|
|
||||||
}
|
|
||||||
else{
|
|
||||||
throw std::runtime_error("unsupported layout");
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
void FillShapes(OpKernelContext* context,
|
|
||||||
int64_t &C, int64_t &H, int64_t &W, int64_t &B, int64_t &F,
|
|
||||||
const Tensor& tf_a, const Tensor& tf_b) {
|
|
||||||
if(OP == triton::dnn::WGRAD) {
|
|
||||||
int64_t Ha, Wa, Ba;
|
|
||||||
int64_t Hb, Wb, Bb;
|
|
||||||
ExtractShapes(tf_a, F, Ha, Wa, Ba);
|
|
||||||
ExtractShapes(tf_b, C, Hb, Wb, Bb);
|
|
||||||
OP_REQUIRES(context, Ha*stride_h_ == Hb, tensorflow::errors::InvalidArgument("operands must have the same image height"));
|
|
||||||
OP_REQUIRES(context, Wa*stride_w_ == Wb, tensorflow::errors::InvalidArgument("operands must have the same image width"));
|
|
||||||
OP_REQUIRES(context, Ba == Bb, tensorflow::errors::InvalidArgument("operands must have the same batch size"));
|
|
||||||
H = Hb;
|
|
||||||
W = Wb;
|
|
||||||
B = Bb;
|
|
||||||
}
|
|
||||||
else {
|
|
||||||
// shapes for a
|
|
||||||
int64_t Ca;
|
|
||||||
ExtractShapes(tf_a, Ca, H, W, B);
|
|
||||||
if(OP == triton::dnn::BPROP){
|
|
||||||
H *= stride_h_;
|
|
||||||
W *= stride_w_;
|
|
||||||
}
|
|
||||||
// shapes for b
|
|
||||||
int64_t Cb = tf_b.dim_size(0);
|
|
||||||
F = tf_b.dim_size(1);
|
|
||||||
if(OP == triton::dnn::BPROP)
|
|
||||||
std::swap(Cb, F);
|
|
||||||
// checks
|
|
||||||
OP_REQUIRES(context, Ca == Cb, tensorflow::errors::InvalidArgument("operands must have the same number of channels"));
|
|
||||||
C = Ca;
|
|
||||||
if(OP == triton::dnn::BPROP)
|
|
||||||
std::swap(C, F);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
void Compute(OpKernelContext* context){
|
|
||||||
// get device/stream
|
|
||||||
GPUDevice device = context->eigen_device<GPUDevice>();
|
|
||||||
triton::driver::cu_stream sstream(device.stream(), false);
|
|
||||||
triton::driver::context* ctx = sstream.context();
|
|
||||||
triton::driver::stream* stream = &sstream;
|
|
||||||
// get inputs
|
|
||||||
const Tensor& tf_a = context->input(0);
|
|
||||||
const Tensor& tf_b = context->input(1);
|
|
||||||
// shapes
|
|
||||||
int64_t C, H, W, B, F;
|
|
||||||
FillShapes(context, C, H, W, B, F, tf_a, tf_b);
|
|
||||||
int64_t D = 1, T = 1;
|
|
||||||
bool has_bias = false;
|
|
||||||
// shift offsets
|
|
||||||
int32_t* shift_h_data = h_shift_h_.flat<int32_t>().data();
|
|
||||||
int32_t* shift_w_data = h_shift_w_.flat<int32_t>().data();
|
|
||||||
// create configuration
|
|
||||||
triton::dnn::shift shift(B, C, D, H, W, T, R_, S_, F,
|
|
||||||
stride_h_, stride_w_,
|
|
||||||
shift_h_data, shift_w_data,
|
|
||||||
"half", "half", OP, has_bias, layout_);
|
|
||||||
|
|
||||||
// shapes for c
|
|
||||||
std::vector<int64> c_shapes;
|
|
||||||
for(int32_t x: shift.c_shapes())
|
|
||||||
c_shapes.push_back(x);
|
|
||||||
TensorShape out_shapes(c_shapes);
|
|
||||||
Tensor* tf_c = nullptr;
|
|
||||||
OP_REQUIRES_OK(context, context->allocate_output(0, out_shapes, &tf_c));
|
|
||||||
// return early if possible
|
|
||||||
if (out_shapes.num_elements() == 0)
|
|
||||||
return;
|
|
||||||
// matrix multiplication parameters
|
|
||||||
triton::driver::cu_buffer da(ctx, tf_a.tensor_data().size(), (CUdeviceptr)tf_a.tensor_data().data(), false);
|
|
||||||
triton::driver::cu_buffer db(ctx, tf_b.tensor_data().size(), (CUdeviceptr)tf_b.tensor_data().data(), false);
|
|
||||||
triton::driver::cu_buffer dc(ctx, tf_c->tensor_data().size(), (CUdeviceptr)tf_c->tensor_data().data(), false);
|
|
||||||
shift.enqueue(stream, {&da, &db, &dc}, triton::dnn::PARTIAL_TUNING);
|
|
||||||
}
|
|
||||||
|
|
||||||
private:
|
|
||||||
Tensor h_shift_h_;
|
|
||||||
Tensor h_shift_w_;
|
|
||||||
int stride_h_;
|
|
||||||
int stride_w_;
|
|
||||||
int R_;
|
|
||||||
int S_;
|
|
||||||
triton::dnn::layout_t layout_;
|
|
||||||
};
|
|
||||||
|
|
||||||
REGISTER_KERNEL_BUILDER(Name("ShiftConv").Device(DEVICE_GPU), ShiftConvOp<triton::dnn::FPROP>);
|
|
||||||
REGISTER_OP("ShiftConv")
|
|
||||||
.Input("a: float16")
|
|
||||||
.Input("b: float16")
|
|
||||||
.Attr("shift_h: tensor")
|
|
||||||
.Attr("shift_w: tensor")
|
|
||||||
.Attr("stride_h: int")
|
|
||||||
.Attr("stride_w: int")
|
|
||||||
.Output("c: float16");
|
|
||||||
|
|
||||||
REGISTER_KERNEL_BUILDER(Name("ShiftConvDx").Device(DEVICE_GPU), ShiftConvOp<triton::dnn::BPROP>);
|
|
||||||
REGISTER_OP("ShiftConvDx")
|
|
||||||
.Input("a: float16")
|
|
||||||
.Input("b: float16")
|
|
||||||
.Attr("shift_h: tensor")
|
|
||||||
.Attr("shift_w: tensor")
|
|
||||||
.Attr("stride_h: int")
|
|
||||||
.Attr("stride_w: int")
|
|
||||||
.Output("c: float16");
|
|
||||||
|
|
||||||
REGISTER_KERNEL_BUILDER(Name("ShiftConvDw").Device(DEVICE_GPU), ShiftConvOp<triton::dnn::WGRAD>);
|
|
||||||
REGISTER_OP("ShiftConvDw")
|
|
||||||
.Input("a: float16")
|
|
||||||
.Input("b: float16")
|
|
||||||
.Attr("shift_h: tensor")
|
|
||||||
.Attr("shift_w: tensor")
|
|
||||||
.Attr("stride_h: int")
|
|
||||||
.Attr("stride_w: int")
|
|
||||||
.Output("c: float16");
|
|
||||||
|
|
@@ -24,7 +24,7 @@ enum arg_type {
|
|||||||
BUFFER_T
|
BUFFER_T
|
||||||
};
|
};
|
||||||
|
|
||||||
size_t size_of(arg_type ty){
|
inline size_t size_of(arg_type ty){
|
||||||
switch(ty){
|
switch(ty){
|
||||||
case INT1_T: return 1;
|
case INT1_T: return 1;
|
||||||
case INT8_T: return 1;
|
case INT8_T: return 1;
|
||||||
@@ -39,7 +39,7 @@ size_t size_of(arg_type ty){
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
bool is_int_type(arg_type ty){
|
inline bool is_int_type(arg_type ty){
|
||||||
return ty == INT1_T || ty == INT8_T || ty == INT16_T ||
|
return ty == INT1_T || ty == INT8_T || ty == INT16_T ||
|
||||||
ty == INT32_T || ty == INT64_T;
|
ty == INT32_T || ty == INT64_T;
|
||||||
}
|
}
|
||||||
|
@@ -2,6 +2,7 @@
|
|||||||
#include <mutex>
|
#include <mutex>
|
||||||
#include <regex>
|
#include <regex>
|
||||||
#include <functional>
|
#include <functional>
|
||||||
|
#include <algorithm>
|
||||||
#include "triton/codegen/selection/selection.h"
|
#include "triton/codegen/selection/selection.h"
|
||||||
#include "triton/runtime/function.h"
|
#include "triton/runtime/function.h"
|
||||||
#include "triton/lang/lang.h"
|
#include "triton/lang/lang.h"
|
||||||
@@ -260,174 +261,5 @@ void function::operator()(const std::vector<arg>& args, const grid_t& grid, driv
|
|||||||
return this->operator()(args, [&grid](const params_t&){ return grid; }, stream);
|
return this->operator()(args, [&grid](const params_t&){ return grid; }, stream);
|
||||||
}
|
}
|
||||||
|
|
||||||
std::string to_tf_ty(ir::type *ty) {
|
|
||||||
if(ty->is_integer_ty(1))
|
|
||||||
return "bool";
|
|
||||||
if(ty->is_integer_ty(8))
|
|
||||||
return "int8";
|
|
||||||
if(ty->is_integer_ty(16))
|
|
||||||
return "int16";
|
|
||||||
if(ty->is_integer_ty(32))
|
|
||||||
return "int32";
|
|
||||||
if(ty->is_integer_ty(64))
|
|
||||||
return "int64";
|
|
||||||
if(ty->is_half_ty())
|
|
||||||
return "float16";
|
|
||||||
if(ty->is_float_ty())
|
|
||||||
return "float32";
|
|
||||||
if(ty->is_double_ty())
|
|
||||||
return "float64";
|
|
||||||
if(ty->is_pointer_ty())
|
|
||||||
return "Tensor";
|
|
||||||
throw std::runtime_error("unknown type");
|
|
||||||
}
|
|
||||||
|
|
||||||
std::string ref_to_tf_ty(ir::type *ty) {
|
|
||||||
std::string res = to_tf_ty(ty);
|
|
||||||
if(ty->is_pointer_ty())
|
|
||||||
res = "const " + res + "&";
|
|
||||||
return res;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
std::string function::make_tensorflow_src(const std::vector<size_t>& outputs, const std::string& macro) {
|
|
||||||
std::unique_ptr<ir::module> ir = make_ir(ast_);
|
|
||||||
// extract function signature
|
|
||||||
ir::function* fn = ir->get_function_list().front();
|
|
||||||
ir::function_type* fn_ty = fn->get_fn_type();
|
|
||||||
// numberof arguments
|
|
||||||
size_t n_args = fn_ty->get_num_params();
|
|
||||||
size_t n_outputs = outputs.size();
|
|
||||||
// extract function name
|
|
||||||
std::string name = fn->get_name();
|
|
||||||
std::string classname = name + "Op";
|
|
||||||
// extract argument name
|
|
||||||
std::vector<std::string> arg_names;
|
|
||||||
for(ir::argument *arg: fn->args())
|
|
||||||
arg_names.push_back(arg->get_name());
|
|
||||||
// cached int to str
|
|
||||||
std::vector<std::string> str_i;
|
|
||||||
for(size_t i = 0; i < fn_ty->get_num_params(); i++)
|
|
||||||
str_i.push_back(std::to_string(i));
|
|
||||||
// index of tensors
|
|
||||||
std::vector<size_t> ptr_idx;
|
|
||||||
for(unsigned i = 0; i < fn_ty->get_num_params(); i++)
|
|
||||||
if(fn_ty->get_param_ty(i)->is_pointer_ty())
|
|
||||||
ptr_idx.push_back(i);
|
|
||||||
// extract tensorflow types
|
|
||||||
std::vector<std::string> tf_tys;
|
|
||||||
std::transform(fn_ty->params_begin(), fn_ty->params_end(), std::back_inserter(tf_tys), to_tf_ty);
|
|
||||||
std::vector<std::string> tf_cref_tys;
|
|
||||||
std::transform(fn_ty->params_begin(), fn_ty->params_end(), std::back_inserter(tf_cref_tys), ref_to_tf_ty);
|
|
||||||
|
|
||||||
std::ostringstream oss;
|
|
||||||
|
|
||||||
std::string result = R"(
|
|
||||||
#include "triton/driver/buffer.h"
|
|
||||||
#include "triton/driver/backend.h"
|
|
||||||
#include "triton/driver/stream.h"
|
|
||||||
#include "triton/runtime/function.h"
|
|
||||||
|
|
||||||
#define EIGEN_USE_GPU
|
|
||||||
#include "tensorflow/core/framework/op.h"
|
|
||||||
#include "tensorflow/core/framework/shape_inference.h"
|
|
||||||
#include "tensorflow/core/framework/op_kernel.h"
|
|
||||||
#include "tensorflow/core/util/cuda_kernel_helper.h"
|
|
||||||
#include "tensorflow/core/util/padding.h"
|
|
||||||
#include "tensorflow/core/util/tensor_format.h"
|
|
||||||
#include "tensorflow/core/framework/common_shape_fns.h"
|
|
||||||
|
|
||||||
using namespace tensorflow;
|
|
||||||
using GPUDevice = Eigen::GpuDevice;
|
|
||||||
namespace rt = triton::runtime;
|
|
||||||
namespace drv = triton::driver;
|
|
||||||
|
|
||||||
std::string src = R"TTKERNSRC( )" + src_ + ")TTKERNSRC\";" + R"(
|
|
||||||
|
|
||||||
class )" + classname + R"(: public OpKernel {
|
|
||||||
public:
|
|
||||||
explicit )" + classname + R"((OpKernelConstruction* context)
|
|
||||||
: OpKernel(context), fn_(src) { }
|
|
||||||
|
|
||||||
void Compute(OpKernelContext* context){
|
|
||||||
|
|
||||||
// get device/stream
|
|
||||||
GPUDevice device = context->eigen_device<GPUDevice>();
|
|
||||||
drv::cu_stream sstream(device.stream(), false);
|
|
||||||
drv::context* ctx = sstream.context();
|
|
||||||
drv::stream* stream = &sstream;
|
|
||||||
|
|
||||||
// extract inputs)";
|
|
||||||
for(unsigned i = 0; i < n_args; i++){
|
|
||||||
std::string suffix = "";
|
|
||||||
std::string ty = tf_cref_tys[i];
|
|
||||||
if(!fn_ty->get_param_ty(i)->is_pointer_ty())
|
|
||||||
suffix = ".scalar<" + ty + ">()()";
|
|
||||||
result += R"(
|
|
||||||
)" + ty + " " + arg_names[i] + " = context->input(" + str_i[i] + ")" + suffix + ";";
|
|
||||||
}
|
|
||||||
|
|
||||||
result += R"(
|
|
||||||
|
|
||||||
// extract outputs)";
|
|
||||||
for(unsigned i = 0; i < n_outputs; i++)
|
|
||||||
result += R"(
|
|
||||||
context->set_output()" + str_i[i] + ", " + arg_names[outputs[i]] + ");";
|
|
||||||
|
|
||||||
result += R"(
|
|
||||||
|
|
||||||
// wrap tensors)";
|
|
||||||
for(size_t i: ptr_idx)
|
|
||||||
result += R"(
|
|
||||||
drv::cu_buffer cu_)" + arg_names[i] + "(ctx, " + arg_names[i] + ".tensor_data().size(), (CUdeviceptr)" + arg_names[i] + R"(.tensor_data().data(), false);)";
|
|
||||||
|
|
||||||
|
|
||||||
std::regex regex("#([a-zA-Z]([a-zA-Z]|[0-9])*)");
|
|
||||||
std::string grid_str = std::regex_replace(macro, regex, "x.at(\"$1\")");
|
|
||||||
|
|
||||||
result += R"(
|
|
||||||
|
|
||||||
// create launch grid;
|
|
||||||
auto grid = [&](const rt::params_t& x) { return rt::grid_t{)" + grid_str + R"(}; };)";
|
|
||||||
|
|
||||||
result += R"(
|
|
||||||
|
|
||||||
// execute function
|
|
||||||
fn_({
|
|
||||||
)";
|
|
||||||
for(unsigned i = 0; i < n_args; i++){
|
|
||||||
std::string arg = arg_names[i];
|
|
||||||
if(fn_ty->get_param_ty(i)->is_pointer_ty())
|
|
||||||
arg = "&cu_" + arg;
|
|
||||||
if(i > 0)
|
|
||||||
result += ", ";
|
|
||||||
result += arg;
|
|
||||||
}
|
|
||||||
result += R"(
|
|
||||||
}, grid, stream);
|
|
||||||
|
|
||||||
}
|
|
||||||
|
|
||||||
private:
|
|
||||||
rt::function fn_;
|
|
||||||
};
|
|
||||||
|
|
||||||
REGISTER_KERNEL_BUILDER(Name(")" + name + "\").Device(DEVICE_GPU), " + classname + R"();
|
|
||||||
|
|
||||||
REGISTER_OP(")" + name + "\")\n";
|
|
||||||
for(size_t i = 0; i < tf_tys.size(); i++){
|
|
||||||
bool is_output = std::find(outputs.begin(), outputs.end(), i) != outputs.end();
|
|
||||||
std::string mode = is_output ? "Output" : "Input" ;
|
|
||||||
result += " ." + mode + "(\"" + arg_names[i] + ": " + tf_tys[i] + "\")\n";
|
|
||||||
}
|
|
||||||
result += ";\n";
|
|
||||||
|
|
||||||
|
|
||||||
return result;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
BIN
python/dist/triton-0.1-py3.6-linux-x86_64.egg
vendored
Normal file
BIN
python/dist/triton-0.1-py3.6-linux-x86_64.egg
vendored
Normal file
Binary file not shown.
42
python/examples/dot.py
Normal file
42
python/examples/dot.py
Normal file
@@ -0,0 +1,42 @@
|
|||||||
|
import libtriton
|
||||||
|
|
||||||
|
src = """
|
||||||
|
const tunable int TM = {128};
|
||||||
|
const tunable int TN = {128};
|
||||||
|
const tunable int TK = {32};
|
||||||
|
|
||||||
|
void matmul(restrict read_only align(16) half *A,
|
||||||
|
restrict read_only align(16) half *B,
|
||||||
|
restrict read_only align(16) half *C,
|
||||||
|
int M, int N, int K,
|
||||||
|
multiple_of(8) int lda, multiple_of(8)" int ldb, int ldc) {
|
||||||
|
int ridx = get_range_id(0);
|
||||||
|
int ridy = get_range_id(1);
|
||||||
|
int rxa[TM] = ridx * TM + (0 ... TM);
|
||||||
|
int ryb[TN] = ridy * TN + (0 ... TN);
|
||||||
|
int rka[TK] = 0 ... TK;
|
||||||
|
int rkb[TK] = 0 ... TK;
|
||||||
|
float xc[TM, TN] = 0;
|
||||||
|
half* pa[TM, TK] = A + rka[newaxis, :]*lda + rxa[:, newaxis];
|
||||||
|
half* pb[TN, TK] = B + rkb[newaxis, :]*ldb + ryb[:, newaxis];
|
||||||
|
half a[TM, TK] = *pa;
|
||||||
|
half b[TN, TK] = *pb;
|
||||||
|
for(int k = K; k > 0; k = k - TK){
|
||||||
|
xc = dot(a, trans(b), xc);
|
||||||
|
pa = pa + TK*lda;
|
||||||
|
pb = pb + TK*ldb;
|
||||||
|
a = *pa;
|
||||||
|
b = *pb;
|
||||||
|
}
|
||||||
|
int rxc[TM] = ridx * TM + (0 ... TM);
|
||||||
|
int ryc[TN] = ridy * TN + (0 ... TN);
|
||||||
|
half* pc[TM, TN] = C + ryc[newaxis, :]*ldc + rxc[:, newaxis];
|
||||||
|
half c[TM, TN] = xc;
|
||||||
|
bool checkc0[TM] = rxc < M;
|
||||||
|
bool checkc1[TN] = ryc < N;
|
||||||
|
bool checkc[TM, TN] = checkc0[:, newaxis] && checkc1[newaxis, :];
|
||||||
|
@checkc *pc = c;
|
||||||
|
}
|
||||||
|
"""
|
||||||
|
|
||||||
|
print(libtriton.make_tensorflow_src(src, [2], '(M + #TM - 1)/#TM, (N + #TN - 1)/#TN, 1'))
|
76
python/setup.py
Normal file
76
python/setup.py
Normal file
@@ -0,0 +1,76 @@
|
|||||||
|
import os
|
||||||
|
import re
|
||||||
|
import sys
|
||||||
|
import sysconfig
|
||||||
|
import platform
|
||||||
|
import subprocess
|
||||||
|
import distutils
|
||||||
|
|
||||||
|
from distutils.version import LooseVersion
|
||||||
|
from setuptools import setup, Extension, find_packages
|
||||||
|
from setuptools.command.build_ext import build_ext
|
||||||
|
from setuptools.command.test import test as TestCommand
|
||||||
|
|
||||||
|
class CMakeExtension(Extension):
|
||||||
|
def __init__(self, name, sourcedir=''):
|
||||||
|
Extension.__init__(self, name, sources=[])
|
||||||
|
self.sourcedir = os.path.abspath(sourcedir)
|
||||||
|
|
||||||
|
|
||||||
|
class CMakeBuild(build_ext):
|
||||||
|
def run(self):
|
||||||
|
try:
|
||||||
|
out = subprocess.check_output(['cmake', '--version'])
|
||||||
|
except OSError:
|
||||||
|
raise RuntimeError("CMake must be installed to build the following extensions: " +
|
||||||
|
", ".join(e.name for e in self.extensions))
|
||||||
|
|
||||||
|
if platform.system() == "Windows":
|
||||||
|
cmake_version = LooseVersion(re.search(r'version\s*([\d.]+)', out.decode()).group(1))
|
||||||
|
if cmake_version < '3.1.0':
|
||||||
|
raise RuntimeError("CMake >= 3.1.0 is required on Windows")
|
||||||
|
|
||||||
|
for ext in self.extensions:
|
||||||
|
self.build_extension(ext)
|
||||||
|
|
||||||
|
def build_extension(self, ext):
|
||||||
|
extdir = os.path.abspath(os.path.dirname(self.get_ext_fullpath(ext.name)))
|
||||||
|
python_include_dirs = distutils.sysconfig.get_python_inc()
|
||||||
|
python_lib_dirs = distutils.sysconfig.get_config_var('LIBDIR')
|
||||||
|
cmake_args = ['-DCMAKE_LIBRARY_OUTPUT_DIRECTORY=' + extdir,
|
||||||
|
'-DBUILD_EXAMPLES=OFF',
|
||||||
|
'-DBUILD_PYTHON_MODULE=ON',
|
||||||
|
'-DPYTHON_INCLUDE_DIRS=' + python_include_dirs]
|
||||||
|
|
||||||
|
cfg = 'Debug' if self.debug else 'Release'
|
||||||
|
build_args = ['--config', cfg]
|
||||||
|
|
||||||
|
if platform.system() == "Windows":
|
||||||
|
cmake_args += ['-DCMAKE_LIBRARY_OUTPUT_DIRECTORY_{}={}'.format(cfg.upper(), extdir)]
|
||||||
|
if sys.maxsize > 2**32:
|
||||||
|
cmake_args += ['-A', 'x64']
|
||||||
|
build_args += ['--', '/m']
|
||||||
|
else:
|
||||||
|
cmake_args += ['-DCMAKE_BUILD_TYPE=' + cfg]
|
||||||
|
build_args += ['--', '-j4']
|
||||||
|
|
||||||
|
env = os.environ.copy()
|
||||||
|
env['CXXFLAGS'] = '{} -DVERSION_INFO=\\"{}\\"'.format(env.get('CXXFLAGS', ''),
|
||||||
|
self.distribution.get_version())
|
||||||
|
if not os.path.exists(self.build_temp):
|
||||||
|
os.makedirs(self.build_temp)
|
||||||
|
sourcedir = os.path.abspath(os.path.join(os.path.dirname(__file__), os.pardir))
|
||||||
|
subprocess.check_call(['cmake', sourcedir] + cmake_args, cwd=self.build_temp, env=env)
|
||||||
|
subprocess.check_call(['cmake', '--build', '.'] + build_args, cwd=self.build_temp)
|
||||||
|
|
||||||
|
setup(
|
||||||
|
name='triton',
|
||||||
|
version='0.1',
|
||||||
|
author='Philippe Tillet',
|
||||||
|
author_email='ptillet@g.harvard.edu',
|
||||||
|
description='A language and compiler for custom Deep Learning operations',
|
||||||
|
long_description='',
|
||||||
|
ext_modules=[CMakeExtension('triton')],
|
||||||
|
cmdclass=dict(build_ext=CMakeBuild),
|
||||||
|
zip_safe=False,
|
||||||
|
)
|
493
python/src/pybind11/attr.h
Normal file
493
python/src/pybind11/attr.h
Normal file
@@ -0,0 +1,493 @@
|
|||||||
|
/*
|
||||||
|
pybind11/attr.h: Infrastructure for processing custom
|
||||||
|
type and function attributes
|
||||||
|
|
||||||
|
Copyright (c) 2016 Wenzel Jakob <wenzel.jakob@epfl.ch>
|
||||||
|
|
||||||
|
All rights reserved. Use of this source code is governed by a
|
||||||
|
BSD-style license that can be found in the LICENSE file.
|
||||||
|
*/
|
||||||
|
|
||||||
|
#pragma once
|
||||||
|
|
||||||
|
#include "cast.h"
|
||||||
|
|
||||||
|
NAMESPACE_BEGIN(PYBIND11_NAMESPACE)
|
||||||
|
|
||||||
|
/// \addtogroup annotations
|
||||||
|
/// @{
|
||||||
|
|
||||||
|
/// Annotation for methods
|
||||||
|
struct is_method { handle class_; is_method(const handle &c) : class_(c) { } };
|
||||||
|
|
||||||
|
/// Annotation for operators
|
||||||
|
struct is_operator { };
|
||||||
|
|
||||||
|
/// Annotation for parent scope
|
||||||
|
struct scope { handle value; scope(const handle &s) : value(s) { } };
|
||||||
|
|
||||||
|
/// Annotation for documentation
|
||||||
|
struct doc { const char *value; doc(const char *value) : value(value) { } };
|
||||||
|
|
||||||
|
/// Annotation for function names
|
||||||
|
struct name { const char *value; name(const char *value) : value(value) { } };
|
||||||
|
|
||||||
|
/// Annotation indicating that a function is an overload associated with a given "sibling"
|
||||||
|
struct sibling { handle value; sibling(const handle &value) : value(value.ptr()) { } };
|
||||||
|
|
||||||
|
/// Annotation indicating that a class derives from another given type
|
||||||
|
template <typename T> struct base {
|
||||||
|
PYBIND11_DEPRECATED("base<T>() was deprecated in favor of specifying 'T' as a template argument to class_")
|
||||||
|
base() { }
|
||||||
|
};
|
||||||
|
|
||||||
|
/// Keep patient alive while nurse lives
|
||||||
|
template <size_t Nurse, size_t Patient> struct keep_alive { };
|
||||||
|
|
||||||
|
/// Annotation indicating that a class is involved in a multiple inheritance relationship
|
||||||
|
struct multiple_inheritance { };
|
||||||
|
|
||||||
|
/// Annotation which enables dynamic attributes, i.e. adds `__dict__` to a class
|
||||||
|
struct dynamic_attr { };
|
||||||
|
|
||||||
|
/// Annotation which enables the buffer protocol for a type
|
||||||
|
struct buffer_protocol { };
|
||||||
|
|
||||||
|
/// Annotation which requests that a special metaclass is created for a type
|
||||||
|
struct metaclass {
|
||||||
|
handle value;
|
||||||
|
|
||||||
|
PYBIND11_DEPRECATED("py::metaclass() is no longer required. It's turned on by default now.")
|
||||||
|
metaclass() {}
|
||||||
|
|
||||||
|
/// Override pybind11's default metaclass
|
||||||
|
explicit metaclass(handle value) : value(value) { }
|
||||||
|
};
|
||||||
|
|
||||||
|
/// Annotation that marks a class as local to the module:
|
||||||
|
struct module_local { const bool value; constexpr module_local(bool v = true) : value(v) { } };
|
||||||
|
|
||||||
|
/// Annotation to mark enums as an arithmetic type
|
||||||
|
struct arithmetic { };
|
||||||
|
|
||||||
|
/** \rst
|
||||||
|
A call policy which places one or more guard variables (``Ts...``) around the function call.
|
||||||
|
|
||||||
|
For example, this definition:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
m.def("foo", foo, py::call_guard<T>());
|
||||||
|
|
||||||
|
is equivalent to the following pseudocode:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
m.def("foo", [](args...) {
|
||||||
|
T scope_guard;
|
||||||
|
return foo(args...); // forwarded arguments
|
||||||
|
});
|
||||||
|
\endrst */
|
||||||
|
template <typename... Ts> struct call_guard;
|
||||||
|
|
||||||
|
template <> struct call_guard<> { using type = detail::void_type; };
|
||||||
|
|
||||||
|
template <typename T>
|
||||||
|
struct call_guard<T> {
|
||||||
|
static_assert(std::is_default_constructible<T>::value,
|
||||||
|
"The guard type must be default constructible");
|
||||||
|
|
||||||
|
using type = T;
|
||||||
|
};
|
||||||
|
|
||||||
|
template <typename T, typename... Ts>
|
||||||
|
struct call_guard<T, Ts...> {
|
||||||
|
struct type {
|
||||||
|
T guard{}; // Compose multiple guard types with left-to-right default-constructor order
|
||||||
|
typename call_guard<Ts...>::type next{};
|
||||||
|
};
|
||||||
|
};
|
||||||
|
|
||||||
|
/// @} annotations
|
||||||
|
|
||||||
|
NAMESPACE_BEGIN(detail)
|
||||||
|
/* Forward declarations */
|
||||||
|
enum op_id : int;
|
||||||
|
enum op_type : int;
|
||||||
|
struct undefined_t;
|
||||||
|
template <op_id id, op_type ot, typename L = undefined_t, typename R = undefined_t> struct op_;
|
||||||
|
inline void keep_alive_impl(size_t Nurse, size_t Patient, function_call &call, handle ret);
|
||||||
|
|
||||||
|
/// Internal data structure which holds metadata about a keyword argument
|
||||||
|
struct argument_record {
|
||||||
|
const char *name; ///< Argument name
|
||||||
|
const char *descr; ///< Human-readable version of the argument value
|
||||||
|
handle value; ///< Associated Python object
|
||||||
|
bool convert : 1; ///< True if the argument is allowed to convert when loading
|
||||||
|
bool none : 1; ///< True if None is allowed when loading
|
||||||
|
|
||||||
|
argument_record(const char *name, const char *descr, handle value, bool convert, bool none)
|
||||||
|
: name(name), descr(descr), value(value), convert(convert), none(none) { }
|
||||||
|
};
|
||||||
|
|
||||||
|
/// Internal data structure which holds metadata about a bound function (signature, overloads, etc.)
|
||||||
|
struct function_record {
|
||||||
|
function_record()
|
||||||
|
: is_constructor(false), is_new_style_constructor(false), is_stateless(false),
|
||||||
|
is_operator(false), has_args(false), has_kwargs(false), is_method(false) { }
|
||||||
|
|
||||||
|
/// Function name
|
||||||
|
char *name = nullptr; /* why no C++ strings? They generate heavier code.. */
|
||||||
|
|
||||||
|
// User-specified documentation string
|
||||||
|
char *doc = nullptr;
|
||||||
|
|
||||||
|
/// Human-readable version of the function signature
|
||||||
|
char *signature = nullptr;
|
||||||
|
|
||||||
|
/// List of registered keyword arguments
|
||||||
|
std::vector<argument_record> args;
|
||||||
|
|
||||||
|
/// Pointer to lambda function which converts arguments and performs the actual call
|
||||||
|
handle (*impl) (function_call &) = nullptr;
|
||||||
|
|
||||||
|
/// Storage for the wrapped function pointer and captured data, if any
|
||||||
|
void *data[3] = { };
|
||||||
|
|
||||||
|
/// Pointer to custom destructor for 'data' (if needed)
|
||||||
|
void (*free_data) (function_record *ptr) = nullptr;
|
||||||
|
|
||||||
|
/// Return value policy associated with this function
|
||||||
|
return_value_policy policy = return_value_policy::automatic;
|
||||||
|
|
||||||
|
/// True if name == '__init__'
|
||||||
|
bool is_constructor : 1;
|
||||||
|
|
||||||
|
/// True if this is a new-style `__init__` defined in `detail/init.h`
|
||||||
|
bool is_new_style_constructor : 1;
|
||||||
|
|
||||||
|
/// True if this is a stateless function pointer
|
||||||
|
bool is_stateless : 1;
|
||||||
|
|
||||||
|
/// True if this is an operator (__add__), etc.
|
||||||
|
bool is_operator : 1;
|
||||||
|
|
||||||
|
/// True if the function has a '*args' argument
|
||||||
|
bool has_args : 1;
|
||||||
|
|
||||||
|
/// True if the function has a '**kwargs' argument
|
||||||
|
bool has_kwargs : 1;
|
||||||
|
|
||||||
|
/// True if this is a method
|
||||||
|
bool is_method : 1;
|
||||||
|
|
||||||
|
/// Number of arguments (including py::args and/or py::kwargs, if present)
|
||||||
|
std::uint16_t nargs;
|
||||||
|
|
||||||
|
/// Python method object
|
||||||
|
PyMethodDef *def = nullptr;
|
||||||
|
|
||||||
|
/// Python handle to the parent scope (a class or a module)
|
||||||
|
handle scope;
|
||||||
|
|
||||||
|
/// Python handle to the sibling function representing an overload chain
|
||||||
|
handle sibling;
|
||||||
|
|
||||||
|
/// Pointer to next overload
|
||||||
|
function_record *next = nullptr;
|
||||||
|
};
|
||||||
|
|
||||||
|
/// Special data structure which (temporarily) holds metadata about a bound class
|
||||||
|
struct type_record {
|
||||||
|
PYBIND11_NOINLINE type_record()
|
||||||
|
: multiple_inheritance(false), dynamic_attr(false), buffer_protocol(false),
|
||||||
|
default_holder(true), module_local(false) { }
|
||||||
|
|
||||||
|
/// Handle to the parent scope
|
||||||
|
handle scope;
|
||||||
|
|
||||||
|
/// Name of the class
|
||||||
|
const char *name = nullptr;
|
||||||
|
|
||||||
|
// Pointer to RTTI type_info data structure
|
||||||
|
const std::type_info *type = nullptr;
|
||||||
|
|
||||||
|
/// How large is the underlying C++ type?
|
||||||
|
size_t type_size = 0;
|
||||||
|
|
||||||
|
/// What is the alignment of the underlying C++ type?
|
||||||
|
size_t type_align = 0;
|
||||||
|
|
||||||
|
/// How large is the type's holder?
|
||||||
|
size_t holder_size = 0;
|
||||||
|
|
||||||
|
/// The global operator new can be overridden with a class-specific variant
|
||||||
|
void *(*operator_new)(size_t) = nullptr;
|
||||||
|
|
||||||
|
/// Function pointer to class_<..>::init_instance
|
||||||
|
void (*init_instance)(instance *, const void *) = nullptr;
|
||||||
|
|
||||||
|
/// Function pointer to class_<..>::dealloc
|
||||||
|
void (*dealloc)(detail::value_and_holder &) = nullptr;
|
||||||
|
|
||||||
|
/// List of base classes of the newly created type
|
||||||
|
list bases;
|
||||||
|
|
||||||
|
/// Optional docstring
|
||||||
|
const char *doc = nullptr;
|
||||||
|
|
||||||
|
/// Custom metaclass (optional)
|
||||||
|
handle metaclass;
|
||||||
|
|
||||||
|
/// Multiple inheritance marker
|
||||||
|
bool multiple_inheritance : 1;
|
||||||
|
|
||||||
|
/// Does the class manage a __dict__?
|
||||||
|
bool dynamic_attr : 1;
|
||||||
|
|
||||||
|
/// Does the class implement the buffer protocol?
|
||||||
|
bool buffer_protocol : 1;
|
||||||
|
|
||||||
|
/// Is the default (unique_ptr) holder type used?
|
||||||
|
bool default_holder : 1;
|
||||||
|
|
||||||
|
/// Is the class definition local to the module shared object?
|
||||||
|
bool module_local : 1;
|
||||||
|
|
||||||
|
PYBIND11_NOINLINE void add_base(const std::type_info &base, void *(*caster)(void *)) {
|
||||||
|
auto base_info = detail::get_type_info(base, false);
|
||||||
|
if (!base_info) {
|
||||||
|
std::string tname(base.name());
|
||||||
|
detail::clean_type_id(tname);
|
||||||
|
pybind11_fail("generic_type: type \"" + std::string(name) +
|
||||||
|
"\" referenced unknown base type \"" + tname + "\"");
|
||||||
|
}
|
||||||
|
|
||||||
|
if (default_holder != base_info->default_holder) {
|
||||||
|
std::string tname(base.name());
|
||||||
|
detail::clean_type_id(tname);
|
||||||
|
pybind11_fail("generic_type: type \"" + std::string(name) + "\" " +
|
||||||
|
(default_holder ? "does not have" : "has") +
|
||||||
|
" a non-default holder type while its base \"" + tname + "\" " +
|
||||||
|
(base_info->default_holder ? "does not" : "does"));
|
||||||
|
}
|
||||||
|
|
||||||
|
bases.append((PyObject *) base_info->type);
|
||||||
|
|
||||||
|
if (base_info->type->tp_dictoffset != 0)
|
||||||
|
dynamic_attr = true;
|
||||||
|
|
||||||
|
if (caster)
|
||||||
|
base_info->implicit_casts.emplace_back(type, caster);
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
inline function_call::function_call(const function_record &f, handle p) :
|
||||||
|
func(f), parent(p) {
|
||||||
|
args.reserve(f.nargs);
|
||||||
|
args_convert.reserve(f.nargs);
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Tag for a new-style `__init__` defined in `detail/init.h`
|
||||||
|
struct is_new_style_constructor { };
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Partial template specializations to process custom attributes provided to
|
||||||
|
* cpp_function_ and class_. These are either used to initialize the respective
|
||||||
|
* fields in the type_record and function_record data structures or executed at
|
||||||
|
* runtime to deal with custom call policies (e.g. keep_alive).
