exported rl-algs
This commit is contained in:
2
.gitignore
vendored
2
.gitignore
vendored
@@ -34,5 +34,3 @@ src
|
||||
.cache
|
||||
|
||||
MUJOCO_LOG.TXT
|
||||
|
||||
|
||||
|
@@ -10,5 +10,5 @@ install:
|
||||
- docker build . -t baselines-test
|
||||
|
||||
script:
|
||||
- flake8 --select=F baselines/common
|
||||
- flake8 --select=F,E999 baselines/common baselines/trpo_mpi baselines/ppo2 baselines/a2c baselines/deepq baselines/acer
|
||||
- docker run baselines-test pytest
|
||||
|
14
Dockerfile
14
Dockerfile
@@ -4,17 +4,21 @@ RUN apt-get -y update && apt-get -y install git wget python-dev python3-dev libo
|
||||
ENV CODE_DIR /root/code
|
||||
ENV VENV /root/venv
|
||||
|
||||
COPY . $CODE_DIR/baselines
|
||||
RUN \
|
||||
pip install virtualenv && \
|
||||
virtualenv $VENV --python=python3 && \
|
||||
. $VENV/bin/activate && \
|
||||
cd $CODE_DIR && \
|
||||
pip install --upgrade pip && \
|
||||
pip install -e baselines && \
|
||||
pip install pytest
|
||||
pip install --upgrade pip
|
||||
|
||||
ENV PATH=$VENV/bin:$PATH
|
||||
|
||||
COPY . $CODE_DIR/baselines
|
||||
WORKDIR $CODE_DIR/baselines
|
||||
|
||||
# Clean up pycache and pyc files
|
||||
RUN rm -rf __pycache__ && \
|
||||
find . -name "*.pyc" -delete && \
|
||||
pip install -e .[test]
|
||||
|
||||
|
||||
CMD /bin/bash
|
||||
|
52
README.md
52
README.md
@@ -62,6 +62,58 @@ pip install pytest
|
||||
pytest
|
||||
```
|
||||
|
||||
## Subpackages
|
||||
|
||||
## Testing the installation
|
||||
All unit tests in baselines can be run using pytest runner:
|
||||
```
|
||||
pip install pytest
|
||||
pytest
|
||||
```
|
||||
|
||||
## Training models
|
||||
Most of the algorithms in baselines repo are used as follows:
|
||||
```bash
|
||||
python -m baselines.common.run --alg=<name of the algorithm> --env=<environment_id> [additional arguments]
|
||||
```
|
||||
### Example 1. PPO with MuJoCo Humanoid
|
||||
For instance, to train a fully-connected network controlling MuJoCo humanoid using ppo2 for 20M timesteps
|
||||
```bash
|
||||
python -m baselines.common.run --alg=ppo2 --env=Humanoid-v2 --network=mlp --num-timesteps=2e7
|
||||
```
|
||||
Note that for mujoco environments fully-connected network is default, so we can omit `--network=mlp`
|
||||
The hyperparameters for both network and the learning algorithm can be controlled via the command line, for instance:
|
||||
```bash
|
||||
python -m baselines.common.run --alg=ppo2 --env=Humanoid-v2 --network=mlp --num-timesteps=2e7 --ent_coef=0.1 --num_hidden=32 --num_layers=3
|
||||
```
|
||||
will set entropy coeffient to 0.1, and construct fully connected network with 3 layers with 32 hidden units in each.
|
||||
See docstrings in [common/models.py](common/models.py) for description of network parameters for each type of model, and
|
||||
docstring for [baselines/ppo2/ppo2.py/learn()](ppo2/ppo2.py) fir the description of the ppo2 hyperparamters.
|
||||
|
||||
### Example 2. DQN on Atari
|
||||
DQN with Atari is at this point a classics of benchmarks. To run the baselines implementation of DQN on Atari Pong:
|
||||
```
|
||||
python -m baselines.common.run --alg=deepq --env=PongNoFrameskip-v4 --num-timesteps=10000000
|
||||
```
|
||||
|
||||
## Saving, loading and visualizing models
|
||||
The algorithms serialization API is not properly unified yet; however, there is a simple method to save / restore trained models.
|
||||
`--model-path` command-line option loads the tensorflow state from a given path before training, and saves it after the training.
|
||||
Let's imagine you'd like to train a2c on MuJoCo humanoid, save the model and then later visualize what has it learnt.
|
||||
```bash
|
||||
python -m baselines.common.run --alg=a2c --env=Humanoid-v2 --num-timesteps=2e7 --model-path=~/models/humanoid_20M_a2c
|
||||
```
|
||||
To load and visualize the model, we'll do the following - load the model, train it for trivial number of steps (say, 10), and then visualize:
|
||||
```bash
|
||||
python -m baselines.common.run --alg=a2c --env=Humanoid-v2 --num-timesteps=10 --model-path=~/models/humanoid_20M_a2c --play
|
||||
```
|
||||
|
||||
|
||||
|
||||
|
||||
|
||||
|
||||
|
||||
## Subpackages
|
||||
|
||||
- [A2C](baselines/a2c)
|
||||
|
@@ -1,42 +1,48 @@
|
||||
import os.path as osp
|
||||
import time
|
||||
import joblib
|
||||
import numpy as np
|
||||
import tensorflow as tf
|
||||
from baselines import logger
|
||||
|
||||
from baselines.common import set_global_seeds, explained_variance
|
||||
from baselines.common.runners import AbstractEnvRunner
|
||||
from baselines.common import tf_util
|
||||
from baselines.common.policies import build_policy
|
||||
|
||||
|
||||
from baselines.a2c.utils import discount_with_dones
|
||||
from baselines.a2c.utils import Scheduler, make_path, find_trainable_variables
|
||||
from baselines.a2c.utils import cat_entropy, mse
|
||||
from baselines.a2c.runner import Runner
|
||||
|
||||
from tensorflow import losses
|
||||
|
||||
class Model(object):
|
||||
|
||||
def __init__(self, policy, ob_space, ac_space, nenvs, nsteps,
|
||||
def __init__(self, policy, env, nsteps,
|
||||
ent_coef=0.01, vf_coef=0.5, max_grad_norm=0.5, lr=7e-4,
|
||||
alpha=0.99, epsilon=1e-5, total_timesteps=int(80e6), lrschedule='linear'):
|
||||
|
||||
sess = tf_util.make_session()
|
||||
sess = tf_util.get_session()
|
||||
nenvs = env.num_envs
|
||||
nbatch = nenvs*nsteps
|
||||
|
||||
A = tf.placeholder(tf.int32, [nbatch])
|
||||
|
||||
with tf.variable_scope('a2c_model', reuse=tf.AUTO_REUSE):
|
||||
step_model = policy(nenvs, 1, sess)
|
||||
train_model = policy(nbatch, nsteps, sess)
|
||||
|
||||
A = tf.placeholder(train_model.action.dtype, train_model.action.shape)
|
||||
ADV = tf.placeholder(tf.float32, [nbatch])
|
||||
R = tf.placeholder(tf.float32, [nbatch])
|
||||
LR = tf.placeholder(tf.float32, [])
|
||||
|
||||
step_model = policy(sess, ob_space, ac_space, nenvs, 1, reuse=False)
|
||||
train_model = policy(sess, ob_space, ac_space, nenvs*nsteps, nsteps, reuse=True)
|
||||
neglogpac = train_model.pd.neglogp(A)
|
||||
entropy = tf.reduce_mean(train_model.pd.entropy())
|
||||
|
||||
neglogpac = tf.nn.sparse_softmax_cross_entropy_with_logits(logits=train_model.pi, labels=A)
|
||||
pg_loss = tf.reduce_mean(ADV * neglogpac)
|
||||
vf_loss = tf.reduce_mean(mse(tf.squeeze(train_model.vf), R))
|
||||
entropy = tf.reduce_mean(cat_entropy(train_model.pi))
|
||||
vf_loss = losses.mean_squared_error(tf.squeeze(train_model.vf), R)
|
||||
|
||||
loss = pg_loss - entropy*ent_coef + vf_loss * vf_coef
|
||||
|
||||
params = find_trainable_variables("model")
|
||||
params = find_trainable_variables("a2c_model")
|
||||
grads = tf.gradients(loss, params)
|
||||
if max_grad_norm is not None:
|
||||
grads, grad_norm = tf.clip_by_global_norm(grads, max_grad_norm)
|
||||
@@ -50,6 +56,7 @@ class Model(object):
|
||||
advs = rewards - values
|
||||
for step in range(len(obs)):
|
||||
cur_lr = lr.value()
|
||||
|
||||
td_map = {train_model.X:obs, A:actions, ADV:advs, R:rewards, LR:cur_lr}
|
||||
if states is not None:
|
||||
td_map[train_model.S] = states
|
||||
@@ -82,61 +89,79 @@ class Model(object):
|
||||
self.load = load
|
||||
tf.global_variables_initializer().run(session=sess)
|
||||
|
||||
class Runner(AbstractEnvRunner):
|
||||
|
||||
def __init__(self, env, model, nsteps=5, gamma=0.99):
|
||||
super().__init__(env=env, model=model, nsteps=nsteps)
|
||||
self.gamma = gamma
|
||||
def learn(
|
||||
network,
|
||||
env,
|
||||
seed=None,
|
||||
nsteps=5,
|
||||
total_timesteps=int(80e6),
|
||||
vf_coef=0.5,
|
||||
ent_coef=0.01,
|
||||
max_grad_norm=0.5,
|
||||
lr=7e-4,
|
||||
lrschedule='linear',
|
||||
epsilon=1e-5,
|
||||
alpha=0.99,
|
||||
gamma=0.99,
|
||||
log_interval=100,
|
||||
**network_kwargs):
|
||||
|
||||
'''
|
||||
Main entrypoint for A2C algorithm. Train a policy with given network architecture on a given environment using a2c algorithm.
|
||||
|
||||
Parameters:
|
||||
-----------
|
||||
|
||||
network: policy network architecture. Either string (mlp, lstm, lnlstm, cnn_lstm, cnn, cnn_small, conv_only - see baselines.common/models.py for full list)
|
||||
specifying the standard network architecture, or a function that takes tensorflow tensor as input and returns
|
||||
tuple (output_tensor, extra_feed) where output tensor is the last network layer output, extra_feed is None for feed-forward
|
||||
neural nets, and extra_feed is a dictionary describing how to feed state into the network for recurrent neural nets.
|
||||
See baselines.common/policies.py/lstm for more details on using recurrent nets in policies
|
||||
|
||||
|
||||
env: RL environment. Should implement interface similar to VecEnv (baselines.common/vec_env) or be wrapped with DummyVecEnv (baselines.common/vec_env/dummy_vec_env.py)
|
||||
|
||||
|
||||
seed: seed to make random number sequence in the alorightm reproducible. By default is None which means seed from system noise generator (not reproducible)
|
||||
|
||||
nsteps: int, number of steps of the vectorized environment per update (i.e. batch size is nsteps * nenv where
|
||||
nenv is number of environment copies simulated in parallel)
|
||||
|
||||
total_timesteps: int, total number of timesteps to train on (default: 80M)
|
||||
|
||||
vf_coef: float, coefficient in front of value function loss in the total loss function (default: 0.5)
|
||||
|
||||
ent_coef: float, coeffictiant in front of the policy entropy in the total loss function (default: 0.01)
|
||||
|
||||
max_gradient_norm: float, gradient is clipped to have global L2 norm no more than this value (default: 0.5)
|
||||
|
||||
lr: float, learning rate for RMSProp (current implementation has RMSProp hardcoded in) (default: 7e-4)
|
||||
|
||||
lrschedule: schedule of learning rate. Can be 'linear', 'constant', or a function [0..1] -> [0..1] that takes fraction of the training progress as input and
|
||||
returns fraction of the learning rate (specified as lr) as output
|
||||
|
||||
epsilon: float, RMSProp epsilon (stabilizes square root computation in denominator of RMSProp update) (default: 1e-5)
|
||||
|
||||
alpha: float, RMSProp decay parameter (default: 0.99)
|
||||
|
||||
gamma: float, reward discounting parameter (default: 0.99)
|
||||
|
||||
log_interval: int, specifies how frequently the logs are printed out (default: 100)
|
||||
|
||||
**network_kwargs: keyword arguments to the policy / network builder. See baselines.common/policies.py/build_policy and arguments to a particular type of network
|
||||
For instance, 'mlp' network architecture has arguments num_hidden and num_layers.
|
||||
|
||||
'''
|
||||
|
||||
|
||||
def run(self):
|
||||
mb_obs, mb_rewards, mb_actions, mb_values, mb_dones = [],[],[],[],[]
|
||||
mb_states = self.states
|
||||
for n in range(self.nsteps):
|
||||
actions, values, states, _ = self.model.step(self.obs, self.states, self.dones)
|
||||
mb_obs.append(np.copy(self.obs))
|
||||
mb_actions.append(actions)
|
||||
mb_values.append(values)
|
||||
mb_dones.append(self.dones)
|
||||
obs, rewards, dones, _ = self.env.step(actions)
|
||||
self.states = states
|
||||
self.dones = dones
|
||||
for n, done in enumerate(dones):
|
||||
if done:
|
||||
self.obs[n] = self.obs[n]*0
|
||||
self.obs = obs
|
||||
mb_rewards.append(rewards)
|
||||
mb_dones.append(self.dones)
|
||||
#batch of steps to batch of rollouts
|
||||
mb_obs = np.asarray(mb_obs, dtype=np.uint8).swapaxes(1, 0).reshape(self.batch_ob_shape)
|
||||
mb_rewards = np.asarray(mb_rewards, dtype=np.float32).swapaxes(1, 0)
|
||||
mb_actions = np.asarray(mb_actions, dtype=np.int32).swapaxes(1, 0)
|
||||
mb_values = np.asarray(mb_values, dtype=np.float32).swapaxes(1, 0)
|
||||
mb_dones = np.asarray(mb_dones, dtype=np.bool).swapaxes(1, 0)
|
||||
mb_masks = mb_dones[:, :-1]
|
||||
mb_dones = mb_dones[:, 1:]
|
||||
last_values = self.model.value(self.obs, self.states, self.dones).tolist()
|
||||
#discount/bootstrap off value fn
|
||||
for n, (rewards, dones, value) in enumerate(zip(mb_rewards, mb_dones, last_values)):
|
||||
rewards = rewards.tolist()
|
||||
dones = dones.tolist()
|
||||
if dones[-1] == 0:
|
||||
rewards = discount_with_dones(rewards+[value], dones+[0], self.gamma)[:-1]
|
||||
else:
|
||||
rewards = discount_with_dones(rewards, dones, self.gamma)
|
||||
mb_rewards[n] = rewards
|
||||
mb_rewards = mb_rewards.flatten()
|
||||
mb_actions = mb_actions.flatten()
|
||||
mb_values = mb_values.flatten()
|
||||
mb_masks = mb_masks.flatten()
|
||||
return mb_obs, mb_states, mb_rewards, mb_masks, mb_actions, mb_values
|
||||
|
||||
def learn(policy, env, seed, nsteps=5, total_timesteps=int(80e6), vf_coef=0.5, ent_coef=0.01, max_grad_norm=0.5, lr=7e-4, lrschedule='linear', epsilon=1e-5, alpha=0.99, gamma=0.99, log_interval=100):
|
||||
set_global_seeds(seed)
|
||||
|
||||
nenvs = env.num_envs
|
||||
ob_space = env.observation_space
|
||||
ac_space = env.action_space
|
||||
model = Model(policy=policy, ob_space=ob_space, ac_space=ac_space, nenvs=nenvs, nsteps=nsteps, ent_coef=ent_coef, vf_coef=vf_coef,
|
||||
policy = build_policy(env, network, **network_kwargs)
|
||||
|
||||
model = Model(policy=policy, env=env, nsteps=nsteps, ent_coef=ent_coef, vf_coef=vf_coef,
|
||||
max_grad_norm=max_grad_norm, lr=lr, alpha=alpha, epsilon=epsilon, total_timesteps=total_timesteps, lrschedule=lrschedule)
|
||||
runner = Runner(env, model, nsteps=nsteps, gamma=gamma)
|
||||
|
||||
@@ -158,3 +183,4 @@ def learn(policy, env, seed, nsteps=5, total_timesteps=int(80e6), vf_coef=0.5, e
|
||||
logger.dump_tabular()
|
||||
env.close()
|
||||
return model
|
||||
|
||||
|
@@ -1,146 +0,0 @@
|
||||
import numpy as np
|
||||
import tensorflow as tf
|
||||
from baselines.a2c.utils import conv, fc, conv_to_fc, batch_to_seq, seq_to_batch, lstm, lnlstm
|
||||
from baselines.common.distributions import make_pdtype
|
||||
from baselines.common.input import observation_input
|
||||
|
||||
def nature_cnn(unscaled_images, **conv_kwargs):
|
||||
"""
|
||||
CNN from Nature paper.