|
||||||
|
*/
|
||||||
|
template <typename T, typename SFINAE = void> struct process_attribute;
|
||||||
|
|
||||||
|
template <typename T> struct process_attribute_default {
|
||||||
|
/// Default implementation: do nothing
|
||||||
|
static void init(const T &, function_record *) { }
|
||||||
|
static void init(const T &, type_record *) { }
|
||||||
|
static void precall(function_call &) { }
|
||||||
|
static void postcall(function_call &, handle) { }
|
||||||
|
};
|
||||||
|
|
||||||
|
/// Process an attribute specifying the function's name
|
||||||
|
template <> struct process_attribute<name> : process_attribute_default<name> {
|
||||||
|
static void init(const name &n, function_record *r) { r->name = const_cast<char *>(n.value); }
|
||||||
|
};
|
||||||
|
|
||||||
|
/// Process an attribute specifying the function's docstring
|
||||||
|
template <> struct process_attribute<doc> : process_attribute_default<doc> {
|
||||||
|
static void init(const doc &n, function_record *r) { r->doc = const_cast<char *>(n.value); }
|
||||||
|
};
|
||||||
|
|
||||||
|
/// Process an attribute specifying the function's docstring (provided as a C-style string)
|
||||||
|
template <> struct process_attribute<const char *> : process_attribute_default<const char *> {
|
||||||
|
static void init(const char *d, function_record *r) { r->doc = const_cast<char *>(d); }
|
||||||
|
static void init(const char *d, type_record *r) { r->doc = const_cast<char *>(d); }
|
||||||
|
};
|
||||||
|
template <> struct process_attribute<char *> : process_attribute<const char *> { };
|
||||||
|
|
||||||
|
/// Process an attribute indicating the function's return value policy
|
||||||
|
template <> struct process_attribute<return_value_policy> : process_attribute_default<return_value_policy> {
|
||||||
|
static void init(const return_value_policy &p, function_record *r) { r->policy = p; }
|
||||||
|
};
|
||||||
|
|
||||||
|
/// Process an attribute which indicates that this is an overloaded function associated with a given sibling
|
||||||
|
template <> struct process_attribute<sibling> : process_attribute_default<sibling> {
|
||||||
|
static void init(const sibling &s, function_record *r) { r->sibling = s.value; }
|
||||||
|
};
|
||||||
|
|
||||||
|
/// Process an attribute which indicates that this function is a method
|
||||||
|
template <> struct process_attribute<is_method> : process_attribute_default<is_method> {
|
||||||
|
static void init(const is_method &s, function_record *r) { r->is_method = true; r->scope = s.class_; }
|
||||||
|
};
|
||||||
|
|
||||||
|
/// Process an attribute which indicates the parent scope of a method
|
||||||
|
template <> struct process_attribute<scope> : process_attribute_default<scope> {
|
||||||
|
static void init(const scope &s, function_record *r) { r->scope = s.value; }
|
||||||
|
};
|
||||||
|
|
||||||
|
/// Process an attribute which indicates that this function is an operator
|
||||||
|
template <> struct process_attribute<is_operator> : process_attribute_default<is_operator> {
|
||||||
|
static void init(const is_operator &, function_record *r) { r->is_operator = true; }
|
||||||
|
};
|
||||||
|
|
||||||
|
template <> struct process_attribute<is_new_style_constructor> : process_attribute_default<is_new_style_constructor> {
|
||||||
|
static void init(const is_new_style_constructor &, function_record *r) { r->is_new_style_constructor = true; }
|
||||||
|
};
|
||||||
|
|
||||||
|
/// Process a keyword argument attribute (*without* a default value)
|
||||||
|
template <> struct process_attribute<arg> : process_attribute_default<arg> {
|
||||||
|
static void init(const arg &a, function_record *r) {
|
||||||
|
if (r->is_method && r->args.empty())
|
||||||
|
r->args.emplace_back("self", nullptr, handle(), true /*convert*/, false /*none not allowed*/);
|
||||||
|
r->args.emplace_back(a.name, nullptr, handle(), !a.flag_noconvert, a.flag_none);
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
/// Process a keyword argument attribute (*with* a default value)
|
||||||
|
template <> struct process_attribute<arg_v> : process_attribute_default<arg_v> {
|
||||||
|
static void init(const arg_v &a, function_record *r) {
|
||||||
|
if (r->is_method && r->args.empty())
|
||||||
|
r->args.emplace_back("self", nullptr /*descr*/, handle() /*parent*/, true /*convert*/, false /*none not allowed*/);
|
||||||
|
|
||||||
|
if (!a.value) {
|
||||||
|
#if !defined(NDEBUG)
|
||||||
|
std::string descr("'");
|
||||||
|
if (a.name) descr += std::string(a.name) + ": ";
|
||||||
|
descr += a.type + "'";
|
||||||
|
if (r->is_method) {
|
||||||
|
if (r->name)
|
||||||
|
descr += " in method '" + (std::string) str(r->scope) + "." + (std::string) r->name + "'";
|
||||||
|
else
|
||||||
|
descr += " in method of '" + (std::string) str(r->scope) + "'";
|
||||||
|
} else if (r->name) {
|
||||||
|
descr += " in function '" + (std::string) r->name + "'";
|
||||||
|
}
|
||||||
|
pybind11_fail("arg(): could not convert default argument "
|
||||||
|
+ descr + " into a Python object (type not registered yet?)");
|
||||||
|
#else
|
||||||
|
pybind11_fail("arg(): could not convert default argument "
|
||||||
|
"into a Python object (type not registered yet?). "
|
||||||
|
"Compile in debug mode for more information.");
|
||||||
|
#endif
|
||||||
|
}
|
||||||
|
r->args.emplace_back(a.name, a.descr, a.value.inc_ref(), !a.flag_noconvert, a.flag_none);
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
/// Process a parent class attribute. Single inheritance only (class_ itself already guarantees that)
|
||||||
|
template <typename T>
|
||||||
|
struct process_attribute<T, enable_if_t<is_pyobject<T>::value>> : process_attribute_default<handle> {
|
||||||
|
static void init(const handle &h, type_record *r) { r->bases.append(h); }
|
||||||
|
};
|
||||||
|
|
||||||
|
/// Process a parent class attribute (deprecated, does not support multiple inheritance)
|
||||||
|
template <typename T>
|
||||||
|
struct process_attribute<base<T>> : process_attribute_default<base<T>> {
|
||||||
|
static void init(const base<T> &, type_record *r) { r->add_base(typeid(T), nullptr); }
|
||||||
|
};
|
||||||
|
|
||||||
|
/// Process a multiple inheritance attribute
|
||||||
|
template <>
|
||||||
|
struct process_attribute<multiple_inheritance> : process_attribute_default<multiple_inheritance> {
|
||||||
|
static void init(const multiple_inheritance &, type_record *r) { r->multiple_inheritance = true; }
|
||||||
|
};
|
||||||
|
|
||||||
|
template <>
|
||||||
|
struct process_attribute<dynamic_attr> : process_attribute_default<dynamic_attr> {
|
||||||
|
static void init(const dynamic_attr &, type_record *r) { r->dynamic_attr = true; }
|
||||||
|
};
|
||||||
|
|
||||||
|
template <>
|
||||||
|
struct process_attribute<buffer_protocol> : process_attribute_default<buffer_protocol> {
|
||||||
|
static void init(const buffer_protocol &, type_record *r) { r->buffer_protocol = true; }
|
||||||
|
};
|
||||||
|
|
||||||
|
template <>
|
||||||
|
struct process_attribute<metaclass> : process_attribute_default<metaclass> {
|
||||||
|
static void init(const metaclass &m, type_record *r) { r->metaclass = m.value; }
|
||||||
|
};
|
||||||
|
|
||||||
|
template <>
|
||||||
|
struct process_attribute<module_local> : process_attribute_default<module_local> {
|
||||||
|
static void init(const module_local &l, type_record *r) { r->module_local = l.value; }
|
||||||
|
};
|
||||||
|
|
||||||
|
/// Process an 'arithmetic' attribute for enums (does nothing here)
|
||||||
|
template <>
|
||||||
|
struct process_attribute<arithmetic> : process_attribute_default<arithmetic> {};
|
||||||
|
|
||||||
|
template <typename... Ts>
|
||||||
|
struct process_attribute<call_guard<Ts...>> : process_attribute_default<call_guard<Ts...>> { };
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Process a keep_alive call policy -- invokes keep_alive_impl during the
|
||||||
|
* pre-call handler if both Nurse, Patient != 0 and use the post-call handler
|
||||||
|
* otherwise
|
||||||
|
*/
|
||||||
|
template <size_t Nurse, size_t Patient> struct process_attribute<keep_alive<Nurse, Patient>> : public process_attribute_default<keep_alive<Nurse, Patient>> {
|
||||||
|
template <size_t N = Nurse, size_t P = Patient, enable_if_t<N != 0 && P != 0, int> = 0>
|
||||||
|
static void precall(function_call &call) { keep_alive_impl(Nurse, Patient, call, handle()); }
|
||||||
|
template <size_t N = Nurse, size_t P = Patient, enable_if_t<N != 0 && P != 0, int> = 0>
|
||||||
|
static void postcall(function_call &, handle) { }
|
||||||
|
template <size_t N = Nurse, size_t P = Patient, enable_if_t<N == 0 || P == 0, int> = 0>
|
||||||
|
static void precall(function_call &) { }
|
||||||
|
template <size_t N = Nurse, size_t P = Patient, enable_if_t<N == 0 || P == 0, int> = 0>
|
||||||
|
static void postcall(function_call &call, handle ret) { keep_alive_impl(Nurse, Patient, call, ret); }
|
||||||
|
};
|
||||||
|
|
||||||
|
/// Recursively iterate over variadic template arguments
|
||||||
|
template <typename... Args> struct process_attributes {
|
||||||
|
static void init(const Args&... args, function_record *r) {
|
||||||
|
int unused[] = { 0, (process_attribute<typename std::decay<Args>::type>::init(args, r), 0) ... };
|
||||||
|
ignore_unused(unused);
|
||||||
|
}
|
||||||
|
static void init(const Args&... args, type_record *r) {
|
||||||
|
int unused[] = { 0, (process_attribute<typename std::decay<Args>::type>::init(args, r), 0) ... };
|
||||||
|
ignore_unused(unused);
|
||||||
|
}
|
||||||
|
static void precall(function_call &call) {
|
||||||
|
int unused[] = { 0, (process_attribute<typename std::decay<Args>::type>::precall(call), 0) ... };
|
||||||
|
ignore_unused(unused);
|
||||||
|
}
|
||||||
|
static void postcall(function_call &call, handle fn_ret) {
|
||||||
|
int unused[] = { 0, (process_attribute<typename std::decay<Args>::type>::postcall(call, fn_ret), 0) ... };
|
||||||
|
ignore_unused(unused);
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
template <typename T>
|
||||||
|
using is_call_guard = is_instantiation<call_guard, T>;
|
||||||
|
|
||||||
|
/// Extract the ``type`` from the first `call_guard` in `Extras...` (or `void_type` if none found)
|
||||||
|
template <typename... Extra>
|
||||||
|
using extract_guard_t = typename exactly_one_t<is_call_guard, call_guard<>, Extra...>::type;
|
||||||
|
|
||||||
|
/// Check the number of named arguments at compile time
|
||||||
|
template <typename... Extra,
|
||||||
|
size_t named = constexpr_sum(std::is_base_of<arg, Extra>::value...),
|
||||||
|
size_t self = constexpr_sum(std::is_same<is_method, Extra>::value...)>
|
||||||
|
constexpr bool expected_num_args(size_t nargs, bool has_args, bool has_kwargs) {
|
||||||
|
return named == 0 || (self + named + has_args + has_kwargs) == nargs;
|
||||||
|
}
|
||||||
|
|
||||||
|
NAMESPACE_END(detail)
|
||||||
|
NAMESPACE_END(PYBIND11_NAMESPACE)
|
108
python/src/pybind11/buffer_info.h
Normal file
108
python/src/pybind11/buffer_info.h
Normal file
@@ -0,0 +1,108 @@
|
|||||||
|
/*
|
||||||
|
pybind11/buffer_info.h: Python buffer object interface
|
||||||
|
|
||||||
|
Copyright (c) 2016 Wenzel Jakob <wenzel.jakob@epfl.ch>
|
||||||
|
|
||||||
|
All rights reserved. Use of this source code is governed by a
|
||||||
|
BSD-style license that can be found in the LICENSE file.
|
||||||
|
*/
|
||||||
|
|
||||||
|
#pragma once
|
||||||
|
|
||||||
|
#include "detail/common.h"
|
||||||
|
|
||||||
|
NAMESPACE_BEGIN(PYBIND11_NAMESPACE)
|
||||||
|
|
||||||
|
/// Information record describing a Python buffer object
|
||||||
|
struct buffer_info {
|
||||||
|
void *ptr = nullptr; // Pointer to the underlying storage
|
||||||
|
ssize_t itemsize = 0; // Size of individual items in bytes
|
||||||
|
ssize_t size = 0; // Total number of entries
|
||||||
|
std::string format; // For homogeneous buffers, this should be set to format_descriptor<T>::format()
|
||||||
|
ssize_t ndim = 0; // Number of dimensions
|
||||||
|
std::vector<ssize_t> shape; // Shape of the tensor (1 entry per dimension)
|
||||||
|
std::vector<ssize_t> strides; // Number of entries between adjacent entries (for each per dimension)
|
||||||
|
|
||||||
|
buffer_info() { }
|
||||||
|
|
||||||
|
buffer_info(void *ptr, ssize_t itemsize, const std::string &format, ssize_t ndim,
|
||||||
|
detail::any_container<ssize_t> shape_in, detail::any_container<ssize_t> strides_in)
|
||||||
|
: ptr(ptr), itemsize(itemsize), size(1), format(format), ndim(ndim),
|
||||||
|
shape(std::move(shape_in)), strides(std::move(strides_in)) {
|
||||||
|
if (ndim != (ssize_t) shape.size() || ndim != (ssize_t) strides.size())
|
||||||
|
pybind11_fail("buffer_info: ndim doesn't match shape and/or strides length");
|
||||||
|
for (size_t i = 0; i < (size_t) ndim; ++i)
|
||||||
|
size *= shape[i];
|
||||||
|
}
|
||||||
|
|
||||||
|
template <typename T>
|
||||||
|
buffer_info(T *ptr, detail::any_container<ssize_t> shape_in, detail::any_container<ssize_t> strides_in)
|
||||||
|
: buffer_info(private_ctr_tag(), ptr, sizeof(T), format_descriptor<T>::format(), static_cast<ssize_t>(shape_in->size()), std::move(shape_in), std::move(strides_in)) { }
|
||||||
|
|
||||||
|
buffer_info(void *ptr, ssize_t itemsize, const std::string &format, ssize_t size)
|
||||||
|
: buffer_info(ptr, itemsize, format, 1, {size}, {itemsize}) { }
|
||||||
|
|
||||||
|
template <typename T>
|
||||||
|
buffer_info(T *ptr, ssize_t size)
|
||||||
|
: buffer_info(ptr, sizeof(T), format_descriptor<T>::format(), size) { }
|
||||||
|
|
||||||
|
explicit buffer_info(Py_buffer *view, bool ownview = true)
|
||||||
|
: buffer_info(view->buf, view->itemsize, view->format, view->ndim,
|
||||||
|
{view->shape, view->shape + view->ndim}, {view->strides, view->strides + view->ndim}) {
|
||||||
|
this->view = view;
|
||||||
|
this->ownview = ownview;
|
||||||
|
}
|
||||||
|
|
||||||
|
buffer_info(const buffer_info &) = delete;
|
||||||
|
buffer_info& operator=(const buffer_info &) = delete;
|
||||||
|
|
||||||
|
buffer_info(buffer_info &&other) {
|
||||||
|
(*this) = std::move(other);
|
||||||
|
}
|
||||||
|
|
||||||
|
buffer_info& operator=(buffer_info &&rhs) {
|
||||||
|
ptr = rhs.ptr;
|
||||||
|
itemsize = rhs.itemsize;
|
||||||
|
size = rhs.size;
|
||||||
|
format = std::move(rhs.format);
|
||||||
|
ndim = rhs.ndim;
|
||||||
|
shape = std::move(rhs.shape);
|
||||||
|
strides = std::move(rhs.strides);
|
||||||
|
std::swap(view, rhs.view);
|
||||||
|
std::swap(ownview, rhs.ownview);
|
||||||
|
return *this;
|
||||||
|
}
|
||||||
|
|
||||||
|
~buffer_info() {
|
||||||
|
if (view && ownview) { PyBuffer_Release(view); delete view; }
|
||||||
|
}
|
||||||
|
|
||||||
|
private:
|
||||||
|
struct private_ctr_tag { };
|
||||||
|
|
||||||
|
buffer_info(private_ctr_tag, void *ptr, ssize_t itemsize, const std::string &format, ssize_t ndim,
|
||||||
|
detail::any_container<ssize_t> &&shape_in, detail::any_container<ssize_t> &&strides_in)
|
||||||
|
: buffer_info(ptr, itemsize, format, ndim, std::move(shape_in), std::move(strides_in)) { }
|
||||||
|
|
||||||
|
Py_buffer *view = nullptr;
|
||||||
|
bool ownview = false;
|
||||||
|
};
|
||||||
|
|
||||||
|
NAMESPACE_BEGIN(detail)
|
||||||
|
|
||||||
|
template <typename T, typename SFINAE = void> struct compare_buffer_info {
|
||||||
|
static bool compare(const buffer_info& b) {
|
||||||
|
return b.format == format_descriptor<T>::format() && b.itemsize == (ssize_t) sizeof(T);
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
template <typename T> struct compare_buffer_info<T, detail::enable_if_t<std::is_integral<T>::value>> {
|
||||||
|
static bool compare(const buffer_info& b) {
|
||||||
|
return (size_t) b.itemsize == sizeof(T) && (b.format == format_descriptor<T>::value ||
|
||||||
|
((sizeof(T) == sizeof(long)) && b.format == (std::is_unsigned<T>::value ? "L" : "l")) ||
|
||||||
|
((sizeof(T) == sizeof(size_t)) && b.format == (std::is_unsigned<T>::value ? "N" : "n")));
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
NAMESPACE_END(detail)
|
||||||
|
NAMESPACE_END(PYBIND11_NAMESPACE)
|
2128
python/src/pybind11/cast.h
Normal file
2128
python/src/pybind11/cast.h
Normal file
File diff suppressed because it is too large
Load Diff
162
python/src/pybind11/chrono.h
Normal file
162
python/src/pybind11/chrono.h
Normal file
@@ -0,0 +1,162 @@
|
|||||||
|
/*
|
||||||
|
pybind11/chrono.h: Transparent conversion between std::chrono and python's datetime
|
||||||
|
|
||||||
|
Copyright (c) 2016 Trent Houliston <trent@houliston.me> and
|
||||||
|
Wenzel Jakob <wenzel.jakob@epfl.ch>
|
||||||
|
|
||||||
|
All rights reserved. Use of this source code is governed by a
|
||||||
|
BSD-style license that can be found in the LICENSE file.
|
||||||
|
*/
|
||||||
|
|
||||||
|
#pragma once
|
||||||
|
|
||||||
|
#include "pybind11.h"
|
||||||
|
#include <cmath>
|
||||||
|
#include <ctime>
|
||||||
|
#include <chrono>
|
||||||
|
#include <datetime.h>
|
||||||
|
|
||||||
|
// Backport the PyDateTime_DELTA functions from Python3.3 if required
|
||||||
|
#ifndef PyDateTime_DELTA_GET_DAYS
|
||||||
|
#define PyDateTime_DELTA_GET_DAYS(o) (((PyDateTime_Delta*)o)->days)
|
||||||
|
#endif
|
||||||
|
#ifndef PyDateTime_DELTA_GET_SECONDS
|
||||||
|
#define PyDateTime_DELTA_GET_SECONDS(o) (((PyDateTime_Delta*)o)->seconds)
|
||||||
|
#endif
|
||||||
|
#ifndef PyDateTime_DELTA_GET_MICROSECONDS
|
||||||
|
#define PyDateTime_DELTA_GET_MICROSECONDS(o) (((PyDateTime_Delta*)o)->microseconds)
|
||||||
|
#endif
|
||||||
|
|
||||||
|
NAMESPACE_BEGIN(PYBIND11_NAMESPACE)
|
||||||
|
NAMESPACE_BEGIN(detail)
|
||||||
|
|
||||||
|
template <typename type> class duration_caster {
|
||||||
|
public:
|
||||||
|
typedef typename type::rep rep;
|
||||||
|
typedef typename type::period period;
|
||||||
|
|
||||||
|
typedef std::chrono::duration<uint_fast32_t, std::ratio<86400>> days;
|
||||||
|
|
||||||
|
bool load(handle src, bool) {
|
||||||
|
using namespace std::chrono;
|
||||||
|
|
||||||
|
// Lazy initialise the PyDateTime import
|
||||||
|
if (!PyDateTimeAPI) { PyDateTime_IMPORT; }
|
||||||
|
|
||||||
|
if (!src) return false;
|
||||||
|
// If invoked with datetime.delta object
|
||||||
|
if (PyDelta_Check(src.ptr())) {
|
||||||
|
value = type(duration_cast<duration<rep, period>>(
|
||||||
|
days(PyDateTime_DELTA_GET_DAYS(src.ptr()))
|
||||||
|
+ seconds(PyDateTime_DELTA_GET_SECONDS(src.ptr()))
|
||||||
|
+ microseconds(PyDateTime_DELTA_GET_MICROSECONDS(src.ptr()))));
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
// If invoked with a float we assume it is seconds and convert
|
||||||
|
else if (PyFloat_Check(src.ptr())) {
|
||||||
|
value = type(duration_cast<duration<rep, period>>(duration<double>(PyFloat_AsDouble(src.ptr()))));
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
else return false;
|
||||||
|
}
|
||||||
|
|
||||||
|
// If this is a duration just return it back
|
||||||
|
static const std::chrono::duration<rep, period>& get_duration(const std::chrono::duration<rep, period> &src) {
|
||||||
|
return src;
|
||||||
|
}
|
||||||
|
|
||||||
|
// If this is a time_point get the time_since_epoch
|
||||||
|
template <typename Clock> static std::chrono::duration<rep, period> get_duration(const std::chrono::time_point<Clock, std::chrono::duration<rep, period>> &src) {
|
||||||
|
return src.time_since_epoch();
|
||||||
|
}
|
||||||
|
|
||||||
|
static handle cast(const type &src, return_value_policy /* policy */, handle /* parent */) {
|
||||||
|
using namespace std::chrono;
|
||||||
|
|
||||||
|
// Use overloaded function to get our duration from our source
|
||||||
|
// Works out if it is a duration or time_point and get the duration
|
||||||
|
auto d = get_duration(src);
|
||||||
|
|
||||||
|
// Lazy initialise the PyDateTime import
|
||||||
|
if (!PyDateTimeAPI) { PyDateTime_IMPORT; }
|
||||||
|
|
||||||
|
// Declare these special duration types so the conversions happen with the correct primitive types (int)
|
||||||
|
using dd_t = duration<int, std::ratio<86400>>;
|
||||||
|
using ss_t = duration<int, std::ratio<1>>;
|
||||||
|
using us_t = duration<int, std::micro>;
|
||||||
|
|
||||||
|
auto dd = duration_cast<dd_t>(d);
|
||||||
|
auto subd = d - dd;
|
||||||
|
auto ss = duration_cast<ss_t>(subd);
|
||||||
|
auto us = duration_cast<us_t>(subd - ss);
|
||||||
|
return PyDelta_FromDSU(dd.count(), ss.count(), us.count());
|
||||||
|
}
|
||||||
|
|
||||||
|
PYBIND11_TYPE_CASTER(type, _("datetime.timedelta"));
|
||||||
|
};
|
||||||
|
|
||||||
|
// This is for casting times on the system clock into datetime.datetime instances
|
||||||
|
template <typename Duration> class type_caster<std::chrono::time_point<std::chrono::system_clock, Duration>> {
|
||||||
|
public:
|
||||||
|
typedef std::chrono::time_point<std::chrono::system_clock, Duration> type;
|
||||||
|
bool load(handle src, bool) {
|
||||||
|
using namespace std::chrono;
|
||||||
|
|
||||||
|
// Lazy initialise the PyDateTime import
|
||||||
|
if (!PyDateTimeAPI) { PyDateTime_IMPORT; }
|
||||||
|
|
||||||
|
if (!src) return false;
|
||||||
|
if (PyDateTime_Check(src.ptr())) {
|
||||||
|
std::tm cal;
|
||||||
|
cal.tm_sec = PyDateTime_DATE_GET_SECOND(src.ptr());
|
||||||
|
cal.tm_min = PyDateTime_DATE_GET_MINUTE(src.ptr());
|
||||||
|
cal.tm_hour = PyDateTime_DATE_GET_HOUR(src.ptr());
|
||||||
|
cal.tm_mday = PyDateTime_GET_DAY(src.ptr());
|
||||||
|
cal.tm_mon = PyDateTime_GET_MONTH(src.ptr()) - 1;
|
||||||
|
cal.tm_year = PyDateTime_GET_YEAR(src.ptr()) - 1900;
|
||||||
|
cal.tm_isdst = -1;
|
||||||
|
|
||||||
|
value = system_clock::from_time_t(std::mktime(&cal)) + microseconds(PyDateTime_DATE_GET_MICROSECOND(src.ptr()));
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
else return false;
|
||||||
|
}
|
||||||
|
|
||||||
|
static handle cast(const std::chrono::time_point<std::chrono::system_clock, Duration> &src, return_value_policy /* policy */, handle /* parent */) {
|
||||||
|
using namespace std::chrono;
|
||||||
|
|
||||||
|
// Lazy initialise the PyDateTime import
|
||||||
|
if (!PyDateTimeAPI) { PyDateTime_IMPORT; }
|
||||||
|
|
||||||
|
std::time_t tt = system_clock::to_time_t(src);
|
||||||
|
// this function uses static memory so it's best to copy it out asap just in case
|
||||||
|
// otherwise other code that is using localtime may break this (not just python code)
|
||||||
|
std::tm localtime = *std::localtime(&tt);
|
||||||
|
|
||||||
|
// Declare these special duration types so the conversions happen with the correct primitive types (int)
|
||||||
|
using us_t = duration<int, std::micro>;
|
||||||
|
|
||||||
|
return PyDateTime_FromDateAndTime(localtime.tm_year + 1900,
|
||||||
|
localtime.tm_mon + 1,
|
||||||
|
localtime.tm_mday,
|
||||||
|
localtime.tm_hour,
|
||||||
|
localtime.tm_min,
|
||||||
|
localtime.tm_sec,
|
||||||
|
(duration_cast<us_t>(src.time_since_epoch() % seconds(1))).count());
|
||||||
|
}
|
||||||
|
PYBIND11_TYPE_CASTER(type, _("datetime.datetime"));
|
||||||
|
};
|
||||||
|
|
||||||
|
// Other clocks that are not the system clock are not measured as datetime.datetime objects
|
||||||
|
// since they are not measured on calendar time. So instead we just make them timedeltas
|
||||||
|
// Or if they have passed us a time as a float we convert that
|
||||||
|
template <typename Clock, typename Duration> class type_caster<std::chrono::time_point<Clock, Duration>>
|
||||||
|
: public duration_caster<std::chrono::time_point<Clock, Duration>> {
|
||||||
|
};
|
||||||
|
|
||||||
|
template <typename Rep, typename Period> class type_caster<std::chrono::duration<Rep, Period>>
|
||||||
|
: public duration_caster<std::chrono::duration<Rep, Period>> {
|
||||||
|
};
|
||||||
|
|
||||||
|
NAMESPACE_END(detail)
|
||||||
|
NAMESPACE_END(PYBIND11_NAMESPACE)
|
2
python/src/pybind11/common.h
Normal file
2
python/src/pybind11/common.h
Normal file
@@ -0,0 +1,2 @@
|
|||||||
|
#include "detail/common.h"
|
||||||
|
#warning "Including 'common.h' is deprecated. It will be removed in v3.0. Use 'pybind11.h'."
|
65
python/src/pybind11/complex.h
Normal file
65
python/src/pybind11/complex.h
Normal file
@@ -0,0 +1,65 @@
|
|||||||
|
/*
|
||||||
|
pybind11/complex.h: Complex number support
|
||||||
|
|
||||||
|
Copyright (c) 2016 Wenzel Jakob <wenzel.jakob@epfl.ch>
|
||||||
|
|
||||||
|
All rights reserved. Use of this source code is governed by a
|
||||||
|
BSD-style license that can be found in the LICENSE file.
|
||||||
|
*/
|
||||||
|
|
||||||
|
#pragma once
|
||||||
|
|
||||||
|
#include "pybind11.h"
|
||||||
|
#include <complex>
|
||||||
|
|
||||||
|
/// glibc defines I as a macro which breaks things, e.g., boost template names
|
||||||
|
#ifdef I
|
||||||
|
# undef I
|
||||||
|
#endif
|
||||||
|
|
||||||
|
NAMESPACE_BEGIN(PYBIND11_NAMESPACE)
|
||||||
|
|
||||||
|
template <typename T> struct format_descriptor<std::complex<T>, detail::enable_if_t<std::is_floating_point<T>::value>> {
|
||||||
|
static constexpr const char c = format_descriptor<T>::c;
|
||||||
|
static constexpr const char value[3] = { 'Z', c, '\0' };
|
||||||
|
static std::string format() { return std::string(value); }
|
||||||
|
};
|
||||||
|
|
||||||
|
#ifndef PYBIND11_CPP17
|
||||||
|
|
||||||
|
template <typename T> constexpr const char format_descriptor<
|
||||||
|
std::complex<T>, detail::enable_if_t<std::is_floating_point<T>::value>>::value[3];
|
||||||
|
|
||||||
|
#endif
|
||||||
|
|
||||||
|
NAMESPACE_BEGIN(detail)
|
||||||
|
|
||||||
|
template <typename T> struct is_fmt_numeric<std::complex<T>, detail::enable_if_t<std::is_floating_point<T>::value>> {
|
||||||
|
static constexpr bool value = true;
|
||||||
|
static constexpr int index = is_fmt_numeric<T>::index + 3;
|
||||||
|
};
|
||||||
|
|
||||||
|
template <typename T> class type_caster<std::complex<T>> {
|
||||||
|
public:
|
||||||
|
bool load(handle src, bool convert) {
|
||||||
|
if (!src)
|
||||||
|
return false;
|
||||||
|
if (!convert && !PyComplex_Check(src.ptr()))
|
||||||
|
return false;
|
||||||
|
Py_complex result = PyComplex_AsCComplex(src.ptr());
|
||||||
|
if (result.real == -1.0 && PyErr_Occurred()) {
|
||||||
|
PyErr_Clear();
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
value = std::complex<T>((T) result.real, (T) result.imag);
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
|
||||||
|
static handle cast(const std::complex<T> &src, return_value_policy /* policy */, handle /* parent */) {
|
||||||
|
return PyComplex_FromDoubles((double) src.real(), (double) src.imag());
|
||||||
|
}
|
||||||
|
|
||||||
|
PYBIND11_TYPE_CASTER(std::complex<T>, _("complex"));
|
||||||
|
};
|
||||||
|
NAMESPACE_END(detail)
|
||||||
|
NAMESPACE_END(PYBIND11_NAMESPACE)
|
623
python/src/pybind11/detail/class.h
Normal file
623
python/src/pybind11/detail/class.h
Normal file
@@ -0,0 +1,623 @@
|
|||||||
|
/*
|
||||||
|
pybind11/detail/class.h: Python C API implementation details for py::class_
|
||||||
|
|
||||||
|
Copyright (c) 2017 Wenzel Jakob <wenzel.jakob@epfl.ch>
|
||||||
|
|
||||||
|
All rights reserved. Use of this source code is governed by a
|
||||||
|
BSD-style license that can be found in the LICENSE file.
|
||||||
|
*/
|
||||||
|
|
||||||
|
#pragma once
|
||||||
|
|
||||||
|
#include "../attr.h"
|
||||||
|
#include "../options.h"
|
||||||
|
|
||||||
|
NAMESPACE_BEGIN(PYBIND11_NAMESPACE)
|
||||||
|
NAMESPACE_BEGIN(detail)
|
||||||
|
|
||||||
|
#if PY_VERSION_HEX >= 0x03030000
|
||||||
|
# define PYBIND11_BUILTIN_QUALNAME
|
||||||
|
# define PYBIND11_SET_OLDPY_QUALNAME(obj, nameobj)
|
||||||
|
#else
|
||||||
|
// In pre-3.3 Python, we still set __qualname__ so that we can produce reliable function type
|
||||||
|
// signatures; in 3.3+ this macro expands to nothing:
|
||||||
|
# define PYBIND11_SET_OLDPY_QUALNAME(obj, nameobj) setattr((PyObject *) obj, "__qualname__", nameobj)
|
||||||
|
#endif
|
||||||
|
|
||||||
|
inline PyTypeObject *type_incref(PyTypeObject *type) {
|
||||||
|
Py_INCREF(type);
|
||||||
|
return type;
|
||||||
|
}
|
||||||
|
|
||||||
|
#if !defined(PYPY_VERSION)
|
||||||
|
|
||||||
|
/// `pybind11_static_property.__get__()`: Always pass the class instead of the instance.
|
||||||
|
extern "C" inline PyObject *pybind11_static_get(PyObject *self, PyObject * /*ob*/, PyObject *cls) {
|
||||||
|
return PyProperty_Type.tp_descr_get(self, cls, cls);
|
||||||
|
}
|
||||||
|
|
||||||
|
/// `pybind11_static_property.__set__()`: Just like the above `__get__()`.
|
||||||
|
extern "C" inline int pybind11_static_set(PyObject *self, PyObject *obj, PyObject *value) {
|
||||||
|
PyObject *cls = PyType_Check(obj) ? obj : (PyObject *) Py_TYPE(obj);
|
||||||
|
return PyProperty_Type.tp_descr_set(self, cls, value);
|
||||||
|
}
|
||||||
|
|
||||||
|
/** A `static_property` is the same as a `property` but the `__get__()` and `__set__()`
|
||||||
|
methods are modified to always use the object type instead of a concrete instance.
|
||||||
|
Return value: New reference. */
|
||||||
|
inline PyTypeObject *make_static_property_type() {
|
||||||
|
constexpr auto *name = "pybind11_static_property";
|
||||||
|
auto name_obj = reinterpret_steal<object>(PYBIND11_FROM_STRING(name));
|
||||||
|
|
||||||
|
/* Danger zone: from now (and until PyType_Ready), make sure to
|
||||||
|
issue no Python C API calls which could potentially invoke the
|
||||||
|
garbage collector (the GC will call type_traverse(), which will in
|
||||||
|
turn find the newly constructed type in an invalid state) */
|
||||||
|
auto heap_type = (PyHeapTypeObject *) PyType_Type.tp_alloc(&PyType_Type, 0);
|
||||||
|
if (!heap_type)
|
||||||
|
pybind11_fail("make_static_property_type(): error allocating type!");
|
||||||
|
|
||||||
|
heap_type->ht_name = name_obj.inc_ref().ptr();
|
||||||
|
#ifdef PYBIND11_BUILTIN_QUALNAME
|
||||||
|
heap_type->ht_qualname = name_obj.inc_ref().ptr();
|
||||||
|
#endif
|
||||||
|
|
||||||
|
auto type = &heap_type->ht_type;
|
||||||
|
type->tp_name = name;
|
||||||
|
type->tp_base = type_incref(&PyProperty_Type);
|
||||||
|
type->tp_flags = Py_TPFLAGS_DEFAULT | Py_TPFLAGS_BASETYPE | Py_TPFLAGS_HEAPTYPE;
|
||||||
|
type->tp_descr_get = pybind11_static_get;
|
||||||
|
type->tp_descr_set = pybind11_static_set;
|
||||||
|
|
||||||
|
if (PyType_Ready(type) < 0)
|
||||||
|
pybind11_fail("make_static_property_type(): failure in PyType_Ready()!");
|
||||||
|
|
||||||
|
setattr((PyObject *) type, "__module__", str("pybind11_builtins"));
|
||||||
|
PYBIND11_SET_OLDPY_QUALNAME(type, name_obj);
|
||||||
|
|
||||||
|
return type;
|
||||||
|
}
|
||||||
|
|
||||||
|
#else // PYPY
|
||||||
|
|
||||||
|
/** PyPy has some issues with the above C API, so we evaluate Python code instead.
|
||||||
|
This function will only be called once so performance isn't really a concern.
|
||||||
|
Return value: New reference. */
|
||||||
|
inline PyTypeObject *make_static_property_type() {
|
||||||
|
auto d = dict();
|
||||||
|
PyObject *result = PyRun_String(R"(\
|
||||||
|
class pybind11_static_property(property):
|
||||||
|
def __get__(self, obj, cls):
|
||||||
|
return property.__get__(self, cls, cls)
|
||||||
|
|
||||||
|
def __set__(self, obj, value):
|
||||||
|
cls = obj if isinstance(obj, type) else type(obj)
|
||||||
|
property.__set__(self, cls, value)
|
||||||
|
)", Py_file_input, d.ptr(), d.ptr()
|
||||||
|
);
|
||||||
|
if (result == nullptr)
|
||||||
|
throw error_already_set();
|
||||||
|
Py_DECREF(result);
|
||||||
|
return (PyTypeObject *) d["pybind11_static_property"].cast<object>().release().ptr();
|
||||||
|
}
|
||||||
|
|
||||||
|
#endif // PYPY
|
||||||
|
|
||||||
|
/** Types with static properties need to handle `Type.static_prop = x` in a specific way.
|
||||||
|
By default, Python replaces the `static_property` itself, but for wrapped C++ types
|
||||||
|
we need to call `static_property.__set__()` in order to propagate the new value to
|
||||||
|
the underlying C++ data structure. */
|
||||||
|
extern "C" inline int pybind11_meta_setattro(PyObject* obj, PyObject* name, PyObject* value) {
|
||||||
|
// Use `_PyType_Lookup()` instead of `PyObject_GetAttr()` in order to get the raw
|
||||||
|
// descriptor (`property`) instead of calling `tp_descr_get` (`property.__get__()`).
|
||||||
|
PyObject *descr = _PyType_Lookup((PyTypeObject *) obj, name);
|
||||||
|
|
||||||
|
// The following assignment combinations are possible:
|
||||||
|
// 1. `Type.static_prop = value` --> descr_set: `Type.static_prop.__set__(value)`
|
||||||
|
// 2. `Type.static_prop = other_static_prop` --> setattro: replace existing `static_prop`
|
||||||
|
// 3. `Type.regular_attribute = value` --> setattro: regular attribute assignment
|
||||||
|
const auto static_prop = (PyObject *) get_internals().static_property_type;
|
||||||
|
const auto call_descr_set = descr && PyObject_IsInstance(descr, static_prop)
|
||||||
|
&& !PyObject_IsInstance(value, static_prop);
|
||||||
|
if (call_descr_set) {
|
||||||
|
// Call `static_property.__set__()` instead of replacing the `static_property`.
|
||||||
|
#if !defined(PYPY_VERSION)
|
||||||
|
return Py_TYPE(descr)->tp_descr_set(descr, obj, value);
|
||||||
|
#else
|
||||||
|
if (PyObject *result = PyObject_CallMethod(descr, "__set__", "OO", obj, value)) {
|
||||||
|
Py_DECREF(result);
|
||||||
|
return 0;
|
||||||
|
} else {
|
||||||
|
return -1;
|
||||||
|
}
|
||||||
|
#endif
|
||||||
|
} else {
|
||||||
|
// Replace existing attribute.
|
||||||
|
return PyType_Type.tp_setattro(obj, name, value);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#if PY_MAJOR_VERSION >= 3
|
||||||
|
/**
|
||||||
|
* Python 3's PyInstanceMethod_Type hides itself via its tp_descr_get, which prevents aliasing
|
||||||
|
* methods via cls.attr("m2") = cls.attr("m1"): instead the tp_descr_get returns a plain function,
|
||||||
|
* when called on a class, or a PyMethod, when called on an instance. Override that behaviour here
|
||||||
|
* to do a special case bypass for PyInstanceMethod_Types.
|
||||||
|
*/
|
||||||
|
extern "C" inline PyObject *pybind11_meta_getattro(PyObject *obj, PyObject *name) {
|
||||||
|
PyObject *descr = _PyType_Lookup((PyTypeObject *) obj, name);
|
||||||
|
if (descr && PyInstanceMethod_Check(descr)) {
|
||||||
|
Py_INCREF(descr);
|
||||||
|
return descr;
|
||||||
|
}
|
||||||
|
else {
|
||||||
|
return PyType_Type.tp_getattro(obj, name);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
#endif
|
||||||
|
|
||||||
|
/** This metaclass is assigned by default to all pybind11 types and is required in order
|
||||||
|
for static properties to function correctly. Users may override this using `py::metaclass`.
|
||||||
|
Return value: New reference. */
|
||||||
|
inline PyTypeObject* make_default_metaclass() {
|
||||||
|
constexpr auto *name = "pybind11_type";
|
||||||
|
auto name_obj = reinterpret_steal<object>(PYBIND11_FROM_STRING(name));
|
||||||
|
|
||||||
|
/* Danger zone: from now (and until PyType_Ready), make sure to
|
||||||
|
issue no Python C API calls which could potentially invoke the
|
||||||
|
garbage collector (the GC will call type_traverse(), which will in
|
||||||
|
turn find the newly constructed type in an invalid state) */
|
||||||
|
auto heap_type = (PyHeapTypeObject *) PyType_Type.tp_alloc(&PyType_Type, 0);
|
||||||
|
if (!heap_type)
|
||||||
|
pybind11_fail("make_default_metaclass(): error allocating metaclass!");
|
||||||
|
|
||||||
|
heap_type->ht_name = name_obj.inc_ref().ptr();
|
||||||
|
#ifdef PYBIND11_BUILTIN_QUALNAME
|
||||||
|
heap_type->ht_qualname = name_obj.inc_ref().ptr();
|
||||||
|
#endif
|
||||||
|
|
||||||
|
auto type = &heap_type->ht_type;
|
||||||
|
type->tp_name = name;
|
||||||
|
type->tp_base = type_incref(&PyType_Type);
|
||||||
|
type->tp_flags = Py_TPFLAGS_DEFAULT | Py_TPFLAGS_BASETYPE | Py_TPFLAGS_HEAPTYPE;
|
||||||
|
|
||||||
|
type->tp_setattro = pybind11_meta_setattro;
|
||||||
|
#if PY_MAJOR_VERSION >= 3
|
||||||
|
type->tp_getattro = pybind11_meta_getattro;
|
||||||
|
#endif
|
||||||
|
|
||||||
|
if (PyType_Ready(type) < 0)
|
||||||
|
pybind11_fail("make_default_metaclass(): failure in PyType_Ready()!");
|
||||||
|
|
||||||
|
setattr((PyObject *) type, "__module__", str("pybind11_builtins"));
|
||||||
|
PYBIND11_SET_OLDPY_QUALNAME(type, name_obj);
|
||||||
|
|
||||||
|
return type;
|
||||||
|
}
|
||||||
|
|
||||||
|
/// For multiple inheritance types we need to recursively register/deregister base pointers for any
|
||||||
|
/// base classes with pointers that are difference from the instance value pointer so that we can
|
||||||
|
/// correctly recognize an offset base class pointer. This calls a function with any offset base ptrs.
|
||||||
|
inline void traverse_offset_bases(void *valueptr, const detail::type_info *tinfo, instance *self,
|
||||||
|
bool (*f)(void * /*parentptr*/, instance * /*self*/)) {
|
||||||
|
for (handle h : reinterpret_borrow<tuple>(tinfo->type->tp_bases)) {
|
||||||
|
if (auto parent_tinfo = get_type_info((PyTypeObject *) h.ptr())) {
|
||||||
|
for (auto &c : parent_tinfo->implicit_casts) {
|
||||||
|
if (c.first == tinfo->cpptype) {
|
||||||
|
auto *parentptr = c.second(valueptr);
|
||||||
|
if (parentptr != valueptr)
|
||||||
|
f(parentptr, self);
|
||||||
|
traverse_offset_bases(parentptr, parent_tinfo, self, f);
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
inline bool register_instance_impl(void *ptr, instance *self) {
|
||||||
|
get_internals().registered_instances.emplace(ptr, self);
|
||||||
|
return true; // unused, but gives the same signature as the deregister func
|
||||||
|
}
|
||||||
|
inline bool deregister_instance_impl(void *ptr, instance *self) {
|
||||||
|
auto ®istered_instances = get_internals().registered_instances;
|
||||||
|
auto range = registered_instances.equal_range(ptr);
|
||||||
|
for (auto it = range.first; it != range.second; ++it) {
|
||||||
|
if (Py_TYPE(self) == Py_TYPE(it->second)) {
|
||||||
|
registered_instances.erase(it);
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
|
||||||
|
inline void register_instance(instance *self, void *valptr, const type_info *tinfo) {
|
||||||
|
register_instance_impl(valptr, self);
|
||||||
|
if (!tinfo->simple_ancestors)
|
||||||
|
traverse_offset_bases(valptr, tinfo, self, register_instance_impl);
|
||||||
|
}
|
||||||
|
|
||||||
|
inline bool deregister_instance(instance *self, void *valptr, const type_info *tinfo) {
|
||||||
|
bool ret = deregister_instance_impl(valptr, self);
|
||||||
|
if (!tinfo->simple_ancestors)
|
||||||
|
traverse_offset_bases(valptr, tinfo, self, deregister_instance_impl);
|
||||||
|
return ret;
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Instance creation function for all pybind11 types. It allocates the internal instance layout for
|
||||||
|
/// holding C++ objects and holders. Allocation is done lazily (the first time the instance is cast
|
||||||
|
/// to a reference or pointer), and initialization is done by an `__init__` function.
|
||||||
|
inline PyObject *make_new_instance(PyTypeObject *type) {
|
||||||
|
#if defined(PYPY_VERSION)
|
||||||
|
// PyPy gets tp_basicsize wrong (issue 2482) under multiple inheritance when the first inherited
|
||||||
|
// object is a a plain Python type (i.e. not derived from an extension type). Fix it.
|
||||||
|
ssize_t instance_size = static_cast<ssize_t>(sizeof(instance));
|
||||||
|
if (type->tp_basicsize < instance_size) {
|
||||||
|
type->tp_basicsize = instance_size;
|
||||||
|
}
|
||||||
|
#endif
|
||||||
|
PyObject *self = type->tp_alloc(type, 0);
|
||||||
|
auto inst = reinterpret_cast<instance *>(self);
|
||||||
|
// Allocate the value/holder internals:
|
||||||
|
inst->allocate_layout();
|
||||||
|
|
||||||
|
inst->owned = true;
|
||||||
|
|
||||||
|
return self;
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Instance creation function for all pybind11 types. It only allocates space for the
|
||||||
|
/// C++ object, but doesn't call the constructor -- an `__init__` function must do that.
|
||||||
|
extern "C" inline PyObject *pybind11_object_new(PyTypeObject *type, PyObject *, PyObject *) {
|
||||||
|
return make_new_instance(type);
|
||||||
|
}
|
||||||
|
|
||||||
|
/// An `__init__` function constructs the C++ object. Users should provide at least one
|
||||||
|
/// of these using `py::init` or directly with `.def(__init__, ...)`. Otherwise, the
|
||||||
|
/// following default function will be used which simply throws an exception.
|
||||||
|
extern "C" inline int pybind11_object_init(PyObject *self, PyObject *, PyObject *) {
|
||||||
|
PyTypeObject *type = Py_TYPE(self);
|
||||||
|
std::string msg;
|
||||||
|
#if defined(PYPY_VERSION)
|
||||||
|
msg += handle((PyObject *) type).attr("__module__").cast<std::string>() + ".";
|
||||||
|
#endif
|
||||||
|
msg += type->tp_name;
|
||||||
|
msg += ": No constructor defined!";
|
||||||
|
PyErr_SetString(PyExc_TypeError, msg.c_str());
|
||||||
|
return -1;
|
||||||
|
}
|
||||||
|
|
||||||
|
inline void add_patient(PyObject *nurse, PyObject *patient) {
|
||||||
|
auto &internals = get_internals();
|
||||||
|
auto instance = reinterpret_cast<detail::instance *>(nurse);
|
||||||
|
instance->has_patients = true;
|
||||||
|
Py_INCREF(patient);
|
||||||
|
internals.patients[nurse].push_back(patient);
|
||||||
|
}
|
||||||
|
|
||||||
|
inline void clear_patients(PyObject *self) {
|
||||||
|
auto instance = reinterpret_cast<detail::instance *>(self);
|
||||||
|
auto &internals = get_internals();
|
||||||
|
auto pos = internals.patients.find(self);
|
||||||
|
assert(pos != internals.patients.end());
|
||||||
|
// Clearing the patients can cause more Python code to run, which
|
||||||
|
// can invalidate the iterator. Extract the vector of patients
|
||||||
|
// from the unordered_map first.