|
||||
"""
|
||||
scaled_images = tf.cast(unscaled_images, tf.float32) / 255.
|
||||
activ = tf.nn.relu
|
||||
h = activ(conv(scaled_images, 'c1', nf=32, rf=8, stride=4, init_scale=np.sqrt(2),
|
||||
**conv_kwargs))
|
||||
h2 = activ(conv(h, 'c2', nf=64, rf=4, stride=2, init_scale=np.sqrt(2), **conv_kwargs))
|
||||
h3 = activ(conv(h2, 'c3', nf=64, rf=3, stride=1, init_scale=np.sqrt(2), **conv_kwargs))
|
||||
h3 = conv_to_fc(h3)
|
||||
return activ(fc(h3, 'fc1', nh=512, init_scale=np.sqrt(2)))
|
||||
|
||||
class LnLstmPolicy(object):
|
||||
def __init__(self, sess, ob_space, ac_space, nbatch, nsteps, nlstm=256, reuse=False):
|
||||
nenv = nbatch // nsteps
|
||||
X, processed_x = observation_input(ob_space, nbatch)
|
||||
M = tf.placeholder(tf.float32, [nbatch]) #mask (done t-1)
|
||||
S = tf.placeholder(tf.float32, [nenv, nlstm*2]) #states
|
||||
self.pdtype = make_pdtype(ac_space)
|
||||
with tf.variable_scope("model", reuse=reuse):
|
||||
h = nature_cnn(processed_x)
|
||||
xs = batch_to_seq(h, nenv, nsteps)
|
||||
ms = batch_to_seq(M, nenv, nsteps)
|
||||
h5, snew = lnlstm(xs, ms, S, 'lstm1', nh=nlstm)
|
||||
h5 = seq_to_batch(h5)
|
||||
vf = fc(h5, 'v', 1)
|
||||
self.pd, self.pi = self.pdtype.pdfromlatent(h5)
|
||||
|
||||
v0 = vf[:, 0]
|
||||
a0 = self.pd.sample()
|
||||
neglogp0 = self.pd.neglogp(a0)
|
||||
self.initial_state = np.zeros((nenv, nlstm*2), dtype=np.float32)
|
||||
|
||||
def step(ob, state, mask):
|
||||
return sess.run([a0, v0, snew, neglogp0], {X:ob, S:state, M:mask})
|
||||
|
||||
def value(ob, state, mask):
|
||||
return sess.run(v0, {X:ob, S:state, M:mask})
|
||||
|
||||
self.X = X
|
||||
self.M = M
|
||||
self.S = S
|
||||
self.vf = vf
|
||||
self.step = step
|
||||
self.value = value
|
||||
|
||||
class LstmPolicy(object):
|
||||
|
||||
def __init__(self, sess, ob_space, ac_space, nbatch, nsteps, nlstm=256, reuse=False):
|
||||
nenv = nbatch // nsteps
|
||||
self.pdtype = make_pdtype(ac_space)
|
||||
X, processed_x = observation_input(ob_space, nbatch)
|
||||
|
||||
M = tf.placeholder(tf.float32, [nbatch]) #mask (done t-1)
|
||||
S = tf.placeholder(tf.float32, [nenv, nlstm*2]) #states
|
||||
with tf.variable_scope("model", reuse=reuse):
|
||||
h = nature_cnn(X)
|
||||
xs = batch_to_seq(h, nenv, nsteps)
|
||||
ms = batch_to_seq(M, nenv, nsteps)
|
||||
h5, snew = lstm(xs, ms, S, 'lstm1', nh=nlstm)
|
||||
h5 = seq_to_batch(h5)
|
||||
vf = fc(h5, 'v', 1)
|
||||
self.pd, self.pi = self.pdtype.pdfromlatent(h5)
|
||||
|
||||
v0 = vf[:, 0]
|
||||
a0 = self.pd.sample()
|
||||
neglogp0 = self.pd.neglogp(a0)
|
||||
self.initial_state = np.zeros((nenv, nlstm*2), dtype=np.float32)
|
||||
|
||||
def step(ob, state, mask):
|
||||
return sess.run([a0, v0, snew, neglogp0], {X:ob, S:state, M:mask})
|
||||
|
||||
def value(ob, state, mask):
|
||||
return sess.run(v0, {X:ob, S:state, M:mask})
|
||||
|
||||
self.X = X
|
||||
self.M = M
|
||||
self.S = S
|
||||
self.vf = vf
|
||||
self.step = step
|
||||
self.value = value
|
||||
|
||||
class CnnPolicy(object):
|
||||
|
||||
def __init__(self, sess, ob_space, ac_space, nbatch, nsteps, reuse=False, **conv_kwargs): #pylint: disable=W0613
|
||||
self.pdtype = make_pdtype(ac_space)
|
||||
X, processed_x = observation_input(ob_space, nbatch)
|
||||
with tf.variable_scope("model", reuse=reuse):
|
||||
h = nature_cnn(processed_x, **conv_kwargs)
|
||||
vf = fc(h, 'v', 1)[:,0]
|
||||
self.pd, self.pi = self.pdtype.pdfromlatent(h, init_scale=0.01)
|
||||
|
||||
a0 = self.pd.sample()
|
||||
neglogp0 = self.pd.neglogp(a0)
|
||||
self.initial_state = None
|
||||
|
||||
def step(ob, *_args, **_kwargs):
|
||||
a, v, neglogp = sess.run([a0, vf, neglogp0], {X:ob})
|
||||
return a, v, self.initial_state, neglogp
|
||||
|
||||
def value(ob, *_args, **_kwargs):
|
||||
return sess.run(vf, {X:ob})
|
||||
|
||||
self.X = X
|
||||
self.vf = vf
|
||||
self.step = step
|
||||
self.value = value
|
||||
|
||||
class MlpPolicy(object):
|
||||
def __init__(self, sess, ob_space, ac_space, nbatch, nsteps, reuse=False): #pylint: disable=W0613
|
||||
self.pdtype = make_pdtype(ac_space)
|
||||
with tf.variable_scope("model", reuse=reuse):
|
||||
X, processed_x = observation_input(ob_space, nbatch)
|
||||
activ = tf.tanh
|
||||
processed_x = tf.layers.flatten(processed_x)
|
||||
pi_h1 = activ(fc(processed_x, 'pi_fc1', nh=64, init_scale=np.sqrt(2)))
|
||||
pi_h2 = activ(fc(pi_h1, 'pi_fc2', nh=64, init_scale=np.sqrt(2)))
|
||||
vf_h1 = activ(fc(processed_x, 'vf_fc1', nh=64, init_scale=np.sqrt(2)))
|
||||
vf_h2 = activ(fc(vf_h1, 'vf_fc2', nh=64, init_scale=np.sqrt(2)))
|
||||
vf = fc(vf_h2, 'vf', 1)[:,0]
|
||||
|
||||
self.pd, self.pi = self.pdtype.pdfromlatent(pi_h2, init_scale=0.01)
|
||||
|
||||
|
||||
a0 = self.pd.sample()
|
||||
neglogp0 = self.pd.neglogp(a0)
|
||||
self.initial_state = None
|
||||
|
||||
def step(ob, *_args, **_kwargs):
|
||||
a, v, neglogp = sess.run([a0, vf, neglogp0], {X:ob})
|
||||
return a, v, self.initial_state, neglogp
|
||||
|
||||
def value(ob, *_args, **_kwargs):
|
||||
return sess.run(vf, {X:ob})
|
||||
|
||||
self.X = X
|
||||
self.vf = vf
|
||||
self.step = step
|
||||
self.value = value
|
@@ -1,30 +0,0 @@
|
||||
#!/usr/bin/env python3
|
||||
|
||||
from baselines import logger
|
||||
from baselines.common.cmd_util import make_atari_env, atari_arg_parser
|
||||
from baselines.common.vec_env.vec_frame_stack import VecFrameStack
|
||||
from baselines.a2c.a2c import learn
|
||||
from baselines.ppo2.policies import CnnPolicy, LstmPolicy, LnLstmPolicy
|
||||
|
||||
def train(env_id, num_timesteps, seed, policy, lrschedule, num_env):
|
||||
if policy == 'cnn':
|
||||
policy_fn = CnnPolicy
|
||||
elif policy == 'lstm':
|
||||
policy_fn = LstmPolicy
|
||||
elif policy == 'lnlstm':
|
||||
policy_fn = LnLstmPolicy
|
||||
env = VecFrameStack(make_atari_env(env_id, num_env, seed), 4)
|
||||
learn(policy_fn, env, seed, total_timesteps=int(num_timesteps * 1.1), lrschedule=lrschedule)
|
||||
env.close()
|
||||
|
||||
def main():
|
||||
parser = atari_arg_parser()
|
||||
parser.add_argument('--policy', help='Policy architecture', choices=['cnn', 'lstm', 'lnlstm'], default='cnn')
|
||||
parser.add_argument('--lrschedule', help='Learning rate schedule', choices=['constant', 'linear'], default='constant')
|
||||
args = parser.parse_args()
|
||||
logger.configure()
|
||||
train(args.env, num_timesteps=args.num_timesteps, seed=args.seed,
|
||||
policy=args.policy, lrschedule=args.lrschedule, num_env=16)
|
||||
|
||||
if __name__ == '__main__':
|
||||
main()
|
@@ -1,8 +1,6 @@
|
||||
import os
|
||||
import gym
|
||||
import numpy as np
|
||||
import tensorflow as tf
|
||||
from gym import spaces
|
||||
from collections import deque
|
||||
|
||||
def sample(logits):
|
||||
@@ -10,18 +8,15 @@ def sample(logits):
|
||||
return tf.argmax(logits - tf.log(-tf.log(noise)), 1)
|
||||
|
||||
def cat_entropy(logits):
|
||||
a0 = logits - tf.reduce_max(logits, 1, keep_dims=True)
|
||||
a0 = logits - tf.reduce_max(logits, 1, keepdims=True)
|
||||
ea0 = tf.exp(a0)
|
||||
z0 = tf.reduce_sum(ea0, 1, keep_dims=True)
|
||||
z0 = tf.reduce_sum(ea0, 1, keepdims=True)
|
||||
p0 = ea0 / z0
|
||||
return tf.reduce_sum(p0 * (tf.log(z0) - a0), 1)
|
||||
|
||||
def cat_entropy_softmax(p0):
|
||||
return - tf.reduce_sum(p0 * tf.log(p0 + 1e-6), axis = 1)
|
||||
|
||||
def mse(pred, target):
|
||||
return tf.square(pred-target)/2.
|
||||
|
||||
def ortho_init(scale=1.0):
|
||||
def _ortho_init(shape, dtype, partition_info=None):
|
||||
#lasagne ortho init for tf
|
||||
@@ -58,7 +53,7 @@ def conv(x, scope, *, nf, rf, stride, pad='VALID', init_scale=1.0, data_format='
|
||||
b = tf.get_variable("b", bias_var_shape, initializer=tf.constant_initializer(0.0))
|
||||
if not one_dim_bias and data_format == 'NHWC':
|
||||
b = tf.reshape(b, bshape)
|
||||
return b + tf.nn.conv2d(x, w, strides=strides, padding=pad, data_format=data_format)
|
||||
return tf.nn.conv2d(x, w, strides=strides, padding=pad, data_format=data_format) + b
|
||||
|
||||
def fc(x, scope, nh, *, init_scale=1.0, init_bias=0.0):
|
||||
with tf.variable_scope(scope):
|
||||
@@ -85,7 +80,6 @@ def seq_to_batch(h, flat = False):
|
||||
|
||||
def lstm(xs, ms, s, scope, nh, init_scale=1.0):
|
||||
nbatch, nin = [v.value for v in xs[0].get_shape()]
|
||||
nsteps = len(xs)
|
||||
with tf.variable_scope(scope):
|
||||
wx = tf.get_variable("wx", [nin, nh*4], initializer=ortho_init(init_scale))
|
||||
wh = tf.get_variable("wh", [nh, nh*4], initializer=ortho_init(init_scale))
|
||||
@@ -115,7 +109,6 @@ def _ln(x, g, b, e=1e-5, axes=[1]):
|
||||
|
||||
def lnlstm(xs, ms, s, scope, nh, init_scale=1.0):
|
||||
nbatch, nin = [v.value for v in xs[0].get_shape()]
|
||||
nsteps = len(xs)
|
||||
with tf.variable_scope(scope):
|
||||
wx = tf.get_variable("wx", [nin, nh*4], initializer=ortho_init(init_scale))
|
||||
gx = tf.get_variable("gx", [nh*4], initializer=tf.constant_initializer(1.0))
|
||||
@@ -160,8 +153,7 @@ def discount_with_dones(rewards, dones, gamma):
|
||||
return discounted[::-1]
|
||||
|
||||
def find_trainable_variables(key):
|
||||
with tf.variable_scope(key):
|
||||
return tf.trainable_variables()
|
||||
return tf.trainable_variables(key)
|
||||
|
||||
def make_path(f):
|
||||
return os.makedirs(f, exist_ok=True)
|
||||
|
@@ -1,348 +0,0 @@
|
||||
import time
|
||||
import joblib
|
||||
import numpy as np
|
||||
import tensorflow as tf
|
||||
from baselines import logger
|
||||
|
||||
from baselines.common import set_global_seeds
|
||||
from baselines.common.runners import AbstractEnvRunner
|
||||
|
||||
from baselines.a2c.utils import batch_to_seq, seq_to_batch
|
||||
from baselines.a2c.utils import Scheduler, make_path, find_trainable_variables
|
||||
from baselines.a2c.utils import cat_entropy_softmax
|
||||
from baselines.a2c.utils import EpisodeStats
|
||||
from baselines.a2c.utils import get_by_index, check_shape, avg_norm, gradient_add, q_explained_variance
|
||||
from baselines.acer.buffer import Buffer
|
||||
|
||||
import os.path as osp
|
||||
|
||||
# remove last step
|
||||
def strip(var, nenvs, nsteps, flat = False):
|
||||
vars = batch_to_seq(var, nenvs, nsteps + 1, flat)
|
||||
return seq_to_batch(vars[:-1], flat)
|
||||
|
||||
def q_retrace(R, D, q_i, v, rho_i, nenvs, nsteps, gamma):
|
||||
"""
|
||||
Calculates q_retrace targets
|
||||
|
||||
:param R: Rewards
|
||||
:param D: Dones
|
||||
:param q_i: Q values for actions taken
|
||||
:param v: V values
|
||||
:param rho_i: Importance weight for each action
|
||||
:return: Q_retrace values
|
||||
"""
|
||||
rho_bar = batch_to_seq(tf.minimum(1.0, rho_i), nenvs, nsteps, True) # list of len steps, shape [nenvs]