|
||||||
|
auto patients = std::move(pos->second);
|
||||||
|
internals.patients.erase(pos);
|
||||||
|
instance->has_patients = false;
|
||||||
|
for (PyObject *&patient : patients)
|
||||||
|
Py_CLEAR(patient);
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Clears all internal data from the instance and removes it from registered instances in
|
||||||
|
/// preparation for deallocation.
|
||||||
|
inline void clear_instance(PyObject *self) {
|
||||||
|
auto instance = reinterpret_cast<detail::instance *>(self);
|
||||||
|
|
||||||
|
// Deallocate any values/holders, if present:
|
||||||
|
for (auto &v_h : values_and_holders(instance)) {
|
||||||
|
if (v_h) {
|
||||||
|
|
||||||
|
// We have to deregister before we call dealloc because, for virtual MI types, we still
|
||||||
|
// need to be able to get the parent pointers.
|
||||||
|
if (v_h.instance_registered() && !deregister_instance(instance, v_h.value_ptr(), v_h.type))
|
||||||
|
pybind11_fail("pybind11_object_dealloc(): Tried to deallocate unregistered instance!");
|
||||||
|
|
||||||
|
if (instance->owned || v_h.holder_constructed())
|
||||||
|
v_h.type->dealloc(v_h);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
// Deallocate the value/holder layout internals:
|
||||||
|
instance->deallocate_layout();
|
||||||
|
|
||||||
|
if (instance->weakrefs)
|
||||||
|
PyObject_ClearWeakRefs(self);
|
||||||
|
|
||||||
|
PyObject **dict_ptr = _PyObject_GetDictPtr(self);
|
||||||
|
if (dict_ptr)
|
||||||
|
Py_CLEAR(*dict_ptr);
|
||||||
|
|
||||||
|
if (instance->has_patients)
|
||||||
|
clear_patients(self);
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Instance destructor function for all pybind11 types. It calls `type_info.dealloc`
|
||||||
|
/// to destroy the C++ object itself, while the rest is Python bookkeeping.
|
||||||
|
extern "C" inline void pybind11_object_dealloc(PyObject *self) {
|
||||||
|
clear_instance(self);
|
||||||
|
|
||||||
|
auto type = Py_TYPE(self);
|
||||||
|
type->tp_free(self);
|
||||||
|
|
||||||
|
// `type->tp_dealloc != pybind11_object_dealloc` means that we're being called
|
||||||
|
// as part of a derived type's dealloc, in which case we're not allowed to decref
|
||||||
|
// the type here. For cross-module compatibility, we shouldn't compare directly
|
||||||
|
// with `pybind11_object_dealloc`, but with the common one stashed in internals.
|
||||||
|
auto pybind11_object_type = (PyTypeObject *) get_internals().instance_base;
|
||||||
|
if (type->tp_dealloc == pybind11_object_type->tp_dealloc)
|
||||||
|
Py_DECREF(type);
|
||||||
|
}
|
||||||
|
|
||||||
|
/** Create the type which can be used as a common base for all classes. This is
|
||||||
|
needed in order to satisfy Python's requirements for multiple inheritance.
|
||||||
|
Return value: New reference. */
|
||||||
|
inline PyObject *make_object_base_type(PyTypeObject *metaclass) {
|
||||||
|
constexpr auto *name = "pybind11_object";
|
||||||
|
auto name_obj = reinterpret_steal<object>(PYBIND11_FROM_STRING(name));
|
||||||
|
|
||||||
|
/* Danger zone: from now (and until PyType_Ready), make sure to
|
||||||
|
issue no Python C API calls which could potentially invoke the
|
||||||
|
garbage collector (the GC will call type_traverse(), which will in
|
||||||
|
turn find the newly constructed type in an invalid state) */
|
||||||
|
auto heap_type = (PyHeapTypeObject *) metaclass->tp_alloc(metaclass, 0);
|
||||||
|
if (!heap_type)
|
||||||
|
pybind11_fail("make_object_base_type(): error allocating type!");
|
||||||
|
|
||||||
|
heap_type->ht_name = name_obj.inc_ref().ptr();
|
||||||
|
#ifdef PYBIND11_BUILTIN_QUALNAME
|
||||||
|
heap_type->ht_qualname = name_obj.inc_ref().ptr();
|
||||||
|
#endif
|
||||||
|
|
||||||
|
auto type = &heap_type->ht_type;
|
||||||
|
type->tp_name = name;
|
||||||
|
type->tp_base = type_incref(&PyBaseObject_Type);
|
||||||
|
type->tp_basicsize = static_cast<ssize_t>(sizeof(instance));
|
||||||
|
type->tp_flags = Py_TPFLAGS_DEFAULT | Py_TPFLAGS_BASETYPE | Py_TPFLAGS_HEAPTYPE;
|
||||||
|
|
||||||
|
type->tp_new = pybind11_object_new;
|
||||||
|
type->tp_init = pybind11_object_init;
|
||||||
|
type->tp_dealloc = pybind11_object_dealloc;
|
||||||
|
|
||||||
|
/* Support weak references (needed for the keep_alive feature) */
|
||||||
|
type->tp_weaklistoffset = offsetof(instance, weakrefs);
|
||||||
|
|
||||||
|
if (PyType_Ready(type) < 0)
|
||||||
|
pybind11_fail("PyType_Ready failed in make_object_base_type():" + error_string());
|
||||||
|
|
||||||
|
setattr((PyObject *) type, "__module__", str("pybind11_builtins"));
|
||||||
|
PYBIND11_SET_OLDPY_QUALNAME(type, name_obj);
|
||||||
|
|
||||||
|
assert(!PyType_HasFeature(type, Py_TPFLAGS_HAVE_GC));
|
||||||
|
return (PyObject *) heap_type;
|
||||||
|
}
|
||||||
|
|
||||||
|
/// dynamic_attr: Support for `d = instance.__dict__`.
|
||||||
|
extern "C" inline PyObject *pybind11_get_dict(PyObject *self, void *) {
|
||||||
|
PyObject *&dict = *_PyObject_GetDictPtr(self);
|
||||||
|
if (!dict)
|
||||||
|
dict = PyDict_New();
|
||||||
|
Py_XINCREF(dict);
|
||||||
|
return dict;
|
||||||
|
}
|
||||||
|
|
||||||
|
/// dynamic_attr: Support for `instance.__dict__ = dict()`.
|
||||||
|
extern "C" inline int pybind11_set_dict(PyObject *self, PyObject *new_dict, void *) {
|
||||||
|
if (!PyDict_Check(new_dict)) {
|
||||||
|
PyErr_Format(PyExc_TypeError, "__dict__ must be set to a dictionary, not a '%.200s'",
|
||||||
|
Py_TYPE(new_dict)->tp_name);
|
||||||
|
return -1;
|
||||||
|
}
|
||||||
|
PyObject *&dict = *_PyObject_GetDictPtr(self);
|
||||||
|
Py_INCREF(new_dict);
|
||||||
|
Py_CLEAR(dict);
|
||||||
|
dict = new_dict;
|
||||||
|
return 0;
|
||||||
|
}
|
||||||
|
|
||||||
|
/// dynamic_attr: Allow the garbage collector to traverse the internal instance `__dict__`.
|
||||||
|
extern "C" inline int pybind11_traverse(PyObject *self, visitproc visit, void *arg) {
|
||||||
|
PyObject *&dict = *_PyObject_GetDictPtr(self);
|
||||||
|
Py_VISIT(dict);
|
||||||
|
return 0;
|
||||||
|
}
|
||||||
|
|
||||||
|
/// dynamic_attr: Allow the GC to clear the dictionary.
|
||||||
|
extern "C" inline int pybind11_clear(PyObject *self) {
|
||||||
|
PyObject *&dict = *_PyObject_GetDictPtr(self);
|
||||||
|
Py_CLEAR(dict);
|
||||||
|
return 0;
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Give instances of this type a `__dict__` and opt into garbage collection.
|
||||||
|
inline void enable_dynamic_attributes(PyHeapTypeObject *heap_type) {
|
||||||
|
auto type = &heap_type->ht_type;
|
||||||
|
#if defined(PYPY_VERSION)
|
||||||
|
pybind11_fail(std::string(type->tp_name) + ": dynamic attributes are "
|
||||||
|
"currently not supported in "
|
||||||
|
"conjunction with PyPy!");
|
||||||
|
#endif
|
||||||
|
type->tp_flags |= Py_TPFLAGS_HAVE_GC;
|
||||||
|
type->tp_dictoffset = type->tp_basicsize; // place dict at the end
|
||||||
|
type->tp_basicsize += (ssize_t)sizeof(PyObject *); // and allocate enough space for it
|
||||||
|
type->tp_traverse = pybind11_traverse;
|
||||||
|
type->tp_clear = pybind11_clear;
|
||||||
|
|
||||||
|
static PyGetSetDef getset[] = {
|
||||||
|
{const_cast<char*>("__dict__"), pybind11_get_dict, pybind11_set_dict, nullptr, nullptr},
|
||||||
|
{nullptr, nullptr, nullptr, nullptr, nullptr}
|
||||||
|
};
|
||||||
|
type->tp_getset = getset;
|
||||||
|
}
|
||||||
|
|
||||||
|
/// buffer_protocol: Fill in the view as specified by flags.
|
||||||
|
extern "C" inline int pybind11_getbuffer(PyObject *obj, Py_buffer *view, int flags) {
|
||||||
|
// Look for a `get_buffer` implementation in this type's info or any bases (following MRO).
|
||||||
|
type_info *tinfo = nullptr;
|
||||||
|
for (auto type : reinterpret_borrow<tuple>(Py_TYPE(obj)->tp_mro)) {
|
||||||
|
tinfo = get_type_info((PyTypeObject *) type.ptr());
|
||||||
|
if (tinfo && tinfo->get_buffer)
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
if (view == nullptr || !tinfo || !tinfo->get_buffer) {
|
||||||
|
if (view)
|
||||||
|
view->obj = nullptr;
|
||||||
|
PyErr_SetString(PyExc_BufferError, "pybind11_getbuffer(): Internal error");
|
||||||
|
return -1;
|
||||||
|
}
|
||||||
|
std::memset(view, 0, sizeof(Py_buffer));
|
||||||
|
buffer_info *info = tinfo->get_buffer(obj, tinfo->get_buffer_data);
|
||||||
|
view->obj = obj;
|
||||||
|
view->ndim = 1;
|
||||||
|
view->internal = info;
|
||||||
|
view->buf = info->ptr;
|
||||||
|
view->itemsize = info->itemsize;
|
||||||
|
view->len = view->itemsize;
|
||||||
|
for (auto s : info->shape)
|
||||||
|
view->len *= s;
|
||||||
|
if ((flags & PyBUF_FORMAT) == PyBUF_FORMAT)
|
||||||
|
view->format = const_cast<char *>(info->format.c_str());
|
||||||
|
if ((flags & PyBUF_STRIDES) == PyBUF_STRIDES) {
|
||||||
|
view->ndim = (int) info->ndim;
|
||||||
|
view->strides = &info->strides[0];
|
||||||
|
view->shape = &info->shape[0];
|
||||||
|
}
|
||||||
|
Py_INCREF(view->obj);
|
||||||
|
return 0;
|
||||||
|
}
|
||||||
|
|
||||||
|
/// buffer_protocol: Release the resources of the buffer.
|
||||||
|
extern "C" inline void pybind11_releasebuffer(PyObject *, Py_buffer *view) {
|
||||||
|
delete (buffer_info *) view->internal;
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Give this type a buffer interface.
|
||||||
|
inline void enable_buffer_protocol(PyHeapTypeObject *heap_type) {
|
||||||
|
heap_type->ht_type.tp_as_buffer = &heap_type->as_buffer;
|
||||||
|
#if PY_MAJOR_VERSION < 3
|
||||||
|
heap_type->ht_type.tp_flags |= Py_TPFLAGS_HAVE_NEWBUFFER;
|
||||||
|
#endif
|
||||||
|
|
||||||
|
heap_type->as_buffer.bf_getbuffer = pybind11_getbuffer;
|
||||||
|
heap_type->as_buffer.bf_releasebuffer = pybind11_releasebuffer;
|
||||||
|
}
|
||||||
|
|
||||||
|
/** Create a brand new Python type according to the `type_record` specification.
|
||||||
|
Return value: New reference. */
|
||||||
|
inline PyObject* make_new_python_type(const type_record &rec) {
|
||||||
|
auto name = reinterpret_steal<object>(PYBIND11_FROM_STRING(rec.name));
|
||||||
|
|
||||||
|
auto qualname = name;
|
||||||
|
if (rec.scope && !PyModule_Check(rec.scope.ptr()) && hasattr(rec.scope, "__qualname__")) {
|
||||||
|
#if PY_MAJOR_VERSION >= 3
|
||||||
|
qualname = reinterpret_steal<object>(
|
||||||
|
PyUnicode_FromFormat("%U.%U", rec.scope.attr("__qualname__").ptr(), name.ptr()));
|
||||||
|
#else
|
||||||
|
qualname = str(rec.scope.attr("__qualname__").cast<std::string>() + "." + rec.name);
|
||||||
|
#endif
|
||||||
|
}
|
||||||
|
|
||||||
|
object module;
|
||||||
|
if (rec.scope) {
|
||||||
|
if (hasattr(rec.scope, "__module__"))
|
||||||
|
module = rec.scope.attr("__module__");
|
||||||
|
else if (hasattr(rec.scope, "__name__"))
|
||||||
|
module = rec.scope.attr("__name__");
|
||||||
|
}
|
||||||
|
|
||||||
|
auto full_name = c_str(
|
||||||
|
#if !defined(PYPY_VERSION)
|
||||||
|
module ? str(module).cast<std::string>() + "." + rec.name :
|
||||||
|
#endif
|
||||||
|
rec.name);
|
||||||
|
|
||||||
|
char *tp_doc = nullptr;
|
||||||
|
if (rec.doc && options::show_user_defined_docstrings()) {
|
||||||
|
/* Allocate memory for docstring (using PyObject_MALLOC, since
|
||||||
|
Python will free this later on) */
|
||||||
|
size_t size = strlen(rec.doc) + 1;
|
||||||
|
tp_doc = (char *) PyObject_MALLOC(size);
|
||||||
|
memcpy((void *) tp_doc, rec.doc, size);
|
||||||
|
}
|
||||||
|
|
||||||
|
auto &internals = get_internals();
|
||||||
|
auto bases = tuple(rec.bases);
|
||||||
|
auto base = (bases.size() == 0) ? internals.instance_base
|
||||||
|
: bases[0].ptr();
|
||||||
|
|
||||||
|
/* Danger zone: from now (and until PyType_Ready), make sure to
|
||||||
|
issue no Python C API calls which could potentially invoke the
|
||||||
|
garbage collector (the GC will call type_traverse(), which will in
|
||||||
|
turn find the newly constructed type in an invalid state) */
|
||||||
|
auto metaclass = rec.metaclass.ptr() ? (PyTypeObject *) rec.metaclass.ptr()
|
||||||
|
: internals.default_metaclass;
|
||||||
|
|
||||||
|
auto heap_type = (PyHeapTypeObject *) metaclass->tp_alloc(metaclass, 0);
|
||||||
|
if (!heap_type)
|
||||||
|
pybind11_fail(std::string(rec.name) + ": Unable to create type object!");
|
||||||
|
|
||||||
|
heap_type->ht_name = name.release().ptr();
|
||||||
|
#ifdef PYBIND11_BUILTIN_QUALNAME
|
||||||
|
heap_type->ht_qualname = qualname.inc_ref().ptr();
|
||||||
|
#endif
|
||||||
|
|
||||||
|
auto type = &heap_type->ht_type;
|
||||||
|
type->tp_name = full_name;
|
||||||
|
type->tp_doc = tp_doc;
|
||||||
|
type->tp_base = type_incref((PyTypeObject *)base);
|
||||||
|
type->tp_basicsize = static_cast<ssize_t>(sizeof(instance));
|
||||||
|
if (bases.size() > 0)
|
||||||
|
type->tp_bases = bases.release().ptr();
|
||||||
|
|
||||||
|
/* Don't inherit base __init__ */
|
||||||
|
type->tp_init = pybind11_object_init;
|
||||||
|
|
||||||
|
/* Supported protocols */
|
||||||
|
type->tp_as_number = &heap_type->as_number;
|
||||||
|
type->tp_as_sequence = &heap_type->as_sequence;
|
||||||
|
type->tp_as_mapping = &heap_type->as_mapping;
|
||||||
|
|
||||||
|
/* Flags */
|
||||||
|
type->tp_flags |= Py_TPFLAGS_DEFAULT | Py_TPFLAGS_BASETYPE | Py_TPFLAGS_HEAPTYPE;
|
||||||
|
#if PY_MAJOR_VERSION < 3
|
||||||
|
type->tp_flags |= Py_TPFLAGS_CHECKTYPES;
|
||||||
|
#endif
|
||||||
|
|
||||||
|
if (rec.dynamic_attr)
|
||||||
|
enable_dynamic_attributes(heap_type);
|
||||||
|
|
||||||
|
if (rec.buffer_protocol)
|
||||||
|
enable_buffer_protocol(heap_type);
|
||||||
|
|
||||||
|
if (PyType_Ready(type) < 0)
|
||||||
|
pybind11_fail(std::string(rec.name) + ": PyType_Ready failed (" + error_string() + ")!");
|
||||||
|
|
||||||
|
assert(rec.dynamic_attr ? PyType_HasFeature(type, Py_TPFLAGS_HAVE_GC)
|
||||||
|
: !PyType_HasFeature(type, Py_TPFLAGS_HAVE_GC));
|
||||||
|
|
||||||
|
/* Register type with the parent scope */
|
||||||
|
if (rec.scope)
|
||||||
|
setattr(rec.scope, rec.name, (PyObject *) type);
|
||||||
|
else
|
||||||
|
Py_INCREF(type); // Keep it alive forever (reference leak)
|
||||||
|
|
||||||
|
if (module) // Needed by pydoc
|
||||||
|
setattr((PyObject *) type, "__module__", module);
|
||||||
|
|
||||||
|
PYBIND11_SET_OLDPY_QUALNAME(type, qualname);
|
||||||
|
|
||||||
|
return (PyObject *) type;
|
||||||
|
}
|
||||||
|
|
||||||
|
NAMESPACE_END(detail)
|
||||||
|
NAMESPACE_END(PYBIND11_NAMESPACE)
|
807
python/src/pybind11/detail/common.h
Normal file
807
python/src/pybind11/detail/common.h
Normal file
@@ -0,0 +1,807 @@
|
|||||||
|
/*
|
||||||
|
pybind11/detail/common.h -- Basic macros
|
||||||
|
|
||||||
|
Copyright (c) 2016 Wenzel Jakob <wenzel.jakob@epfl.ch>
|
||||||
|
|
||||||
|
All rights reserved. Use of this source code is governed by a
|
||||||
|
BSD-style license that can be found in the LICENSE file.
|
||||||
|
*/
|
||||||
|
|
||||||
|
#pragma once
|
||||||
|
|
||||||
|
#if !defined(NAMESPACE_BEGIN)
|
||||||
|
# define NAMESPACE_BEGIN(name) namespace name {
|
||||||
|
#endif
|
||||||
|
#if !defined(NAMESPACE_END)
|
||||||
|
# define NAMESPACE_END(name) }
|
||||||
|
#endif
|
||||||
|
|
||||||
|
// Robust support for some features and loading modules compiled against different pybind versions
|
||||||
|
// requires forcing hidden visibility on pybind code, so we enforce this by setting the attribute on
|
||||||
|
// the main `pybind11` namespace.
|
||||||
|
#if !defined(PYBIND11_NAMESPACE)
|
||||||
|
# ifdef __GNUG__
|
||||||
|
# define PYBIND11_NAMESPACE pybind11 __attribute__((visibility("hidden")))
|
||||||
|
# else
|
||||||
|
# define PYBIND11_NAMESPACE pybind11
|
||||||
|
# endif
|
||||||
|
#endif
|
||||||
|
|
||||||
|
#if !(defined(_MSC_VER) && __cplusplus == 199711L) && !defined(__INTEL_COMPILER)
|
||||||
|
# if __cplusplus >= 201402L
|
||||||
|
# define PYBIND11_CPP14
|
||||||
|
# if __cplusplus >= 201703L
|
||||||
|
# define PYBIND11_CPP17
|
||||||
|
# endif
|
||||||
|
# endif
|
||||||
|
#elif defined(_MSC_VER) && __cplusplus == 199711L
|
||||||
|
// MSVC sets _MSVC_LANG rather than __cplusplus (supposedly until the standard is fully implemented)
|
||||||
|
// Unless you use the /Zc:__cplusplus flag on Visual Studio 2017 15.7 Preview 3 or newer
|
||||||
|
# if _MSVC_LANG >= 201402L
|
||||||
|
# define PYBIND11_CPP14
|
||||||
|
# if _MSVC_LANG > 201402L && _MSC_VER >= 1910
|
||||||
|
# define PYBIND11_CPP17
|
||||||
|
# endif
|
||||||
|
# endif
|
||||||
|
#endif
|
||||||
|
|
||||||
|
// Compiler version assertions
|
||||||
|
#if defined(__INTEL_COMPILER)
|
||||||
|
# if __INTEL_COMPILER < 1700
|
||||||
|
# error pybind11 requires Intel C++ compiler v17 or newer
|
||||||
|
# endif
|
||||||
|
#elif defined(__clang__) && !defined(__apple_build_version__)
|
||||||
|
# if __clang_major__ < 3 || (__clang_major__ == 3 && __clang_minor__ < 3)
|
||||||
|
# error pybind11 requires clang 3.3 or newer
|
||||||
|
# endif
|
||||||
|
#elif defined(__clang__)
|
||||||
|
// Apple changes clang version macros to its Xcode version; the first Xcode release based on
|
||||||
|
// (upstream) clang 3.3 was Xcode 5:
|
||||||
|
# if __clang_major__ < 5
|
||||||
|
# error pybind11 requires Xcode/clang 5.0 or newer
|
||||||
|
# endif
|
||||||
|
#elif defined(__GNUG__)
|
||||||
|
# if __GNUC__ < 4 || (__GNUC__ == 4 && __GNUC_MINOR__ < 8)
|
||||||
|
# error pybind11 requires gcc 4.8 or newer
|
||||||
|
# endif
|
||||||
|
#elif defined(_MSC_VER)
|
||||||
|
// Pybind hits various compiler bugs in 2015u2 and earlier, and also makes use of some stl features
|
||||||
|
// (e.g. std::negation) added in 2015u3:
|
||||||
|
# if _MSC_FULL_VER < 190024210
|
||||||
|
# error pybind11 requires MSVC 2015 update 3 or newer
|
||||||
|
# endif
|
||||||
|
#endif
|
||||||
|
|
||||||
|
#if !defined(PYBIND11_EXPORT)
|
||||||
|
# if defined(WIN32) || defined(_WIN32)
|
||||||
|
# define PYBIND11_EXPORT __declspec(dllexport)
|
||||||
|
# else
|
||||||
|
# define PYBIND11_EXPORT __attribute__ ((visibility("default")))
|
||||||
|
# endif
|
||||||
|
#endif
|
||||||
|
|
||||||
|
#if defined(_MSC_VER)
|
||||||
|
# define PYBIND11_NOINLINE __declspec(noinline)
|
||||||
|
#else
|
||||||
|
# define PYBIND11_NOINLINE __attribute__ ((noinline))
|
||||||
|
#endif
|
||||||
|
|
||||||
|
#if defined(PYBIND11_CPP14)
|
||||||
|
# define PYBIND11_DEPRECATED(reason) [[deprecated(reason)]]
|
||||||
|
#else
|
||||||
|
# define PYBIND11_DEPRECATED(reason) __attribute__((deprecated(reason)))
|
||||||
|
#endif
|
||||||
|
|
||||||
|
#define PYBIND11_VERSION_MAJOR 2
|
||||||
|
#define PYBIND11_VERSION_MINOR 3
|
||||||
|
#define PYBIND11_VERSION_PATCH 0
|
||||||
|
|
||||||
|
/// Include Python header, disable linking to pythonX_d.lib on Windows in debug mode
|
||||||
|
#if defined(_MSC_VER)
|
||||||
|
# if (PY_MAJOR_VERSION == 3 && PY_MINOR_VERSION < 4)
|
||||||
|
# define HAVE_ROUND 1
|
||||||
|
# endif
|
||||||
|
# pragma warning(push)
|
||||||
|
# pragma warning(disable: 4510 4610 4512 4005)
|
||||||
|
# if defined(_DEBUG)
|
||||||
|
# define PYBIND11_DEBUG_MARKER
|
||||||
|
# undef _DEBUG
|
||||||
|
# endif
|
||||||
|
#endif
|
||||||
|
|
||||||
|
#include <Python.h>
|
||||||
|
#include <frameobject.h>
|
||||||
|
#include <pythread.h>
|
||||||
|
|
||||||
|
#if defined(_WIN32) && (defined(min) || defined(max))
|
||||||
|
# error Macro clash with min and max -- define NOMINMAX when compiling your program on Windows
|
||||||
|
#endif
|
||||||
|
|
||||||
|
#if defined(isalnum)
|
||||||
|
# undef isalnum
|
||||||
|
# undef isalpha
|
||||||
|
# undef islower
|
||||||
|
# undef isspace
|
||||||
|
# undef isupper
|
||||||
|
# undef tolower
|
||||||
|
# undef toupper
|
||||||
|
#endif
|
||||||
|
|
||||||
|
#if defined(_MSC_VER)
|
||||||
|
# if defined(PYBIND11_DEBUG_MARKER)
|
||||||
|
# define _DEBUG
|
||||||
|
# undef PYBIND11_DEBUG_MARKER
|
||||||
|
# endif
|
||||||
|
# pragma warning(pop)
|
||||||
|
#endif
|
||||||
|
|
||||||
|
#include <cstddef>
|
||||||
|
#include <cstring>
|
||||||
|
#include <forward_list>
|
||||||
|
#include <vector>
|
||||||
|
#include <string>
|
||||||
|
#include <stdexcept>
|
||||||
|
#include <unordered_set>
|
||||||
|
#include <unordered_map>
|
||||||
|
#include <memory>
|
||||||
|
#include <typeindex>
|
||||||
|
#include <type_traits>
|
||||||
|
|
||||||
|
#if PY_MAJOR_VERSION >= 3 /// Compatibility macros for various Python versions
|
||||||
|
#define PYBIND11_INSTANCE_METHOD_NEW(ptr, class_) PyInstanceMethod_New(ptr)
|
||||||
|
#define PYBIND11_INSTANCE_METHOD_CHECK PyInstanceMethod_Check
|
||||||
|
#define PYBIND11_INSTANCE_METHOD_GET_FUNCTION PyInstanceMethod_GET_FUNCTION
|
||||||
|
#define PYBIND11_BYTES_CHECK PyBytes_Check
|
||||||
|
#define PYBIND11_BYTES_FROM_STRING PyBytes_FromString
|
||||||
|
#define PYBIND11_BYTES_FROM_STRING_AND_SIZE PyBytes_FromStringAndSize
|
||||||
|
#define PYBIND11_BYTES_AS_STRING_AND_SIZE PyBytes_AsStringAndSize
|
||||||
|
#define PYBIND11_BYTES_AS_STRING PyBytes_AsString
|
||||||
|
#define PYBIND11_BYTES_SIZE PyBytes_Size
|
||||||
|
#define PYBIND11_LONG_CHECK(o) PyLong_Check(o)
|
||||||
|
#define PYBIND11_LONG_AS_LONGLONG(o) PyLong_AsLongLong(o)
|
||||||
|
#define PYBIND11_LONG_FROM_SIGNED(o) PyLong_FromSsize_t((ssize_t) o)
|
||||||
|
#define PYBIND11_LONG_FROM_UNSIGNED(o) PyLong_FromSize_t((size_t) o)
|
||||||
|
#define PYBIND11_BYTES_NAME "bytes"
|
||||||
|
#define PYBIND11_STRING_NAME "str"
|
||||||
|
#define PYBIND11_SLICE_OBJECT PyObject
|
||||||
|
#define PYBIND11_FROM_STRING PyUnicode_FromString
|
||||||
|
#define PYBIND11_STR_TYPE ::pybind11::str
|
||||||
|
#define PYBIND11_BOOL_ATTR "__bool__"
|
||||||
|
#define PYBIND11_NB_BOOL(ptr) ((ptr)->nb_bool)
|
||||||
|
#define PYBIND11_PLUGIN_IMPL(name) \
|
||||||
|
extern "C" PYBIND11_EXPORT PyObject *PyInit_##name()
|
||||||
|
|
||||||
|
#else
|
||||||
|
#define PYBIND11_INSTANCE_METHOD_NEW(ptr, class_) PyMethod_New(ptr, nullptr, class_)
|
||||||
|
#define PYBIND11_INSTANCE_METHOD_CHECK PyMethod_Check
|
||||||
|
#define PYBIND11_INSTANCE_METHOD_GET_FUNCTION PyMethod_GET_FUNCTION
|
||||||
|
#define PYBIND11_BYTES_CHECK PyString_Check
|
||||||
|
#define PYBIND11_BYTES_FROM_STRING PyString_FromString
|
||||||
|
#define PYBIND11_BYTES_FROM_STRING_AND_SIZE PyString_FromStringAndSize
|
||||||
|
#define PYBIND11_BYTES_AS_STRING_AND_SIZE PyString_AsStringAndSize
|
||||||
|
#define PYBIND11_BYTES_AS_STRING PyString_AsString
|
||||||
|
#define PYBIND11_BYTES_SIZE PyString_Size
|
||||||
|
#define PYBIND11_LONG_CHECK(o) (PyInt_Check(o) || PyLong_Check(o))
|
||||||
|
#define PYBIND11_LONG_AS_LONGLONG(o) (PyInt_Check(o) ? (long long) PyLong_AsLong(o) : PyLong_AsLongLong(o))
|
||||||
|
#define PYBIND11_LONG_FROM_SIGNED(o) PyInt_FromSsize_t((ssize_t) o) // Returns long if needed.
|
||||||
|
#define PYBIND11_LONG_FROM_UNSIGNED(o) PyInt_FromSize_t((size_t) o) // Returns long if needed.
|
||||||
|
#define PYBIND11_BYTES_NAME "str"
|
||||||
|
#define PYBIND11_STRING_NAME "unicode"
|
||||||
|
#define PYBIND11_SLICE_OBJECT PySliceObject
|
||||||
|
#define PYBIND11_FROM_STRING PyString_FromString
|
||||||
|
#define PYBIND11_STR_TYPE ::pybind11::bytes
|
||||||
|
#define PYBIND11_BOOL_ATTR "__nonzero__"
|
||||||
|
#define PYBIND11_NB_BOOL(ptr) ((ptr)->nb_nonzero)
|
||||||
|
#define PYBIND11_PLUGIN_IMPL(name) \
|
||||||
|
static PyObject *pybind11_init_wrapper(); \
|
||||||
|
extern "C" PYBIND11_EXPORT void init##name() { \
|
||||||
|
(void)pybind11_init_wrapper(); \
|
||||||
|
} \
|
||||||
|
PyObject *pybind11_init_wrapper()
|
||||||
|
#endif
|
||||||
|
|
||||||
|
#if PY_VERSION_HEX >= 0x03050000 && PY_VERSION_HEX < 0x03050200
|
||||||
|
extern "C" {
|
||||||
|
struct _Py_atomic_address { void *value; };
|
||||||
|
PyAPI_DATA(_Py_atomic_address) _PyThreadState_Current;
|
||||||
|
}
|
||||||
|
#endif
|
||||||
|
|
||||||
|
#define PYBIND11_TRY_NEXT_OVERLOAD ((PyObject *) 1) // special failure return code
|
||||||
|
#define PYBIND11_STRINGIFY(x) #x
|
||||||
|
#define PYBIND11_TOSTRING(x) PYBIND11_STRINGIFY(x)
|
||||||
|
#define PYBIND11_CONCAT(first, second) first##second
|
||||||
|
|
||||||
|
#define PYBIND11_CHECK_PYTHON_VERSION \
|
||||||
|
{ \
|
||||||
|
const char *compiled_ver = PYBIND11_TOSTRING(PY_MAJOR_VERSION) \
|
||||||
|
"." PYBIND11_TOSTRING(PY_MINOR_VERSION); \
|
||||||
|
const char *runtime_ver = Py_GetVersion(); \
|
||||||
|
size_t len = std::strlen(compiled_ver); \
|
||||||
|
if (std::strncmp(runtime_ver, compiled_ver, len) != 0 \
|
||||||
|
|| (runtime_ver[len] >= '0' && runtime_ver[len] <= '9')) { \
|
||||||
|
PyErr_Format(PyExc_ImportError, \
|
||||||
|
"Python version mismatch: module was compiled for Python %s, " \
|
||||||
|
"but the interpreter version is incompatible: %s.", \
|
||||||
|
compiled_ver, runtime_ver); \
|
||||||
|
return nullptr; \
|
||||||
|
} \
|
||||||
|
}
|
||||||
|
|
||||||
|
#define PYBIND11_CATCH_INIT_EXCEPTIONS \
|
||||||
|
catch (pybind11::error_already_set &e) { \
|
||||||
|
PyErr_SetString(PyExc_ImportError, e.what()); \
|
||||||
|
return nullptr; \
|
||||||
|
} catch (const std::exception &e) { \
|
||||||
|
PyErr_SetString(PyExc_ImportError, e.what()); \
|
||||||
|
return nullptr; \
|
||||||
|
} \
|
||||||
|
|
||||||
|
/** \rst
|
||||||
|
***Deprecated in favor of PYBIND11_MODULE***
|
||||||
|
|
||||||
|
This macro creates the entry point that will be invoked when the Python interpreter
|
||||||
|
imports a plugin library. Please create a `module` in the function body and return
|
||||||
|
the pointer to its underlying Python object at the end.
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
PYBIND11_PLUGIN(example) {
|
||||||
|
pybind11::module m("example", "pybind11 example plugin");
|
||||||
|
/// Set up bindings here
|
||||||
|
return m.ptr();
|
||||||
|
}
|
||||||
|
\endrst */
|
||||||
|
#define PYBIND11_PLUGIN(name) \
|
||||||
|
PYBIND11_DEPRECATED("PYBIND11_PLUGIN is deprecated, use PYBIND11_MODULE") \
|
||||||
|
static PyObject *pybind11_init(); \
|
||||||
|
PYBIND11_PLUGIN_IMPL(name) { \
|
||||||
|
PYBIND11_CHECK_PYTHON_VERSION \
|
||||||
|
try { \
|
||||||
|
return pybind11_init(); \
|
||||||
|
} PYBIND11_CATCH_INIT_EXCEPTIONS \
|
||||||
|
} \
|
||||||
|
PyObject *pybind11_init()
|
||||||
|
|
||||||
|
/** \rst
|
||||||
|
This macro creates the entry point that will be invoked when the Python interpreter
|
||||||
|
imports an extension module. The module name is given as the fist argument and it
|
||||||
|
should not be in quotes. The second macro argument defines a variable of type
|
||||||
|
`py::module` which can be used to initialize the module.
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
PYBIND11_MODULE(example, m) {
|
||||||
|
m.doc() = "pybind11 example module";
|
||||||
|
|
||||||
|
// Add bindings here
|
||||||
|
m.def("foo", []() {
|
||||||
|
return "Hello, World!";
|
||||||
|
});
|
||||||
|
}
|
||||||
|
\endrst */
|
||||||
|
#define PYBIND11_MODULE(name, variable) \
|
||||||
|
static void PYBIND11_CONCAT(pybind11_init_, name)(pybind11::module &); \
|
||||||
|
PYBIND11_PLUGIN_IMPL(name) { \
|
||||||
|
PYBIND11_CHECK_PYTHON_VERSION \
|
||||||
|
auto m = pybind11::module(PYBIND11_TOSTRING(name)); \
|
||||||
|
try { \
|
||||||
|
PYBIND11_CONCAT(pybind11_init_, name)(m); \
|
||||||
|
return m.ptr(); \
|
||||||
|
} PYBIND11_CATCH_INIT_EXCEPTIONS \
|
||||||
|
} \
|
||||||
|
void PYBIND11_CONCAT(pybind11_init_, name)(pybind11::module &variable)
|
||||||
|
|
||||||
|
|
||||||
|
NAMESPACE_BEGIN(PYBIND11_NAMESPACE)
|
||||||
|
|
||||||
|
using ssize_t = Py_ssize_t;
|
||||||
|
using size_t = std::size_t;
|
||||||
|
|
||||||
|
/// Approach used to cast a previously unknown C++ instance into a Python object
|
||||||
|
enum class return_value_policy : uint8_t {
|
||||||
|
/** This is the default return value policy, which falls back to the policy
|
||||||
|
return_value_policy::take_ownership when the return value is a pointer.
|
||||||
|
Otherwise, it uses return_value::move or return_value::copy for rvalue
|
||||||
|
and lvalue references, respectively. See below for a description of what
|
||||||
|
all of these different policies do. */
|
||||||
|
automatic = 0,
|
||||||
|
|
||||||
|
/** As above, but use policy return_value_policy::reference when the return
|
||||||
|
value is a pointer. This is the default conversion policy for function
|
||||||
|
arguments when calling Python functions manually from C++ code (i.e. via
|
||||||
|
handle::operator()). You probably won't need to use this. */
|
||||||
|
automatic_reference,
|
||||||
|
|
||||||
|
/** Reference an existing object (i.e. do not create a new copy) and take
|
||||||
|
ownership. Python will call the destructor and delete operator when the
|
||||||
|
object’s reference count reaches zero. Undefined behavior ensues when
|
||||||
|
the C++ side does the same.. */
|
||||||
|
take_ownership,
|
||||||
|
|
||||||
|
/** Create a new copy of the returned object, which will be owned by
|
||||||
|
Python. This policy is comparably safe because the lifetimes of the two
|
||||||
|
instances are decoupled. */
|
||||||
|
copy,
|
||||||
|
|
||||||
|
/** Use std::move to move the return value contents into a new instance
|
||||||
|
that will be owned by Python. This policy is comparably safe because the
|
||||||
|
lifetimes of the two instances (move source and destination) are
|
||||||
|
decoupled. */
|
||||||
|
move,
|
||||||
|
|
||||||
|
/** Reference an existing object, but do not take ownership. The C++ side
|
||||||
|
is responsible for managing the object’s lifetime and deallocating it
|
||||||
|
when it is no longer used. Warning: undefined behavior will ensue when
|
||||||
|
the C++ side deletes an object that is still referenced and used by
|
||||||
|
Python. */
|
||||||
|
reference,
|
||||||
|
|
||||||
|
/** This policy only applies to methods and properties. It references the
|
||||||
|
object without taking ownership similar to the above
|
||||||
|
return_value_policy::reference policy. In contrast to that policy, the
|
||||||
|
function or property’s implicit this argument (called the parent) is
|
||||||
|
considered to be the the owner of the return value (the child).
|
||||||
|
pybind11 then couples the lifetime of the parent to the child via a
|
||||||
|
reference relationship that ensures that the parent cannot be garbage
|
||||||
|
collected while Python is still using the child. More advanced
|
||||||
|
variations of this scheme are also possible using combinations of
|
||||||
|
return_value_policy::reference and the keep_alive call policy */
|
||||||
|
reference_internal
|
||||||
|
};
|
||||||
|
|
||||||
|
NAMESPACE_BEGIN(detail)
|
||||||
|
|
||||||
|
inline static constexpr int log2(size_t n, int k = 0) { return (n <= 1) ? k : log2(n >> 1, k + 1); }
|
||||||
|
|
||||||
|
// Returns the size as a multiple of sizeof(void *), rounded up.
|
||||||
|
inline static constexpr size_t size_in_ptrs(size_t s) { return 1 + ((s - 1) >> log2(sizeof(void *))); }
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The space to allocate for simple layout instance holders (see below) in multiple of the size of
|
||||||
|
* a pointer (e.g. 2 means 16 bytes on 64-bit architectures). The default is the minimum required
|
||||||
|
* to holder either a std::unique_ptr or std::shared_ptr (which is almost always
|
||||||
|
* sizeof(std::shared_ptr<T>)).
|
||||||
|
*/
|
||||||
|
constexpr size_t instance_simple_holder_in_ptrs() {
|
||||||
|
static_assert(sizeof(std::shared_ptr<int>) >= sizeof(std::unique_ptr<int>),
|
||||||
|
"pybind assumes std::shared_ptrs are at least as big as std::unique_ptrs");
|
||||||
|
return size_in_ptrs(sizeof(std::shared_ptr<int>));
|
||||||
|
}
|
||||||
|
|
||||||
|
// Forward declarations
|
||||||
|
struct type_info;
|
||||||
|
struct value_and_holder;
|
||||||
|
|
||||||
|
struct nonsimple_values_and_holders {
|
||||||
|
void **values_and_holders;
|
||||||
|
uint8_t *status;
|
||||||
|
};
|
||||||
|
|
||||||
|
/// The 'instance' type which needs to be standard layout (need to be able to use 'offsetof')
|
||||||
|
struct instance {
|
||||||
|
PyObject_HEAD
|
||||||
|
/// Storage for pointers and holder; see simple_layout, below, for a description
|
||||||
|
union {
|
||||||
|
void *simple_value_holder[1 + instance_simple_holder_in_ptrs()];
|
||||||
|
nonsimple_values_and_holders nonsimple;
|
||||||
|
};
|
||||||
|
/// Weak references
|
||||||
|
PyObject *weakrefs;
|
||||||
|
/// If true, the pointer is owned which means we're free to manage it with a holder.
|
||||||
|
bool owned : 1;
|
||||||
|
/**
|
||||||
|
* An instance has two possible value/holder layouts.
|
||||||
|
*
|
||||||
|
* Simple layout (when this flag is true), means the `simple_value_holder` is set with a pointer
|
||||||
|
* and the holder object governing that pointer, i.e. [val1*][holder]. This layout is applied
|
||||||
|
* whenever there is no python-side multiple inheritance of bound C++ types *and* the type's
|
||||||
|
* holder will fit in the default space (which is large enough to hold either a std::unique_ptr
|
||||||
|
* or std::shared_ptr).
|
||||||
|
*
|
||||||
|
* Non-simple layout applies when using custom holders that require more space than `shared_ptr`
|
||||||
|
* (which is typically the size of two pointers), or when multiple inheritance is used on the
|
||||||
|
* python side. Non-simple layout allocates the required amount of memory to have multiple
|
||||||
|
* bound C++ classes as parents. Under this layout, `nonsimple.values_and_holders` is set to a
|
||||||
|
* pointer to allocated space of the required space to hold a sequence of value pointers and
|
||||||
|
* holders followed `status`, a set of bit flags (1 byte each), i.e.
|
||||||
|
* [val1*][holder1][val2*][holder2]...[bb...] where each [block] is rounded up to a multiple of
|
||||||
|
* `sizeof(void *)`. `nonsimple.status` is, for convenience, a pointer to the
|
||||||
|
* beginning of the [bb...] block (but not independently allocated).
|
||||||
|
*
|
||||||
|
* Status bits indicate whether the associated holder is constructed (&
|
||||||
|
* status_holder_constructed) and whether the value pointer is registered (&
|
||||||
|
* status_instance_registered) in `registered_instances`.