|
||||
rs = batch_to_seq(R, nenvs, nsteps, True) # list of len steps, shape [nenvs]
|
||||
ds = batch_to_seq(D, nenvs, nsteps, True) # list of len steps, shape [nenvs]
|
||||
q_is = batch_to_seq(q_i, nenvs, nsteps, True)
|
||||
vs = batch_to_seq(v, nenvs, nsteps + 1, True)
|
||||
v_final = vs[-1]
|
||||
qret = v_final
|
||||
qrets = []
|
||||
for i in range(nsteps - 1, -1, -1):
|
||||
check_shape([qret, ds[i], rs[i], rho_bar[i], q_is[i], vs[i]], [[nenvs]] * 6)
|
||||
qret = rs[i] + gamma * qret * (1.0 - ds[i])
|
||||
qrets.append(qret)
|
||||
qret = (rho_bar[i] * (qret - q_is[i])) + vs[i]
|
||||
qrets = qrets[::-1]
|
||||
qret = seq_to_batch(qrets, flat=True)
|
||||
return qret
|
||||
|
||||
# For ACER with PPO clipping instead of trust region
|
||||
# def clip(ratio, eps_clip):
|
||||
# # assume 0 <= eps_clip <= 1
|
||||
# return tf.minimum(1 + eps_clip, tf.maximum(1 - eps_clip, ratio))
|
||||
|
||||
class Model(object):
|
||||
def __init__(self, policy, ob_space, ac_space, nenvs, nsteps, nstack, num_procs,
|
||||
ent_coef, q_coef, gamma, max_grad_norm, lr,
|
||||
rprop_alpha, rprop_epsilon, total_timesteps, lrschedule,
|
||||
c, trust_region, alpha, delta):
|
||||
config = tf.ConfigProto(allow_soft_placement=True,
|
||||
intra_op_parallelism_threads=num_procs,
|
||||
inter_op_parallelism_threads=num_procs)
|
||||
sess = tf.Session(config=config)
|
||||
nact = ac_space.n
|
||||
nbatch = nenvs * nsteps
|
||||
|
||||
A = tf.placeholder(tf.int32, [nbatch]) # actions
|
||||
D = tf.placeholder(tf.float32, [nbatch]) # dones
|
||||
R = tf.placeholder(tf.float32, [nbatch]) # rewards, not returns
|
||||
MU = tf.placeholder(tf.float32, [nbatch, nact]) # mu's
|
||||
LR = tf.placeholder(tf.float32, [])
|
||||
eps = 1e-6
|
||||
|
||||
step_model = policy(sess, ob_space, ac_space, nenvs, 1, nstack, reuse=False)
|
||||
train_model = policy(sess, ob_space, ac_space, nenvs, nsteps + 1, nstack, reuse=True)
|
||||
|
||||
params = find_trainable_variables("model")
|
||||
print("Params {}".format(len(params)))
|
||||
for var in params:
|
||||
print(var)
|
||||
|
||||
# create polyak averaged model
|
||||
ema = tf.train.ExponentialMovingAverage(alpha)
|
||||
ema_apply_op = ema.apply(params)
|
||||
|
||||
def custom_getter(getter, *args, **kwargs):
|
||||
v = ema.average(getter(*args, **kwargs))
|
||||
print(v.name)
|
||||
return v
|
||||
|
||||
with tf.variable_scope("", custom_getter=custom_getter, reuse=True):
|
||||
polyak_model = policy(sess, ob_space, ac_space, nenvs, nsteps + 1, nstack, reuse=True)
|
||||
|
||||
# Notation: (var) = batch variable, (var)s = seqeuence variable, (var)_i = variable index by action at step i
|
||||
v = tf.reduce_sum(train_model.pi * train_model.q, axis = -1) # shape is [nenvs * (nsteps + 1)]
|
||||
|
||||
# strip off last step
|
||||
f, f_pol, q = map(lambda var: strip(var, nenvs, nsteps), [train_model.pi, polyak_model.pi, train_model.q])
|
||||
# Get pi and q values for actions taken
|
||||
f_i = get_by_index(f, A)
|
||||
q_i = get_by_index(q, A)
|
||||
|
||||
# Compute ratios for importance truncation
|
||||
rho = f / (MU + eps)
|
||||
rho_i = get_by_index(rho, A)
|
||||
|
||||
# Calculate Q_retrace targets
|
||||
qret = q_retrace(R, D, q_i, v, rho_i, nenvs, nsteps, gamma)
|
||||
|
||||
# Calculate losses
|
||||
# Entropy
|
||||
entropy = tf.reduce_mean(cat_entropy_softmax(f))
|
||||
|
||||
# Policy Graident loss, with truncated importance sampling & bias correction
|
||||
v = strip(v, nenvs, nsteps, True)
|
||||
check_shape([qret, v, rho_i, f_i], [[nenvs * nsteps]] * 4)
|
||||
check_shape([rho, f, q], [[nenvs * nsteps, nact]] * 2)
|
||||
|
||||
# Truncated importance sampling
|
||||
adv = qret - v
|
||||
logf = tf.log(f_i + eps)
|
||||
gain_f = logf * tf.stop_gradient(adv * tf.minimum(c, rho_i)) # [nenvs * nsteps]
|
||||
loss_f = -tf.reduce_mean(gain_f)
|
||||
|
||||
# Bias correction for the truncation
|
||||
adv_bc = (q - tf.reshape(v, [nenvs * nsteps, 1])) # [nenvs * nsteps, nact]
|
||||
logf_bc = tf.log(f + eps) # / (f_old + eps)
|
||||
check_shape([adv_bc, logf_bc], [[nenvs * nsteps, nact]]*2)
|
||||
gain_bc = tf.reduce_sum(logf_bc * tf.stop_gradient(adv_bc * tf.nn.relu(1.0 - (c / (rho + eps))) * f), axis = 1) #IMP: This is sum, as expectation wrt f
|
||||
loss_bc= -tf.reduce_mean(gain_bc)
|
||||
|
||||
loss_policy = loss_f + loss_bc
|
||||
|
||||
# Value/Q function loss, and explained variance
|
||||
check_shape([qret, q_i], [[nenvs * nsteps]]*2)
|
||||
ev = q_explained_variance(tf.reshape(q_i, [nenvs, nsteps]), tf.reshape(qret, [nenvs, nsteps]))
|
||||
loss_q = tf.reduce_mean(tf.square(tf.stop_gradient(qret) - q_i)*0.5)
|
||||
|
||||
# Net loss
|
||||
check_shape([loss_policy, loss_q, entropy], [[]] * 3)
|
||||
loss = loss_policy + q_coef * loss_q - ent_coef * entropy
|
||||
|
||||
if trust_region:
|
||||
g = tf.gradients(- (loss_policy - ent_coef * entropy) * nsteps * nenvs, f) #[nenvs * nsteps, nact]
|
||||
# k = tf.gradients(KL(f_pol || f), f)
|
||||
k = - f_pol / (f + eps) #[nenvs * nsteps, nact] # Directly computed gradient of KL divergence wrt f
|
||||
k_dot_g = tf.reduce_sum(k * g, axis=-1)
|
||||
adj = tf.maximum(0.0, (tf.reduce_sum(k * g, axis=-1) - delta) / (tf.reduce_sum(tf.square(k), axis=-1) + eps)) #[nenvs * nsteps]
|
||||
|
||||
# Calculate stats (before doing adjustment) for logging.
|
||||
avg_norm_k = avg_norm(k)
|
||||
avg_norm_g = avg_norm(g)
|
||||
avg_norm_k_dot_g = tf.reduce_mean(tf.abs(k_dot_g))
|
||||
avg_norm_adj = tf.reduce_mean(tf.abs(adj))
|
||||
|
||||
g = g - tf.reshape(adj, [nenvs * nsteps, 1]) * k
|
||||
grads_f = -g/(nenvs*nsteps) # These are turst region adjusted gradients wrt f ie statistics of policy pi
|
||||
grads_policy = tf.gradients(f, params, grads_f)
|
||||
grads_q = tf.gradients(loss_q * q_coef, params)
|
||||
grads = [gradient_add(g1, g2, param) for (g1, g2, param) in zip(grads_policy, grads_q, params)]
|
||||
|
||||
avg_norm_grads_f = avg_norm(grads_f) * (nsteps * nenvs)
|
||||
norm_grads_q = tf.global_norm(grads_q)
|
||||
norm_grads_policy = tf.global_norm(grads_policy)
|
||||
else:
|
||||
grads = tf.gradients(loss, params)
|
||||
|
||||
if max_grad_norm is not None:
|
||||
grads, norm_grads = tf.clip_by_global_norm(grads, max_grad_norm)
|
||||
grads = list(zip(grads, params))
|
||||
trainer = tf.train.RMSPropOptimizer(learning_rate=LR, decay=rprop_alpha, epsilon=rprop_epsilon)
|
||||
_opt_op = trainer.apply_gradients(grads)
|
||||
|
||||
# so when you call _train, you first do the gradient step, then you apply ema
|
||||
with tf.control_dependencies([_opt_op]):
|
||||
_train = tf.group(ema_apply_op)
|
||||
|
||||
lr = Scheduler(v=lr, nvalues=total_timesteps, schedule=lrschedule)
|
||||
|
||||
# Ops/Summaries to run, and their names for logging
|
||||
run_ops = [_train, loss, loss_q, entropy, loss_policy, loss_f, loss_bc, ev, norm_grads]
|
||||
names_ops = ['loss', 'loss_q', 'entropy', 'loss_policy', 'loss_f', 'loss_bc', 'explained_variance',
|
||||
'norm_grads']
|
||||
if trust_region:
|
||||
run_ops = run_ops + [norm_grads_q, norm_grads_policy, avg_norm_grads_f, avg_norm_k, avg_norm_g, avg_norm_k_dot_g,
|
||||
avg_norm_adj]
|
||||
names_ops = names_ops + ['norm_grads_q', 'norm_grads_policy', 'avg_norm_grads_f', 'avg_norm_k', 'avg_norm_g',
|
||||
'avg_norm_k_dot_g', 'avg_norm_adj']
|
||||
|
||||
def train(obs, actions, rewards, dones, mus, states, masks, steps):
|
||||
cur_lr = lr.value_steps(steps)
|
||||
td_map = {train_model.X: obs, polyak_model.X: obs, A: actions, R: rewards, D: dones, MU: mus, LR: cur_lr}
|
||||
if states != []:
|
||||
td_map[train_model.S] = states
|
||||
td_map[train_model.M] = masks
|
||||
td_map[polyak_model.S] = states
|
||||
td_map[polyak_model.M] = masks
|
||||
return names_ops, sess.run(run_ops, td_map)[1:] # strip off _train
|
||||
|
||||
def save(save_path):
|
||||
ps = sess.run(params)
|
||||
make_path(osp.dirname(save_path))
|
||||
joblib.dump(ps, save_path)
|
||||
|
||||
self.train = train
|
||||
self.save = save
|
||||
self.train_model = train_model
|
||||
self.step_model = step_model
|
||||
self.step = step_model.step
|
||||
self.initial_state = step_model.initial_state
|
||||
tf.global_variables_initializer().run(session=sess)
|
||||
|
||||
class Runner(AbstractEnvRunner):
|
||||
def __init__(self, env, model, nsteps, nstack):
|
||||
super().__init__(env=env, model=model, nsteps=nsteps)
|
||||
self.nstack = nstack
|
||||
nh, nw, nc = env.observation_space.shape
|
||||
self.nc = nc # nc = 1 for atari, but just in case
|
||||
self.nenv = nenv = env.num_envs
|
||||
self.nact = env.action_space.n
|
||||
self.nbatch = nenv * nsteps
|
||||
self.batch_ob_shape = (nenv*(nsteps+1), nh, nw, nc*nstack)
|
||||
self.obs = np.zeros((nenv, nh, nw, nc * nstack), dtype=np.uint8)
|
||||
obs = env.reset()
|
||||
self.update_obs(obs)
|
||||
|
||||
def update_obs(self, obs, dones=None):
|
||||
if dones is not None:
|
||||
self.obs *= (1 - dones.astype(np.uint8))[:, None, None, None]
|
||||
self.obs = np.roll(self.obs, shift=-self.nc, axis=3)
|
||||
self.obs[:, :, :, -self.nc:] = obs[:, :, :, :]
|
||||
|
||||
def run(self):
|
||||
enc_obs = np.split(self.obs, self.nstack, axis=3) # so now list of obs steps
|
||||
mb_obs, mb_actions, mb_mus, mb_dones, mb_rewards = [], [], [], [], []
|
||||
for _ in range(self.nsteps):
|
||||
actions, mus, states = self.model.step(self.obs, state=self.states, mask=self.dones)
|
||||
mb_obs.append(np.copy(self.obs))
|
||||
mb_actions.append(actions)
|
||||
mb_mus.append(mus)
|
||||
mb_dones.append(self.dones)
|
||||
obs, rewards, dones, _ = self.env.step(actions)
|
||||
# states information for statefull models like LSTM
|
||||
self.states = states
|
||||
self.dones = dones
|
||||
self.update_obs(obs, dones)
|
||||
mb_rewards.append(rewards)
|
||||
enc_obs.append(obs)
|
||||
mb_obs.append(np.copy(self.obs))
|
||||
mb_dones.append(self.dones)
|
||||
|
||||
enc_obs = np.asarray(enc_obs, dtype=np.uint8).swapaxes(1, 0)
|
||||
mb_obs = np.asarray(mb_obs, dtype=np.uint8).swapaxes(1, 0)
|
||||
mb_actions = np.asarray(mb_actions, dtype=np.int32).swapaxes(1, 0)
|
||||
mb_rewards = np.asarray(mb_rewards, dtype=np.float32).swapaxes(1, 0)
|
||||
mb_mus = np.asarray(mb_mus, dtype=np.float32).swapaxes(1, 0)
|
||||
|
||||
mb_dones = np.asarray(mb_dones, dtype=np.bool).swapaxes(1, 0)
|
||||
|
||||
mb_masks = mb_dones # Used for statefull models like LSTM's to mask state when done
|
||||
mb_dones = mb_dones[:, 1:] # Used for calculating returns. The dones array is now aligned with rewards