|
||||||
|
*/
|
||||||
|
bool simple_layout : 1;
|
||||||
|
/// For simple layout, tracks whether the holder has been constructed
|
||||||
|
bool simple_holder_constructed : 1;
|
||||||
|
/// For simple layout, tracks whether the instance is registered in `registered_instances`
|
||||||
|
bool simple_instance_registered : 1;
|
||||||
|
/// If true, get_internals().patients has an entry for this object
|
||||||
|
bool has_patients : 1;
|
||||||
|
|
||||||
|
/// Initializes all of the above type/values/holders data (but not the instance values themselves)
|
||||||
|
void allocate_layout();
|
||||||
|
|
||||||
|
/// Destroys/deallocates all of the above
|
||||||
|
void deallocate_layout();
|
||||||
|
|
||||||
|
/// Returns the value_and_holder wrapper for the given type (or the first, if `find_type`
|
||||||
|
/// omitted). Returns a default-constructed (with `.inst = nullptr`) object on failure if
|
||||||
|
/// `throw_if_missing` is false.
|
||||||
|
value_and_holder get_value_and_holder(const type_info *find_type = nullptr, bool throw_if_missing = true);
|
||||||
|
|
||||||
|
/// Bit values for the non-simple status flags
|
||||||
|
static constexpr uint8_t status_holder_constructed = 1;
|
||||||
|
static constexpr uint8_t status_instance_registered = 2;
|
||||||
|
};
|
||||||
|
|
||||||
|
static_assert(std::is_standard_layout<instance>::value, "Internal error: `pybind11::detail::instance` is not standard layout!");
|
||||||
|
|
||||||
|
/// from __cpp_future__ import (convenient aliases from C++14/17)
|
||||||
|
#if defined(PYBIND11_CPP14) && (!defined(_MSC_VER) || _MSC_VER >= 1910)
|
||||||
|
using std::enable_if_t;
|
||||||
|
using std::conditional_t;
|
||||||
|
using std::remove_cv_t;
|
||||||
|
using std::remove_reference_t;
|
||||||
|
#else
|
||||||
|
template <bool B, typename T = void> using enable_if_t = typename std::enable_if<B, T>::type;
|
||||||
|
template <bool B, typename T, typename F> using conditional_t = typename std::conditional<B, T, F>::type;
|
||||||
|
template <typename T> using remove_cv_t = typename std::remove_cv<T>::type;
|
||||||
|
template <typename T> using remove_reference_t = typename std::remove_reference<T>::type;
|
||||||
|
#endif
|
||||||
|
|
||||||
|
/// Index sequences
|
||||||
|
#if defined(PYBIND11_CPP14)
|
||||||
|
using std::index_sequence;
|
||||||
|
using std::make_index_sequence;
|
||||||
|
#else
|
||||||
|
template<size_t ...> struct index_sequence { };
|
||||||
|
template<size_t N, size_t ...S> struct make_index_sequence_impl : make_index_sequence_impl <N - 1, N - 1, S...> { };
|
||||||
|
template<size_t ...S> struct make_index_sequence_impl <0, S...> { typedef index_sequence<S...> type; };
|
||||||
|
template<size_t N> using make_index_sequence = typename make_index_sequence_impl<N>::type;
|
||||||
|
#endif
|
||||||
|
|
||||||
|
/// Make an index sequence of the indices of true arguments
|
||||||
|
template <typename ISeq, size_t, bool...> struct select_indices_impl { using type = ISeq; };
|
||||||
|
template <size_t... IPrev, size_t I, bool B, bool... Bs> struct select_indices_impl<index_sequence<IPrev...>, I, B, Bs...>
|
||||||
|
: select_indices_impl<conditional_t<B, index_sequence<IPrev..., I>, index_sequence<IPrev...>>, I + 1, Bs...> {};
|
||||||
|
template <bool... Bs> using select_indices = typename select_indices_impl<index_sequence<>, 0, Bs...>::type;
|
||||||
|
|
||||||
|
/// Backports of std::bool_constant and std::negation to accommodate older compilers
|
||||||
|
template <bool B> using bool_constant = std::integral_constant<bool, B>;
|
||||||
|
template <typename T> struct negation : bool_constant<!T::value> { };
|
||||||
|
|
||||||
|
template <typename...> struct void_t_impl { using type = void; };
|
||||||
|
template <typename... Ts> using void_t = typename void_t_impl<Ts...>::type;
|
||||||
|
|
||||||
|
/// Compile-time all/any/none of that check the boolean value of all template types
|
||||||
|
#if defined(__cpp_fold_expressions) && !(defined(_MSC_VER) && (_MSC_VER < 1916))
|
||||||
|
template <class... Ts> using all_of = bool_constant<(Ts::value && ...)>;
|
||||||
|
template <class... Ts> using any_of = bool_constant<(Ts::value || ...)>;
|
||||||
|
#elif !defined(_MSC_VER)
|
||||||
|
template <bool...> struct bools {};
|
||||||
|
template <class... Ts> using all_of = std::is_same<
|
||||||
|
bools<Ts::value..., true>,
|
||||||
|
bools<true, Ts::value...>>;
|
||||||
|
template <class... Ts> using any_of = negation<all_of<negation<Ts>...>>;
|
||||||
|
#else
|
||||||
|
// MSVC has trouble with the above, but supports std::conjunction, which we can use instead (albeit
|
||||||
|
// at a slight loss of compilation efficiency).
|
||||||
|
template <class... Ts> using all_of = std::conjunction<Ts...>;
|
||||||
|
template <class... Ts> using any_of = std::disjunction<Ts...>;
|
||||||
|
#endif
|
||||||
|
template <class... Ts> using none_of = negation<any_of<Ts...>>;
|
||||||
|
|
||||||
|
template <class T, template<class> class... Predicates> using satisfies_all_of = all_of<Predicates<T>...>;
|
||||||
|
template <class T, template<class> class... Predicates> using satisfies_any_of = any_of<Predicates<T>...>;
|
||||||
|
template <class T, template<class> class... Predicates> using satisfies_none_of = none_of<Predicates<T>...>;
|
||||||
|
|
||||||
|
/// Strip the class from a method type
|
||||||
|
template <typename T> struct remove_class { };
|
||||||
|
template <typename C, typename R, typename... A> struct remove_class<R (C::*)(A...)> { typedef R type(A...); };
|
||||||
|
template <typename C, typename R, typename... A> struct remove_class<R (C::*)(A...) const> { typedef R type(A...); };
|
||||||
|
|
||||||
|
/// Helper template to strip away type modifiers
|
||||||
|
template <typename T> struct intrinsic_type { typedef T type; };
|
||||||
|
template <typename T> struct intrinsic_type<const T> { typedef typename intrinsic_type<T>::type type; };
|
||||||
|
template <typename T> struct intrinsic_type<T*> { typedef typename intrinsic_type<T>::type type; };
|
||||||
|
template <typename T> struct intrinsic_type<T&> { typedef typename intrinsic_type<T>::type type; };
|
||||||
|
template <typename T> struct intrinsic_type<T&&> { typedef typename intrinsic_type<T>::type type; };
|
||||||
|
template <typename T, size_t N> struct intrinsic_type<const T[N]> { typedef typename intrinsic_type<T>::type type; };
|
||||||
|
template <typename T, size_t N> struct intrinsic_type<T[N]> { typedef typename intrinsic_type<T>::type type; };
|
||||||
|
template <typename T> using intrinsic_t = typename intrinsic_type<T>::type;
|
||||||
|
|
||||||
|
/// Helper type to replace 'void' in some expressions
|
||||||
|
struct void_type { };
|
||||||
|
|
||||||
|
/// Helper template which holds a list of types
|
||||||
|
template <typename...> struct type_list { };
|
||||||
|
|
||||||
|
/// Compile-time integer sum
|
||||||
|
#ifdef __cpp_fold_expressions
|
||||||
|
template <typename... Ts> constexpr size_t constexpr_sum(Ts... ns) { return (0 + ... + size_t{ns}); }
|
||||||
|
#else
|
||||||
|
constexpr size_t constexpr_sum() { return 0; }
|
||||||
|
template <typename T, typename... Ts>
|
||||||
|
constexpr size_t constexpr_sum(T n, Ts... ns) { return size_t{n} + constexpr_sum(ns...); }
|
||||||
|
#endif
|
||||||
|
|
||||||
|
NAMESPACE_BEGIN(constexpr_impl)
|
||||||
|
/// Implementation details for constexpr functions
|
||||||
|
constexpr int first(int i) { return i; }
|
||||||
|
template <typename T, typename... Ts>
|
||||||
|
constexpr int first(int i, T v, Ts... vs) { return v ? i : first(i + 1, vs...); }
|
||||||
|
|
||||||
|
constexpr int last(int /*i*/, int result) { return result; }
|
||||||
|
template <typename T, typename... Ts>
|
||||||
|
constexpr int last(int i, int result, T v, Ts... vs) { return last(i + 1, v ? i : result, vs...); }
|
||||||
|
NAMESPACE_END(constexpr_impl)
|
||||||
|
|
||||||
|
/// Return the index of the first type in Ts which satisfies Predicate<T>. Returns sizeof...(Ts) if
|
||||||
|
/// none match.
|
||||||
|
template <template<typename> class Predicate, typename... Ts>
|
||||||
|
constexpr int constexpr_first() { return constexpr_impl::first(0, Predicate<Ts>::value...); }
|
||||||
|
|
||||||
|
/// Return the index of the last type in Ts which satisfies Predicate<T>, or -1 if none match.
|
||||||
|
template <template<typename> class Predicate, typename... Ts>
|
||||||
|
constexpr int constexpr_last() { return constexpr_impl::last(0, -1, Predicate<Ts>::value...); }
|
||||||
|
|
||||||
|
/// Return the Nth element from the parameter pack
|
||||||
|
template <size_t N, typename T, typename... Ts>
|
||||||
|
struct pack_element { using type = typename pack_element<N - 1, Ts...>::type; };
|
||||||
|
template <typename T, typename... Ts>
|
||||||
|
struct pack_element<0, T, Ts...> { using type = T; };
|
||||||
|
|
||||||
|
/// Return the one and only type which matches the predicate, or Default if none match.
|
||||||
|
/// If more than one type matches the predicate, fail at compile-time.
|
||||||
|
template <template<typename> class Predicate, typename Default, typename... Ts>
|
||||||
|
struct exactly_one {
|
||||||
|
static constexpr auto found = constexpr_sum(Predicate<Ts>::value...);
|
||||||
|
static_assert(found <= 1, "Found more than one type matching the predicate");
|
||||||
|
|
||||||
|
static constexpr auto index = found ? constexpr_first<Predicate, Ts...>() : 0;
|
||||||
|
using type = conditional_t<found, typename pack_element<index, Ts...>::type, Default>;
|
||||||
|
};
|
||||||
|
template <template<typename> class P, typename Default>
|
||||||
|
struct exactly_one<P, Default> { using type = Default; };
|
||||||
|
|
||||||
|
template <template<typename> class Predicate, typename Default, typename... Ts>
|
||||||
|
using exactly_one_t = typename exactly_one<Predicate, Default, Ts...>::type;
|
||||||
|
|
||||||
|
/// Defer the evaluation of type T until types Us are instantiated
|
||||||
|
template <typename T, typename... /*Us*/> struct deferred_type { using type = T; };
|
||||||
|
template <typename T, typename... Us> using deferred_t = typename deferred_type<T, Us...>::type;
|
||||||
|
|
||||||
|
/// Like is_base_of, but requires a strict base (i.e. `is_strict_base_of<T, T>::value == false`,
|
||||||
|
/// unlike `std::is_base_of`)
|
||||||
|
template <typename Base, typename Derived> using is_strict_base_of = bool_constant<
|
||||||
|
std::is_base_of<Base, Derived>::value && !std::is_same<Base, Derived>::value>;
|
||||||
|
|
||||||
|
/// Like is_base_of, but also requires that the base type is accessible (i.e. that a Derived pointer
|
||||||
|
/// can be converted to a Base pointer)
|
||||||
|
template <typename Base, typename Derived> using is_accessible_base_of = bool_constant<
|
||||||
|
std::is_base_of<Base, Derived>::value && std::is_convertible<Derived *, Base *>::value>;
|
||||||
|
|
||||||
|
template <template<typename...> class Base>
|
||||||
|
struct is_template_base_of_impl {
|
||||||
|
template <typename... Us> static std::true_type check(Base<Us...> *);
|
||||||
|
static std::false_type check(...);
|
||||||
|
};
|
||||||
|
|
||||||
|
/// Check if a template is the base of a type. For example:
|
||||||
|
/// `is_template_base_of<Base, T>` is true if `struct T : Base<U> {}` where U can be anything
|
||||||
|
template <template<typename...> class Base, typename T>
|
||||||
|
#if !defined(_MSC_VER)
|
||||||
|
using is_template_base_of = decltype(is_template_base_of_impl<Base>::check((intrinsic_t<T>*)nullptr));
|
||||||
|
#else // MSVC2015 has trouble with decltype in template aliases
|
||||||
|
struct is_template_base_of : decltype(is_template_base_of_impl<Base>::check((intrinsic_t<T>*)nullptr)) { };
|
||||||
|
#endif
|
||||||
|
|
||||||
|
/// Check if T is an instantiation of the template `Class`. For example:
|
||||||
|
/// `is_instantiation<shared_ptr, T>` is true if `T == shared_ptr<U>` where U can be anything.
|
||||||
|
template <template<typename...> class Class, typename T>
|
||||||
|
struct is_instantiation : std::false_type { };
|
||||||
|
template <template<typename...> class Class, typename... Us>
|
||||||
|
struct is_instantiation<Class, Class<Us...>> : std::true_type { };
|
||||||
|
|
||||||
|
/// Check if T is std::shared_ptr<U> where U can be anything
|
||||||
|
template <typename T> using is_shared_ptr = is_instantiation<std::shared_ptr, T>;
|
||||||
|
|
||||||
|
/// Check if T looks like an input iterator
|
||||||
|
template <typename T, typename = void> struct is_input_iterator : std::false_type {};
|
||||||
|
template <typename T>
|
||||||
|
struct is_input_iterator<T, void_t<decltype(*std::declval<T &>()), decltype(++std::declval<T &>())>>
|
||||||
|
: std::true_type {};
|
||||||
|
|
||||||
|
template <typename T> using is_function_pointer = bool_constant<
|
||||||
|
std::is_pointer<T>::value && std::is_function<typename std::remove_pointer<T>::type>::value>;
|
||||||
|
|
||||||
|
template <typename F> struct strip_function_object {
|
||||||
|
using type = typename remove_class<decltype(&F::operator())>::type;
|
||||||
|
};
|
||||||
|
|
||||||
|
// Extracts the function signature from a function, function pointer or lambda.
|
||||||
|
template <typename Function, typename F = remove_reference_t<Function>>
|
||||||
|
using function_signature_t = conditional_t<
|
||||||
|
std::is_function<F>::value,
|
||||||
|
F,
|
||||||
|
typename conditional_t<
|
||||||
|
std::is_pointer<F>::value || std::is_member_pointer<F>::value,
|
||||||
|
std::remove_pointer<F>,
|
||||||
|
strip_function_object<F>
|
||||||
|
>::type
|
||||||
|
>;
|
||||||
|
|
||||||
|
/// Returns true if the type looks like a lambda: that is, isn't a function, pointer or member
|
||||||
|
/// pointer. Note that this can catch all sorts of other things, too; this is intended to be used
|
||||||
|
/// in a place where passing a lambda makes sense.
|
||||||
|
template <typename T> using is_lambda = satisfies_none_of<remove_reference_t<T>,
|
||||||
|
std::is_function, std::is_pointer, std::is_member_pointer>;
|
||||||
|
|
||||||
|
/// Ignore that a variable is unused in compiler warnings
|
||||||
|
inline void ignore_unused(const int *) { }
|
||||||
|
|
||||||
|
/// Apply a function over each element of a parameter pack
|
||||||
|
#ifdef __cpp_fold_expressions
|
||||||
|
#define PYBIND11_EXPAND_SIDE_EFFECTS(PATTERN) (((PATTERN), void()), ...)
|
||||||
|
#else
|
||||||
|
using expand_side_effects = bool[];
|
||||||
|
#define PYBIND11_EXPAND_SIDE_EFFECTS(PATTERN) pybind11::detail::expand_side_effects{ ((PATTERN), void(), false)..., false }
|
||||||
|
#endif
|
||||||
|
|
||||||
|
NAMESPACE_END(detail)
|
||||||
|
|
||||||
|
/// C++ bindings of builtin Python exceptions
|
||||||
|
class builtin_exception : public std::runtime_error {
|
||||||
|
public:
|
||||||
|
using std::runtime_error::runtime_error;
|
||||||
|
/// Set the error using the Python C API
|
||||||
|
virtual void set_error() const = 0;
|
||||||
|
};
|
||||||
|
|
||||||
|
#define PYBIND11_RUNTIME_EXCEPTION(name, type) \
|
||||||
|
class name : public builtin_exception { public: \
|
||||||
|
using builtin_exception::builtin_exception; \
|
||||||
|
name() : name("") { } \
|
||||||
|
void set_error() const override { PyErr_SetString(type, what()); } \
|
||||||
|
};
|
||||||
|
|
||||||
|
PYBIND11_RUNTIME_EXCEPTION(stop_iteration, PyExc_StopIteration)
|
||||||
|
PYBIND11_RUNTIME_EXCEPTION(index_error, PyExc_IndexError)
|
||||||
|
PYBIND11_RUNTIME_EXCEPTION(key_error, PyExc_KeyError)
|
||||||
|
PYBIND11_RUNTIME_EXCEPTION(value_error, PyExc_ValueError)
|
||||||
|
PYBIND11_RUNTIME_EXCEPTION(type_error, PyExc_TypeError)
|
||||||
|
PYBIND11_RUNTIME_EXCEPTION(cast_error, PyExc_RuntimeError) /// Thrown when pybind11::cast or handle::call fail due to a type casting error
|
||||||
|
PYBIND11_RUNTIME_EXCEPTION(reference_cast_error, PyExc_RuntimeError) /// Used internally
|
||||||
|
|
||||||
|
[[noreturn]] PYBIND11_NOINLINE inline void pybind11_fail(const char *reason) { throw std::runtime_error(reason); }
|
||||||
|
[[noreturn]] PYBIND11_NOINLINE inline void pybind11_fail(const std::string &reason) { throw std::runtime_error(reason); }
|
||||||
|
|
||||||
|
template <typename T, typename SFINAE = void> struct format_descriptor { };
|
||||||
|
|
||||||
|
NAMESPACE_BEGIN(detail)
|
||||||
|
// Returns the index of the given type in the type char array below, and in the list in numpy.h
|
||||||
|
// The order here is: bool; 8 ints ((signed,unsigned)x(8,16,32,64)bits); float,double,long double;
|
||||||
|
// complex float,double,long double. Note that the long double types only participate when long
|
||||||
|
// double is actually longer than double (it isn't under MSVC).
|
||||||
|
// NB: not only the string below but also complex.h and numpy.h rely on this order.
|
||||||
|
template <typename T, typename SFINAE = void> struct is_fmt_numeric { static constexpr bool value = false; };
|
||||||
|
template <typename T> struct is_fmt_numeric<T, enable_if_t<std::is_arithmetic<T>::value>> {
|
||||||
|
static constexpr bool value = true;
|
||||||
|
static constexpr int index = std::is_same<T, bool>::value ? 0 : 1 + (
|
||||||
|
std::is_integral<T>::value ? detail::log2(sizeof(T))*2 + std::is_unsigned<T>::value : 8 + (
|
||||||
|
std::is_same<T, double>::value ? 1 : std::is_same<T, long double>::value ? 2 : 0));
|
||||||
|
};
|
||||||
|
NAMESPACE_END(detail)
|
||||||
|
|
||||||
|
template <typename T> struct format_descriptor<T, detail::enable_if_t<std::is_arithmetic<T>::value>> {
|
||||||
|
static constexpr const char c = "?bBhHiIqQfdg"[detail::is_fmt_numeric<T>::index];
|
||||||
|
static constexpr const char value[2] = { c, '\0' };
|
||||||
|
static std::string format() { return std::string(1, c); }
|
||||||
|
};
|
||||||
|
|
||||||
|
#if !defined(PYBIND11_CPP17)
|
||||||
|
|
||||||
|
template <typename T> constexpr const char format_descriptor<
|
||||||
|
T, detail::enable_if_t<std::is_arithmetic<T>::value>>::value[2];
|
||||||
|
|
||||||
|
#endif
|
||||||
|
|
||||||
|
/// RAII wrapper that temporarily clears any Python error state
|
||||||
|
struct error_scope {
|
||||||
|
PyObject *type, *value, *trace;
|
||||||
|
error_scope() { PyErr_Fetch(&type, &value, &trace); }
|
||||||
|
~error_scope() { PyErr_Restore(type, value, trace); }
|
||||||
|
};
|
||||||
|
|
||||||
|
/// Dummy destructor wrapper that can be used to expose classes with a private destructor
|
||||||
|
struct nodelete { template <typename T> void operator()(T*) { } };
|
||||||
|
|
||||||
|
// overload_cast requires variable templates: C++14
|
||||||
|
#if defined(PYBIND11_CPP14)
|
||||||
|
#define PYBIND11_OVERLOAD_CAST 1
|
||||||
|
|
||||||
|
NAMESPACE_BEGIN(detail)
|
||||||
|
template <typename... Args>
|
||||||
|
struct overload_cast_impl {
|
||||||
|
constexpr overload_cast_impl() {} // MSVC 2015 needs this
|
||||||
|
|
||||||
|
template <typename Return>
|
||||||
|
constexpr auto operator()(Return (*pf)(Args...)) const noexcept
|
||||||
|
-> decltype(pf) { return pf; }
|
||||||
|
|
||||||
|
template <typename Return, typename Class>
|
||||||
|
constexpr auto operator()(Return (Class::*pmf)(Args...), std::false_type = {}) const noexcept
|
||||||
|
-> decltype(pmf) { return pmf; }
|
||||||
|
|
||||||
|
template <typename Return, typename Class>
|
||||||
|
constexpr auto operator()(Return (Class::*pmf)(Args...) const, std::true_type) const noexcept
|
||||||
|
-> decltype(pmf) { return pmf; }
|
||||||
|
};
|
||||||
|
NAMESPACE_END(detail)
|
||||||
|
|
||||||
|
/// Syntax sugar for resolving overloaded function pointers:
|
||||||
|
/// - regular: static_cast<Return (Class::*)(Arg0, Arg1, Arg2)>(&Class::func)
|
||||||
|
/// - sweet: overload_cast<Arg0, Arg1, Arg2>(&Class::func)
|
||||||
|
template <typename... Args>
|
||||||
|
static constexpr detail::overload_cast_impl<Args...> overload_cast = {};
|
||||||
|
// MSVC 2015 only accepts this particular initialization syntax for this variable template.
|
||||||
|
|
||||||
|
/// Const member function selector for overload_cast
|
||||||
|
/// - regular: static_cast<Return (Class::*)(Arg) const>(&Class::func)
|
||||||
|
/// - sweet: overload_cast<Arg>(&Class::func, const_)
|
||||||
|
static constexpr auto const_ = std::true_type{};
|
||||||
|
|
||||||
|
#else // no overload_cast: providing something that static_assert-fails:
|
||||||
|
template <typename... Args> struct overload_cast {
|
||||||
|
static_assert(detail::deferred_t<std::false_type, Args...>::value,
|
||||||
|
"pybind11::overload_cast<...> requires compiling in C++14 mode");
|
||||||
|
};
|
||||||
|
#endif // overload_cast
|
||||||
|
|
||||||
|
NAMESPACE_BEGIN(detail)
|
||||||
|
|
||||||
|
// Adaptor for converting arbitrary container arguments into a vector; implicitly convertible from
|
||||||
|
// any standard container (or C-style array) supporting std::begin/std::end, any singleton
|
||||||
|
// arithmetic type (if T is arithmetic), or explicitly constructible from an iterator pair.
|
||||||
|
template <typename T>
|
||||||
|
class any_container {
|
||||||
|
std::vector<T> v;
|
||||||
|
public:
|
||||||
|
any_container() = default;
|
||||||
|
|
||||||
|
// Can construct from a pair of iterators
|
||||||
|
template <typename It, typename = enable_if_t<is_input_iterator<It>::value>>
|
||||||
|
any_container(It first, It last) : v(first, last) { }
|
||||||
|
|
||||||
|
// Implicit conversion constructor from any arbitrary container type with values convertible to T
|
||||||
|
template <typename Container, typename = enable_if_t<std::is_convertible<decltype(*std::begin(std::declval<const Container &>())), T>::value>>
|
||||||
|
any_container(const Container &c) : any_container(std::begin(c), std::end(c)) { }
|
||||||
|
|
||||||
|
// initializer_list's aren't deducible, so don't get matched by the above template; we need this
|
||||||
|
// to explicitly allow implicit conversion from one:
|
||||||
|
template <typename TIn, typename = enable_if_t<std::is_convertible<TIn, T>::value>>
|
||||||
|
any_container(const std::initializer_list<TIn> &c) : any_container(c.begin(), c.end()) { }
|
||||||
|
|
||||||
|
// Avoid copying if given an rvalue vector of the correct type.
|
||||||
|
any_container(std::vector<T> &&v) : v(std::move(v)) { }
|
||||||
|
|
||||||
|
// Moves the vector out of an rvalue any_container
|
||||||
|
operator std::vector<T> &&() && { return std::move(v); }
|
||||||
|
|
||||||
|
// Dereferencing obtains a reference to the underlying vector
|
||||||
|
std::vector<T> &operator*() { return v; }
|
||||||
|
const std::vector<T> &operator*() const { return v; }
|
||||||
|
|
||||||
|
// -> lets you call methods on the underlying vector
|
||||||
|
std::vector<T> *operator->() { return &v; }
|
||||||
|
const std::vector<T> *operator->() const { return &v; }
|
||||||
|
};
|
||||||
|
|
||||||
|
NAMESPACE_END(detail)
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
NAMESPACE_END(PYBIND11_NAMESPACE)
|
100
python/src/pybind11/detail/descr.h
Normal file
100
python/src/pybind11/detail/descr.h
Normal file
@@ -0,0 +1,100 @@
|
|||||||
|
/*
|
||||||
|
pybind11/detail/descr.h: Helper type for concatenating type signatures at compile time
|
||||||
|
|
||||||
|
Copyright (c) 2016 Wenzel Jakob <wenzel.jakob@epfl.ch>
|
||||||
|
|
||||||
|
All rights reserved. Use of this source code is governed by a
|
||||||
|
BSD-style license that can be found in the LICENSE file.
|
||||||
|
*/
|
||||||
|
|
||||||
|
#pragma once
|
||||||
|
|
||||||
|
#include "common.h"
|
||||||
|
|
||||||
|
NAMESPACE_BEGIN(PYBIND11_NAMESPACE)
|
||||||
|
NAMESPACE_BEGIN(detail)
|
||||||
|
|
||||||
|
#if !defined(_MSC_VER)
|
||||||
|
# define PYBIND11_DESCR_CONSTEXPR static constexpr
|
||||||
|
#else
|
||||||
|
# define PYBIND11_DESCR_CONSTEXPR const
|
||||||
|
#endif
|
||||||
|
|
||||||
|
/* Concatenate type signatures at compile time */
|
||||||
|
template <size_t N, typename... Ts>
|
||||||
|
struct descr {
|
||||||
|
char text[N + 1];
|
||||||
|
|
||||||
|
constexpr descr() : text{'\0'} { }
|
||||||
|
constexpr descr(char const (&s)[N+1]) : descr(s, make_index_sequence<N>()) { }
|
||||||
|
|
||||||
|
template <size_t... Is>
|
||||||
|
constexpr descr(char const (&s)[N+1], index_sequence<Is...>) : text{s[Is]..., '\0'} { }
|
||||||
|
|
||||||
|
template <typename... Chars>
|
||||||
|
constexpr descr(char c, Chars... cs) : text{c, static_cast<char>(cs)..., '\0'} { }
|
||||||
|
|
||||||
|
static constexpr std::array<const std::type_info *, sizeof...(Ts) + 1> types() {
|
||||||
|
return {{&typeid(Ts)..., nullptr}};
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
template <size_t N1, size_t N2, typename... Ts1, typename... Ts2, size_t... Is1, size_t... Is2>
|
||||||
|
constexpr descr<N1 + N2, Ts1..., Ts2...> plus_impl(const descr<N1, Ts1...> &a, const descr<N2, Ts2...> &b,
|
||||||
|
index_sequence<Is1...>, index_sequence<Is2...>) {
|
||||||
|
return {a.text[Is1]..., b.text[Is2]...};
|
||||||
|
}
|
||||||
|
|
||||||
|
template <size_t N1, size_t N2, typename... Ts1, typename... Ts2>
|
||||||
|
constexpr descr<N1 + N2, Ts1..., Ts2...> operator+(const descr<N1, Ts1...> &a, const descr<N2, Ts2...> &b) {
|
||||||
|
return plus_impl(a, b, make_index_sequence<N1>(), make_index_sequence<N2>());
|
||||||
|
}
|
||||||
|
|
||||||
|
template <size_t N>
|
||||||
|
constexpr descr<N - 1> _(char const(&text)[N]) { return descr<N - 1>(text); }
|
||||||
|
constexpr descr<0> _(char const(&)[1]) { return {}; }
|
||||||
|
|
||||||
|
template <size_t Rem, size_t... Digits> struct int_to_str : int_to_str<Rem/10, Rem%10, Digits...> { };
|
||||||
|
template <size_t...Digits> struct int_to_str<0, Digits...> {
|
||||||
|
static constexpr auto digits = descr<sizeof...(Digits)>(('0' + Digits)...);
|
||||||
|
};
|
||||||
|
|
||||||
|
// Ternary description (like std::conditional)
|
||||||
|
template <bool B, size_t N1, size_t N2>
|
||||||
|
constexpr enable_if_t<B, descr<N1 - 1>> _(char const(&text1)[N1], char const(&)[N2]) {
|
||||||
|
return _(text1);
|
||||||
|
}
|
||||||
|
template <bool B, size_t N1, size_t N2>
|
||||||
|
constexpr enable_if_t<!B, descr<N2 - 1>> _(char const(&)[N1], char const(&text2)[N2]) {
|
||||||
|
return _(text2);
|
||||||
|
}
|
||||||
|
|
||||||
|
template <bool B, typename T1, typename T2>
|
||||||
|
constexpr enable_if_t<B, T1> _(const T1 &d, const T2 &) { return d; }
|
||||||
|
template <bool B, typename T1, typename T2>
|
||||||
|
constexpr enable_if_t<!B, T2> _(const T1 &, const T2 &d) { return d; }
|
||||||
|
|
||||||
|
template <size_t Size> auto constexpr _() -> decltype(int_to_str<Size / 10, Size % 10>::digits) {
|
||||||
|
return int_to_str<Size / 10, Size % 10>::digits;
|
||||||
|
}
|
||||||
|
|
||||||
|
template <typename Type> constexpr descr<1, Type> _() { return {'%'}; }
|
||||||
|
|
||||||
|
constexpr descr<0> concat() { return {}; }
|
||||||
|
|
||||||
|
template <size_t N, typename... Ts>
|
||||||
|
constexpr descr<N, Ts...> concat(const descr<N, Ts...> &descr) { return descr; }
|
||||||
|
|
||||||
|
template <size_t N, typename... Ts, typename... Args>
|
||||||
|
constexpr auto concat(const descr<N, Ts...> &d, const Args &...args)
|
||||||
|
-> decltype(std::declval<descr<N + 2, Ts...>>() + concat(args...)) {
|
||||||
|
return d + _(", ") + concat(args...);
|
||||||
|
}
|
||||||
|
|
||||||
|
template <size_t N, typename... Ts>
|
||||||
|
constexpr descr<N + 2, Ts...> type_descr(const descr<N, Ts...> &descr) {
|
||||||
|
return _("{") + descr + _("}");
|
||||||
|
}
|
||||||
|
|
||||||
|
NAMESPACE_END(detail)
|
||||||
|
NAMESPACE_END(PYBIND11_NAMESPACE)
|
335
python/src/pybind11/detail/init.h
Normal file
335
python/src/pybind11/detail/init.h
Normal file
@@ -0,0 +1,335 @@
|
|||||||
|
/*
|
||||||
|
pybind11/detail/init.h: init factory function implementation and support code.
|
||||||
|
|
||||||
|
Copyright (c) 2017 Jason Rhinelander <jason@imaginary.ca>
|
||||||
|
|
||||||
|
All rights reserved. Use of this source code is governed by a
|
||||||
|
BSD-style license that can be found in the LICENSE file.
|
||||||
|
*/
|
||||||
|
|
||||||
|
#pragma once
|
||||||
|
|
||||||
|
#include "class.h"
|
||||||
|
|
||||||
|
NAMESPACE_BEGIN(PYBIND11_NAMESPACE)
|
||||||
|
NAMESPACE_BEGIN(detail)
|
||||||
|
|
||||||
|
template <>
|
||||||
|
class type_caster<value_and_holder> {
|
||||||
|
public:
|
||||||
|
bool load(handle h, bool) {
|
||||||
|
value = reinterpret_cast<value_and_holder *>(h.ptr());
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
|
||||||
|
template <typename> using cast_op_type = value_and_holder &;
|
||||||
|
operator value_and_holder &() { return *value; }
|
||||||
|
static constexpr auto name = _<value_and_holder>();
|
||||||
|
|
||||||
|
private:
|
||||||
|
value_and_holder *value = nullptr;
|
||||||
|
};
|
||||||
|
|
||||||
|
NAMESPACE_BEGIN(initimpl)
|
||||||
|
|
||||||
|
inline void no_nullptr(void *ptr) {
|
||||||
|
if (!ptr) throw type_error("pybind11::init(): factory function returned nullptr");
|
||||||
|
}
|
||||||
|
|
||||||
|
// Implementing functions for all forms of py::init<...> and py::init(...)
|
||||||
|
template <typename Class> using Cpp = typename Class::type;
|
||||||
|
template <typename Class> using Alias = typename Class::type_alias;
|
||||||
|
template <typename Class> using Holder = typename Class::holder_type;
|
||||||
|
|
||||||
|
template <typename Class> using is_alias_constructible = std::is_constructible<Alias<Class>, Cpp<Class> &&>;
|
||||||
|
|
||||||
|
// Takes a Cpp pointer and returns true if it actually is a polymorphic Alias instance.
|
||||||
|
template <typename Class, enable_if_t<Class::has_alias, int> = 0>
|
||||||
|
bool is_alias(Cpp<Class> *ptr) {
|
||||||
|
return dynamic_cast<Alias<Class> *>(ptr) != nullptr;
|
||||||
|
}
|
||||||
|
// Failing fallback version of the above for a no-alias class (always returns false)
|
||||||
|
template <typename /*Class*/>
|
||||||
|
constexpr bool is_alias(void *) { return false; }
|
||||||
|
|
||||||
|
// Constructs and returns a new object; if the given arguments don't map to a constructor, we fall
|
||||||
|
// back to brace aggregate initiailization so that for aggregate initialization can be used with
|
||||||
|
// py::init, e.g. `py::init<int, int>` to initialize a `struct T { int a; int b; }`. For
|
||||||
|
// non-aggregate types, we need to use an ordinary T(...) constructor (invoking as `T{...}` usually
|
||||||
|
// works, but will not do the expected thing when `T` has an `initializer_list<T>` constructor).
|
||||||
|
template <typename Class, typename... Args, detail::enable_if_t<std::is_constructible<Class, Args...>::value, int> = 0>
|
||||||
|
inline Class *construct_or_initialize(Args &&...args) { return new Class(std::forward<Args>(args)...); }
|
||||||
|
template <typename Class, typename... Args, detail::enable_if_t<!std::is_constructible<Class, Args...>::value, int> = 0>
|
||||||
|
inline Class *construct_or_initialize(Args &&...args) { return new Class{std::forward<Args>(args)...}; }
|
||||||
|
|
||||||
|
// Attempts to constructs an alias using a `Alias(Cpp &&)` constructor. This allows types with
|
||||||
|
// an alias to provide only a single Cpp factory function as long as the Alias can be
|
||||||
|
// constructed from an rvalue reference of the base Cpp type. This means that Alias classes
|
||||||
|
// can, when appropriate, simply define a `Alias(Cpp &&)` constructor rather than needing to
|
||||||
|
// inherit all the base class constructors.
|
||||||
|
template <typename Class>
|
||||||
|
void construct_alias_from_cpp(std::true_type /*is_alias_constructible*/,
|
||||||
|
value_and_holder &v_h, Cpp<Class> &&base) {
|
||||||
|
v_h.value_ptr() = new Alias<Class>(std::move(base));
|
||||||
|
}
|
||||||
|
template <typename Class>
|
||||||
|
[[noreturn]] void construct_alias_from_cpp(std::false_type /*!is_alias_constructible*/,
|
||||||
|
value_and_holder &, Cpp<Class> &&) {
|
||||||
|
throw type_error("pybind11::init(): unable to convert returned instance to required "
|
||||||
|
"alias class: no `Alias<Class>(Class &&)` constructor available");
|
||||||
|
}
|
||||||
|
|
||||||
|
// Error-generating fallback for factories that don't match one of the below construction
|
||||||
|
// mechanisms.
|
||||||
|
template <typename Class>
|
||||||
|
void construct(...) {
|
||||||
|
static_assert(!std::is_same<Class, Class>::value /* always false */,
|
||||||
|
"pybind11::init(): init function must return a compatible pointer, "
|
||||||
|
"holder, or value");
|
||||||
|
}
|
||||||
|
|
||||||
|
// Pointer return v1: the factory function returns a class pointer for a registered class.
|
||||||
|
// If we don't need an alias (because this class doesn't have one, or because the final type is
|
||||||
|
// inherited on the Python side) we can simply take over ownership. Otherwise we need to try to
|
||||||
|
// construct an Alias from the returned base instance.
|
||||||
|
template <typename Class>
|
||||||
|
void construct(value_and_holder &v_h, Cpp<Class> *ptr, bool need_alias) {
|
||||||
|
no_nullptr(ptr);
|
||||||
|
if (Class::has_alias && need_alias && !is_alias<Class>(ptr)) {
|
||||||
|
// We're going to try to construct an alias by moving the cpp type. Whether or not
|
||||||
|
// that succeeds, we still need to destroy the original cpp pointer (either the
|
||||||
|
// moved away leftover, if the alias construction works, or the value itself if we
|
||||||
|
// throw an error), but we can't just call `delete ptr`: it might have a special
|
||||||
|
// deleter, or might be shared_from_this. So we construct a holder around it as if
|
||||||
|
// it was a normal instance, then steal the holder away into a local variable; thus
|
||||||
|
// the holder and destruction happens when we leave the C++ scope, and the holder
|
||||||
|
// class gets to handle the destruction however it likes.
|
||||||
|
v_h.value_ptr() = ptr;
|
||||||
|
v_h.set_instance_registered(true); // To prevent init_instance from registering it
|
||||||
|
v_h.type->init_instance(v_h.inst, nullptr); // Set up the holder
|
||||||
|
Holder<Class> temp_holder(std::move(v_h.holder<Holder<Class>>())); // Steal the holder
|
||||||
|
v_h.type->dealloc(v_h); // Destroys the moved-out holder remains, resets value ptr to null
|
||||||
|
v_h.set_instance_registered(false);
|
||||||
|
|
||||||
|
construct_alias_from_cpp<Class>(is_alias_constructible<Class>{}, v_h, std::move(*ptr));
|
||||||
|
} else {
|
||||||
|
// Otherwise the type isn't inherited, so we don't need an Alias
|
||||||
|
v_h.value_ptr() = ptr;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// Pointer return v2: a factory that always returns an alias instance ptr. We simply take over
|
||||||
|
// ownership of the pointer.
|
||||||
|
template <typename Class, enable_if_t<Class::has_alias, int> = 0>
|
||||||
|
void construct(value_and_holder &v_h, Alias<Class> *alias_ptr, bool) {
|
||||||
|
no_nullptr(alias_ptr);
|
||||||
|
v_h.value_ptr() = static_cast<Cpp<Class> *>(alias_ptr);
|
||||||
|
}
|
||||||
|
|
||||||
|
// Holder return: copy its pointer, and move or copy the returned holder into the new instance's
|
||||||
|
// holder. This also handles types like std::shared_ptr<T> and std::unique_ptr<T> where T is a
|
||||||
|
// derived type (through those holder's implicit conversion from derived class holder constructors).
|
||||||
|
template <typename Class>
|
||||||
|
void construct(value_and_holder &v_h, Holder<Class> holder, bool need_alias) {
|
||||||
|
auto *ptr = holder_helper<Holder<Class>>::get(holder);
|
||||||
|
// If we need an alias, check that the held pointer is actually an alias instance
|
||||||
|
if (Class::has_alias && need_alias && !is_alias<Class>(ptr))
|
||||||
|
throw type_error("pybind11::init(): construction failed: returned holder-wrapped instance "
|
||||||
|
"is not an alias instance");
|
||||||
|
|
||||||
|
v_h.value_ptr() = ptr;
|
||||||
|
v_h.type->init_instance(v_h.inst, &holder);
|
||||||
|
}
|
||||||
|
|
||||||
|
// return-by-value version 1: returning a cpp class by value. If the class has an alias and an
|
||||||
|
// alias is required the alias must have an `Alias(Cpp &&)` constructor so that we can construct
|
||||||
|
// the alias from the base when needed (i.e. because of Python-side inheritance). When we don't
|
||||||
|
// need it, we simply move-construct the cpp value into a new instance.
|
||||||
|
template <typename Class>
|
||||||
|
void construct(value_and_holder &v_h, Cpp<Class> &&result, bool need_alias) {
|
||||||
|
static_assert(std::is_move_constructible<Cpp<Class>>::value,
|
||||||
|
"pybind11::init() return-by-value factory function requires a movable class");
|
||||||
|
if (Class::has_alias && need_alias)
|
||||||
|
construct_alias_from_cpp<Class>(is_alias_constructible<Class>{}, v_h, std::move(result));
|
||||||
|
else
|
||||||
|
v_h.value_ptr() = new Cpp<Class>(std::move(result));
|
||||||
|
}
|
||||||
|
|
||||||
|
// return-by-value version 2: returning a value of the alias type itself. We move-construct an
|
||||||
|
// Alias instance (even if no the python-side inheritance is involved). The is intended for
|
||||||
|
// cases where Alias initialization is always desired.