|
||||
|
||||
# shapes are now [nenv, nsteps, []]
|
||||
# When pulling from buffer, arrays will now be reshaped in place, preventing a deep copy.
|
||||
|
||||
return enc_obs, mb_obs, mb_actions, mb_rewards, mb_mus, mb_dones, mb_masks
|
||||
|
||||
class Acer():
|
||||
def __init__(self, runner, model, buffer, log_interval):
|
||||
self.runner = runner
|
||||
self.model = model
|
||||
self.buffer = buffer
|
||||
self.log_interval = log_interval
|
||||
self.tstart = None
|
||||
self.episode_stats = EpisodeStats(runner.nsteps, runner.nenv)
|
||||
self.steps = None
|
||||
|
||||
def call(self, on_policy):
|
||||
runner, model, buffer, steps = self.runner, self.model, self.buffer, self.steps
|
||||
if on_policy:
|
||||
enc_obs, obs, actions, rewards, mus, dones, masks = runner.run()
|
||||
self.episode_stats.feed(rewards, dones)
|
||||
if buffer is not None:
|
||||
buffer.put(enc_obs, actions, rewards, mus, dones, masks)
|
||||
else:
|
||||
# get obs, actions, rewards, mus, dones from buffer.
|
||||
obs, actions, rewards, mus, dones, masks = buffer.get()
|
||||
|
||||
# reshape stuff correctly
|
||||
obs = obs.reshape(runner.batch_ob_shape)
|
||||
actions = actions.reshape([runner.nbatch])
|
||||
rewards = rewards.reshape([runner.nbatch])
|
||||
mus = mus.reshape([runner.nbatch, runner.nact])
|
||||
dones = dones.reshape([runner.nbatch])
|
||||
masks = masks.reshape([runner.batch_ob_shape[0]])
|
||||
|
||||
names_ops, values_ops = model.train(obs, actions, rewards, dones, mus, model.initial_state, masks, steps)
|
||||
|
||||
if on_policy and (int(steps/runner.nbatch) % self.log_interval == 0):
|
||||
logger.record_tabular("total_timesteps", steps)
|
||||
logger.record_tabular("fps", int(steps/(time.time() - self.tstart)))
|
||||
# IMP: In EpisodicLife env, during training, we get done=True at each loss of life, not just at the terminal state.
|
||||
# Thus, this is mean until end of life, not end of episode.
|
||||
# For true episode rewards, see the monitor files in the log folder.
|
||||
logger.record_tabular("mean_episode_length", self.episode_stats.mean_length())
|
||||
logger.record_tabular("mean_episode_reward", self.episode_stats.mean_reward())
|
||||
for name, val in zip(names_ops, values_ops):
|
||||
logger.record_tabular(name, float(val))
|
||||
logger.dump_tabular()
|
||||
|
||||
|
||||
def learn(policy, env, seed, nsteps=20, nstack=4, total_timesteps=int(80e6), q_coef=0.5, ent_coef=0.01,
|
||||
max_grad_norm=10, lr=7e-4, lrschedule='linear', rprop_epsilon=1e-5, rprop_alpha=0.99, gamma=0.99,
|
||||
log_interval=100, buffer_size=50000, replay_ratio=4, replay_start=10000, c=10.0,
|
||||
trust_region=True, alpha=0.99, delta=1):
|
||||
print("Running Acer Simple")
|
||||
print(locals())
|
||||
tf.reset_default_graph()
|
||||
set_global_seeds(seed)
|
||||
|
||||
nenvs = env.num_envs
|
||||
ob_space = env.observation_space
|
||||
ac_space = env.action_space
|
||||
num_procs = len(env.remotes) # HACK
|
||||
model = Model(policy=policy, ob_space=ob_space, ac_space=ac_space, nenvs=nenvs, nsteps=nsteps, nstack=nstack,
|
||||
num_procs=num_procs, ent_coef=ent_coef, q_coef=q_coef, gamma=gamma,
|
||||
max_grad_norm=max_grad_norm, lr=lr, rprop_alpha=rprop_alpha, rprop_epsilon=rprop_epsilon,
|
||||
total_timesteps=total_timesteps, lrschedule=lrschedule, c=c,
|
||||
trust_region=trust_region, alpha=alpha, delta=delta)
|
||||
|
||||
runner = Runner(env=env, model=model, nsteps=nsteps, nstack=nstack)
|
||||
if replay_ratio > 0:
|
||||
buffer = Buffer(env=env, nsteps=nsteps, nstack=nstack, size=buffer_size)
|
||||
else:
|
||||
buffer = None
|
||||
nbatch = nenvs*nsteps
|
||||
acer = Acer(runner, model, buffer, log_interval)
|
||||
acer.tstart = time.time()
|
||||
for acer.steps in range(0, total_timesteps, nbatch): #nbatch samples, 1 on_policy call and multiple off-policy calls
|
||||
acer.call(on_policy=True)
|
||||
if replay_ratio > 0 and buffer.has_atleast(replay_start):
|
||||
n = np.random.poisson(replay_ratio)
|
||||
for _ in range(n):
|
||||
acer.call(on_policy=False) # no simulation steps in this
|
||||
|
||||
env.close()
|
@@ -1,6 +1,6 @@
|
||||
import numpy as np
|
||||
import tensorflow as tf
|
||||
from baselines.ppo2.policies import nature_cnn
|
||||
from baselines.common.policies import nature_cnn
|
||||
from baselines.a2c.utils import fc, batch_to_seq, seq_to_batch, lstm, sample
|
||||
|
||||
|
||||
@@ -18,11 +18,13 @@ class AcerCnnPolicy(object):
|
||||
pi = tf.nn.softmax(pi_logits)
|
||||
q = fc(h, 'q', nact)
|
||||
|
||||
a = sample(pi_logits) # could change this to use self.pi instead
|
||||
a = sample(tf.nn.softmax(pi_logits)) # could change this to use self.pi instead
|
||||
self.initial_state = [] # not stateful
|
||||
self.X = X
|
||||
self.pi = pi # actual policy params now
|
||||
self.pi_logits = pi_logits
|
||||
self.q = q
|
||||
self.vf = q
|
||||
|
||||
def step(ob, *args, **kwargs):
|
||||
# returns actions, mus, states
|
||||
|
@@ -1,30 +0,0 @@
|
||||
#!/usr/bin/env python3
|
||||
from baselines import logger
|
||||
from baselines.acer.acer_simple import learn
|
||||
from baselines.acer.policies import AcerCnnPolicy, AcerLstmPolicy
|
||||
from baselines.common.cmd_util import make_atari_env, atari_arg_parser
|
||||
|
||||
def train(env_id, num_timesteps, seed, policy, lrschedule, num_cpu):
|
||||
env = make_atari_env(env_id, num_cpu, seed)
|
||||
if policy == 'cnn':
|
||||
policy_fn = AcerCnnPolicy
|
||||
elif policy == 'lstm':
|
||||
policy_fn = AcerLstmPolicy
|
||||
else:
|
||||
print("Policy {} not implemented".format(policy))
|
||||
return
|
||||
learn(policy_fn, env, seed, total_timesteps=int(num_timesteps * 1.1), lrschedule=lrschedule)
|
||||
env.close()
|
||||
|
||||
def main():
|
||||
parser = atari_arg_parser()
|
||||
parser.add_argument('--policy', help='Policy architecture', choices=['cnn', 'lstm', 'lnlstm'], default='cnn')