|
||||||
|
template <typename Class>
|
||||||
|
void construct(value_and_holder &v_h, Alias<Class> &&result, bool) {
|
||||||
|
static_assert(std::is_move_constructible<Alias<Class>>::value,
|
||||||
|
"pybind11::init() return-by-alias-value factory function requires a movable alias class");
|
||||||
|
v_h.value_ptr() = new Alias<Class>(std::move(result));
|
||||||
|
}
|
||||||
|
|
||||||
|
// Implementing class for py::init<...>()
|
||||||
|
template <typename... Args>
|
||||||
|
struct constructor {
|
||||||
|
template <typename Class, typename... Extra, enable_if_t<!Class::has_alias, int> = 0>
|
||||||
|
static void execute(Class &cl, const Extra&... extra) {
|
||||||
|
cl.def("__init__", [](value_and_holder &v_h, Args... args) {
|
||||||
|
v_h.value_ptr() = construct_or_initialize<Cpp<Class>>(std::forward<Args>(args)...);
|
||||||
|
}, is_new_style_constructor(), extra...);
|
||||||
|
}
|
||||||
|
|
||||||
|
template <typename Class, typename... Extra,
|
||||||
|
enable_if_t<Class::has_alias &&
|
||||||
|
std::is_constructible<Cpp<Class>, Args...>::value, int> = 0>
|
||||||
|
static void execute(Class &cl, const Extra&... extra) {
|
||||||
|
cl.def("__init__", [](value_and_holder &v_h, Args... args) {
|
||||||
|
if (Py_TYPE(v_h.inst) == v_h.type->type)
|
||||||
|
v_h.value_ptr() = construct_or_initialize<Cpp<Class>>(std::forward<Args>(args)...);
|
||||||
|
else
|
||||||
|
v_h.value_ptr() = construct_or_initialize<Alias<Class>>(std::forward<Args>(args)...);
|
||||||
|
}, is_new_style_constructor(), extra...);
|
||||||
|
}
|
||||||
|
|
||||||
|
template <typename Class, typename... Extra,
|
||||||
|
enable_if_t<Class::has_alias &&
|
||||||
|
!std::is_constructible<Cpp<Class>, Args...>::value, int> = 0>
|
||||||
|
static void execute(Class &cl, const Extra&... extra) {
|
||||||
|
cl.def("__init__", [](value_and_holder &v_h, Args... args) {
|
||||||
|
v_h.value_ptr() = construct_or_initialize<Alias<Class>>(std::forward<Args>(args)...);
|
||||||
|
}, is_new_style_constructor(), extra...);
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
// Implementing class for py::init_alias<...>()
|
||||||
|
template <typename... Args> struct alias_constructor {
|
||||||
|
template <typename Class, typename... Extra,
|
||||||
|
enable_if_t<Class::has_alias && std::is_constructible<Alias<Class>, Args...>::value, int> = 0>
|
||||||
|
static void execute(Class &cl, const Extra&... extra) {
|
||||||
|
cl.def("__init__", [](value_and_holder &v_h, Args... args) {
|
||||||
|
v_h.value_ptr() = construct_or_initialize<Alias<Class>>(std::forward<Args>(args)...);
|
||||||
|
}, is_new_style_constructor(), extra...);
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
// Implementation class for py::init(Func) and py::init(Func, AliasFunc)
|
||||||
|
template <typename CFunc, typename AFunc = void_type (*)(),
|
||||||
|
typename = function_signature_t<CFunc>, typename = function_signature_t<AFunc>>
|
||||||
|
struct factory;
|
||||||
|
|
||||||
|
// Specialization for py::init(Func)
|
||||||
|
template <typename Func, typename Return, typename... Args>
|
||||||
|
struct factory<Func, void_type (*)(), Return(Args...)> {
|
||||||
|
remove_reference_t<Func> class_factory;
|
||||||
|
|
||||||
|
factory(Func &&f) : class_factory(std::forward<Func>(f)) { }
|
||||||
|
|
||||||
|
// The given class either has no alias or has no separate alias factory;
|
||||||
|
// this always constructs the class itself. If the class is registered with an alias
|
||||||
|
// type and an alias instance is needed (i.e. because the final type is a Python class
|
||||||
|
// inheriting from the C++ type) the returned value needs to either already be an alias
|
||||||
|
// instance, or the alias needs to be constructible from a `Class &&` argument.
|
||||||
|
template <typename Class, typename... Extra>
|
||||||
|
void execute(Class &cl, const Extra &...extra) && {
|
||||||
|
#if defined(PYBIND11_CPP14)
|
||||||
|
cl.def("__init__", [func = std::move(class_factory)]
|
||||||
|
#else
|
||||||
|
auto &func = class_factory;
|
||||||
|
cl.def("__init__", [func]
|
||||||
|
#endif
|
||||||
|
(value_and_holder &v_h, Args... args) {
|
||||||
|
construct<Class>(v_h, func(std::forward<Args>(args)...),
|
||||||
|
Py_TYPE(v_h.inst) != v_h.type->type);
|
||||||
|
}, is_new_style_constructor(), extra...);
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
// Specialization for py::init(Func, AliasFunc)
|
||||||
|
template <typename CFunc, typename AFunc,
|
||||||
|
typename CReturn, typename... CArgs, typename AReturn, typename... AArgs>
|
||||||
|
struct factory<CFunc, AFunc, CReturn(CArgs...), AReturn(AArgs...)> {
|
||||||
|
static_assert(sizeof...(CArgs) == sizeof...(AArgs),
|
||||||
|
"pybind11::init(class_factory, alias_factory): class and alias factories "
|
||||||
|
"must have identical argument signatures");
|
||||||
|
static_assert(all_of<std::is_same<CArgs, AArgs>...>::value,
|
||||||
|
"pybind11::init(class_factory, alias_factory): class and alias factories "
|
||||||
|
"must have identical argument signatures");
|
||||||
|
|
||||||
|
remove_reference_t<CFunc> class_factory;
|
||||||
|
remove_reference_t<AFunc> alias_factory;
|
||||||
|
|
||||||
|
factory(CFunc &&c, AFunc &&a)
|
||||||
|
: class_factory(std::forward<CFunc>(c)), alias_factory(std::forward<AFunc>(a)) { }
|
||||||
|
|
||||||
|
// The class factory is called when the `self` type passed to `__init__` is the direct
|
||||||
|
// class (i.e. not inherited), the alias factory when `self` is a Python-side subtype.
|
||||||
|
template <typename Class, typename... Extra>
|
||||||
|
void execute(Class &cl, const Extra&... extra) && {
|
||||||
|
static_assert(Class::has_alias, "The two-argument version of `py::init()` can "
|
||||||
|
"only be used if the class has an alias");
|
||||||
|
#if defined(PYBIND11_CPP14)
|
||||||
|
cl.def("__init__", [class_func = std::move(class_factory), alias_func = std::move(alias_factory)]
|
||||||
|
#else
|
||||||
|
auto &class_func = class_factory;
|
||||||
|
auto &alias_func = alias_factory;
|
||||||
|
cl.def("__init__", [class_func, alias_func]
|
||||||
|
#endif
|
||||||
|
(value_and_holder &v_h, CArgs... args) {
|
||||||
|
if (Py_TYPE(v_h.inst) == v_h.type->type)
|
||||||
|
// If the instance type equals the registered type we don't have inheritance, so
|
||||||
|
// don't need the alias and can construct using the class function:
|
||||||
|
construct<Class>(v_h, class_func(std::forward<CArgs>(args)...), false);
|
||||||
|
else
|
||||||
|
construct<Class>(v_h, alias_func(std::forward<CArgs>(args)...), true);
|
||||||
|
}, is_new_style_constructor(), extra...);
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
/// Set just the C++ state. Same as `__init__`.
|
||||||
|
template <typename Class, typename T>
|
||||||
|
void setstate(value_and_holder &v_h, T &&result, bool need_alias) {
|
||||||
|
construct<Class>(v_h, std::forward<T>(result), need_alias);
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Set both the C++ and Python states
|
||||||
|
template <typename Class, typename T, typename O,
|
||||||
|
enable_if_t<std::is_convertible<O, handle>::value, int> = 0>
|
||||||
|
void setstate(value_and_holder &v_h, std::pair<T, O> &&result, bool need_alias) {
|
||||||
|
construct<Class>(v_h, std::move(result.first), need_alias);
|
||||||
|
setattr((PyObject *) v_h.inst, "__dict__", result.second);
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Implementation for py::pickle(GetState, SetState)
|
||||||
|
template <typename Get, typename Set,
|
||||||
|
typename = function_signature_t<Get>, typename = function_signature_t<Set>>
|
||||||
|
struct pickle_factory;
|
||||||
|
|
||||||
|
template <typename Get, typename Set,
|
||||||
|
typename RetState, typename Self, typename NewInstance, typename ArgState>
|
||||||
|
struct pickle_factory<Get, Set, RetState(Self), NewInstance(ArgState)> {
|
||||||
|
static_assert(std::is_same<intrinsic_t<RetState>, intrinsic_t<ArgState>>::value,
|
||||||
|
"The type returned by `__getstate__` must be the same "
|
||||||
|
"as the argument accepted by `__setstate__`");
|
||||||
|
|
||||||
|
remove_reference_t<Get> get;
|
||||||
|
remove_reference_t<Set> set;
|
||||||
|
|
||||||
|
pickle_factory(Get get, Set set)
|
||||||
|
: get(std::forward<Get>(get)), set(std::forward<Set>(set)) { }
|
||||||
|
|
||||||
|
template <typename Class, typename... Extra>
|
||||||
|
void execute(Class &cl, const Extra &...extra) && {
|
||||||
|
cl.def("__getstate__", std::move(get));
|
||||||
|
|
||||||
|
#if defined(PYBIND11_CPP14)
|
||||||
|
cl.def("__setstate__", [func = std::move(set)]
|
||||||
|
#else
|
||||||
|
auto &func = set;
|
||||||
|
cl.def("__setstate__", [func]
|
||||||
|
#endif
|
||||||
|
(value_and_holder &v_h, ArgState state) {
|
||||||
|
setstate<Class>(v_h, func(std::forward<ArgState>(state)),
|
||||||
|
Py_TYPE(v_h.inst) != v_h.type->type);
|
||||||
|
}, is_new_style_constructor(), extra...);
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
NAMESPACE_END(initimpl)
|
||||||
|
NAMESPACE_END(detail)
|
||||||
|
NAMESPACE_END(pybind11)
|
291
python/src/pybind11/detail/internals.h
Normal file
291
python/src/pybind11/detail/internals.h
Normal file
@@ -0,0 +1,291 @@
|
|||||||
|
/*
|
||||||
|
pybind11/detail/internals.h: Internal data structure and related functions
|
||||||
|
|
||||||
|
Copyright (c) 2017 Wenzel Jakob <wenzel.jakob@epfl.ch>
|
||||||
|
|
||||||
|
All rights reserved. Use of this source code is governed by a
|
||||||
|
BSD-style license that can be found in the LICENSE file.
|
||||||
|
*/
|
||||||
|
|
||||||
|
#pragma once
|
||||||
|
|
||||||
|
#include "../pytypes.h"
|
||||||
|
|
||||||
|
NAMESPACE_BEGIN(PYBIND11_NAMESPACE)
|
||||||
|
NAMESPACE_BEGIN(detail)
|
||||||
|
// Forward declarations
|
||||||
|
inline PyTypeObject *make_static_property_type();
|
||||||
|
inline PyTypeObject *make_default_metaclass();
|
||||||
|
inline PyObject *make_object_base_type(PyTypeObject *metaclass);
|
||||||
|
|
||||||
|
// The old Python Thread Local Storage (TLS) API is deprecated in Python 3.7 in favor of the new
|
||||||
|
// Thread Specific Storage (TSS) API.
|
||||||
|
#if PY_VERSION_HEX >= 0x03070000
|
||||||
|
# define PYBIND11_TLS_KEY_INIT(var) Py_tss_t *var = nullptr
|
||||||
|
# define PYBIND11_TLS_GET_VALUE(key) PyThread_tss_get((key))
|
||||||
|
# define PYBIND11_TLS_REPLACE_VALUE(key, value) PyThread_tss_set((key), (value))
|
||||||
|
# define PYBIND11_TLS_DELETE_VALUE(key) PyThread_tss_set((key), nullptr)
|
||||||
|
#else
|
||||||
|
// Usually an int but a long on Cygwin64 with Python 3.x
|
||||||
|
# define PYBIND11_TLS_KEY_INIT(var) decltype(PyThread_create_key()) var = 0
|
||||||
|
# define PYBIND11_TLS_GET_VALUE(key) PyThread_get_key_value((key))
|
||||||
|
# if PY_MAJOR_VERSION < 3
|
||||||
|
# define PYBIND11_TLS_DELETE_VALUE(key) \
|
||||||
|
PyThread_delete_key_value(key)
|
||||||
|
# define PYBIND11_TLS_REPLACE_VALUE(key, value) \
|
||||||
|
do { \
|
||||||
|
PyThread_delete_key_value((key)); \
|
||||||
|
PyThread_set_key_value((key), (value)); \
|
||||||
|
} while (false)
|
||||||
|
# else
|
||||||
|
# define PYBIND11_TLS_DELETE_VALUE(key) \
|
||||||
|
PyThread_set_key_value((key), nullptr)
|
||||||
|
# define PYBIND11_TLS_REPLACE_VALUE(key, value) \
|
||||||
|
PyThread_set_key_value((key), (value))
|
||||||
|
# endif
|
||||||
|
#endif
|
||||||
|
|
||||||
|
// Python loads modules by default with dlopen with the RTLD_LOCAL flag; under libc++ and possibly
|
||||||
|
// other STLs, this means `typeid(A)` from one module won't equal `typeid(A)` from another module
|
||||||
|
// even when `A` is the same, non-hidden-visibility type (e.g. from a common include). Under
|
||||||
|
// libstdc++, this doesn't happen: equality and the type_index hash are based on the type name,
|
||||||
|
// which works. If not under a known-good stl, provide our own name-based hash and equality
|
||||||
|
// functions that use the type name.
|
||||||
|
#if defined(__GLIBCXX__)
|
||||||
|
inline bool same_type(const std::type_info &lhs, const std::type_info &rhs) { return lhs == rhs; }
|
||||||
|
using type_hash = std::hash<std::type_index>;
|
||||||
|
using type_equal_to = std::equal_to<std::type_index>;
|
||||||
|
#else
|
||||||
|
inline bool same_type(const std::type_info &lhs, const std::type_info &rhs) {
|
||||||
|
return lhs.name() == rhs.name() || std::strcmp(lhs.name(), rhs.name()) == 0;
|
||||||
|
}
|
||||||
|
|
||||||
|
struct type_hash {
|
||||||
|
size_t operator()(const std::type_index &t) const {
|
||||||
|
size_t hash = 5381;
|
||||||
|
const char *ptr = t.name();
|
||||||
|
while (auto c = static_cast<unsigned char>(*ptr++))
|
||||||
|
hash = (hash * 33) ^ c;
|
||||||
|
return hash;
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
struct type_equal_to {
|
||||||
|
bool operator()(const std::type_index &lhs, const std::type_index &rhs) const {
|
||||||
|
return lhs.name() == rhs.name() || std::strcmp(lhs.name(), rhs.name()) == 0;
|
||||||
|
}
|
||||||
|
};
|
||||||
|
#endif
|
||||||
|
|
||||||
|
template <typename value_type>
|
||||||
|
using type_map = std::unordered_map<std::type_index, value_type, type_hash, type_equal_to>;
|
||||||
|
|
||||||
|
struct overload_hash {
|
||||||
|
inline size_t operator()(const std::pair<const PyObject *, const char *>& v) const {
|
||||||
|
size_t value = std::hash<const void *>()(v.first);
|
||||||
|
value ^= std::hash<const void *>()(v.second) + 0x9e3779b9 + (value<<6) + (value>>2);
|
||||||
|
return value;
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
/// Internal data structure used to track registered instances and types.
|
||||||
|
/// Whenever binary incompatible changes are made to this structure,
|
||||||
|
/// `PYBIND11_INTERNALS_VERSION` must be incremented.
|
||||||
|
struct internals {
|
||||||
|
type_map<type_info *> registered_types_cpp; // std::type_index -> pybind11's type information
|
||||||
|
std::unordered_map<PyTypeObject *, std::vector<type_info *>> registered_types_py; // PyTypeObject* -> base type_info(s)
|
||||||
|
std::unordered_multimap<const void *, instance*> registered_instances; // void * -> instance*
|
||||||
|
std::unordered_set<std::pair<const PyObject *, const char *>, overload_hash> inactive_overload_cache;
|
||||||
|
type_map<std::vector<bool (*)(PyObject *, void *&)>> direct_conversions;
|
||||||
|
std::unordered_map<const PyObject *, std::vector<PyObject *>> patients;
|
||||||
|
std::forward_list<void (*) (std::exception_ptr)> registered_exception_translators;
|
||||||
|
std::unordered_map<std::string, void *> shared_data; // Custom data to be shared across extensions
|
||||||
|
std::vector<PyObject *> loader_patient_stack; // Used by `loader_life_support`
|
||||||
|
std::forward_list<std::string> static_strings; // Stores the std::strings backing detail::c_str()
|
||||||
|
PyTypeObject *static_property_type;
|
||||||
|
PyTypeObject *default_metaclass;
|
||||||
|
PyObject *instance_base;
|
||||||
|
#if defined(WITH_THREAD)
|
||||||
|
PYBIND11_TLS_KEY_INIT(tstate);
|
||||||
|
PyInterpreterState *istate = nullptr;
|
||||||
|
#endif
|
||||||
|
};
|
||||||
|
|
||||||
|
/// Additional type information which does not fit into the PyTypeObject.
|
||||||
|
/// Changes to this struct also require bumping `PYBIND11_INTERNALS_VERSION`.
|
||||||
|
struct type_info {
|
||||||
|
PyTypeObject *type;
|
||||||
|
const std::type_info *cpptype;
|
||||||
|
size_t type_size, type_align, holder_size_in_ptrs;
|
||||||
|
void *(*operator_new)(size_t);
|
||||||
|
void (*init_instance)(instance *, const void *);
|
||||||
|
void (*dealloc)(value_and_holder &v_h);
|
||||||
|
std::vector<PyObject *(*)(PyObject *, PyTypeObject *)> implicit_conversions;
|
||||||
|
std::vector<std::pair<const std::type_info *, void *(*)(void *)>> implicit_casts;
|
||||||
|
std::vector<bool (*)(PyObject *, void *&)> *direct_conversions;
|
||||||
|
buffer_info *(*get_buffer)(PyObject *, void *) = nullptr;
|
||||||
|
void *get_buffer_data = nullptr;
|
||||||
|
void *(*module_local_load)(PyObject *, const type_info *) = nullptr;
|
||||||
|
/* A simple type never occurs as a (direct or indirect) parent
|
||||||
|
* of a class that makes use of multiple inheritance */
|
||||||
|
bool simple_type : 1;
|
||||||
|
/* True if there is no multiple inheritance in this type's inheritance tree */
|
||||||
|
bool simple_ancestors : 1;
|
||||||
|
/* for base vs derived holder_type checks */
|
||||||
|
bool default_holder : 1;
|
||||||
|
/* true if this is a type registered with py::module_local */
|
||||||
|
bool module_local : 1;
|
||||||
|
};
|
||||||
|
|
||||||
|
/// Tracks the `internals` and `type_info` ABI version independent of the main library version
|
||||||
|
#define PYBIND11_INTERNALS_VERSION 3
|
||||||
|
|
||||||
|
#if defined(_DEBUG)
|
||||||
|
# define PYBIND11_BUILD_TYPE "_debug"
|
||||||
|
#else
|
||||||
|
# define PYBIND11_BUILD_TYPE ""
|
||||||
|
#endif
|
||||||
|
|
||||||
|
#if defined(WITH_THREAD)
|
||||||
|
# define PYBIND11_INTERNALS_KIND ""
|
||||||
|
#else
|
||||||
|
# define PYBIND11_INTERNALS_KIND "_without_thread"
|
||||||
|
#endif
|
||||||
|
|
||||||
|
#define PYBIND11_INTERNALS_ID "__pybind11_internals_v" \
|
||||||
|
PYBIND11_TOSTRING(PYBIND11_INTERNALS_VERSION) PYBIND11_INTERNALS_KIND PYBIND11_BUILD_TYPE "__"
|
||||||
|
|
||||||
|
#define PYBIND11_MODULE_LOCAL_ID "__pybind11_module_local_v" \
|
||||||
|
PYBIND11_TOSTRING(PYBIND11_INTERNALS_VERSION) PYBIND11_INTERNALS_KIND PYBIND11_BUILD_TYPE "__"
|
||||||
|
|
||||||
|
/// Each module locally stores a pointer to the `internals` data. The data
|
||||||
|
/// itself is shared among modules with the same `PYBIND11_INTERNALS_ID`.
|
||||||
|
inline internals **&get_internals_pp() {
|
||||||
|
static internals **internals_pp = nullptr;
|
||||||
|
return internals_pp;
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Return a reference to the current `internals` data
|
||||||
|
PYBIND11_NOINLINE inline internals &get_internals() {
|
||||||
|
auto **&internals_pp = get_internals_pp();
|
||||||
|
if (internals_pp && *internals_pp)
|
||||||
|
return **internals_pp;
|
||||||
|
|
||||||
|
constexpr auto *id = PYBIND11_INTERNALS_ID;
|
||||||
|
auto builtins = handle(PyEval_GetBuiltins());
|
||||||
|
if (builtins.contains(id) && isinstance<capsule>(builtins[id])) {
|
||||||
|
internals_pp = static_cast<internals **>(capsule(builtins[id]));
|
||||||
|
|
||||||
|
// We loaded builtins through python's builtins, which means that our `error_already_set`
|
||||||
|
// and `builtin_exception` may be different local classes than the ones set up in the
|
||||||
|
// initial exception translator, below, so add another for our local exception classes.
|
||||||
|
//
|
||||||
|
// libstdc++ doesn't require this (types there are identified only by name)
|
||||||
|
#if !defined(__GLIBCXX__)
|
||||||
|
(*internals_pp)->registered_exception_translators.push_front(
|
||||||
|
[](std::exception_ptr p) -> void {
|
||||||
|
try {
|
||||||
|
if (p) std::rethrow_exception(p);
|
||||||
|
} catch (error_already_set &e) { e.restore(); return;
|
||||||
|
} catch (const builtin_exception &e) { e.set_error(); return;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
);
|
||||||
|
#endif
|
||||||
|
} else {
|
||||||
|
if (!internals_pp) internals_pp = new internals*();
|
||||||
|
auto *&internals_ptr = *internals_pp;
|
||||||
|
internals_ptr = new internals();
|
||||||
|
#if defined(WITH_THREAD)
|
||||||
|
PyEval_InitThreads();
|
||||||
|
PyThreadState *tstate = PyThreadState_Get();
|
||||||
|
#if PY_VERSION_HEX >= 0x03070000
|
||||||
|
internals_ptr->tstate = PyThread_tss_alloc();
|
||||||
|
if (!internals_ptr->tstate || PyThread_tss_create(internals_ptr->tstate))
|
||||||
|
pybind11_fail("get_internals: could not successfully initialize the TSS key!");
|
||||||
|
PyThread_tss_set(internals_ptr->tstate, tstate);
|
||||||
|
#else
|
||||||
|
internals_ptr->tstate = PyThread_create_key();
|
||||||
|
if (internals_ptr->tstate == -1)
|
||||||
|
pybind11_fail("get_internals: could not successfully initialize the TLS key!");
|
||||||
|
PyThread_set_key_value(internals_ptr->tstate, tstate);
|
||||||
|
#endif
|
||||||
|
internals_ptr->istate = tstate->interp;
|
||||||
|
#endif
|
||||||
|
builtins[id] = capsule(internals_pp);
|
||||||
|
internals_ptr->registered_exception_translators.push_front(
|
||||||
|
[](std::exception_ptr p) -> void {
|
||||||
|
try {
|
||||||
|
if (p) std::rethrow_exception(p);
|
||||||
|
} catch (error_already_set &e) { e.restore(); return;
|
||||||
|
} catch (const builtin_exception &e) { e.set_error(); return;
|
||||||
|
} catch (const std::bad_alloc &e) { PyErr_SetString(PyExc_MemoryError, e.what()); return;
|
||||||
|
} catch (const std::domain_error &e) { PyErr_SetString(PyExc_ValueError, e.what()); return;
|
||||||
|
} catch (const std::invalid_argument &e) { PyErr_SetString(PyExc_ValueError, e.what()); return;
|
||||||
|
} catch (const std::length_error &e) { PyErr_SetString(PyExc_ValueError, e.what()); return;
|
||||||
|
} catch (const std::out_of_range &e) { PyErr_SetString(PyExc_IndexError, e.what()); return;
|
||||||
|
} catch (const std::range_error &e) { PyErr_SetString(PyExc_ValueError, e.what()); return;
|
||||||
|
} catch (const std::exception &e) { PyErr_SetString(PyExc_RuntimeError, e.what()); return;
|
||||||
|
} catch (...) {
|
||||||
|
PyErr_SetString(PyExc_RuntimeError, "Caught an unknown exception!");
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
);
|
||||||
|
internals_ptr->static_property_type = make_static_property_type();
|
||||||
|
internals_ptr->default_metaclass = make_default_metaclass();
|
||||||
|
internals_ptr->instance_base = make_object_base_type(internals_ptr->default_metaclass);
|
||||||
|
}
|
||||||
|
return **internals_pp;
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Works like `internals.registered_types_cpp`, but for module-local registered types:
|
||||||
|
inline type_map<type_info *> ®istered_local_types_cpp() {
|
||||||
|
static type_map<type_info *> locals{};
|
||||||
|
return locals;
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Constructs a std::string with the given arguments, stores it in `internals`, and returns its
|
||||||
|
/// `c_str()`. Such strings objects have a long storage duration -- the internal strings are only
|
||||||
|
/// cleared when the program exits or after interpreter shutdown (when embedding), and so are
|
||||||
|
/// suitable for c-style strings needed by Python internals (such as PyTypeObject's tp_name).
|
||||||
|
template <typename... Args>
|
||||||
|
const char *c_str(Args &&...args) {
|
||||||
|
auto &strings = get_internals().static_strings;
|
||||||
|
strings.emplace_front(std::forward<Args>(args)...);
|
||||||
|
return strings.front().c_str();
|
||||||
|
}
|
||||||
|
|
||||||
|
NAMESPACE_END(detail)
|
||||||
|
|
||||||
|
/// Returns a named pointer that is shared among all extension modules (using the same
|
||||||
|
/// pybind11 version) running in the current interpreter. Names starting with underscores
|
||||||
|
/// are reserved for internal usage. Returns `nullptr` if no matching entry was found.
|
||||||
|
inline PYBIND11_NOINLINE void *get_shared_data(const std::string &name) {
|
||||||
|
auto &internals = detail::get_internals();
|
||||||
|
auto it = internals.shared_data.find(name);
|
||||||
|
return it != internals.shared_data.end() ? it->second : nullptr;
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Set the shared data that can be later recovered by `get_shared_data()`.
|
||||||
|
inline PYBIND11_NOINLINE void *set_shared_data(const std::string &name, void *data) {
|
||||||
|
detail::get_internals().shared_data[name] = data;
|
||||||
|
return data;
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Returns a typed reference to a shared data entry (by using `get_shared_data()`) if
|
||||||
|
/// such entry exists. Otherwise, a new object of default-constructible type `T` is
|
||||||
|
/// added to the shared data under the given name and a reference to it is returned.
|
||||||
|
template<typename T>
|
||||||
|
T &get_or_create_shared_data(const std::string &name) {
|
||||||
|
auto &internals = detail::get_internals();
|
||||||
|
auto it = internals.shared_data.find(name);
|
||||||
|
T *ptr = (T *) (it != internals.shared_data.end() ? it->second : nullptr);
|
||||||
|
if (!ptr) {
|
||||||
|
ptr = new T();
|
||||||
|
internals.shared_data[name] = ptr;
|
||||||
|
}
|
||||||
|
return *ptr;
|
||||||
|
}
|
||||||
|
|
||||||
|
NAMESPACE_END(PYBIND11_NAMESPACE)
|
55
python/src/pybind11/detail/typeid.h
Normal file
55
python/src/pybind11/detail/typeid.h
Normal file
@@ -0,0 +1,55 @@
|
|||||||
|
/*
|
||||||
|
pybind11/detail/typeid.h: Compiler-independent access to type identifiers
|
||||||
|
|
||||||
|
Copyright (c) 2016 Wenzel Jakob <wenzel.jakob@epfl.ch>
|
||||||
|
|
||||||
|
All rights reserved. Use of this source code is governed by a
|
||||||
|
BSD-style license that can be found in the LICENSE file.
|
||||||
|
*/
|
||||||
|
|
||||||
|
#pragma once
|
||||||
|
|
||||||
|
#include <cstdio>
|
||||||
|
#include <cstdlib>
|
||||||
|
|
||||||
|
#if defined(__GNUG__)
|
||||||
|
#include <cxxabi.h>
|
||||||
|
#endif
|
||||||
|
|
||||||
|
#include "common.h"
|
||||||
|
|
||||||
|
NAMESPACE_BEGIN(PYBIND11_NAMESPACE)
|
||||||
|
NAMESPACE_BEGIN(detail)
|
||||||
|
/// Erase all occurrences of a substring
|
||||||
|
inline void erase_all(std::string &string, const std::string &search) {
|
||||||
|
for (size_t pos = 0;;) {
|
||||||
|
pos = string.find(search, pos);
|
||||||
|
if (pos == std::string::npos) break;
|
||||||
|
string.erase(pos, search.length());
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
PYBIND11_NOINLINE inline void clean_type_id(std::string &name) {
|
||||||
|
#if defined(__GNUG__)
|
||||||
|
int status = 0;
|
||||||
|
std::unique_ptr<char, void (*)(void *)> res {
|
||||||
|
abi::__cxa_demangle(name.c_str(), nullptr, nullptr, &status), std::free };
|
||||||
|
if (status == 0)
|
||||||
|
name = res.get();
|
||||||
|
#else
|
||||||
|
detail::erase_all(name, "class ");
|
||||||
|
detail::erase_all(name, "struct ");
|
||||||
|
detail::erase_all(name, "enum ");
|
||||||
|
#endif
|
||||||
|
detail::erase_all(name, "pybind11::");
|
||||||
|
}
|
||||||
|
NAMESPACE_END(detail)
|
||||||
|
|
||||||
|
/// Return a string representation of a C++ type
|
||||||
|
template <typename T> static std::string type_id() {
|
||||||
|
std::string name(typeid(T).name());
|
||||||
|
detail::clean_type_id(name);
|
||||||
|
return name;
|
||||||
|
}
|
||||||
|
|
||||||
|
NAMESPACE_END(PYBIND11_NAMESPACE)
|
607
python/src/pybind11/eigen.h
Normal file
607
python/src/pybind11/eigen.h
Normal file
@@ -0,0 +1,607 @@
|
|||||||
|
/*
|
||||||
|
pybind11/eigen.h: Transparent conversion for dense and sparse Eigen matrices
|
||||||
|
|
||||||
|
Copyright (c) 2016 Wenzel Jakob <wenzel.jakob@epfl.ch>
|
||||||
|
|
||||||
|
All rights reserved. Use of this source code is governed by a
|
||||||
|
BSD-style license that can be found in the LICENSE file.
|
||||||
|
*/
|
||||||
|
|
||||||
|
#pragma once
|
||||||
|
|
||||||
|
#include "numpy.h"
|
||||||
|
|
||||||
|
#if defined(__INTEL_COMPILER)
|
||||||
|
# pragma warning(disable: 1682) // implicit conversion of a 64-bit integral type to a smaller integral type (potential portability problem)
|
||||||
|
#elif defined(__GNUG__) || defined(__clang__)
|
||||||
|
# pragma GCC diagnostic push
|
||||||
|
# pragma GCC diagnostic ignored "-Wconversion"
|
||||||
|
# pragma GCC diagnostic ignored "-Wdeprecated-declarations"
|
||||||
|
# ifdef __clang__
|
||||||
|
// Eigen generates a bunch of implicit-copy-constructor-is-deprecated warnings with -Wdeprecated
|
||||||
|
// under Clang, so disable that warning here:
|
||||||
|
# pragma GCC diagnostic ignored "-Wdeprecated"
|
||||||
|
# endif
|
||||||
|
# if __GNUC__ >= 7
|
||||||
|
# pragma GCC diagnostic ignored "-Wint-in-bool-context"
|
||||||
|
# endif
|
||||||
|
#endif
|
||||||
|
|
||||||
|
#if defined(_MSC_VER)
|
||||||
|
# pragma warning(push)
|
||||||
|
# pragma warning(disable: 4127) // warning C4127: Conditional expression is constant
|
||||||
|
# pragma warning(disable: 4996) // warning C4996: std::unary_negate is deprecated in C++17
|
||||||
|
#endif
|
||||||
|
|
||||||
|
#include <Eigen/Core>
|
||||||
|
#include <Eigen/SparseCore>
|
||||||
|
|
||||||
|
// Eigen prior to 3.2.7 doesn't have proper move constructors--but worse, some classes get implicit
|
||||||
|
// move constructors that break things. We could detect this an explicitly copy, but an extra copy
|
||||||
|
// of matrices seems highly undesirable.
|
||||||
|
static_assert(EIGEN_VERSION_AT_LEAST(3,2,7), "Eigen support in pybind11 requires Eigen >= 3.2.7");
|
||||||
|
|
||||||
|
NAMESPACE_BEGIN(PYBIND11_NAMESPACE)
|
||||||
|
|
||||||
|
// Provide a convenience alias for easier pass-by-ref usage with fully dynamic strides:
|
||||||
|
using EigenDStride = Eigen::Stride<Eigen::Dynamic, Eigen::Dynamic>;
|
||||||
|
template <typename MatrixType> using EigenDRef = Eigen::Ref<MatrixType, 0, EigenDStride>;
|
||||||
|
template <typename MatrixType> using EigenDMap = Eigen::Map<MatrixType, 0, EigenDStride>;
|
||||||
|
|
||||||
|
NAMESPACE_BEGIN(detail)
|
||||||
|
|
||||||
|
#if EIGEN_VERSION_AT_LEAST(3,3,0)
|
||||||
|
using EigenIndex = Eigen::Index;
|
||||||
|
#else
|
||||||
|
using EigenIndex = EIGEN_DEFAULT_DENSE_INDEX_TYPE;
|
||||||
|
#endif
|
||||||
|
|
||||||
|
// Matches Eigen::Map, Eigen::Ref, blocks, etc:
|
||||||
|
template <typename T> using is_eigen_dense_map = all_of<is_template_base_of<Eigen::DenseBase, T>, std::is_base_of<Eigen::MapBase<T, Eigen::ReadOnlyAccessors>, T>>;
|
||||||
|
template <typename T> using is_eigen_mutable_map = std::is_base_of<Eigen::MapBase<T, Eigen::WriteAccessors>, T>;
|
||||||
|
template <typename T> using is_eigen_dense_plain = all_of<negation<is_eigen_dense_map<T>>, is_template_base_of<Eigen::PlainObjectBase, T>>;
|
||||||
|
template <typename T> using is_eigen_sparse = is_template_base_of<Eigen::SparseMatrixBase, T>;
|
||||||
|
// Test for objects inheriting from EigenBase<Derived> that aren't captured by the above. This
|
||||||
|
// basically covers anything that can be assigned to a dense matrix but that don't have a typical
|
||||||
|
// matrix data layout that can be copied from their .data(). For example, DiagonalMatrix and
|
||||||
|
// SelfAdjointView fall into this category.
|
||||||
|
template <typename T> using is_eigen_other = all_of<
|
||||||
|
is_template_base_of<Eigen::EigenBase, T>,
|
||||||
|
negation<any_of<is_eigen_dense_map<T>, is_eigen_dense_plain<T>, is_eigen_sparse<T>>>
|
||||||
|
>;
|
||||||
|
|
||||||
|
// Captures numpy/eigen conformability status (returned by EigenProps::conformable()):
|
||||||
|
template <bool EigenRowMajor> struct EigenConformable {
|
||||||
|
bool conformable = false;
|
||||||
|
EigenIndex rows = 0, cols = 0;
|
||||||
|
EigenDStride stride{0, 0}; // Only valid if negativestrides is false!
|
||||||
|
bool negativestrides = false; // If true, do not use stride!
|
||||||
|
|
||||||
|
EigenConformable(bool fits = false) : conformable{fits} {}
|
||||||
|
// Matrix type:
|
||||||
|
EigenConformable(EigenIndex r, EigenIndex c,
|
||||||
|
EigenIndex rstride, EigenIndex cstride) :
|
||||||
|
conformable{true}, rows{r}, cols{c} {
|
||||||
|
// TODO: when Eigen bug #747 is fixed, remove the tests for non-negativity. http://eigen.tuxfamily.org/bz/show_bug.cgi?id=747
|
||||||
|
if (rstride < 0 || cstride < 0) {
|
||||||
|
negativestrides = true;
|
||||||
|
} else {
|
||||||
|
stride = {EigenRowMajor ? rstride : cstride /* outer stride */,
|
||||||
|
EigenRowMajor ? cstride : rstride /* inner stride */ };
|
||||||
|
}
|
||||||
|
}
|
||||||
|
// Vector type:
|
||||||
|
EigenConformable(EigenIndex r, EigenIndex c, EigenIndex stride)
|
||||||
|
: EigenConformable(r, c, r == 1 ? c*stride : stride, c == 1 ? r : r*stride) {}
|
||||||
|
|
||||||
|
template <typename props> bool stride_compatible() const {
|
||||||
|
// To have compatible strides, we need (on both dimensions) one of fully dynamic strides,
|
||||||
|
// matching strides, or a dimension size of 1 (in which case the stride value is irrelevant)
|
||||||
|
return
|
||||||
|
!negativestrides &&
|
||||||
|
(props::inner_stride == Eigen::Dynamic || props::inner_stride == stride.inner() ||
|
||||||
|
(EigenRowMajor ? cols : rows) == 1) &&
|
||||||
|
(props::outer_stride == Eigen::Dynamic || props::outer_stride == stride.outer() ||
|
||||||
|
(EigenRowMajor ? rows : cols) == 1);
|
||||||
|
}
|
||||||
|
operator bool() const { return conformable; }
|
||||||
|
};
|
||||||
|
|
||||||
|
template <typename Type> struct eigen_extract_stride { using type = Type; };
|
||||||
|
template <typename PlainObjectType, int MapOptions, typename StrideType>
|
||||||
|
struct eigen_extract_stride<Eigen::Map<PlainObjectType, MapOptions, StrideType>> { using type = StrideType; };
|
||||||
|
template <typename PlainObjectType, int Options, typename StrideType>
|
||||||
|
struct eigen_extract_stride<Eigen::Ref<PlainObjectType, Options, StrideType>> { using type = StrideType; };
|
||||||
|
|
||||||
|
// Helper struct for extracting information from an Eigen type
|
||||||
|
template <typename Type_> struct EigenProps {
|
||||||
|
using Type = Type_;
|
||||||
|
using Scalar = typename Type::Scalar;
|
||||||
|
using StrideType = typename eigen_extract_stride<Type>::type;
|
||||||
|
static constexpr EigenIndex
|
||||||
|
rows = Type::RowsAtCompileTime,
|
||||||
|
cols = Type::ColsAtCompileTime,
|
||||||
|
size = Type::SizeAtCompileTime;
|
||||||
|
static constexpr bool
|
||||||
|
row_major = Type::IsRowMajor,
|
||||||
|
vector = Type::IsVectorAtCompileTime, // At least one dimension has fixed size 1
|
||||||
|
fixed_rows = rows != Eigen::Dynamic,
|
||||||
|
fixed_cols = cols != Eigen::Dynamic,
|
||||||
|
fixed = size != Eigen::Dynamic, // Fully-fixed size
|
||||||
|
dynamic = !fixed_rows && !fixed_cols; // Fully-dynamic size
|
||||||
|
|
||||||
|
template <EigenIndex i, EigenIndex ifzero> using if_zero = std::integral_constant<EigenIndex, i == 0 ? ifzero : i>;
|
||||||
|
static constexpr EigenIndex inner_stride = if_zero<StrideType::InnerStrideAtCompileTime, 1>::value,
|
||||||
|
outer_stride = if_zero<StrideType::OuterStrideAtCompileTime,
|
||||||
|
vector ? size : row_major ? cols : rows>::value;
|
||||||
|
static constexpr bool dynamic_stride = inner_stride == Eigen::Dynamic && outer_stride == Eigen::Dynamic;
|
||||||
|
static constexpr bool requires_row_major = !dynamic_stride && !vector && (row_major ? inner_stride : outer_stride) == 1;
|
||||||
|
static constexpr bool requires_col_major = !dynamic_stride && !vector && (row_major ? outer_stride : inner_stride) == 1;
|
||||||
|
|
||||||
|
// Takes an input array and determines whether we can make it fit into the Eigen type. If
|
||||||
|
// the array is a vector, we attempt to fit it into either an Eigen 1xN or Nx1 vector
|
||||||
|
// (preferring the latter if it will fit in either, i.e. for a fully dynamic matrix type).
|
||||||
|
static EigenConformable<row_major> conformable(const array &a) {
|
||||||
|
const auto dims = a.ndim();
|
||||||
|
if (dims < 1 || dims > 2)
|
||||||
|
return false;
|
||||||
|
|
||||||
|
if (dims == 2) { // Matrix type: require exact match (or dynamic)
|
||||||
|
|
||||||
|
EigenIndex
|
||||||
|
np_rows = a.shape(0),
|
||||||
|
np_cols = a.shape(1),
|
||||||
|
np_rstride = a.strides(0) / static_cast<ssize_t>(sizeof(Scalar)),
|
||||||
|
np_cstride = a.strides(1) / static_cast<ssize_t>(sizeof(Scalar));
|
||||||
|
if ((fixed_rows && np_rows != rows) || (fixed_cols && np_cols != cols))
|
||||||
|
return false;
|
||||||
|
|
||||||
|
return {np_rows, np_cols, np_rstride, np_cstride};
|
||||||
|
}
|
||||||
|
|
||||||
|
// Otherwise we're storing an n-vector. Only one of the strides will be used, but whichever
|
||||||
|
// is used, we want the (single) numpy stride value.
|
||||||
|
const EigenIndex n = a.shape(0),
|
||||||
|
stride = a.strides(0) / static_cast<ssize_t>(sizeof(Scalar));
|
||||||
|
|
||||||
|
if (vector) { // Eigen type is a compile-time vector
|
||||||
|
if (fixed && size != n)
|
||||||
|
return false; // Vector size mismatch
|
||||||
|
return {rows == 1 ? 1 : n, cols == 1 ? 1 : n, stride};
|
||||||
|
}
|
||||||
|
else if (fixed) {
|
||||||
|
// The type has a fixed size, but is not a vector: abort
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
else if (fixed_cols) {
|
||||||
|
// Since this isn't a vector, cols must be != 1. We allow this only if it exactly
|
||||||
|
// equals the number of elements (rows is Dynamic, and so 1 row is allowed).
|
||||||
|
if (cols != n) return false;
|
||||||
|
return {1, n, stride};
|
||||||
|
}
|
||||||
|
else {
|
||||||
|
// Otherwise it's either fully dynamic, or column dynamic; both become a column vector
|
||||||
|
if (fixed_rows && rows != n) return false;
|
||||||
|
return {n, 1, stride};
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
static constexpr bool show_writeable = is_eigen_dense_map<Type>::value && is_eigen_mutable_map<Type>::value;
|
||||||
|
static constexpr bool show_order = is_eigen_dense_map<Type>::value;
|
||||||
|
static constexpr bool show_c_contiguous = show_order && requires_row_major;
|
||||||
|
static constexpr bool show_f_contiguous = !show_c_contiguous && show_order && requires_col_major;
|
||||||
|
|
||||||
|
static constexpr auto descriptor =
|
||||||
|
_("numpy.ndarray[") + npy_format_descriptor<Scalar>::name +
|
||||||
|
_("[") + _<fixed_rows>(_<(size_t) rows>(), _("m")) +
|
||||||
|
_(", ") + _<fixed_cols>(_<(size_t) cols>(), _("n")) +
|
||||||
|
_("]") +
|
||||||
|
// For a reference type (e.g. Ref<MatrixXd>) we have other constraints that might need to be
|
||||||
|
// satisfied: writeable=True (for a mutable reference), and, depending on the map's stride
|
||||||
|
// options, possibly f_contiguous or c_contiguous. We include them in the descriptor output
|
||||||
|
// to provide some hint as to why a TypeError is occurring (otherwise it can be confusing to
|
||||||
|
// see that a function accepts a 'numpy.ndarray[float64[3,2]]' and an error message that you
|
||||||
|
// *gave* a numpy.ndarray of the right type and dimensions.
|
||||||
|
_<show_writeable>(", flags.writeable", "") +
|
||||||
|
_<show_c_contiguous>(", flags.c_contiguous", "") +
|
||||||
|
_<show_f_contiguous>(", flags.f_contiguous", "") +
|
||||||
|
_("]");
|
||||||
|
};
|
||||||
|
|
||||||
|
// Casts an Eigen type to numpy array. If given a base, the numpy array references the src data,
|
||||||
|
// otherwise it'll make a copy. writeable lets you turn off the writeable flag for the array.
|
||||||
|
template <typename props> handle eigen_array_cast(typename props::Type const &src, handle base = handle(), bool writeable = true) {
|
||||||
|
constexpr ssize_t elem_size = sizeof(typename props::Scalar);
|
||||||
|
array a;
|
||||||
|
if (props::vector)
|
||||||
|
a = array({ src.size() }, { elem_size * src.innerStride() }, src.data(), base);
|
||||||
|
else
|
||||||
|
a = array({ src.rows(), src.cols() }, { elem_size * src.rowStride(), elem_size * src.colStride() },
|
||||||
|
src.data(), base);
|
||||||
|
|
||||||
|
if (!writeable)
|
||||||
|
array_proxy(a.ptr())->flags &= ~detail::npy_api::NPY_ARRAY_WRITEABLE_;
|
||||||
|
|
||||||
|
return a.release();
|
||||||
|
}
|
||||||
|
|
||||||
|
// Takes an lvalue ref to some Eigen type and a (python) base object, creating a numpy array that
|
||||||
|
// reference the Eigen object's data with `base` as the python-registered base class (if omitted,
|
||||||
|
// the base will be set to None, and lifetime management is up to the caller). The numpy array is
|
||||||
|
// non-writeable if the given type is const.
|
||||||
|
template <typename props, typename Type>
|
||||||
|
handle eigen_ref_array(Type &src, handle parent = none()) {
|
||||||
|
// none here is to get past array's should-we-copy detection, which currently always
|
||||||
|
// copies when there is no base. Setting the base to None should be harmless.
|
||||||
|
return eigen_array_cast<props>(src, parent, !std::is_const<Type>::value);
|
||||||
|
}
|
||||||
|
|
||||||
|
// Takes a pointer to some dense, plain Eigen type, builds a capsule around it, then returns a numpy
|
||||||
|
// array that references the encapsulated data with a python-side reference to the capsule to tie
|
||||||
|
// its destruction to that of any dependent python objects. Const-ness is determined by whether or
|
||||||
|
// not the Type of the pointer given is const.
|
||||||
|
template <typename props, typename Type, typename = enable_if_t<is_eigen_dense_plain<Type>::value>>
|
||||||
|
handle eigen_encapsulate(Type *src) {
|
||||||
|
capsule base(src, [](void *o) { delete static_cast<Type *>(o); });
|
||||||
|
return eigen_ref_array<props>(*src, base);
|
||||||
|
}
|
||||||
|
|
||||||
|
// Type caster for regular, dense matrix types (e.g. MatrixXd), but not maps/refs/etc. of dense
|
||||||
|
// types.
|
||||||
|
template<typename Type>
|
||||||
|
struct type_caster<Type, enable_if_t<is_eigen_dense_plain<Type>::value>> {
|
||||||
|
using Scalar = typename Type::Scalar;
|
||||||
|
using props = EigenProps<Type>;
|
||||||
|
|
||||||
|
bool load(handle src, bool convert) {
|
||||||
|
// If we're in no-convert mode, only load if given an array of the correct type
|
||||||
|
if (!convert && !isinstance<array_t<Scalar>>(src))
|
||||||
|
return false;
|
||||||
|
|
||||||
|
// Coerce into an array, but don't do type conversion yet; the copy below handles it.
|
||||||
|
auto buf = array::ensure(src);
|
||||||
|
|
||||||
|
if (!buf)
|
||||||
|
return false;
|
||||||
|
|
||||||
|
auto dims = buf.ndim();
|
||||||
|
if (dims < 1 || dims > 2)
|
||||||
|
return false;
|
||||||
|
|
||||||
|
auto fits = props::conformable(buf);
|
||||||
|
if (!fits)
|
||||||
|
return false;
|
||||||
|
|
||||||
|
// Allocate the new type, then build a numpy reference into it
|
||||||
|
value = Type(fits.rows, fits.cols);
|
||||||
|
auto ref = reinterpret_steal<array>(eigen_ref_array<props>(value));
|
||||||
|
if (dims == 1) ref = ref.squeeze();
|
||||||
|
else if (ref.ndim() == 1) buf = buf.squeeze();
|
||||||
|
|
||||||
|
int result = detail::npy_api::get().PyArray_CopyInto_(ref.ptr(), buf.ptr());
|
||||||
|
|
||||||
|
if (result < 0) { // Copy failed!
|
||||||
|
PyErr_Clear();
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
|
||||||
|
private:
|
||||||
|
|
||||||
|
// Cast implementation
|
||||||
|
template <typename CType>
|
||||||
|
static handle cast_impl(CType *src, return_value_policy policy, handle parent) {
|
||||||
|
switch (policy) {
|
||||||
|
case return_value_policy::take_ownership:
|
||||||
|
case return_value_policy::automatic:
|
||||||
|
return eigen_encapsulate<props>(src);
|
||||||
|
case return_value_policy::move:
|
||||||
|
return eigen_encapsulate<props>(new CType(std::move(*src)));
|
||||||
|
case return_value_policy::copy:
|
||||||
|
return eigen_array_cast<props>(*src);
|
||||||
|
case return_value_policy::reference:
|
||||||
|
case return_value_policy::automatic_reference:
|
||||||
|
return eigen_ref_array<props>(*src);
|
||||||
|
case return_value_policy::reference_internal:
|
||||||
|
return eigen_ref_array<props>(*src, parent);
|
||||||
|
default:
|
||||||
|
throw cast_error("unhandled return_value_policy: should not happen!");
|
||||||
|
};
|
||||||
|
}
|
||||||
|
|
||||||
|
public:
|
||||||
|
|
||||||
|
// Normal returned non-reference, non-const value:
|
||||||
|
static handle cast(Type &&src, return_value_policy /* policy */, handle parent) {
|
||||||
|
return cast_impl(&src, return_value_policy::move, parent);
|
||||||
|
}
|
||||||
|
// If you return a non-reference const, we mark the numpy array readonly:
|
||||||
|
static handle cast(const Type &&src, return_value_policy /* policy */, handle parent) {
|
||||||
|
return cast_impl(&src, return_value_policy::move, parent);
|
||||||
|
}
|
||||||
|
// lvalue reference return; default (automatic) becomes copy
|
||||||
|
static handle cast(Type &src, return_value_policy policy, handle parent) {
|
||||||
|
if (policy == return_value_policy::automatic || policy == return_value_policy::automatic_reference)
|
||||||
|
policy = return_value_policy::copy;
|
||||||
|
return cast_impl(&src, policy, parent);
|
||||||
|
}
|
||||||
|
// const lvalue reference return; default (automatic) becomes copy
|
||||||
|
static handle cast(const Type &src, return_value_policy policy, handle parent) {
|
||||||
|
if (policy == return_value_policy::automatic || policy == return_value_policy::automatic_reference)
|
||||||
|
policy = return_value_policy::copy;
|
||||||
|
return cast(&src, policy, parent);
|
||||||
|
}
|
||||||
|
// non-const pointer return
|
||||||
|
static handle cast(Type *src, return_value_policy policy, handle parent) {
|
||||||
|
return cast_impl(src, policy, parent);
|
||||||
|
}
|
||||||
|
// const pointer return
|
||||||
|
static handle cast(const Type *src, return_value_policy policy, handle parent) {
|
||||||
|
return cast_impl(src, policy, parent);
|
||||||
|
}
|
||||||
|
|
||||||
|
static constexpr auto name = props::descriptor;
|
||||||
|
|
||||||
|
operator Type*() { return &value; }
|
||||||
|
operator Type&() { return value; }
|
||||||
|
operator Type&&() && { return std::move(value); }
|
||||||
|
template <typename T> using cast_op_type = movable_cast_op_type<T>;
|
||||||
|
|
||||||
|
private:
|
||||||
|
Type value;
|
||||||
|
};
|
||||||
|
|
||||||
|
// Base class for casting reference/map/block/etc. objects back to python.
|
||||||
|
template <typename MapType> struct eigen_map_caster {
|
||||||
|
private:
|
||||||
|
using props = EigenProps<MapType>;
|
||||||
|
|
||||||
|
public:
|
||||||
|
|
||||||
|
// Directly referencing a ref/map's data is a bit dangerous (whatever the map/ref points to has
|
||||||
|
// to stay around), but we'll allow it under the assumption that you know what you're doing (and
|
||||||
|
// have an appropriate keep_alive in place). We return a numpy array pointing directly at the
|
||||||
|
// ref's data (The numpy array ends up read-only if the ref was to a const matrix type.) Note
|
||||||
|
// that this means you need to ensure you don't destroy the object in some other way (e.g. with
|
||||||
|
// an appropriate keep_alive, or with a reference to a statically allocated matrix).
|
||||||
|
static handle cast(const MapType &src, return_value_policy policy, handle parent) {
|
||||||
|
switch (policy) {
|
||||||
|
case return_value_policy::copy:
|
||||||
|
return eigen_array_cast<props>(src);
|
||||||
|
case return_value_policy::reference_internal:
|
||||||
|
return eigen_array_cast<props>(src, parent, is_eigen_mutable_map<MapType>::value);
|
||||||
|
case return_value_policy::reference:
|
||||||
|
case return_value_policy::automatic:
|
||||||
|
case return_value_policy::automatic_reference:
|
||||||
|
return eigen_array_cast<props>(src, none(), is_eigen_mutable_map<MapType>::value);
|
||||||
|
default:
|
||||||
|
// move, take_ownership don't make any sense for a ref/map:
|
||||||
|
pybind11_fail("Invalid return_value_policy for Eigen Map/Ref/Block type");
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
static constexpr auto name = props::descriptor;
|
||||||
|
|
||||||
|
// Explicitly delete these: support python -> C++ conversion on these (i.e. these can be return
|
||||||
|
// types but not bound arguments). We still provide them (with an explicitly delete) so that
|
||||||
|
// you end up here if you try anyway.
|
||||||
|
bool load(handle, bool) = delete;
|
||||||
|
operator MapType() = delete;
|
||||||
|
template <typename> using cast_op_type = MapType;
|
||||||
|
};
|
||||||
|
|
||||||
|
// We can return any map-like object (but can only load Refs, specialized next):
|
||||||
|
template <typename Type> struct type_caster<Type, enable_if_t<is_eigen_dense_map<Type>::value>>
|
||||||
|
: eigen_map_caster<Type> {};
|
||||||
|
|
||||||
|
// Loader for Ref<...> arguments. See the documentation for info on how to make this work without
|
||||||
|
// copying (it requires some extra effort in many cases).
|
||||||
|
template <typename PlainObjectType, typename StrideType>
|
||||||
|
struct type_caster<
|
||||||
|
Eigen::Ref<PlainObjectType, 0, StrideType>,
|
||||||
|
enable_if_t<is_eigen_dense_map<Eigen::Ref<PlainObjectType, 0, StrideType>>::value>
|
||||||
|
> : public eigen_map_caster<Eigen::Ref<PlainObjectType, 0, StrideType>> {
|
||||||
|
private:
|
||||||
|
using Type = Eigen::Ref<PlainObjectType, 0, StrideType>;
|
||||||
|
using props = EigenProps<Type>;
|
||||||
|
using Scalar = typename props::Scalar;
|
||||||
|
using MapType = Eigen::Map<PlainObjectType, 0, StrideType>;
|
||||||
|
using Array = array_t<Scalar, array::forcecast |
|
||||||
|
((props::row_major ? props::inner_stride : props::outer_stride) == 1 ? array::c_style :
|
||||||
|
(props::row_major ? props::outer_stride : props::inner_stride) == 1 ? array::f_style : 0)>;
|
||||||
|
static constexpr bool need_writeable = is_eigen_mutable_map<Type>::value;
|
||||||
|
// Delay construction (these have no default constructor)
|
||||||
|
std::unique_ptr<MapType> map;
|
||||||
|
std::unique_ptr<Type> ref;
|
||||||
|
// Our array. When possible, this is just a numpy array pointing to the source data, but
|
||||||
|
// sometimes we can't avoid copying (e.g. input is not a numpy array at all, has an incompatible
|
||||||
|
// layout, or is an array of a type that needs to be converted). Using a numpy temporary
|
||||||
|
// (rather than an Eigen temporary) saves an extra copy when we need both type conversion and
|
||||||
|
// storage order conversion. (Note that we refuse to use this temporary copy when loading an
|
||||||
|
// argument for a Ref<M> with M non-const, i.e. a read-write reference).
|
||||||
|
Array copy_or_ref;
|
||||||
|
public:
|
||||||
|
bool load(handle src, bool convert) {
|
||||||
|
// First check whether what we have is already an array of the right type. If not, we can't
|
||||||
|
// avoid a copy (because the copy is also going to do type conversion).
|
||||||
|
bool need_copy = !isinstance<Array>(src);
|
||||||
|
|
||||||
|
EigenConformable<props::row_major> fits;
|
||||||
|
if (!need_copy) {
|
||||||
|
// We don't need a converting copy, but we also need to check whether the strides are
|
||||||
|
// compatible with the Ref's stride requirements
|
||||||
|
Array aref = reinterpret_borrow<Array>(src);
|
||||||
|
|
||||||
|
if (aref && (!need_writeable || aref.writeable())) {
|
||||||
|
fits = props::conformable(aref);
|
||||||
|
if (!fits) return false; // Incompatible dimensions
|
||||||
|
if (!fits.template stride_compatible<props>())
|
||||||
|
need_copy = true;
|
||||||
|
else
|
||||||
|
copy_or_ref = std::move(aref);
|
||||||
|
}
|
||||||
|
else {
|
||||||
|
need_copy = true;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
if (need_copy) {
|
||||||
|
// We need to copy: If we need a mutable reference, or we're not supposed to convert
|
||||||
|
// (either because we're in the no-convert overload pass, or because we're explicitly
|
||||||
|
// instructed not to copy (via `py::arg().noconvert()`) we have to fail loading.
|
||||||
|
if (!convert || need_writeable) return false;
|
||||||
|
|
||||||
|
Array copy = Array::ensure(src);
|
||||||
|
if (!copy) return false;
|
||||||
|
fits = props::conformable(copy);
|
||||||
|
if (!fits || !fits.template stride_compatible<props>())
|
||||||
|
return false;
|
||||||
|
copy_or_ref = std::move(copy);
|
||||||
|
loader_life_support::add_patient(copy_or_ref);
|
||||||
|
}
|
||||||
|
|
||||||
|
ref.reset();
|
||||||
|
map.reset(new MapType(data(copy_or_ref), fits.rows, fits.cols, make_stride(fits.stride.outer(), fits.stride.inner())));
|
||||||
|
ref.reset(new Type(*map));
|
||||||
|
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
|
||||||
|
operator Type*() { return ref.get(); }
|
||||||
|
operator Type&() { return *ref; }
|
||||||
|
template <typename _T> using cast_op_type = pybind11::detail::cast_op_type<_T>;
|
||||||
|
|
||||||
|
private:
|
||||||
|
template <typename T = Type, enable_if_t<is_eigen_mutable_map<T>::value, int> = 0>
|
||||||
|
Scalar *data(Array &a) { return a.mutable_data(); }
|
||||||
|
|
||||||
|
template <typename T = Type, enable_if_t<!is_eigen_mutable_map<T>::value, int> = 0>
|
||||||
|
const Scalar *data(Array &a) { return a.data(); }
|
||||||
|
|
||||||
|
// Attempt to figure out a constructor of `Stride` that will work.
|
||||||
|
// If both strides are fixed, use a default constructor:
|
||||||
|
template <typename S> using stride_ctor_default = bool_constant<
|
||||||
|
S::InnerStrideAtCompileTime != Eigen::Dynamic && S::OuterStrideAtCompileTime != Eigen::Dynamic &&
|
||||||
|
std::is_default_constructible<S>::value>;
|
||||||
|
// Otherwise, if there is a two-index constructor, assume it is (outer,inner) like
|
||||||
|
// Eigen::Stride, and use it:
|
||||||
|
template <typename S> using stride_ctor_dual = bool_constant<
|
||||||
|
!stride_ctor_default<S>::value && std::is_constructible<S, EigenIndex, EigenIndex>::value>;
|
||||||
|
// Otherwise, if there is a one-index constructor, and just one of the strides is dynamic, use
|
||||||
|
// it (passing whichever stride is dynamic).
|
||||||
|
template <typename S> using stride_ctor_outer = bool_constant<
|
||||||
|
!any_of<stride_ctor_default<S>, stride_ctor_dual<S>>::value &&
|
||||||
|
S::OuterStrideAtCompileTime == Eigen::Dynamic && S::InnerStrideAtCompileTime != Eigen::Dynamic &&
|
||||||
|
std::is_constructible<S, EigenIndex>::value>;
|
||||||
|
template <typename S> using stride_ctor_inner = bool_constant<
|
||||||
|
!any_of<stride_ctor_default<S>, stride_ctor_dual<S>>::value &&
|
||||||
|
S::InnerStrideAtCompileTime == Eigen::Dynamic && S::OuterStrideAtCompileTime != Eigen::Dynamic &&
|
||||||
|
std::is_constructible<S, EigenIndex>::value>;
|
||||||
|
|
||||||
|
template <typename S = StrideType, enable_if_t<stride_ctor_default<S>::value, int> = 0>
|
||||||
|
static S make_stride(EigenIndex, EigenIndex) { return S(); }
|
||||||
|
template <typename S = StrideType, enable_if_t<stride_ctor_dual<S>::value, int> = 0>
|
||||||
|
static S make_stride(EigenIndex outer, EigenIndex inner) { return S(outer, inner); }
|
||||||
|
template <typename S = StrideType, enable_if_t<stride_ctor_outer<S>::value, int> = 0>
|
||||||
|
static S make_stride(EigenIndex outer, EigenIndex) { return S(outer); }
|
||||||
|
template <typename S = StrideType, enable_if_t<stride_ctor_inner<S>::value, int> = 0>
|
||||||
|
static S make_stride(EigenIndex, EigenIndex inner) { return S(inner); }
|
||||||
|
|
||||||
|
};
|
||||||
|
|
||||||
|
// type_caster for special matrix types (e.g. DiagonalMatrix), which are EigenBase, but not
|
||||||
|
// EigenDense (i.e. they don't have a data(), at least not with the usual matrix layout).
|
||||||
|
// load() is not supported, but we can cast them into the python domain by first copying to a
|
||||||
|
// regular Eigen::Matrix, then casting that.
|
||||||
|
template <typename Type>
|
||||||
|
struct type_caster<Type, enable_if_t<is_eigen_other<Type>::value>> {
|
||||||
|
protected:
|
||||||
|
using Matrix = Eigen::Matrix<typename Type::Scalar, Type::RowsAtCompileTime, Type::ColsAtCompileTime>;
|
||||||
|
using props = EigenProps<Matrix>;
|
||||||
|
public:
|
||||||
|
static handle cast(const Type &src, return_value_policy /* policy */, handle /* parent */) {
|
||||||
|
handle h = eigen_encapsulate<props>(new Matrix(src));
|
||||||
|
return h;
|
||||||
|
}
|
||||||
|
static handle cast(const Type *src, return_value_policy policy, handle parent) { return cast(*src, policy, parent); }
|
||||||
|
|
||||||
|
static constexpr auto name = props::descriptor;
|
||||||
|
|
||||||
|
// Explicitly delete these: support python -> C++ conversion on these (i.e. these can be return
|
||||||
|
// types but not bound arguments). We still provide them (with an explicitly delete) so that
|
||||||
|
// you end up here if you try anyway.
|
||||||
|
bool load(handle, bool) = delete;
|
||||||
|
operator Type() = delete;
|
||||||
|
template <typename> using cast_op_type = Type;
|
||||||
|
};
|
||||||
|
|
||||||
|
template<typename Type>
|
||||||
|
struct type_caster<Type, enable_if_t<is_eigen_sparse<Type>::value>> {
|
||||||
|
typedef typename Type::Scalar Scalar;
|
||||||
|
typedef remove_reference_t<decltype(*std::declval<Type>().outerIndexPtr())> StorageIndex;
|
||||||
|
typedef typename Type::Index Index;
|
||||||
|
static constexpr bool rowMajor = Type::IsRowMajor;
|
||||||
|
|
||||||
|
bool load(handle src, bool) {
|
||||||
|
if (!src)
|
||||||
|
return false;
|
||||||
|
|
||||||
|
auto obj = reinterpret_borrow<object>(src);
|
||||||
|
object sparse_module = module::import("scipy.sparse");
|
||||||
|
object matrix_type = sparse_module.attr(
|
||||||
|
rowMajor ? "csr_matrix" : "csc_matrix");
|
||||||
|
|
||||||
|
if (!obj.get_type().is(matrix_type)) {
|
||||||
|
try {
|
||||||
|
obj = matrix_type(obj);
|
||||||
|
} catch (const error_already_set &) {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
auto values = array_t<Scalar>((object) obj.attr("data"));
|
||||||
|
auto innerIndices = array_t<StorageIndex>((object) obj.attr("indices"));
|
||||||
|
auto outerIndices = array_t<StorageIndex>((object) obj.attr("indptr"));
|
||||||
|
auto shape = pybind11::tuple((pybind11::object) obj.attr("shape"));
|
||||||
|
auto nnz = obj.attr("nnz").cast<Index>();
|
||||||
|
|
||||||
|
if (!values || !innerIndices || !outerIndices)
|
||||||
|
return false;
|
||||||
|
|
||||||
|
value = Eigen::MappedSparseMatrix<Scalar, Type::Flags, StorageIndex>(
|
||||||
|
shape[0].cast<Index>(), shape[1].cast<Index>(), nnz,
|
||||||
|
outerIndices.mutable_data(), innerIndices.mutable_data(), values.mutable_data());
|
||||||
|
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
|
||||||
|
static handle cast(const Type &src, return_value_policy /* policy */, handle /* parent */) {
|
||||||
|
const_cast<Type&>(src).makeCompressed();
|
||||||
|
|
||||||
|
object matrix_type = module::import("scipy.sparse").attr(
|
||||||
|
rowMajor ? "csr_matrix" : "csc_matrix");
|
||||||
|
|
||||||
|
array data(src.nonZeros(), src.valuePtr());
|
||||||
|
array outerIndices((rowMajor ? src.rows() : src.cols()) + 1, src.outerIndexPtr());
|
||||||
|
array innerIndices(src.nonZeros(), src.innerIndexPtr());
|
||||||
|
|
||||||
|
return matrix_type(
|
||||||
|
std::make_tuple(data, innerIndices, outerIndices),
|
||||||
|
std::make_pair(src.rows(), src.cols())
|
||||||
|
).release();
|
||||||
|
}
|
||||||
|
|
||||||
|
PYBIND11_TYPE_CASTER(Type, _<(Type::IsRowMajor) != 0>("scipy.sparse.csr_matrix[", "scipy.sparse.csc_matrix[")
|
||||||
|
+ npy_format_descriptor<Scalar>::name + _("]"));
|
||||||
|
};
|
||||||
|
|
||||||
|
NAMESPACE_END(detail)
|
||||||
|
NAMESPACE_END(PYBIND11_NAMESPACE)
|
||||||
|
|
||||||
|
#if defined(__GNUG__) || defined(__clang__)
|
||||||
|
# pragma GCC diagnostic pop
|
||||||
|
#elif defined(_MSC_VER)
|
||||||
|
# pragma warning(pop)
|
||||||
|
#endif
|
200
python/src/pybind11/embed.h
Normal file
200
python/src/pybind11/embed.h
Normal file
@@ -0,0 +1,200 @@
|
|||||||
|
/*
|
||||||
|
pybind11/embed.h: Support for embedding the interpreter
|
||||||
|
|
||||||
|
Copyright (c) 2017 Wenzel Jakob <wenzel.jakob@epfl.ch>
|
||||||
|
|
||||||
|
All rights reserved. Use of this source code is governed by a
|
||||||
|
BSD-style license that can be found in the LICENSE file.
|
||||||
|
*/
|
||||||
|
|
||||||
|
#pragma once
|
||||||
|
|
||||||
|
#include "pybind11.h"
|
||||||
|
#include "eval.h"
|
||||||
|
|
||||||
|
#if defined(PYPY_VERSION)
|
||||||
|
# error Embedding the interpreter is not supported with PyPy
|
||||||
|
#endif
|
||||||
|
|
||||||
|
#if PY_MAJOR_VERSION >= 3
|
||||||
|
# define PYBIND11_EMBEDDED_MODULE_IMPL(name) \
|
||||||
|
extern "C" PyObject *pybind11_init_impl_##name() { \
|
||||||
|
return pybind11_init_wrapper_##name(); \
|
||||||
|
}
|
||||||
|
#else
|
||||||
|
# define PYBIND11_EMBEDDED_MODULE_IMPL(name) \
|
||||||
|
extern "C" void pybind11_init_impl_##name() { \
|
||||||
|
pybind11_init_wrapper_##name(); \
|
||||||
|
}
|
||||||
|
#endif
|
||||||
|
|
||||||
|
/** \rst
|
||||||
|
Add a new module to the table of builtins for the interpreter. Must be
|
||||||
|
defined in global scope. The first macro parameter is the name of the
|
||||||
|
module (without quotes). The second parameter is the variable which will
|
||||||
|
be used as the interface to add functions and classes to the module.
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
PYBIND11_EMBEDDED_MODULE(example, m) {
|
||||||
|
// ... initialize functions and classes here
|
||||||
|
m.def("foo", []() {
|
||||||
|
return "Hello, World!";
|
||||||
|
});
|
||||||
|
}
|
||||||
|
\endrst */
|
||||||
|
#define PYBIND11_EMBEDDED_MODULE(name, variable) \
|
||||||
|
static void PYBIND11_CONCAT(pybind11_init_, name)(pybind11::module &); \
|
||||||
|
static PyObject PYBIND11_CONCAT(*pybind11_init_wrapper_, name)() { \
|
||||||
|
auto m = pybind11::module(PYBIND11_TOSTRING(name)); \
|
||||||
|
try { \
|
||||||
|
PYBIND11_CONCAT(pybind11_init_, name)(m); \
|
||||||
|
return m.ptr(); \
|
||||||
|
} catch (pybind11::error_already_set &e) { \
|
||||||
|
PyErr_SetString(PyExc_ImportError, e.what()); \
|
||||||
|
return nullptr; \
|
||||||
|
} catch (const std::exception &e) { \
|
||||||
|
PyErr_SetString(PyExc_ImportError, e.what()); \
|
||||||
|
return nullptr; \
|
||||||
|
} \
|
||||||
|
} \
|
||||||
|
PYBIND11_EMBEDDED_MODULE_IMPL(name) \
|
||||||
|
pybind11::detail::embedded_module name(PYBIND11_TOSTRING(name), \
|
||||||
|
PYBIND11_CONCAT(pybind11_init_impl_, name)); \
|
||||||
|
void PYBIND11_CONCAT(pybind11_init_, name)(pybind11::module &variable)
|
||||||
|
|
||||||
|
|
||||||
|
NAMESPACE_BEGIN(PYBIND11_NAMESPACE)
|
||||||
|
NAMESPACE_BEGIN(detail)
|
||||||
|
|
||||||
|
/// Python 2.7/3.x compatible version of `PyImport_AppendInittab` and error checks.
|
||||||
|
struct embedded_module {
|
||||||
|
#if PY_MAJOR_VERSION >= 3
|
||||||
|
using init_t = PyObject *(*)();
|
||||||
|
#else
|
||||||
|
using init_t = void (*)();
|
||||||
|
#endif
|
||||||
|
embedded_module(const char *name, init_t init) {
|
||||||
|
if (Py_IsInitialized())
|
||||||
|
pybind11_fail("Can't add new modules after the interpreter has been initialized");
|
||||||
|
|
||||||
|
auto result = PyImport_AppendInittab(name, init);
|
||||||
|
if (result == -1)
|
||||||
|
pybind11_fail("Insufficient memory to add a new module");
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
NAMESPACE_END(detail)
|
||||||
|
|
||||||
|
/** \rst
|
||||||
|
Initialize the Python interpreter. No other pybind11 or CPython API functions can be
|
||||||
|
called before this is done; with the exception of `PYBIND11_EMBEDDED_MODULE`. The
|
||||||
|
optional parameter can be used to skip the registration of signal handlers (see the
|
||||||
|
`Python documentation`_ for details). Calling this function again after the interpreter
|
||||||
|
has already been initialized is a fatal error.
|
||||||
|
|
||||||
|
If initializing the Python interpreter fails, then the program is terminated. (This
|
||||||
|
is controlled by the CPython runtime and is an exception to pybind11's normal behavior
|
||||||
|
of throwing exceptions on errors.)
|
||||||
|
|
||||||
|
.. _Python documentation: https://docs.python.org/3/c-api/init.html#c.Py_InitializeEx
|
||||||
|
\endrst */
|
||||||
|
inline void initialize_interpreter(bool init_signal_handlers = true) {
|
||||||
|
if (Py_IsInitialized())
|
||||||
|
pybind11_fail("The interpreter is already running");
|
||||||
|
|
||||||
|
Py_InitializeEx(init_signal_handlers ? 1 : 0);
|
||||||
|
|
||||||
|
// Make .py files in the working directory available by default
|
||||||
|
module::import("sys").attr("path").cast<list>().append(".");
|
||||||
|
}
|
||||||
|
|
||||||
|
/** \rst
|
||||||
|
Shut down the Python interpreter. No pybind11 or CPython API functions can be called
|
||||||
|
after this. In addition, pybind11 objects must not outlive the interpreter:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
{ // BAD
|
||||||
|
py::initialize_interpreter();
|
||||||
|
auto hello = py::str("Hello, World!");
|
||||||
|
py::finalize_interpreter();
|
||||||
|
} // <-- BOOM, hello's destructor is called after interpreter shutdown
|
||||||
|
|
||||||
|
{ // GOOD
|
||||||
|
py::initialize_interpreter();
|
||||||
|
{ // scoped
|
||||||
|
auto hello = py::str("Hello, World!");
|
||||||
|
} // <-- OK, hello is cleaned up properly
|
||||||
|
py::finalize_interpreter();
|
||||||
|
}
|
||||||
|
|
||||||
|
{ // BETTER
|
||||||
|
py::scoped_interpreter guard{};
|
||||||
|
auto hello = py::str("Hello, World!");
|
||||||
|
}
|
||||||
|
|
||||||
|
.. warning::
|
||||||
|
|
||||||
|
The interpreter can be restarted by calling `initialize_interpreter` again.
|
||||||
|
Modules created using pybind11 can be safely re-initialized. However, Python
|
||||||
|
itself cannot completely unload binary extension modules and there are several
|
||||||
|
caveats with regard to interpreter restarting. All the details can be found
|
||||||
|
in the CPython documentation. In short, not all interpreter memory may be
|
||||||
|
freed, either due to reference cycles or user-created global data.
|
||||||
|
|
||||||
|
\endrst */
|
||||||
|
inline void finalize_interpreter() {
|
||||||
|
handle builtins(PyEval_GetBuiltins());
|
||||||
|
const char *id = PYBIND11_INTERNALS_ID;
|
||||||
|
|
||||||
|
// Get the internals pointer (without creating it if it doesn't exist). It's possible for the
|
||||||
|
// internals to be created during Py_Finalize() (e.g. if a py::capsule calls `get_internals()`
|
||||||
|
// during destruction), so we get the pointer-pointer here and check it after Py_Finalize().
|
||||||
|
detail::internals **internals_ptr_ptr = detail::get_internals_pp();
|
||||||
|
// It could also be stashed in builtins, so look there too:
|
||||||
|
if (builtins.contains(id) && isinstance<capsule>(builtins[id]))
|
||||||
|
internals_ptr_ptr = capsule(builtins[id]);
|
||||||
|
|
||||||
|
Py_Finalize();
|
||||||
|
|
||||||
|
if (internals_ptr_ptr) {
|
||||||
|
delete *internals_ptr_ptr;
|
||||||
|
*internals_ptr_ptr = nullptr;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/** \rst
|
||||||
|
Scope guard version of `initialize_interpreter` and `finalize_interpreter`.
|
||||||
|
This a move-only guard and only a single instance can exist.
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
#include <pybind11/embed.h>
|
||||||
|
|
||||||
|
int main() {
|
||||||
|
py::scoped_interpreter guard{};
|
||||||
|
py::print(Hello, World!);
|
||||||
|
} // <-- interpreter shutdown
|
||||||
|
\endrst */
|
||||||
|
class scoped_interpreter {
|
||||||
|
public:
|
||||||
|
scoped_interpreter(bool init_signal_handlers = true) {
|
||||||
|
initialize_interpreter(init_signal_handlers);
|
||||||
|
}
|
||||||
|
|
||||||
|
scoped_interpreter(const scoped_interpreter &) = delete;
|
||||||
|
scoped_interpreter(scoped_interpreter &&other) noexcept { other.is_valid = false; }
|
||||||
|
scoped_interpreter &operator=(const scoped_interpreter &) = delete;
|
||||||
|
scoped_interpreter &operator=(scoped_interpreter &&) = delete;
|
||||||
|
|
||||||
|
~scoped_interpreter() {
|
||||||
|
if (is_valid)
|
||||||
|
finalize_interpreter();
|
||||||
|
}
|
||||||
|
|
||||||
|
private:
|
||||||
|
bool is_valid = true;
|
||||||
|
};
|
||||||
|
|
||||||
|
NAMESPACE_END(PYBIND11_NAMESPACE)
|
117
python/src/pybind11/eval.h
Normal file
117
python/src/pybind11/eval.h
Normal file
@@ -0,0 +1,117 @@
|
|||||||
|
/*
|
||||||
|
pybind11/exec.h: Support for evaluating Python expressions and statements
|
||||||
|
from strings and files
|
||||||
|
|
||||||
|
Copyright (c) 2016 Klemens Morgenstern <klemens.morgenstern@ed-chemnitz.de> and
|
||||||
|
Wenzel Jakob <wenzel.jakob@epfl.ch>
|
||||||
|
|
||||||
|
All rights reserved. Use of this source code is governed by a
|
||||||
|
BSD-style license that can be found in the LICENSE file.
|
||||||
|
*/
|
||||||
|
|
||||||
|
#pragma once
|
||||||
|
|
||||||
|
#include "pybind11.h"
|
||||||
|
|
||||||
|
NAMESPACE_BEGIN(PYBIND11_NAMESPACE)
|
||||||
|
|
||||||
|
enum eval_mode {
|
||||||
|
/// Evaluate a string containing an isolated expression
|
||||||
|
eval_expr,
|
||||||
|
|
||||||
|
/// Evaluate a string containing a single statement. Returns \c none
|
||||||
|
eval_single_statement,
|
||||||
|
|
||||||
|
/// Evaluate a string containing a sequence of statement. Returns \c none
|
||||||
|
eval_statements
|
||||||
|
};
|
||||||
|
|
||||||
|
template <eval_mode mode = eval_expr>
|
||||||
|
object eval(str expr, object global = globals(), object local = object()) {
|
||||||
|
if (!local)
|
||||||
|
local = global;
|
||||||
|
|
||||||
|
/* PyRun_String does not accept a PyObject / encoding specifier,
|
||||||
|
this seems to be the only alternative */
|
||||||
|
std::string buffer = "# -*- coding: utf-8 -*-\n" + (std::string) expr;
|
||||||
|
|
||||||
|
int start;
|
||||||
|
switch (mode) {
|
||||||
|
case eval_expr: start = Py_eval_input; break;
|
||||||
|
case eval_single_statement: start = Py_single_input; break;
|
||||||
|
case eval_statements: start = Py_file_input; break;
|
||||||
|
default: pybind11_fail("invalid evaluation mode");
|
||||||
|
}
|
||||||
|
|
||||||
|
PyObject *result = PyRun_String(buffer.c_str(), start, global.ptr(), local.ptr());
|
||||||
|
if (!result)
|
||||||
|
throw error_already_set();
|
||||||
|
return reinterpret_steal<object>(result);
|
||||||
|
}
|
||||||
|
|
||||||
|
template <eval_mode mode = eval_expr, size_t N>
|
||||||
|
object eval(const char (&s)[N], object global = globals(), object local = object()) {
|
||||||
|
/* Support raw string literals by removing common leading whitespace */
|
||||||
|
auto expr = (s[0] == '\n') ? str(module::import("textwrap").attr("dedent")(s))
|
||||||
|
: str(s);
|
||||||
|
return eval<mode>(expr, global, local);
|
||||||
|
}
|
||||||
|
|
||||||
|
inline void exec(str expr, object global = globals(), object local = object()) {
|
||||||
|
eval<eval_statements>(expr, global, local);
|
||||||
|
}
|
||||||
|
|
||||||
|
template <size_t N>
|
||||||
|
void exec(const char (&s)[N], object global = globals(), object local = object()) {
|
||||||
|
eval<eval_statements>(s, global, local);
|
||||||
|
}
|
||||||
|
|
||||||
|
template <eval_mode mode = eval_statements>
|
||||||
|
object eval_file(str fname, object global = globals(), object local = object()) {
|
||||||
|
if (!local)
|
||||||
|
local = global;
|
||||||
|
|
||||||
|
int start;
|
||||||
|
switch (mode) {
|
||||||
|
case eval_expr: start = Py_eval_input; break;
|
||||||
|
case eval_single_statement: start = Py_single_input; break;
|
||||||
|
case eval_statements: start = Py_file_input; break;
|
||||||
|
default: pybind11_fail("invalid evaluation mode");
|
||||||
|
}
|
||||||
|
|
||||||
|
int closeFile = 1;
|
||||||
|
std::string fname_str = (std::string) fname;
|
||||||
|
#if PY_VERSION_HEX >= 0x03040000
|
||||||
|
FILE *f = _Py_fopen_obj(fname.ptr(), "r");
|
||||||
|
#elif PY_VERSION_HEX >= 0x03000000
|
||||||
|
FILE *f = _Py_fopen(fname.ptr(), "r");
|
||||||
|
#else
|
||||||
|
/* No unicode support in open() :( */
|
||||||
|
auto fobj = reinterpret_steal<object>(PyFile_FromString(
|
||||||
|
const_cast<char *>(fname_str.c_str()),
|
||||||
|
const_cast<char*>("r")));
|
||||||
|
FILE *f = nullptr;
|
||||||
|
if (fobj)
|
||||||
|
f = PyFile_AsFile(fobj.ptr());
|
||||||
|
closeFile = 0;
|
||||||
|
#endif
|
||||||
|
if (!f) {
|
||||||
|
PyErr_Clear();
|
||||||
|
pybind11_fail("File \"" + fname_str + "\" could not be opened!");
|
||||||
|
}
|
||||||
|
|
||||||
|
#if PY_VERSION_HEX < 0x03000000 && defined(PYPY_VERSION)
|
||||||
|
PyObject *result = PyRun_File(f, fname_str.c_str(), start, global.ptr(),
|
||||||
|
local.ptr());
|
||||||
|
(void) closeFile;
|
||||||
|
#else
|
||||||
|
PyObject *result = PyRun_FileEx(f, fname_str.c_str(), start, global.ptr(),
|
||||||
|
local.ptr(), closeFile);
|
||||||
|
#endif
|
||||||
|
|
||||||
|
if (!result)
|
||||||
|
throw error_already_set();
|
||||||
|
return reinterpret_steal<object>(result);
|
||||||
|
}
|
||||||
|
|
||||||
|
NAMESPACE_END(PYBIND11_NAMESPACE)
|
94
python/src/pybind11/functional.h
Normal file
94
python/src/pybind11/functional.h
Normal file
@@ -0,0 +1,94 @@
|
|||||||
|
/*
|
||||||
|
pybind11/functional.h: std::function<> support
|
||||||
|
|
||||||
|
Copyright (c) 2016 Wenzel Jakob <wenzel.jakob@epfl.ch>
|
||||||
|
|
||||||
|
All rights reserved. Use of this source code is governed by a
|
||||||
|
BSD-style license that can be found in the LICENSE file.
|
||||||
|
*/
|
||||||
|
|
||||||
|
#pragma once
|
||||||
|
|
||||||
|
#include "pybind11.h"
|
||||||
|
#include <functional>
|
||||||
|
|
||||||
|
NAMESPACE_BEGIN(PYBIND11_NAMESPACE)
|
||||||
|
NAMESPACE_BEGIN(detail)
|
||||||
|
|
||||||
|
template <typename Return, typename... Args>
|
||||||
|
struct type_caster<std::function<Return(Args...)>> {
|
||||||
|
using type = std::function<Return(Args...)>;
|
||||||
|
using retval_type = conditional_t<std::is_same<Return, void>::value, void_type, Return>;
|
||||||
|
using function_type = Return (*) (Args...);
|
||||||
|
|
||||||
|
public:
|
||||||
|
bool load(handle src, bool convert) {
|
||||||
|
if (src.is_none()) {
|
||||||
|
// Defer accepting None to other overloads (if we aren't in convert mode):
|
||||||
|
if (!convert) return false;
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
|
||||||
|
if (!isinstance<function>(src))
|
||||||
|
return false;
|
||||||
|
|
||||||
|
auto func = reinterpret_borrow<function>(src);
|
||||||
|
|
||||||
|
/*
|
||||||
|
When passing a C++ function as an argument to another C++
|
||||||
|
function via Python, every function call would normally involve
|
||||||
|
a full C++ -> Python -> C++ roundtrip, which can be prohibitive.
|
||||||
|
Here, we try to at least detect the case where the function is
|
||||||
|
stateless (i.e. function pointer or lambda function without
|
||||||
|
captured variables), in which case the roundtrip can be avoided.
|
||||||
|
*/
|
||||||
|
if (auto cfunc = func.cpp_function()) {
|
||||||
|
auto c = reinterpret_borrow<capsule>(PyCFunction_GET_SELF(cfunc.ptr()));
|
||||||
|
auto rec = (function_record *) c;
|
||||||
|
|
||||||
|
if (rec && rec->is_stateless &&
|
||||||
|
same_type(typeid(function_type), *reinterpret_cast<const std::type_info *>(rec->data[1]))) {
|
||||||
|
struct capture { function_type f; };
|
||||||
|
value = ((capture *) &rec->data)->f;
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// ensure GIL is held during functor destruction
|
||||||
|
struct func_handle {
|
||||||
|
function f;
|
||||||
|
func_handle(function&& f_) : f(std::move(f_)) {}
|
||||||
|
func_handle(const func_handle&) = default;
|
||||||
|
~func_handle() {
|
||||||
|
gil_scoped_acquire acq;
|
||||||
|
function kill_f(std::move(f));
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
value = [hfunc = func_handle(std::move(func))](Args... args) -> Return {
|
||||||
|
gil_scoped_acquire acq;
|
||||||
|
object retval(hfunc.f(std::forward<Args>(args)...));
|
||||||
|
/* Visual studio 2015 parser issue: need parentheses around this expression */
|
||||||
|
return (retval.template cast<Return>());
|
||||||
|
};
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
|
||||||
|
template <typename Func>
|
||||||
|
static handle cast(Func &&f_, return_value_policy policy, handle /* parent */) {
|
||||||
|
if (!f_)
|
||||||
|
return none().inc_ref();
|
||||||
|
|
||||||
|
auto result = f_.template target<function_type>();
|
||||||
|
if (result)
|
||||||
|
return cpp_function(*result, policy).release();
|
||||||
|
else
|
||||||
|
return cpp_function(std::forward<Func>(f_), policy).release();
|
||||||
|
}
|
||||||
|
|
||||||
|
PYBIND11_TYPE_CASTER(type, _("Callable[[") + concat(make_caster<Args>::name...) + _("], ")
|
||||||
|
+ make_caster<retval_type>::name + _("]"));
|
||||||
|
};
|
||||||
|
|
||||||
|
NAMESPACE_END(detail)
|
||||||
|
NAMESPACE_END(PYBIND11_NAMESPACE)
|
207
python/src/pybind11/iostream.h
Normal file
207
python/src/pybind11/iostream.h
Normal file
@@ -0,0 +1,207 @@
|
|||||||
|
/*
|
||||||
|
pybind11/iostream.h -- Tools to assist with redirecting cout and cerr to Python
|
||||||
|
|
||||||
|
Copyright (c) 2017 Henry F. Schreiner
|
||||||
|
|
||||||
|
All rights reserved. Use of this source code is governed by a
|
||||||
|
BSD-style license that can be found in the LICENSE file.
|
||||||
|
*/
|
||||||
|
|
||||||
|
#pragma once
|
||||||
|
|
||||||
|
#include "pybind11.h"
|
||||||
|
|
||||||
|
#include <streambuf>
|
||||||
|
#include <ostream>
|
||||||
|
#include <string>
|
||||||
|
#include <memory>
|
||||||
|
#include <iostream>
|
||||||
|
|
||||||
|
NAMESPACE_BEGIN(PYBIND11_NAMESPACE)
|
||||||
|
NAMESPACE_BEGIN(detail)
|
||||||
|
|
||||||
|
// Buffer that writes to Python instead of C++
|
||||||
|
class pythonbuf : public std::streambuf {
|
||||||
|
private:
|
||||||
|
using traits_type = std::streambuf::traits_type;
|
||||||
|
|
||||||
|
const size_t buf_size;
|
||||||
|
std::unique_ptr<char[]> d_buffer;
|
||||||
|
object pywrite;
|
||||||
|
object pyflush;
|
||||||
|
|
||||||
|
int overflow(int c) {
|
||||||
|
if (!traits_type::eq_int_type(c, traits_type::eof())) {
|
||||||
|
*pptr() = traits_type::to_char_type(c);
|
||||||
|
pbump(1);
|
||||||
|
}
|
||||||
|
return sync() == 0 ? traits_type::not_eof(c) : traits_type::eof();
|
||||||
|
}
|
||||||
|
|
||||||
|
int sync() {
|
||||||
|
if (pbase() != pptr()) {
|
||||||
|
// This subtraction cannot be negative, so dropping the sign
|
||||||
|
str line(pbase(), static_cast<size_t>(pptr() - pbase()));
|
||||||
|
|
||||||
|
{
|
||||||
|
gil_scoped_acquire tmp;
|
||||||
|
pywrite(line);
|
||||||
|
pyflush();
|
||||||
|
}
|
||||||
|
|
||||||
|
setp(pbase(), epptr());
|
||||||
|
}
|
||||||
|
return 0;
|
||||||
|
}
|
||||||
|
|
||||||
|
public:
|
||||||
|
|
||||||
|
pythonbuf(object pyostream, size_t buffer_size = 1024)
|
||||||
|
: buf_size(buffer_size),
|
||||||
|
d_buffer(new char[buf_size]),
|
||||||
|
pywrite(pyostream.attr("write")),
|
||||||
|
pyflush(pyostream.attr("flush")) {
|
||||||
|
setp(d_buffer.get(), d_buffer.get() + buf_size - 1);
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Sync before destroy
|
||||||
|
~pythonbuf() {
|
||||||
|
sync();
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
NAMESPACE_END(detail)
|
||||||
|
|
||||||
|
|
||||||
|
/** \rst
|
||||||
|
This a move-only guard that redirects output.
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
#include <pybind11/iostream.h>
|
||||||
|
|
||||||
|
...
|
||||||
|
|
||||||
|
{
|
||||||
|
py::scoped_ostream_redirect output;
|
||||||
|
std::cout << "Hello, World!"; // Python stdout
|
||||||
|
} // <-- return std::cout to normal
|
||||||
|
|
||||||
|
You can explicitly pass the c++ stream and the python object,
|
||||||
|
for example to guard stderr instead.
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
{
|
||||||
|
py::scoped_ostream_redirect output{std::cerr, py::module::import("sys").attr("stderr")};
|
||||||
|
std::cerr << "Hello, World!";
|
||||||
|
}
|
||||||
|
\endrst */
|
||||||
|
class scoped_ostream_redirect {
|
||||||
|
protected:
|
||||||
|
std::streambuf *old;
|
||||||
|
std::ostream &costream;
|
||||||
|
detail::pythonbuf buffer;
|
||||||
|
|
||||||
|
public:
|
||||||
|
scoped_ostream_redirect(
|
||||||
|
std::ostream &costream = std::cout,
|
||||||
|
object pyostream = module::import("sys").attr("stdout"))
|
||||||
|
: costream(costream), buffer(pyostream) {
|
||||||
|
old = costream.rdbuf(&buffer);
|
||||||
|
}
|
||||||
|
|
||||||
|
~scoped_ostream_redirect() {
|
||||||
|
costream.rdbuf(old);
|
||||||
|
}
|
||||||
|
|
||||||
|
scoped_ostream_redirect(const scoped_ostream_redirect &) = delete;
|
||||||
|
scoped_ostream_redirect(scoped_ostream_redirect &&other) = default;
|
||||||
|
scoped_ostream_redirect &operator=(const scoped_ostream_redirect &) = delete;
|
||||||
|
scoped_ostream_redirect &operator=(scoped_ostream_redirect &&) = delete;
|
||||||
|
};
|
||||||
|
|
||||||
|
|
||||||
|
/** \rst
|
||||||
|
Like `scoped_ostream_redirect`, but redirects cerr by default. This class
|
||||||
|
is provided primary to make ``py::call_guard`` easier to make.
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
m.def("noisy_func", &noisy_func,
|
||||||
|
py::call_guard<scoped_ostream_redirect,
|
||||||
|
scoped_estream_redirect>());
|
||||||
|
|
||||||
|
\endrst */
|
||||||
|
class scoped_estream_redirect : public scoped_ostream_redirect {
|
||||||
|
public:
|
||||||
|
scoped_estream_redirect(
|
||||||
|
std::ostream &costream = std::cerr,
|
||||||
|
object pyostream = module::import("sys").attr("stderr"))
|
||||||
|
: scoped_ostream_redirect(costream,pyostream) {}
|
||||||
|
};
|
||||||
|
|
||||||
|
|
||||||
|
NAMESPACE_BEGIN(detail)
|
||||||
|
|
||||||
|
// Class to redirect output as a context manager. C++ backend.
|
||||||
|
class OstreamRedirect {
|
||||||
|
bool do_stdout_;
|
||||||
|
bool do_stderr_;
|
||||||
|
std::unique_ptr<scoped_ostream_redirect> redirect_stdout;
|
||||||
|
std::unique_ptr<scoped_estream_redirect> redirect_stderr;
|
||||||
|
|
||||||
|
public:
|
||||||
|
OstreamRedirect(bool do_stdout = true, bool do_stderr = true)
|
||||||
|
: do_stdout_(do_stdout), do_stderr_(do_stderr) {}
|
||||||
|
|
||||||
|
void enter() {
|
||||||
|
if (do_stdout_)
|
||||||
|
redirect_stdout.reset(new scoped_ostream_redirect());
|
||||||
|
if (do_stderr_)
|
||||||
|
redirect_stderr.reset(new scoped_estream_redirect());
|
||||||
|
}
|
||||||
|
|
||||||
|
void exit() {
|
||||||
|
redirect_stdout.reset();
|
||||||
|
redirect_stderr.reset();
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
NAMESPACE_END(detail)
|
||||||
|
|
||||||
|
/** \rst
|
||||||
|
This is a helper function to add a C++ redirect context manager to Python
|
||||||
|
instead of using a C++ guard. To use it, add the following to your binding code:
|
||||||
|
|
||||||
|
.. code-block:: cpp
|
||||||
|
|
||||||
|
#include <pybind11/iostream.h>
|
||||||
|
|
||||||
|
...
|
||||||
|
|
||||||
|
py::add_ostream_redirect(m, "ostream_redirect");
|
||||||
|
|
||||||
|
You now have a Python context manager that redirects your output:
|
||||||
|
|
||||||
|
.. code-block:: python
|
||||||
|
|
||||||
|
with m.ostream_redirect():
|
||||||
|
m.print_to_cout_function()
|
||||||
|
|
||||||
|
This manager can optionally be told which streams to operate on:
|
||||||
|
|
||||||
|
.. code-block:: python
|
||||||
|
|
||||||
|
with m.ostream_redirect(stdout=true, stderr=true):
|
||||||
|
m.noisy_function_with_error_printing()
|
||||||
|
|
||||||
|
\endrst */
|
||||||
|
inline class_<detail::OstreamRedirect> add_ostream_redirect(module m, std::string name = "ostream_redirect") {
|
||||||
|
return class_<detail::OstreamRedirect>(m, name.c_str(), module_local())
|
||||||
|
.def(init<bool,bool>(), arg("stdout")=true, arg("stderr")=true)
|
||||||
|
.def("__enter__", &detail::OstreamRedirect::enter)
|
||||||
|
.def("__exit__", [](detail::OstreamRedirect &self_, args) { self_.exit(); });
|
||||||
|
}
|
||||||
|
|
||||||
|
NAMESPACE_END(PYBIND11_NAMESPACE)
|
1610
python/src/pybind11/numpy.h
Normal file
1610
python/src/pybind11/numpy.h
Normal file
File diff suppressed because it is too large
Load Diff
168
python/src/pybind11/operators.h
Normal file
168
python/src/pybind11/operators.h
Normal file
@@ -0,0 +1,168 @@
|
|||||||
|
/*
|
||||||
|
pybind11/operator.h: Metatemplates for operator overloading
|
||||||
|
|
||||||
|
Copyright (c) 2016 Wenzel Jakob <wenzel.jakob@epfl.ch>
|
||||||
|
|
||||||
|
All rights reserved. Use of this source code is governed by a
|
||||||
|
BSD-style license that can be found in the LICENSE file.
|
||||||
|
*/
|
||||||
|
|
||||||
|
#pragma once
|
||||||
|
|
||||||
|
#include "pybind11.h"
|
||||||
|
|
||||||
|
#if defined(__clang__) && !defined(__INTEL_COMPILER)
|
||||||
|
# pragma clang diagnostic ignored "-Wunsequenced" // multiple unsequenced modifications to 'self' (when using def(py::self OP Type()))
|
||||||
|
#elif defined(_MSC_VER)
|
||||||
|
# pragma warning(push)
|
||||||
|
# pragma warning(disable: 4127) // warning C4127: Conditional expression is constant
|
||||||
|
#endif
|
||||||
|
|
||||||
|
NAMESPACE_BEGIN(PYBIND11_NAMESPACE)
|
||||||
|
NAMESPACE_BEGIN(detail)
|
||||||
|
|
||||||
|
/// Enumeration with all supported operator types
|
||||||
|
enum op_id : int {
|
||||||
|
op_add, op_sub, op_mul, op_div, op_mod, op_divmod, op_pow, op_lshift,
|
||||||
|
op_rshift, op_and, op_xor, op_or, op_neg, op_pos, op_abs, op_invert,
|
||||||
|
op_int, op_long, op_float, op_str, op_cmp, op_gt, op_ge, op_lt, op_le,
|
||||||
|
op_eq, op_ne, op_iadd, op_isub, op_imul, op_idiv, op_imod, op_ilshift,
|
||||||
|
op_irshift, op_iand, op_ixor, op_ior, op_complex, op_bool, op_nonzero,
|
||||||
|
op_repr, op_truediv, op_itruediv, op_hash
|
||||||
|
};
|
||||||
|
|
||||||
|
enum op_type : int {
|
||||||
|
op_l, /* base type on left */
|
||||||
|
op_r, /* base type on right */
|
||||||
|
op_u /* unary operator */
|
||||||
|
};
|
||||||
|
|
||||||
|
struct self_t { };
|
||||||
|
static const self_t self = self_t();
|
||||||
|
|
||||||
|
/// Type for an unused type slot
|
||||||
|
struct undefined_t { };
|
||||||
|
|
||||||
|
/// Don't warn about an unused variable
|
||||||
|
inline self_t __self() { return self; }
|
||||||
|
|
||||||
|
/// base template of operator implementations
|
||||||
|
template <op_id, op_type, typename B, typename L, typename R> struct op_impl { };
|
||||||
|
|
||||||
|
/// Operator implementation generator
|
||||||
|
template <op_id id, op_type ot, typename L, typename R> struct op_ {
|
||||||
|
template <typename Class, typename... Extra> void execute(Class &cl, const Extra&... extra) const {
|
||||||
|
using Base = typename Class::type;
|
||||||
|
using L_type = conditional_t<std::is_same<L, self_t>::value, Base, L>;
|
||||||
|
using R_type = conditional_t<std::is_same<R, self_t>::value, Base, R>;
|
||||||
|
using op = op_impl<id, ot, Base, L_type, R_type>;
|
||||||
|
cl.def(op::name(), &op::execute, is_operator(), extra...);
|
||||||
|
#if PY_MAJOR_VERSION < 3
|
||||||
|
if (id == op_truediv || id == op_itruediv)
|
||||||
|
cl.def(id == op_itruediv ? "__idiv__" : ot == op_l ? "__div__" : "__rdiv__",
|
||||||
|
&op::execute, is_operator(), extra...);
|
||||||
|
#endif
|
||||||
|
}
|
||||||
|
template <typename Class, typename... Extra> void execute_cast(Class &cl, const Extra&... extra) const {
|
||||||
|
using Base = typename Class::type;
|
||||||
|
using L_type = conditional_t<std::is_same<L, self_t>::value, Base, L>;
|
||||||
|
using R_type = conditional_t<std::is_same<R, self_t>::value, Base, R>;
|
||||||
|
using op = op_impl<id, ot, Base, L_type, R_type>;
|
||||||
|
cl.def(op::name(), &op::execute_cast, is_operator(), extra...);
|
||||||
|
#if PY_MAJOR_VERSION < 3
|
||||||
|
if (id == op_truediv || id == op_itruediv)
|
||||||
|
cl.def(id == op_itruediv ? "__idiv__" : ot == op_l ? "__div__" : "__rdiv__",
|
||||||
|
&op::execute, is_operator(), extra...);
|
||||||
|
#endif
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
#define PYBIND11_BINARY_OPERATOR(id, rid, op, expr) \
|
||||||
|
template <typename B, typename L, typename R> struct op_impl<op_##id, op_l, B, L, R> { \
|
||||||
|
static char const* name() { return "__" #id "__"; } \
|
||||||
|
static auto execute(const L &l, const R &r) -> decltype(expr) { return (expr); } \
|
||||||
|
static B execute_cast(const L &l, const R &r) { return B(expr); } \
|
||||||
|
}; \
|
||||||
|
template <typename B, typename L, typename R> struct op_impl<op_##id, op_r, B, L, R> { \
|
||||||
|
static char const* name() { return "__" #rid "__"; } \
|
||||||
|
static auto execute(const R &r, const L &l) -> decltype(expr) { return (expr); } \
|
||||||
|
static B execute_cast(const R &r, const L &l) { return B(expr); } \
|
||||||
|
}; \
|
||||||
|
inline op_<op_##id, op_l, self_t, self_t> op(const self_t &, const self_t &) { \
|
||||||
|
return op_<op_##id, op_l, self_t, self_t>(); \
|
||||||
|
} \
|
||||||
|
template <typename T> op_<op_##id, op_l, self_t, T> op(const self_t &, const T &) { \
|
||||||
|
return op_<op_##id, op_l, self_t, T>(); \
|
||||||
|
} \
|
||||||
|
template <typename T> op_<op_##id, op_r, T, self_t> op(const T &, const self_t &) { \
|
||||||
|
return op_<op_##id, op_r, T, self_t>(); \
|
||||||
|
}
|
||||||
|
|
||||||
|
#define PYBIND11_INPLACE_OPERATOR(id, op, expr) \
|
||||||
|
template <typename B, typename L, typename R> struct op_impl<op_##id, op_l, B, L, R> { \
|
||||||
|
static char const* name() { return "__" #id "__"; } \
|
||||||
|
static auto execute(L &l, const R &r) -> decltype(expr) { return expr; } \
|
||||||
|
static B execute_cast(L &l, const R &r) { return B(expr); } \
|
||||||
|
}; \
|
||||||
|
template <typename T> op_<op_##id, op_l, self_t, T> op(const self_t &, const T &) { \
|
||||||
|
return op_<op_##id, op_l, self_t, T>(); \
|
||||||
|
}
|
||||||
|
|
||||||
|
#define PYBIND11_UNARY_OPERATOR(id, op, expr) \
|
||||||
|
template <typename B, typename L> struct op_impl<op_##id, op_u, B, L, undefined_t> { \
|
||||||
|
static char const* name() { return "__" #id "__"; } \
|
||||||
|
static auto execute(const L &l) -> decltype(expr) { return expr; } \
|
||||||
|
static B execute_cast(const L &l) { return B(expr); } \
|
||||||
|
}; \
|
||||||
|
inline op_<op_##id, op_u, self_t, undefined_t> op(const self_t &) { \
|
||||||
|
return op_<op_##id, op_u, self_t, undefined_t>(); \
|
||||||
|
}
|
||||||
|
|
||||||
|
PYBIND11_BINARY_OPERATOR(sub, rsub, operator-, l - r)
|
||||||
|
PYBIND11_BINARY_OPERATOR(add, radd, operator+, l + r)
|
||||||
|
PYBIND11_BINARY_OPERATOR(mul, rmul, operator*, l * r)
|
||||||
|
PYBIND11_BINARY_OPERATOR(truediv, rtruediv, operator/, l / r)
|
||||||
|
PYBIND11_BINARY_OPERATOR(mod, rmod, operator%, l % r)
|
||||||
|
PYBIND11_BINARY_OPERATOR(lshift, rlshift, operator<<, l << r)
|
||||||
|
PYBIND11_BINARY_OPERATOR(rshift, rrshift, operator>>, l >> r)
|
||||||
|
PYBIND11_BINARY_OPERATOR(and, rand, operator&, l & r)
|
||||||
|
PYBIND11_BINARY_OPERATOR(xor, rxor, operator^, l ^ r)
|
||||||
|
PYBIND11_BINARY_OPERATOR(eq, eq, operator==, l == r)
|
||||||
|
PYBIND11_BINARY_OPERATOR(ne, ne, operator!=, l != r)
|
||||||
|
PYBIND11_BINARY_OPERATOR(or, ror, operator|, l | r)
|
||||||
|
PYBIND11_BINARY_OPERATOR(gt, lt, operator>, l > r)
|
||||||
|
PYBIND11_BINARY_OPERATOR(ge, le, operator>=, l >= r)
|
||||||
|
PYBIND11_BINARY_OPERATOR(lt, gt, operator<, l < r)
|
||||||
|
PYBIND11_BINARY_OPERATOR(le, ge, operator<=, l <= r)
|
||||||
|
//PYBIND11_BINARY_OPERATOR(pow, rpow, pow, std::pow(l, r))
|
||||||
|
PYBIND11_INPLACE_OPERATOR(iadd, operator+=, l += r)
|
||||||
|
PYBIND11_INPLACE_OPERATOR(isub, operator-=, l -= r)
|
||||||
|
PYBIND11_INPLACE_OPERATOR(imul, operator*=, l *= r)
|
||||||
|
PYBIND11_INPLACE_OPERATOR(itruediv, operator/=, l /= r)
|
||||||
|
PYBIND11_INPLACE_OPERATOR(imod, operator%=, l %= r)
|
||||||
|
PYBIND11_INPLACE_OPERATOR(ilshift, operator<<=, l <<= r)
|
||||||
|
PYBIND11_INPLACE_OPERATOR(irshift, operator>>=, l >>= r)
|
||||||
|
PYBIND11_INPLACE_OPERATOR(iand, operator&=, l &= r)
|
||||||
|
PYBIND11_INPLACE_OPERATOR(ixor, operator^=, l ^= r)
|
||||||
|
PYBIND11_INPLACE_OPERATOR(ior, operator|=, l |= r)
|
||||||
|
PYBIND11_UNARY_OPERATOR(neg, operator-, -l)
|
||||||
|
PYBIND11_UNARY_OPERATOR(pos, operator+, +l)
|
||||||
|
PYBIND11_UNARY_OPERATOR(abs, abs, std::abs(l))
|
||||||
|
PYBIND11_UNARY_OPERATOR(hash, hash, std::hash<L>()(l))
|
||||||
|
PYBIND11_UNARY_OPERATOR(invert, operator~, (~l))
|
||||||
|
PYBIND11_UNARY_OPERATOR(bool, operator!, !!l)
|
||||||
|
PYBIND11_UNARY_OPERATOR(int, int_, (int) l)
|
||||||
|
PYBIND11_UNARY_OPERATOR(float, float_, (double) l)
|
||||||
|
|
||||||
|
#undef PYBIND11_BINARY_OPERATOR
|
||||||
|
#undef PYBIND11_INPLACE_OPERATOR
|
||||||
|
#undef PYBIND11_UNARY_OPERATOR
|
||||||
|
NAMESPACE_END(detail)
|
||||||
|
|
||||||
|
using detail::self;
|
||||||
|
|
||||||
|
NAMESPACE_END(PYBIND11_NAMESPACE)
|
||||||
|
|
||||||
|
#if defined(_MSC_VER)
|
||||||
|
# pragma warning(pop)
|
||||||
|
#endif
|
65
python/src/pybind11/options.h
Normal file
65
python/src/pybind11/options.h
Normal file
@@ -0,0 +1,65 @@
|
|||||||
|
/*
|
||||||
|
pybind11/options.h: global settings that are configurable at runtime.
|
||||||
|
|
||||||
|
Copyright (c) 2016 Wenzel Jakob <wenzel.jakob@epfl.ch>
|
||||||
|
|
||||||
|
All rights reserved. Use of this source code is governed by a
|
||||||
|
BSD-style license that can be found in the LICENSE file.
|
||||||
|
*/
|
||||||
|
|
||||||
|
#pragma once
|
||||||
|
|
||||||
|
#include "detail/common.h"
|
||||||
|
|
||||||
|
NAMESPACE_BEGIN(PYBIND11_NAMESPACE)
|
||||||
|
|
||||||
|
class options {
|
||||||
|
public:
|
||||||
|
|
||||||
|
// Default RAII constructor, which leaves settings as they currently are.
|
||||||
|
options() : previous_state(global_state()) {}
|
||||||
|
|
||||||
|
// Class is non-copyable.
|
||||||
|
options(const options&) = delete;
|
||||||
|
options& operator=(const options&) = delete;
|
||||||
|
|
||||||
|
// Destructor, which restores settings that were in effect before.
|
||||||
|
~options() {
|
||||||
|
global_state() = previous_state;
|
||||||
|
}
|
||||||
|
|
||||||
|
// Setter methods (affect the global state):
|
||||||
|
|
||||||
|
options& disable_user_defined_docstrings() & { global_state().show_user_defined_docstrings = false; return *this; }
|
||||||
|
|
||||||
|
options& enable_user_defined_docstrings() & { global_state().show_user_defined_docstrings = true; return *this; }
|
||||||
|
|
||||||
|
options& disable_function_signatures() & { global_state().show_function_signatures = false; return *this; }
|
||||||
|
|
||||||
|
options& enable_function_signatures() & { global_state().show_function_signatures = true; return *this; }
|
||||||
|
|
||||||
|
// Getter methods (return the global state):
|
||||||
|
|
||||||
|
static bool show_user_defined_docstrings() { return global_state().show_user_defined_docstrings; }
|
||||||
|
|
||||||
|
static bool show_function_signatures() { return global_state().show_function_signatures; }
|
||||||
|
|
||||||
|
// This type is not meant to be allocated on the heap.
|
||||||
|
void* operator new(size_t) = delete;
|
||||||
|
|
||||||
|
private:
|
||||||
|
|
||||||
|
struct state {
|
||||||
|
bool show_user_defined_docstrings = true; //< Include user-supplied texts in docstrings.
|
||||||
|
bool show_function_signatures = true; //< Include auto-generated function signatures in docstrings.
|
||||||
|
};
|
||||||
|
|
||||||
|
static state &global_state() {
|
||||||
|
static state instance;
|
||||||
|
return instance;
|
||||||
|
}
|
||||||
|
|
||||||
|
state previous_state;
|
||||||
|
};
|
||||||
|
|
||||||
|
NAMESPACE_END(PYBIND11_NAMESPACE)
|
2162
python/src/pybind11/pybind11.h
Normal file
2162
python/src/pybind11/pybind11.h
Normal file
File diff suppressed because it is too large
Load Diff
1471
python/src/pybind11/pytypes.h
Normal file
1471
python/src/pybind11/pytypes.h
Normal file
File diff suppressed because it is too large
Load Diff
386
python/src/pybind11/stl.h
Normal file
386
python/src/pybind11/stl.h
Normal file
@@ -0,0 +1,386 @@
|
|||||||
|
/*
|
||||||
|
pybind11/stl.h: Transparent conversion for STL data types
|
||||||
|
|
||||||
|
Copyright (c) 2016 Wenzel Jakob <wenzel.jakob@epfl.ch>
|
||||||
|
|
||||||
|
All rights reserved. Use of this source code is governed by a
|
||||||
|
BSD-style license that can be found in the LICENSE file.
|
||||||
|
*/
|
||||||
|
|
||||||
|
#pragma once
|
||||||
|
|
||||||
|
#include "pybind11.h"
|
||||||
|
#include <set>
|
||||||
|
#include <unordered_set>
|
||||||
|
#include <map>
|
||||||
|
#include <unordered_map>
|
||||||
|
#include <iostream>
|
||||||
|
#include <list>
|
||||||
|
#include <deque>
|
||||||
|
#include <valarray>
|
||||||
|
|
||||||
|
#if defined(_MSC_VER)
|
||||||
|
#pragma warning(push)
|
||||||
|
#pragma warning(disable: 4127) // warning C4127: Conditional expression is constant
|
||||||
|
#endif
|
||||||
|
|
||||||
|
#ifdef __has_include
|
||||||
|
// std::optional (but including it in c++14 mode isn't allowed)
|
||||||
|
# if defined(PYBIND11_CPP17) && __has_include(<optional>)
|
||||||
|
# include <optional>
|
||||||
|
# define PYBIND11_HAS_OPTIONAL 1
|
||||||
|
# endif
|
||||||
|
// std::experimental::optional (but not allowed in c++11 mode)
|
||||||
|
# if defined(PYBIND11_CPP14) && (__has_include(<experimental/optional>) && \
|
||||||
|
!__has_include(<optional>))
|
||||||
|
# include <experimental/optional>
|
||||||
|
# define PYBIND11_HAS_EXP_OPTIONAL 1
|
||||||
|
# endif
|
||||||
|
// std::variant
|
||||||
|
# if defined(PYBIND11_CPP17) && __has_include(<variant>)
|
||||||
|
# include <variant>
|
||||||
|
# define PYBIND11_HAS_VARIANT 1
|
||||||
|
# endif
|
||||||
|
#elif defined(_MSC_VER) && defined(PYBIND11_CPP17)
|
||||||
|
# include <optional>
|
||||||
|
# include <variant>
|
||||||
|
# define PYBIND11_HAS_OPTIONAL 1
|
||||||
|
# define PYBIND11_HAS_VARIANT 1
|
||||||
|
#endif
|
||||||
|
|
||||||
|
NAMESPACE_BEGIN(PYBIND11_NAMESPACE)
|
||||||
|
NAMESPACE_BEGIN(detail)
|
||||||
|
|
||||||
|
/// Extracts an const lvalue reference or rvalue reference for U based on the type of T (e.g. for
|
||||||
|
/// forwarding a container element). Typically used indirect via forwarded_type(), below.
|
||||||
|
template <typename T, typename U>
|
||||||
|
using forwarded_type = conditional_t<
|
||||||
|
std::is_lvalue_reference<T>::value, remove_reference_t<U> &, remove_reference_t<U> &&>;
|
||||||
|
|
||||||
|
/// Forwards a value U as rvalue or lvalue according to whether T is rvalue or lvalue; typically
|
||||||
|
/// used for forwarding a container's elements.
|
||||||
|
template <typename T, typename U>
|
||||||
|
forwarded_type<T, U> forward_like(U &&u) {
|
||||||
|
return std::forward<detail::forwarded_type<T, U>>(std::forward<U>(u));
|
||||||
|
}
|
||||||
|
|
||||||
|
template <typename Type, typename Key> struct set_caster {
|
||||||
|
using type = Type;
|
||||||
|
using key_conv = make_caster<Key>;
|
||||||
|
|
||||||
|
bool load(handle src, bool convert) {
|
||||||
|
if (!isinstance<pybind11::set>(src))
|
||||||
|
return false;
|
||||||
|
auto s = reinterpret_borrow<pybind11::set>(src);
|
||||||
|
value.clear();
|
||||||
|
for (auto entry : s) {
|
||||||
|
key_conv conv;
|
||||||
|
if (!conv.load(entry, convert))
|
||||||
|
return false;
|
||||||
|
value.insert(cast_op<Key &&>(std::move(conv)));
|
||||||
|
}
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
|
||||||
|
template <typename T>
|
||||||
|
static handle cast(T &&src, return_value_policy policy, handle parent) {
|
||||||
|
if (!std::is_lvalue_reference<T>::value)
|
||||||
|
policy = return_value_policy_override<Key>::policy(policy);
|
||||||
|
pybind11::set s;
|
||||||
|
for (auto &&value : src) {
|
||||||
|
auto value_ = reinterpret_steal<object>(key_conv::cast(forward_like<T>(value), policy, parent));
|
||||||
|
if (!value_ || !s.add(value_))
|
||||||
|
return handle();
|
||||||
|
}
|
||||||
|
return s.release();
|
||||||
|
}
|
||||||
|
|
||||||
|
PYBIND11_TYPE_CASTER(type, _("Set[") + key_conv::name + _("]"));
|
||||||
|
};
|
||||||
|
|
||||||
|
template <typename Type, typename Key, typename Value> struct map_caster {
|
||||||
|
using key_conv = make_caster<Key>;
|
||||||
|
using value_conv = make_caster<Value>;
|
||||||
|
|
||||||
|
bool load(handle src, bool convert) {
|
||||||
|
if (!isinstance<dict>(src))
|
||||||
|
return false;
|
||||||
|
auto d = reinterpret_borrow<dict>(src);
|
||||||
|
value.clear();
|
||||||
|
for (auto it : d) {
|
||||||
|
key_conv kconv;
|
||||||
|
value_conv vconv;
|
||||||
|
if (!kconv.load(it.first.ptr(), convert) ||
|
||||||
|
!vconv.load(it.second.ptr(), convert))
|
||||||
|
return false;
|
||||||
|
value.emplace(cast_op<Key &&>(std::move(kconv)), cast_op<Value &&>(std::move(vconv)));
|
||||||
|
}
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
|
||||||
|
template <typename T>
|
||||||
|
static handle cast(T &&src, return_value_policy policy, handle parent) {
|
||||||
|
dict d;
|
||||||
|
return_value_policy policy_key = policy;
|
||||||
|
return_value_policy policy_value = policy;
|
||||||
|
if (!std::is_lvalue_reference<T>::value) {
|
||||||
|
policy_key = return_value_policy_override<Key>::policy(policy_key);
|
||||||
|
policy_value = return_value_policy_override<Value>::policy(policy_value);
|
||||||
|
}
|
||||||
|
for (auto &&kv : src) {
|
||||||
|
auto key = reinterpret_steal<object>(key_conv::cast(forward_like<T>(kv.first), policy_key, parent));
|
||||||
|
auto value = reinterpret_steal<object>(value_conv::cast(forward_like<T>(kv.second), policy_value, parent));
|
||||||
|
if (!key || !value)
|
||||||
|
return handle();
|
||||||
|
d[key] = value;
|
||||||
|
}
|
||||||
|
return d.release();
|
||||||
|
}
|
||||||
|
|
||||||
|
PYBIND11_TYPE_CASTER(Type, _("Dict[") + key_conv::name + _(", ") + value_conv::name + _("]"));
|
||||||
|
};
|
||||||
|
|
||||||
|
template <typename Type, typename Value> struct list_caster {
|
||||||
|
using value_conv = make_caster<Value>;
|
||||||
|
|
||||||
|
bool load(handle src, bool convert) {
|
||||||
|
if (!isinstance<sequence>(src) || isinstance<str>(src))
|
||||||
|
return false;
|
||||||
|
auto s = reinterpret_borrow<sequence>(src);
|
||||||
|
value.clear();
|
||||||
|
reserve_maybe(s, &value);
|
||||||
|
for (auto it : s) {
|
||||||
|
value_conv conv;
|
||||||
|
if (!conv.load(it, convert))
|
||||||
|
return false;
|
||||||
|
value.push_back(cast_op<Value &&>(std::move(conv)));
|
||||||
|
}
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
|
||||||
|
private:
|
||||||
|
template <typename T = Type,
|
||||||
|
enable_if_t<std::is_same<decltype(std::declval<T>().reserve(0)), void>::value, int> = 0>
|
||||||
|
void reserve_maybe(sequence s, Type *) { value.reserve(s.size()); }
|
||||||
|
void reserve_maybe(sequence, void *) { }
|
||||||
|
|
||||||
|
public:
|
||||||
|
template <typename T>
|
||||||
|
static handle cast(T &&src, return_value_policy policy, handle parent) {
|
||||||
|
if (!std::is_lvalue_reference<T>::value)
|
||||||
|
policy = return_value_policy_override<Value>::policy(policy);
|
||||||
|
list l(src.size());
|
||||||
|
size_t index = 0;
|
||||||
|
for (auto &&value : src) {
|
||||||
|
auto value_ = reinterpret_steal<object>(value_conv::cast(forward_like<T>(value), policy, parent));
|
||||||
|
if (!value_)
|
||||||
|
return handle();
|
||||||
|
PyList_SET_ITEM(l.ptr(), (ssize_t) index++, value_.release().ptr()); // steals a reference
|
||||||
|
}
|
||||||
|
return l.release();
|
||||||
|
}
|
||||||
|
|
||||||
|
PYBIND11_TYPE_CASTER(Type, _("List[") + value_conv::name + _("]"));
|
||||||
|
};
|
||||||
|
|
||||||
|
template <typename Type, typename Alloc> struct type_caster<std::vector<Type, Alloc>>
|
||||||
|
: list_caster<std::vector<Type, Alloc>, Type> { };
|
||||||
|
|
||||||
|
template <typename Type, typename Alloc> struct type_caster<std::deque<Type, Alloc>>
|
||||||
|
: list_caster<std::deque<Type, Alloc>, Type> { };
|
||||||
|
|
||||||
|
template <typename Type, typename Alloc> struct type_caster<std::list<Type, Alloc>>
|
||||||
|
: list_caster<std::list<Type, Alloc>, Type> { };
|
||||||
|
|
||||||
|
template <typename ArrayType, typename Value, bool Resizable, size_t Size = 0> struct array_caster {
|
||||||
|
using value_conv = make_caster<Value>;
|
||||||
|
|
||||||
|
private:
|
||||||
|
template <bool R = Resizable>
|
||||||
|
bool require_size(enable_if_t<R, size_t> size) {
|
||||||
|
if (value.size() != size)
|
||||||
|
value.resize(size);
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
template <bool R = Resizable>
|
||||||
|
bool require_size(enable_if_t<!R, size_t> size) {
|
||||||
|
return size == Size;
|
||||||
|
}
|
||||||
|
|
||||||
|
public:
|
||||||
|
bool load(handle src, bool convert) {
|
||||||
|
if (!isinstance<sequence>(src))
|
||||||
|
return false;
|
||||||
|
auto l = reinterpret_borrow<sequence>(src);
|
||||||
|
if (!require_size(l.size()))
|
||||||
|
return false;
|
||||||
|
size_t ctr = 0;
|
||||||
|
for (auto it : l) {
|
||||||
|
value_conv conv;
|
||||||
|
if (!conv.load(it, convert))
|
||||||
|
return false;
|
||||||
|
value[ctr++] = cast_op<Value &&>(std::move(conv));
|
||||||
|
}
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
|
||||||
|
template <typename T>
|
||||||
|
static handle cast(T &&src, return_value_policy policy, handle parent) {
|
||||||
|
list l(src.size());
|
||||||
|
size_t index = 0;
|
||||||
|
for (auto &&value : src) {
|
||||||
|
auto value_ = reinterpret_steal<object>(value_conv::cast(forward_like<T>(value), policy, parent));
|
||||||
|
if (!value_)
|
||||||
|
return handle();
|
||||||
|
PyList_SET_ITEM(l.ptr(), (ssize_t) index++, value_.release().ptr()); // steals a reference
|
||||||
|
}
|
||||||
|
return l.release();
|
||||||
|
}
|
||||||
|
|
||||||
|
PYBIND11_TYPE_CASTER(ArrayType, _("List[") + value_conv::name + _<Resizable>(_(""), _("[") + _<Size>() + _("]")) + _("]"));
|
||||||
|
};
|
||||||
|
|
||||||
|
template <typename Type, size_t Size> struct type_caster<std::array<Type, Size>>
|
||||||
|
: array_caster<std::array<Type, Size>, Type, false, Size> { };
|
||||||
|
|
||||||
|
template <typename Type> struct type_caster<std::valarray<Type>>
|
||||||
|
: array_caster<std::valarray<Type>, Type, true> { };
|
||||||
|
|
||||||
|
template <typename Key, typename Compare, typename Alloc> struct type_caster<std::set<Key, Compare, Alloc>>
|
||||||
|
: set_caster<std::set<Key, Compare, Alloc>, Key> { };
|
||||||
|
|
||||||
|
template <typename Key, typename Hash, typename Equal, typename Alloc> struct type_caster<std::unordered_set<Key, Hash, Equal, Alloc>>
|
||||||
|
: set_caster<std::unordered_set<Key, Hash, Equal, Alloc>, Key> { };
|
||||||
|
|
||||||
|
template <typename Key, typename Value, typename Compare, typename Alloc> struct type_caster<std::map<Key, Value, Compare, Alloc>>
|
||||||
|
: map_caster<std::map<Key, Value, Compare, Alloc>, Key, Value> { };
|
||||||
|
|
||||||
|
template <typename Key, typename Value, typename Hash, typename Equal, typename Alloc> struct type_caster<std::unordered_map<Key, Value, Hash, Equal, Alloc>>
|
||||||
|
: map_caster<std::unordered_map<Key, Value, Hash, Equal, Alloc>, Key, Value> { };
|
||||||
|
|
||||||
|
// This type caster is intended to be used for std::optional and std::experimental::optional
|
||||||
|
template<typename T> struct optional_caster {
|
||||||
|
using value_conv = make_caster<typename T::value_type>;
|
||||||
|
|
||||||
|
template <typename T_>
|
||||||
|
static handle cast(T_ &&src, return_value_policy policy, handle parent) {
|
||||||
|
if (!src)
|
||||||
|
return none().inc_ref();
|
||||||
|
policy = return_value_policy_override<typename T::value_type>::policy(policy);
|
||||||
|
return value_conv::cast(*std::forward<T_>(src), policy, parent);
|
||||||
|
}
|
||||||
|
|
||||||
|
bool load(handle src, bool convert) {
|
||||||
|
if (!src) {
|
||||||
|
return false;
|
||||||
|
} else if (src.is_none()) {
|
||||||
|
return true; // default-constructed value is already empty
|
||||||
|
}
|
||||||
|
value_conv inner_caster;
|
||||||
|
if (!inner_caster.load(src, convert))
|
||||||
|
return false;
|
||||||
|
|
||||||
|
value.emplace(cast_op<typename T::value_type &&>(std::move(inner_caster)));
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
|
||||||
|
PYBIND11_TYPE_CASTER(T, _("Optional[") + value_conv::name + _("]"));
|
||||||
|
};
|
||||||
|
|
||||||
|
#if PYBIND11_HAS_OPTIONAL
|
||||||
|
template<typename T> struct type_caster<std::optional<T>>
|
||||||
|
: public optional_caster<std::optional<T>> {};
|
||||||
|
|
||||||
|
template<> struct type_caster<std::nullopt_t>
|
||||||
|
: public void_caster<std::nullopt_t> {};
|
||||||
|
#endif
|
||||||
|
|
||||||
|
#if PYBIND11_HAS_EXP_OPTIONAL
|
||||||
|
template<typename T> struct type_caster<std::experimental::optional<T>>
|
||||||
|
: public optional_caster<std::experimental::optional<T>> {};
|
||||||
|
|
||||||
|
template<> struct type_caster<std::experimental::nullopt_t>
|
||||||
|
: public void_caster<std::experimental::nullopt_t> {};
|
||||||
|
#endif
|
||||||
|
|
||||||
|
/// Visit a variant and cast any found type to Python
|
||||||
|
struct variant_caster_visitor {
|
||||||
|
return_value_policy policy;
|
||||||
|
handle parent;
|
||||||
|
|
||||||
|
using result_type = handle; // required by boost::variant in C++11
|
||||||
|
|
||||||
|
template <typename T>
|
||||||
|
result_type operator()(T &&src) const {
|
||||||
|
return make_caster<T>::cast(std::forward<T>(src), policy, parent);
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
/// Helper class which abstracts away variant's `visit` function. `std::variant` and similar
|
||||||
|
/// `namespace::variant` types which provide a `namespace::visit()` function are handled here
|
||||||
|
/// automatically using argument-dependent lookup. Users can provide specializations for other
|
||||||
|
/// variant-like classes, e.g. `boost::variant` and `boost::apply_visitor`.
|
||||||
|
template <template<typename...> class Variant>
|
||||||
|
struct visit_helper {
|
||||||
|
template <typename... Args>
|
||||||
|
static auto call(Args &&...args) -> decltype(visit(std::forward<Args>(args)...)) {
|
||||||
|
return visit(std::forward<Args>(args)...);
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
/// Generic variant caster
|
||||||
|
template <typename Variant> struct variant_caster;
|
||||||
|
|
||||||
|
template <template<typename...> class V, typename... Ts>
|
||||||
|
struct variant_caster<V<Ts...>> {
|
||||||
|
static_assert(sizeof...(Ts) > 0, "Variant must consist of at least one alternative.");
|
||||||
|
|
||||||
|
template <typename U, typename... Us>
|
||||||
|
bool load_alternative(handle src, bool convert, type_list<U, Us...>) {
|
||||||
|
auto caster = make_caster<U>();
|
||||||
|
if (caster.load(src, convert)) {
|
||||||
|
value = cast_op<U>(caster);
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
return load_alternative(src, convert, type_list<Us...>{});
|
||||||
|
}
|
||||||
|
|
||||||
|
bool load_alternative(handle, bool, type_list<>) { return false; }
|
||||||
|
|
||||||
|
bool load(handle src, bool convert) {
|
||||||
|
// Do a first pass without conversions to improve constructor resolution.
|
||||||
|
// E.g. `py::int_(1).cast<variant<double, int>>()` needs to fill the `int`
|
||||||
|
// slot of the variant. Without two-pass loading `double` would be filled
|
||||||
|
// because it appears first and a conversion is possible.
|
||||||
|
if (convert && load_alternative(src, false, type_list<Ts...>{}))
|
||||||
|
return true;
|
||||||
|
return load_alternative(src, convert, type_list<Ts...>{});
|
||||||
|
}
|
||||||
|
|
||||||
|
template <typename Variant>
|
||||||
|
static handle cast(Variant &&src, return_value_policy policy, handle parent) {
|
||||||
|
return visit_helper<V>::call(variant_caster_visitor{policy, parent},
|
||||||
|
std::forward<Variant>(src));
|
||||||
|
}
|
||||||
|
|
||||||
|
using Type = V<Ts...>;
|
||||||
|
PYBIND11_TYPE_CASTER(Type, _("Union[") + detail::concat(make_caster<Ts>::name...) + _("]"));
|
||||||
|
};
|
||||||
|
|
||||||
|
#if PYBIND11_HAS_VARIANT
|
||||||
|
template <typename... Ts>
|
||||||
|
struct type_caster<std::variant<Ts...>> : variant_caster<std::variant<Ts...>> { };
|
||||||
|
#endif
|
||||||
|
|
||||||
|
NAMESPACE_END(detail)
|
||||||
|
|
||||||
|
inline std::ostream &operator<<(std::ostream &os, const handle &obj) {
|
||||||
|
os << (std::string) str(obj);
|
||||||
|
return os;
|
||||||
|
}
|
||||||
|
|
||||||
|
NAMESPACE_END(PYBIND11_NAMESPACE)
|
||||||
|
|
||||||
|
#if defined(_MSC_VER)
|
||||||
|
#pragma warning(pop)
|
||||||
|
#endif
|
630
python/src/pybind11/stl_bind.h
Normal file
630
python/src/pybind11/stl_bind.h
Normal file
@@ -0,0 +1,630 @@
|
|||||||
|
/*
|
||||||
|
pybind11/std_bind.h: Binding generators for STL data types
|
||||||
|
|
||||||
|
Copyright (c) 2016 Sergey Lyskov and Wenzel Jakob
|
||||||
|
|
||||||
|
All rights reserved. Use of this source code is governed by a
|
||||||
|
BSD-style license that can be found in the LICENSE file.
|
||||||
|
*/
|
||||||
|
|
||||||
|
#pragma once
|
||||||
|
|
||||||
|
#include "detail/common.h"
|
||||||
|
#include "operators.h"
|
||||||
|
|
||||||
|
#include <algorithm>
|
||||||
|
#include <sstream>
|
||||||
|
|
||||||
|
NAMESPACE_BEGIN(PYBIND11_NAMESPACE)
|
||||||
|
NAMESPACE_BEGIN(detail)
|
||||||
|
|
||||||
|
/* SFINAE helper class used by 'is_comparable */
|
||||||
|
template <typename T> struct container_traits {
|
||||||
|
template <typename T2> static std::true_type test_comparable(decltype(std::declval<const T2 &>() == std::declval<const T2 &>())*);
|
||||||
|
template <typename T2> static std::false_type test_comparable(...);
|
||||||
|
template <typename T2> static std::true_type test_value(typename T2::value_type *);
|
||||||
|
template <typename T2> static std::false_type test_value(...);
|
||||||
|
template <typename T2> static std::true_type test_pair(typename T2::first_type *, typename T2::second_type *);
|
||||||
|
template <typename T2> static std::false_type test_pair(...);
|
||||||
|
|
||||||
|
static constexpr const bool is_comparable = std::is_same<std::true_type, decltype(test_comparable<T>(nullptr))>::value;
|
||||||
|
static constexpr const bool is_pair = std::is_same<std::true_type, decltype(test_pair<T>(nullptr, nullptr))>::value;
|
||||||
|
static constexpr const bool is_vector = std::is_same<std::true_type, decltype(test_value<T>(nullptr))>::value;
|
||||||
|
static constexpr const bool is_element = !is_pair && !is_vector;
|
||||||
|
};
|
||||||
|
|
||||||
|
/* Default: is_comparable -> std::false_type */
|
||||||
|
template <typename T, typename SFINAE = void>
|
||||||
|
struct is_comparable : std::false_type { };
|
||||||
|
|
||||||
|
/* For non-map data structures, check whether operator== can be instantiated */
|
||||||
|
template <typename T>
|
||||||
|
struct is_comparable<
|
||||||
|
T, enable_if_t<container_traits<T>::is_element &&
|
||||||
|
container_traits<T>::is_comparable>>
|
||||||
|
: std::true_type { };
|
||||||
|
|
||||||
|
/* For a vector/map data structure, recursively check the value type (which is std::pair for maps) */
|
||||||
|
template <typename T>
|
||||||
|
struct is_comparable<T, enable_if_t<container_traits<T>::is_vector>> {
|
||||||
|
static constexpr const bool value =
|
||||||
|
is_comparable<typename T::value_type>::value;
|
||||||
|
};
|
||||||
|
|
||||||
|
/* For pairs, recursively check the two data types */
|
||||||
|
template <typename T>
|
||||||
|
struct is_comparable<T, enable_if_t<container_traits<T>::is_pair>> {
|
||||||
|
static constexpr const bool value =
|
||||||
|
is_comparable<typename T::first_type>::value &&
|
||||||
|
is_comparable<typename T::second_type>::value;
|
||||||
|
};
|
||||||
|
|
||||||
|
/* Fallback functions */
|
||||||
|
template <typename, typename, typename... Args> void vector_if_copy_constructible(const Args &...) { }
|
||||||
|
template <typename, typename, typename... Args> void vector_if_equal_operator(const Args &...) { }
|
||||||
|
template <typename, typename, typename... Args> void vector_if_insertion_operator(const Args &...) { }
|
||||||
|
template <typename, typename, typename... Args> void vector_modifiers(const Args &...) { }
|
||||||
|
|
||||||
|
template<typename Vector, typename Class_>
|
||||||
|
void vector_if_copy_constructible(enable_if_t<is_copy_constructible<Vector>::value, Class_> &cl) {
|
||||||
|
cl.def(init<const Vector &>(), "Copy constructor");
|
||||||
|
}
|
||||||
|
|
||||||
|
template<typename Vector, typename Class_>
|
||||||
|
void vector_if_equal_operator(enable_if_t<is_comparable<Vector>::value, Class_> &cl) {
|
||||||
|
using T = typename Vector::value_type;
|
||||||
|
|
||||||
|
cl.def(self == self);
|
||||||
|
cl.def(self != self);
|
||||||
|
|
||||||
|
cl.def("count",
|
||||||
|
[](const Vector &v, const T &x) {
|
||||||
|
return std::count(v.begin(), v.end(), x);
|
||||||
|
},
|
||||||
|
arg("x"),
|
||||||
|
"Return the number of times ``x`` appears in the list"
|
||||||
|
);
|
||||||
|
|
||||||
|
cl.def("remove", [](Vector &v, const T &x) {
|
||||||
|
auto p = std::find(v.begin(), v.end(), x);
|
||||||
|
if (p != v.end())
|
||||||
|
v.erase(p);
|
||||||
|
else
|
||||||
|
throw value_error();
|
||||||
|
},
|
||||||
|
arg("x"),
|
||||||
|
"Remove the first item from the list whose value is x. "
|
||||||
|
"It is an error if there is no such item."
|
||||||
|
);
|
||||||
|
|
||||||
|
cl.def("__contains__",
|
||||||
|
[](const Vector &v, const T &x) {
|
||||||
|
return std::find(v.begin(), v.end(), x) != v.end();
|
||||||
|
},
|
||||||
|
arg("x"),
|
||||||
|
"Return true the container contains ``x``"
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
// Vector modifiers -- requires a copyable vector_type:
|
||||||
|
// (Technically, some of these (pop and __delitem__) don't actually require copyability, but it seems
|
||||||
|
// silly to allow deletion but not insertion, so include them here too.)
|
||||||
|
template <typename Vector, typename Class_>
|
||||||
|
void vector_modifiers(enable_if_t<is_copy_constructible<typename Vector::value_type>::value, Class_> &cl) {
|
||||||
|
using T = typename Vector::value_type;
|
||||||
|
using SizeType = typename Vector::size_type;
|
||||||
|
using DiffType = typename Vector::difference_type;
|
||||||
|
|
||||||
|
cl.def("append",
|
||||||
|
[](Vector &v, const T &value) { v.push_back(value); },
|
||||||
|
arg("x"),
|
||||||
|
"Add an item to the end of the list");
|
||||||
|
|
||||||
|
cl.def(init([](iterable it) {
|
||||||
|
auto v = std::unique_ptr<Vector>(new Vector());
|
||||||
|
v->reserve(len_hint(it));
|
||||||
|
for (handle h : it)
|
||||||
|
v->push_back(h.cast<T>());
|
||||||
|
return v.release();
|
||||||
|
}));
|
||||||
|
|
||||||
|
cl.def("extend",
|
||||||
|
[](Vector &v, const Vector &src) {
|
||||||
|
v.insert(v.end(), src.begin(), src.end());
|
||||||
|
},
|
||||||
|
arg("L"),
|
||||||
|
"Extend the list by appending all the items in the given list"
|
||||||
|
);
|
||||||
|
|
||||||
|
cl.def("extend",
|
||||||
|
[](Vector &v, iterable it) {
|
||||||
|
const size_t old_size = v.size();
|
||||||
|
v.reserve(old_size + len_hint(it));
|
||||||
|
try {
|
||||||
|
for (handle h : it) {
|
||||||
|
v.push_back(h.cast<T>());
|
||||||
|
}
|
||||||
|
} catch (const cast_error &) {
|
||||||
|
v.erase(v.begin() + static_cast<typename Vector::difference_type>(old_size), v.end());
|
||||||
|
try {
|
||||||
|
v.shrink_to_fit();
|
||||||
|
} catch (const std::exception &) {
|
||||||
|
// Do nothing
|
||||||
|
}
|
||||||
|
throw;
|
||||||
|
}
|
||||||
|
},
|
||||||
|
arg("L"),
|
||||||
|
"Extend the list by appending all the items in the given list"
|
||||||
|
);
|
||||||
|
|
||||||
|
cl.def("insert",
|
||||||
|
[](Vector &v, SizeType i, const T &x) {
|
||||||
|
if (i > v.size())
|
||||||
|
throw index_error();
|
||||||
|
v.insert(v.begin() + (DiffType) i, x);
|
||||||
|
},
|
||||||
|
arg("i") , arg("x"),
|
||||||
|
"Insert an item at a given position."
|
||||||
|
);
|
||||||
|
|
||||||
|
cl.def("pop",
|
||||||
|
[](Vector &v) {
|
||||||
|
if (v.empty())
|
||||||
|
throw index_error();
|
||||||
|
T t = v.back();
|
||||||
|
v.pop_back();
|
||||||
|
return t;
|
||||||
|
},
|
||||||
|
"Remove and return the last item"
|
||||||
|
);
|
||||||
|
|
||||||
|
cl.def("pop",
|
||||||
|
[](Vector &v, SizeType i) {
|
||||||
|
if (i >= v.size())
|
||||||
|
throw index_error();
|
||||||
|
T t = v[i];
|
||||||
|
v.erase(v.begin() + (DiffType) i);
|
||||||
|
return t;
|
||||||
|
},
|
||||||
|
arg("i"),
|
||||||
|
"Remove and return the item at index ``i``"
|
||||||
|
);
|
||||||
|
|
||||||
|
cl.def("__setitem__",
|
||||||
|
[](Vector &v, SizeType i, const T &t) {
|
||||||
|
if (i >= v.size())
|
||||||
|
throw index_error();
|
||||||
|
v[i] = t;
|
||||||
|
}
|
||||||
|
);
|
||||||
|
|
||||||
|
/// Slicing protocol
|
||||||
|
cl.def("__getitem__",
|
||||||
|
[](const Vector &v, slice slice) -> Vector * {
|
||||||
|
size_t start, stop, step, slicelength;
|
||||||
|
|
||||||
|
if (!slice.compute(v.size(), &start, &stop, &step, &slicelength))
|
||||||
|
throw error_already_set();
|
||||||
|
|
||||||
|
Vector *seq = new Vector();
|
||||||
|
seq->reserve((size_t) slicelength);
|
||||||
|
|
||||||
|
for (size_t i=0; i<slicelength; ++i) {
|
||||||
|
seq->push_back(v[start]);
|
||||||
|
start += step;
|
||||||
|
}
|
||||||
|
return seq;
|
||||||
|
},
|
||||||
|
arg("s"),
|
||||||
|
"Retrieve list elements using a slice object"
|
||||||
|
);
|
||||||
|
|
||||||
|
cl.def("__setitem__",
|
||||||
|
[](Vector &v, slice slice, const Vector &value) {
|
||||||
|
size_t start, stop, step, slicelength;
|
||||||
|
if (!slice.compute(v.size(), &start, &stop, &step, &slicelength))
|
||||||
|
throw error_already_set();
|
||||||
|
|
||||||
|
if (slicelength != value.size())
|
||||||
|
throw std::runtime_error("Left and right hand size of slice assignment have different sizes!");
|
||||||
|
|
||||||
|
for (size_t i=0; i<slicelength; ++i) {
|
||||||
|
v[start] = value[i];
|
||||||
|
start += step;
|
||||||
|
}
|
||||||
|
},
|
||||||
|
"Assign list elements using a slice object"
|
||||||
|
);
|
||||||
|
|
||||||
|
cl.def("__delitem__",
|
||||||
|
[](Vector &v, SizeType i) {
|
||||||
|
if (i >= v.size())
|
||||||
|
throw index_error();
|
||||||
|
v.erase(v.begin() + DiffType(i));
|
||||||
|
},
|
||||||
|
"Delete the list elements at index ``i``"
|
||||||
|
);
|
||||||
|
|
||||||
|
cl.def("__delitem__",
|
||||||
|
[](Vector &v, slice slice) {
|
||||||
|
size_t start, stop, step, slicelength;
|
||||||
|
|
||||||
|
if (!slice.compute(v.size(), &start, &stop, &step, &slicelength))
|
||||||
|
throw error_already_set();
|
||||||
|
|
||||||
|
if (step == 1 && false) {
|
||||||
|
v.erase(v.begin() + (DiffType) start, v.begin() + DiffType(start + slicelength));
|
||||||
|
} else {
|
||||||
|
for (size_t i = 0; i < slicelength; ++i) {
|
||||||
|
v.erase(v.begin() + DiffType(start));
|
||||||
|
start += step - 1;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
},
|
||||||
|
"Delete list elements using a slice object"
|
||||||
|
);
|
||||||
|
|
||||||
|
}
|
||||||
|
|
||||||
|
// If the type has an operator[] that doesn't return a reference (most notably std::vector<bool>),
|
||||||
|
// we have to access by copying; otherwise we return by reference.
|
||||||
|
template <typename Vector> using vector_needs_copy = negation<
|
||||||
|
std::is_same<decltype(std::declval<Vector>()[typename Vector::size_type()]), typename Vector::value_type &>>;
|
||||||
|
|
||||||
|
// The usual case: access and iterate by reference
|
||||||
|
template <typename Vector, typename Class_>
|
||||||
|
void vector_accessor(enable_if_t<!vector_needs_copy<Vector>::value, Class_> &cl) {
|
||||||
|
using T = typename Vector::value_type;
|
||||||
|
using SizeType = typename Vector::size_type;
|
||||||
|
using ItType = typename Vector::iterator;
|
||||||
|
|
||||||
|
cl.def("__getitem__",
|
||||||
|
[](Vector &v, SizeType i) -> T & {
|
||||||
|
if (i >= v.size())
|
||||||
|
throw index_error();
|
||||||
|
return v[i];
|
||||||
|
},
|
||||||
|
return_value_policy::reference_internal // ref + keepalive
|
||||||
|
);
|
||||||
|
|
||||||
|
cl.def("__iter__",
|
||||||
|
[](Vector &v) {
|
||||||
|
return make_iterator<
|
||||||
|
return_value_policy::reference_internal, ItType, ItType, T&>(
|
||||||
|
v.begin(), v.end());
|
||||||
|
},
|
||||||
|
keep_alive<0, 1>() /* Essential: keep list alive while iterator exists */
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
// The case for special objects, like std::vector<bool>, that have to be returned-by-copy:
|
||||||
|
template <typename Vector, typename Class_>
|
||||||
|
void vector_accessor(enable_if_t<vector_needs_copy<Vector>::value, Class_> &cl) {
|
||||||
|
using T = typename Vector::value_type;
|
||||||
|
using SizeType = typename Vector::size_type;
|
||||||
|
using ItType = typename Vector::iterator;
|
||||||
|
cl.def("__getitem__",
|
||||||
|
[](const Vector &v, SizeType i) -> T {
|
||||||
|
if (i >= v.size())
|
||||||
|
throw index_error();
|
||||||
|
return v[i];
|
||||||
|
}
|
||||||
|
);
|
||||||
|
|
||||||
|
cl.def("__iter__",
|
||||||
|
[](Vector &v) {
|
||||||
|
return make_iterator<
|
||||||
|
return_value_policy::copy, ItType, ItType, T>(
|
||||||
|
v.begin(), v.end());
|
||||||
|
},
|
||||||
|
keep_alive<0, 1>() /* Essential: keep list alive while iterator exists */
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
template <typename Vector, typename Class_> auto vector_if_insertion_operator(Class_ &cl, std::string const &name)
|
||||||
|
-> decltype(std::declval<std::ostream&>() << std::declval<typename Vector::value_type>(), void()) {
|
||||||
|
using size_type = typename Vector::size_type;
|
||||||
|
|
||||||
|
cl.def("__repr__",
|
||||||
|
[name](Vector &v) {
|
||||||
|
std::ostringstream s;
|
||||||
|
s << name << '[';
|
||||||
|
for (size_type i=0; i < v.size(); ++i) {
|
||||||
|
s << v[i];
|
||||||
|
if (i != v.size() - 1)
|
||||||
|
s << ", ";
|
||||||
|
}
|
||||||
|
s << ']';
|
||||||
|
return s.str();
|
||||||
|
},
|
||||||
|
"Return the canonical string representation of this list."
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
// Provide the buffer interface for vectors if we have data() and we have a format for it
|
||||||
|
// GCC seems to have "void std::vector<bool>::data()" - doing SFINAE on the existence of data() is insufficient, we need to check it returns an appropriate pointer
|
||||||
|
template <typename Vector, typename = void>
|
||||||
|
struct vector_has_data_and_format : std::false_type {};
|
||||||
|
template <typename Vector>
|
||||||
|
struct vector_has_data_and_format<Vector, enable_if_t<std::is_same<decltype(format_descriptor<typename Vector::value_type>::format(), std::declval<Vector>().data()), typename Vector::value_type*>::value>> : std::true_type {};
|
||||||
|
|
||||||
|
// Add the buffer interface to a vector
|
||||||
|
template <typename Vector, typename Class_, typename... Args>
|
||||||
|
enable_if_t<detail::any_of<std::is_same<Args, buffer_protocol>...>::value>
|
||||||
|
vector_buffer(Class_& cl) {
|
||||||
|
using T = typename Vector::value_type;
|
||||||
|
|
||||||
|
static_assert(vector_has_data_and_format<Vector>::value, "There is not an appropriate format descriptor for this vector");
|
||||||
|
|
||||||
|
// numpy.h declares this for arbitrary types, but it may raise an exception and crash hard at runtime if PYBIND11_NUMPY_DTYPE hasn't been called, so check here
|
||||||
|
format_descriptor<T>::format();
|
||||||
|
|
||||||
|
cl.def_buffer([](Vector& v) -> buffer_info {
|
||||||
|
return buffer_info(v.data(), static_cast<ssize_t>(sizeof(T)), format_descriptor<T>::format(), 1, {v.size()}, {sizeof(T)});
|
||||||
|
});
|
||||||
|
|
||||||
|
cl.def(init([](buffer buf) {
|
||||||
|
auto info = buf.request();
|
||||||
|
if (info.ndim != 1 || info.strides[0] % static_cast<ssize_t>(sizeof(T)))
|
||||||
|
throw type_error("Only valid 1D buffers can be copied to a vector");
|
||||||
|
if (!detail::compare_buffer_info<T>::compare(info) || (ssize_t) sizeof(T) != info.itemsize)
|
||||||
|
throw type_error("Format mismatch (Python: " + info.format + " C++: " + format_descriptor<T>::format() + ")");
|
||||||
|
|
||||||
|
auto vec = std::unique_ptr<Vector>(new Vector());
|
||||||
|
vec->reserve((size_t) info.shape[0]);
|
||||||
|
T *p = static_cast<T*>(info.ptr);
|
||||||
|
ssize_t step = info.strides[0] / static_cast<ssize_t>(sizeof(T));
|
||||||
|
T *end = p + info.shape[0] * step;
|
||||||
|
for (; p != end; p += step)
|
||||||
|
vec->push_back(*p);
|
||||||
|
return vec.release();
|
||||||
|
}));
|
||||||
|
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
template <typename Vector, typename Class_, typename... Args>
|
||||||
|
enable_if_t<!detail::any_of<std::is_same<Args, buffer_protocol>...>::value> vector_buffer(Class_&) {}
|
||||||
|
|
||||||
|
NAMESPACE_END(detail)
|
||||||
|
|
||||||
|
//
|
||||||
|
// std::vector
|
||||||
|
//
|
||||||
|
template <typename Vector, typename holder_type = std::unique_ptr<Vector>, typename... Args>
|
||||||
|
class_<Vector, holder_type> bind_vector(handle scope, std::string const &name, Args&&... args) {
|
||||||
|
using Class_ = class_<Vector, holder_type>;
|
||||||
|
|
||||||
|
// If the value_type is unregistered (e.g. a converting type) or is itself registered
|
||||||
|
// module-local then make the vector binding module-local as well:
|
||||||
|
using vtype = typename Vector::value_type;
|
||||||
|
auto vtype_info = detail::get_type_info(typeid(vtype));
|
||||||
|
bool local = !vtype_info || vtype_info->module_local;
|
||||||
|
|
||||||
|
Class_ cl(scope, name.c_str(), pybind11::module_local(local), std::forward<Args>(args)...);
|
||||||
|
|
||||||
|
// Declare the buffer interface if a buffer_protocol() is passed in
|
||||||
|
detail::vector_buffer<Vector, Class_, Args...>(cl);
|
||||||
|
|
||||||
|
cl.def(init<>());
|
||||||
|
|
||||||
|
// Register copy constructor (if possible)
|
||||||
|
detail::vector_if_copy_constructible<Vector, Class_>(cl);
|
||||||
|
|
||||||
|
// Register comparison-related operators and functions (if possible)
|
||||||
|
detail::vector_if_equal_operator<Vector, Class_>(cl);
|
||||||
|
|
||||||
|
// Register stream insertion operator (if possible)
|
||||||
|
detail::vector_if_insertion_operator<Vector, Class_>(cl, name);
|
||||||
|
|
||||||
|
// Modifiers require copyable vector value type
|
||||||
|
detail::vector_modifiers<Vector, Class_>(cl);
|
||||||
|
|
||||||
|
// Accessor and iterator; return by value if copyable, otherwise we return by ref + keep-alive
|
||||||
|
detail::vector_accessor<Vector, Class_>(cl);
|
||||||
|
|
||||||
|
cl.def("__bool__",
|
||||||
|
[](const Vector &v) -> bool {
|
||||||
|
return !v.empty();
|
||||||
|
},
|
||||||
|
"Check whether the list is nonempty"
|
||||||
|
);
|
||||||
|
|
||||||
|
cl.def("__len__", &Vector::size);
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
#if 0
|
||||||
|
// C++ style functions deprecated, leaving it here as an example
|
||||||
|
cl.def(init<size_type>());
|
||||||
|
|
||||||
|
cl.def("resize",
|
||||||
|
(void (Vector::*) (size_type count)) & Vector::resize,
|
||||||
|
"changes the number of elements stored");
|
||||||
|
|
||||||
|
cl.def("erase",
|
||||||
|
[](Vector &v, SizeType i) {
|
||||||
|
if (i >= v.size())
|
||||||
|
throw index_error();
|
||||||
|
v.erase(v.begin() + i);
|
||||||
|
}, "erases element at index ``i``");
|
||||||
|
|
||||||
|
cl.def("empty", &Vector::empty, "checks whether the container is empty");
|
||||||
|
cl.def("size", &Vector::size, "returns the number of elements");
|
||||||
|
cl.def("push_back", (void (Vector::*)(const T&)) &Vector::push_back, "adds an element to the end");
|
||||||
|
cl.def("pop_back", &Vector::pop_back, "removes the last element");
|
||||||
|
|
||||||
|
cl.def("max_size", &Vector::max_size, "returns the maximum possible number of elements");
|
||||||
|
cl.def("reserve", &Vector::reserve, "reserves storage");
|
||||||
|
cl.def("capacity", &Vector::capacity, "returns the number of elements that can be held in currently allocated storage");
|
||||||
|
cl.def("shrink_to_fit", &Vector::shrink_to_fit, "reduces memory usage by freeing unused memory");
|
||||||
|
|
||||||
|
cl.def("clear", &Vector::clear, "clears the contents");
|
||||||
|
cl.def("swap", &Vector::swap, "swaps the contents");
|
||||||
|
|
||||||
|
cl.def("front", [](Vector &v) {
|
||||||
|
if (v.size()) return v.front();
|
||||||
|
else throw index_error();
|
||||||
|
}, "access the first element");
|
||||||
|
|
||||||
|
cl.def("back", [](Vector &v) {
|
||||||
|
if (v.size()) return v.back();
|
||||||
|
else throw index_error();
|
||||||
|
}, "access the last element ");
|
||||||
|
|
||||||
|
#endif
|
||||||
|
|
||||||
|
return cl;
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
//
|
||||||
|
// std::map, std::unordered_map
|
||||||
|
//
|
||||||
|
|
||||||
|
NAMESPACE_BEGIN(detail)
|
||||||
|
|
||||||
|
/* Fallback functions */
|
||||||
|
template <typename, typename, typename... Args> void map_if_insertion_operator(const Args &...) { }
|
||||||
|
template <typename, typename, typename... Args> void map_assignment(const Args &...) { }
|
||||||
|
|
||||||
|
// Map assignment when copy-assignable: just copy the value
|
||||||
|
template <typename Map, typename Class_>
|
||||||
|
void map_assignment(enable_if_t<std::is_copy_assignable<typename Map::mapped_type>::value, Class_> &cl) {
|
||||||
|
using KeyType = typename Map::key_type;
|
||||||
|
using MappedType = typename Map::mapped_type;
|
||||||
|
|
||||||
|
cl.def("__setitem__",
|
||||||
|
[](Map &m, const KeyType &k, const MappedType &v) {
|
||||||
|
auto it = m.find(k);
|
||||||
|
if (it != m.end()) it->second = v;
|
||||||
|
else m.emplace(k, v);
|
||||||
|
}
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
// Not copy-assignable, but still copy-constructible: we can update the value by erasing and reinserting
|
||||||
|
template<typename Map, typename Class_>
|
||||||
|
void map_assignment(enable_if_t<
|
||||||
|
!std::is_copy_assignable<typename Map::mapped_type>::value &&
|
||||||
|
is_copy_constructible<typename Map::mapped_type>::value,
|
||||||
|
Class_> &cl) {
|
||||||
|
using KeyType = typename Map::key_type;
|
||||||
|
using MappedType = typename Map::mapped_type;
|
||||||
|
|
||||||
|
cl.def("__setitem__",
|
||||||
|
[](Map &m, const KeyType &k, const MappedType &v) {
|
||||||
|
// We can't use m[k] = v; because value type might not be default constructable
|
||||||
|
auto r = m.emplace(k, v);
|
||||||
|
if (!r.second) {
|
||||||
|
// value type is not copy assignable so the only way to insert it is to erase it first...
|
||||||
|
m.erase(r.first);
|
||||||
|
m.emplace(k, v);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
template <typename Map, typename Class_> auto map_if_insertion_operator(Class_ &cl, std::string const &name)
|
||||||
|
-> decltype(std::declval<std::ostream&>() << std::declval<typename Map::key_type>() << std::declval<typename Map::mapped_type>(), void()) {
|
||||||
|
|
||||||
|
cl.def("__repr__",
|
||||||
|
[name](Map &m) {
|
||||||
|
std::ostringstream s;
|
||||||
|
s << name << '{';
|
||||||
|
bool f = false;
|
||||||
|
for (auto const &kv : m) {
|
||||||
|
if (f)
|
||||||
|
s << ", ";
|
||||||
|
s << kv.first << ": " << kv.second;
|
||||||
|
f = true;
|
||||||
|
}
|
||||||
|
s << '}';
|
||||||
|
return s.str();
|
||||||
|
},
|
||||||
|
"Return the canonical string representation of this map."
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
NAMESPACE_END(detail)
|
||||||
|
|
||||||
|
template <typename Map, typename holder_type = std::unique_ptr<Map>, typename... Args>
|
||||||
|
class_<Map, holder_type> bind_map(handle scope, const std::string &name, Args&&... args) {
|
||||||
|
using KeyType = typename Map::key_type;
|
||||||
|
using MappedType = typename Map::mapped_type;
|
||||||
|
using Class_ = class_<Map, holder_type>;
|
||||||
|
|
||||||
|
// If either type is a non-module-local bound type then make the map binding non-local as well;
|
||||||
|
// otherwise (e.g. both types are either module-local or converting) the map will be
|
||||||
|
// module-local.
|
||||||
|
auto tinfo = detail::get_type_info(typeid(MappedType));
|
||||||
|
bool local = !tinfo || tinfo->module_local;
|
||||||
|
if (local) {
|
||||||
|
tinfo = detail::get_type_info(typeid(KeyType));
|
||||||
|
local = !tinfo || tinfo->module_local;
|
||||||
|
}
|
||||||
|
|
||||||
|
Class_ cl(scope, name.c_str(), pybind11::module_local(local), std::forward<Args>(args)...);
|
||||||
|
|
||||||
|
cl.def(init<>());
|
||||||
|
|
||||||
|
// Register stream insertion operator (if possible)
|
||||||
|
detail::map_if_insertion_operator<Map, Class_>(cl, name);
|
||||||
|
|
||||||
|
cl.def("__bool__",
|
||||||
|
[](const Map &m) -> bool { return !m.empty(); },
|
||||||
|
"Check whether the map is nonempty"
|
||||||
|
);
|
||||||
|
|
||||||
|
cl.def("__iter__",
|
||||||
|
[](Map &m) { return make_key_iterator(m.begin(), m.end()); },
|
||||||
|
keep_alive<0, 1>() /* Essential: keep list alive while iterator exists */
|
||||||
|
);
|
||||||
|
|
||||||
|
cl.def("items",
|
||||||
|
[](Map &m) { return make_iterator(m.begin(), m.end()); },
|
||||||
|
keep_alive<0, 1>() /* Essential: keep list alive while iterator exists */
|
||||||
|
);
|
||||||
|
|
||||||
|
cl.def("__getitem__",
|
||||||
|
[](Map &m, const KeyType &k) -> MappedType & {
|
||||||
|
auto it = m.find(k);
|
||||||
|
if (it == m.end())
|
||||||
|
throw key_error();
|
||||||
|
return it->second;
|
||||||
|
},
|
||||||
|
return_value_policy::reference_internal // ref + keepalive
|
||||||
|
);
|
||||||
|
|
||||||
|
cl.def("__contains__",
|
||||||
|
[](Map &m, const KeyType &k) -> bool {
|
||||||
|
auto it = m.find(k);
|
||||||
|
if (it == m.end())
|
||||||
|
return false;
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
);
|
||||||
|
|
||||||
|
// Assignment provided only if the type is copyable
|
||||||
|
detail::map_assignment<Map, Class_>(cl);
|
||||||
|
|
||||||
|
cl.def("__delitem__",
|
||||||
|
[](Map &m, const KeyType &k) {
|
||||||
|
auto it = m.find(k);
|
||||||
|
if (it == m.end())
|
||||||
|
throw key_error();
|
||||||
|
m.erase(it);
|
||||||
|
}
|
||||||
|
);
|
||||||
|
|
||||||
|
cl.def("__len__", &Map::size);
|
||||||
|
|
||||||
|
return cl;
|
||||||
|
}
|
||||||
|
|
||||||
|
NAMESPACE_END(PYBIND11_NAMESPACE)
|
224
python/src/tensorflow.cpp
Normal file
224
python/src/tensorflow.cpp
Normal file
@@ -0,0 +1,224 @@
|
|||||||
|
#include <pybind11/pybind11.h>
|
||||||
|
#include <pybind11/stl.h>
|
||||||
|
#include <string>
|
||||||
|
#include <regex>
|
||||||
|
#include <algorithm>
|
||||||
|
#include "triton/codegen/selection/selection.h"
|
||||||
|
#include "triton/runtime/function.h"
|
||||||
|
#include "triton/lang/lang.h"
|
||||||
|
#include "triton/driver/device.h"
|
||||||
|
#include "triton/driver/stream.h"
|
||||||
|
#include "triton/driver/kernel.h"
|
||||||
|
#include "triton/driver/module.h"
|
||||||
|
#include "triton/ir/module.h"
|
||||||
|
#include "triton/ir/function.h"
|
||||||
|
#include "triton/tools/bench.hpp"
|
||||||
|
|
||||||
|
typedef struct yy_buffer_state * YY_BUFFER_STATE;
|
||||||
|
extern int yyparse();
|
||||||
|
extern YY_BUFFER_STATE yy_scan_string(const char * str);
|
||||||
|
extern void yy_delete_buffer(YY_BUFFER_STATE buffer);
|
||||||
|
extern triton::lang::translation_unit *ast_root;
|
||||||
|
|
||||||
|
using namespace triton;
|
||||||
|
|
||||||
|
inline std::string to_tf_ty(ir::type *ty) {
|
||||||
|
if(ty->is_integer_ty(1))
|
||||||
|
return "bool";
|
||||||
|
if(ty->is_integer_ty(8))
|
||||||
|
return "int8";
|
||||||
|
if(ty->is_integer_ty(16))
|
||||||
|
return "int16";
|
||||||
|
if(ty->is_integer_ty(32))
|
||||||
|
return "int32";
|
||||||
|
if(ty->is_integer_ty(64))
|
||||||
|
return "int64";
|
||||||
|
if(ty->is_half_ty())
|
||||||
|
return "float16";
|
||||||
|
if(ty->is_float_ty())
|
||||||
|
return "float32";
|
||||||
|
if(ty->is_double_ty())
|
||||||
|
return "float64";
|
||||||
|
if(ty->is_pointer_ty())
|
||||||
|
return "Tensor";
|
||||||
|
throw std::runtime_error("unknown type");
|
||||||
|
}
|
||||||
|
|
||||||
|
inline std::string to_tf_scalar_ty(ir::type *ty) {
|
||||||
|
if(ty->is_pointer_ty())
|
||||||
|
return to_tf_ty(ty->get_pointer_element_ty());
|
||||||
|
else {
|
||||||
|
return to_tf_ty(ty);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
inline std::string ref_to_tf_ty(ir::type *ty) {
|
||||||
|
std::string res = to_tf_ty(ty);
|
||||||
|
if(ty->is_pointer_ty())
|
||||||
|
res = "const " + res + "&";
|
||||||
|
return res;
|
||||||
|
}
|
||||||
|
|
||||||
|
inline triton::lang::translation_unit *make_ast(const char *src) {
|
||||||
|
YY_BUFFER_STATE buffer = yy_scan_string(src);
|
||||||
|
yyparse();
|
||||||
|
yy_delete_buffer(buffer);
|
||||||
|
triton::lang::translation_unit *program = ast_root;
|
||||||
|
return program;
|
||||||
|
}
|
||||||
|
|
||||||
|
inline std::unique_ptr<ir::module> make_ir(ir::context& ctx, triton::lang::translation_unit *program) {
|
||||||
|
// create Triton-IR from AST
|
||||||
|
ir::module* module = new ir::module("", ctx);
|
||||||
|
program->codegen(module);
|
||||||
|
return std::unique_ptr<ir::module>(module);
|
||||||
|
}
|
||||||
|
|
||||||
|
std::string make_tensorflow_src(const std::string src,
|
||||||
|
const std::vector<size_t>& outputs,
|
||||||
|
const std::string& macro) {
|
||||||
|
triton::lang::translation_unit *ast = make_ast(src.c_str());
|
||||||
|
triton::ir::context context;
|
||||||
|
std::unique_ptr<ir::module> ir = make_ir(context, ast);
|
||||||
|
// extract function signature
|
||||||
|
ir::function* fn = ir->get_function_list().front();
|
||||||
|
ir::function_type* fn_ty = fn->get_fn_type();
|
||||||
|
// numberof arguments
|
||||||
|
size_t n_args = fn_ty->get_num_params();
|
||||||
|
size_t n_outputs = outputs.size();
|
||||||
|
// extract function name
|
||||||
|
std::string name = fn->get_name();
|
||||||
|
name[0] = static_cast<char>(std::toupper(name[0]));
|
||||||
|
std::string classname = name + "Op";
|
||||||
|
// extract argument name
|
||||||
|
std::vector<std::string> arg_names;
|
||||||
|
for(ir::argument *arg: fn->args())
|
||||||
|
arg_names.push_back(arg->get_name());
|
||||||
|
// cached int to str
|
||||||
|
std::vector<std::string> str_i;
|
||||||
|
for(size_t i = 0; i < fn_ty->get_num_params(); i++)
|
||||||
|
str_i.push_back(std::to_string(i));
|
||||||
|
// index of tensors
|
||||||
|
std::vector<size_t> ptr_idx;
|
||||||
|
for(unsigned i = 0; i < fn_ty->get_num_params(); i++)
|
||||||
|
if(fn_ty->get_param_ty(i)->is_pointer_ty())
|
||||||
|
ptr_idx.push_back(i);
|
||||||
|
// extract tensorflow types
|
||||||
|
std::vector<std::string> tf_scalar_tys;
|
||||||
|
std::transform(fn_ty->params_begin(), fn_ty->params_end(), std::back_inserter(tf_scalar_tys), to_tf_scalar_ty);
|
||||||
|
std::vector<std::string> tf_cref_tys;
|
||||||
|
std::transform(fn_ty->params_begin(), fn_ty->params_end(), std::back_inserter(tf_cref_tys), ref_to_tf_ty);
|
||||||
|
|
||||||
|
std::ostringstream oss;
|
||||||
|
|
||||||
|
std::string result = R"(
|
||||||
|
#include "triton/driver/buffer.h"
|
||||||
|
#include "triton/driver/backend.h"
|
||||||
|
#include "triton/driver/stream.h"
|
||||||
|
#include "triton/runtime/function.h"
|
||||||
|
|
||||||
|
#define EIGEN_USE_GPU
|
||||||
|
#include "tensorflow/core/framework/op.h"
|
||||||
|
#include "tensorflow/core/framework/shape_inference.h"
|
||||||
|
#include "tensorflow/core/framework/op_kernel.h"
|
||||||
|
#include "tensorflow/core/util/cuda_kernel_helper.h"
|
||||||
|
#include "tensorflow/core/util/padding.h"
|
||||||
|
#include "tensorflow/core/util/tensor_format.h"
|
||||||
|
#include "tensorflow/core/framework/common_shape_fns.h"
|
||||||
|
|
||||||
|
using namespace tensorflow;
|
||||||
|
using GPUDevice = Eigen::GpuDevice;
|
||||||
|
namespace rt = triton::runtime;
|
||||||
|
namespace drv = triton::driver;
|
||||||
|
|
||||||
|
std::string src = R"TTKERNSRC( )" + src + ")TTKERNSRC\";" + R"(
|
||||||
|
|
||||||
|
class )" + classname + R"(: public OpKernel {
|
||||||
|
public:
|
||||||
|
explicit )" + classname + R"((OpKernelConstruction* context)
|
||||||
|
: OpKernel(context), fn_(src) { }
|
||||||
|
|
||||||
|
void Compute(OpKernelContext* context){
|
||||||
|
|
||||||
|
// get device/stream
|
||||||
|
GPUDevice device = context->eigen_device<GPUDevice>();
|
||||||
|
drv::cu_stream sstream(device.stream(), false);
|
||||||
|
drv::context* ctx = sstream.context();
|
||||||
|
drv::stream* stream = &sstream;
|
||||||
|
|
||||||
|
// extract inputs)";
|
||||||
|
for(unsigned i = 0; i < n_args; i++){
|
||||||
|
std::string suffix = "";
|
||||||
|
std::string ty = tf_cref_tys[i];
|
||||||
|
if(!fn_ty->get_param_ty(i)->is_pointer_ty())
|
||||||
|
suffix = ".scalar<" + ty + ">()()";
|
||||||
|
result += R"(
|
||||||
|
)" + ty + " " + arg_names[i] + " = context->input(" + str_i[i] + ")" + suffix + ";";
|
||||||
|
}
|
||||||
|
|
||||||
|
result += R"(
|
||||||
|
|
||||||
|
// extract outputs)";
|
||||||
|
for(unsigned i = 0; i < n_outputs; i++)
|
||||||
|
result += R"(
|
||||||
|
context->set_output()" + str_i[i] + ", " + arg_names[outputs[i]] + ");";
|
||||||
|
|
||||||
|
result += R"(
|
||||||
|
|
||||||
|
// wrap tensors)";
|
||||||
|
for(size_t i: ptr_idx)
|
||||||
|
result += R"(
|
||||||
|
drv::cu_buffer cu_)" + arg_names[i] + "(ctx, " + arg_names[i] + ".tensor_data().size(), (CUdeviceptr)" + arg_names[i] + R"(.tensor_data().data(), false);)";
|
||||||
|
|
||||||
|
|
||||||
|
std::regex regex("#([a-zA-Z]([a-zA-Z]|[0-9])*)");
|
||||||
|
std::string grid_str = std::regex_replace(macro, regex, "x.at(\"$1\")");
|
||||||
|
|
||||||
|
result += R"(
|
||||||
|
|
||||||
|
// create launch grid;
|
||||||
|
auto grid = [&](const rt::params_t& x) { return rt::grid_t{)" + grid_str + R"(}; };)";
|
||||||
|
|
||||||
|
result += R"(
|
||||||
|
|
||||||
|
// execute function
|
||||||
|
fn_({
|
||||||
|
)";
|
||||||
|
for(unsigned i = 0; i < n_args; i++){
|
||||||
|
std::string arg = arg_names[i];
|
||||||
|
if(fn_ty->get_param_ty(i)->is_pointer_ty())
|
||||||
|
arg = "&cu_" + arg;
|
||||||
|
if(i > 0)
|
||||||
|
result += ", ";
|
||||||
|
result += arg;
|
||||||
|
}
|
||||||
|
result += R"(
|
||||||
|
}, grid, stream);
|
||||||
|
|
||||||
|
}
|
||||||
|
|
||||||
|
private:
|
||||||
|
rt::function fn_;
|
||||||
|
};
|
||||||
|
|
||||||
|
REGISTER_KERNEL_BUILDER(Name(")" + name + "\").Device(DEVICE_GPU), " + classname + R"();
|
||||||
|
|
||||||
|
REGISTER_OP(")" + name + "\")\n";
|
||||||
|
for(size_t i = 0; i < tf_scalar_tys.size(); i++){
|
||||||
|
bool is_output = std::find(outputs.begin(), outputs.end(), i) != outputs.end();
|
||||||
|
std::string mode = is_output ? "Output" : "Input" ;
|
||||||
|
std::string arg_name = arg_names[i];
|
||||||
|
std::transform(arg_name.begin(), arg_name.end(), arg_name.begin(), [](char c) { return std::tolower(c);});
|
||||||
|
result += " ." + mode + "(\"" + arg_name + ": " + tf_scalar_tys[i] + "\")\n";
|
||||||
|
}
|
||||||
|
result += ";\n";
|
||||||
|
|
||||||
|
|
||||||
|
return result;
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
PYBIND11_MODULE(libtriton, m) {
|
||||||
|
m.doc() = "Python bindings to the C++ Triton API";
|
||||||
|
m.def("make_tensorflow_src", &make_tensorflow_src, "Creates C++ source code for a custom Tensorflow op corresponding to the specified Triton kernel");
|
||||||
|
}
|
Reference in New Issue
Block a user