|
||||
parser.add_argument('--lrschedule', help='Learning rate schedule', choices=['constant', 'linear'], default='constant')
|
||||
parser.add_argument('--logdir', help ='Directory for logging')
|
||||
args = parser.parse_args()
|
||||
logger.configure(args.logdir)
|
||||
train(args.env, num_timesteps=args.num_timesteps, seed=args.seed,
|
||||
policy=args.policy, lrschedule=args.lrschedule, num_cpu=16)
|
||||
|
||||
if __name__ == '__main__':
|
||||
main()
|
@@ -6,11 +6,12 @@ import tensorflow as tf
|
||||
from baselines import logger
|
||||
|
||||
from baselines.common import set_global_seeds, explained_variance
|
||||
from baselines.common.policies import build_policy
|
||||
from baselines.common.tf_util import get_session
|
||||
|
||||
from baselines.a2c.a2c import Runner
|
||||
from baselines.a2c.runner import Runner
|
||||
from baselines.a2c.utils import discount_with_dones
|
||||
from baselines.a2c.utils import Scheduler, find_trainable_variables
|
||||
from baselines.a2c.utils import cat_entropy, mse
|
||||
from baselines.acktr import kfac
|
||||
|
||||
|
||||
@@ -19,11 +20,8 @@ class Model(object):
|
||||
def __init__(self, policy, ob_space, ac_space, nenvs,total_timesteps, nprocs=32, nsteps=20,
|
||||
ent_coef=0.01, vf_coef=0.5, vf_fisher_coef=1.0, lr=0.25, max_grad_norm=0.5,
|
||||
kfac_clip=0.001, lrschedule='linear'):
|
||||
config = tf.ConfigProto(allow_soft_placement=True,
|
||||
intra_op_parallelism_threads=nprocs,
|
||||
inter_op_parallelism_threads=nprocs)
|
||||
config.gpu_options.allow_growth = True
|
||||
self.sess = sess = tf.Session(config=config)
|
||||
|
||||
self.sess = sess = get_session()
|
||||
nact = ac_space.n
|
||||
nbatch = nenvs * nsteps
|
||||
A = tf.placeholder(tf.int32, [nbatch])
|
||||
@@ -32,27 +30,28 @@ class Model(object):
|
||||
PG_LR = tf.placeholder(tf.float32, [])
|
||||
VF_LR = tf.placeholder(tf.float32, [])
|
||||
|
||||
self.model = step_model = policy(sess, ob_space, ac_space, nenvs, 1, reuse=False)
|
||||
self.model2 = train_model = policy(sess, ob_space, ac_space, nenvs*nsteps, nsteps, reuse=True)
|
||||
with tf.variable_scope('acktr_model', reuse=tf.AUTO_REUSE):
|
||||
self.model = step_model = policy(nenvs, 1, sess=sess)
|
||||
self.model2 = train_model = policy(nenvs*nsteps, nsteps, sess=sess)
|
||||
|
||||
logpac = tf.nn.sparse_softmax_cross_entropy_with_logits(logits=train_model.pi, labels=A)
|
||||
neglogpac = train_model.pd.neglogp(A)
|
||||
self.logits = logits = train_model.pi
|
||||
|
||||
##training loss
|
||||
pg_loss = tf.reduce_mean(ADV*logpac)
|
||||
entropy = tf.reduce_mean(cat_entropy(train_model.pi))
|
||||
pg_loss = tf.reduce_mean(ADV*neglogpac)
|
||||
entropy = tf.reduce_mean(train_model.pd.entropy())
|
||||
pg_loss = pg_loss - ent_coef * entropy
|
||||
vf_loss = tf.reduce_mean(mse(tf.squeeze(train_model.vf), R))
|
||||
vf_loss = tf.losses.mean_squared_error(tf.squeeze(train_model.vf), R)
|
||||
train_loss = pg_loss + vf_coef * vf_loss
|
||||
|
||||
|
||||
##Fisher loss construction
|
||||
self.pg_fisher = pg_fisher_loss = -tf.reduce_mean(logpac)
|
||||
self.pg_fisher = pg_fisher_loss = -tf.reduce_mean(neglogpac)
|
||||
sample_net = train_model.vf + tf.random_normal(tf.shape(train_model.vf))
|
||||
self.vf_fisher = vf_fisher_loss = - vf_fisher_coef*tf.reduce_mean(tf.pow(train_model.vf - tf.stop_gradient(sample_net), 2))
|
||||
self.joint_fisher = joint_fisher_loss = pg_fisher_loss + vf_fisher_loss
|
||||
|
||||
self.params=params = find_trainable_variables("model")
|
||||
self.params=params = find_trainable_variables("acktr_model")
|
||||
|
||||
self.grads_check = grads = tf.gradients(train_loss,params)
|
||||
|
||||
@@ -105,12 +104,17 @@ class Model(object):
|
||||
self.initial_state = step_model.initial_state
|
||||
tf.global_variables_initializer().run(session=sess)
|
||||
|
||||
def learn(policy, env, seed, total_timesteps=int(40e6), gamma=0.99, log_interval=1, nprocs=32, nsteps=20,
|
||||
def learn(network, env, seed, total_timesteps=int(40e6), gamma=0.99, log_interval=1, nprocs=32, nsteps=20,
|
||||
ent_coef=0.01, vf_coef=0.5, vf_fisher_coef=1.0, lr=0.25, max_grad_norm=0.5,
|
||||
kfac_clip=0.001, save_interval=None, lrschedule='linear'):
|
||||
tf.reset_default_graph()
|
||||
kfac_clip=0.001, save_interval=None, lrschedule='linear', **network_kwargs):
|
||||
set_global_seeds(seed)
|
||||
|
||||
|
||||
if network == 'cnn':
|
||||
network_kwargs['one_dim_bias'] = True
|
||||
|
||||
policy = build_policy(env, network, **network_kwargs)
|
||||
|
||||
nenvs = env.num_envs
|
||||
ob_space = env.observation_space
|
||||
ac_space = env.action_space
|
||||
@@ -153,3 +157,4 @@ def learn(policy, env, seed, total_timesteps=int(40e6), gamma=0.99, log_interval
|
||||
coord.request_stop()
|
||||
coord.join(enqueue_threads)
|
||||
env.close()
|
||||
return model
|
||||
|
@@ -6,11 +6,11 @@ from baselines import logger
|
||||
from baselines.acktr.acktr_disc import learn
|
||||
from baselines.common.cmd_util import make_atari_env, atari_arg_parser
|
||||
from baselines.common.vec_env.vec_frame_stack import VecFrameStack
|
||||
from baselines.ppo2.policies import CnnPolicy
|
||||
from baselines.common.policies import cnn
|
||||
|
||||
def train(env_id, num_timesteps, seed, num_cpu):
|
||||
env = VecFrameStack(make_atari_env(env_id, num_cpu, seed), 4)
|
||||
policy_fn = partial(CnnPolicy, one_dim_bias=True)
|
||||
policy_fn = cnn(env=env, one_dim_bias=True)
|
||||
learn(policy_fn, env, seed, total_timesteps=int(num_timesteps * 1.1), nprocs=num_cpu)
|
||||
env.close()
|
||||
|
||||
|
@@ -59,7 +59,7 @@ register_benchmark({
|
||||
register_benchmark({
|
||||
'name': 'Atari10M',
|
||||
'description': '7 Atari games from Mnih et al. (2013), with pixel observations, 10M timesteps',
|
||||
'tasks': [{'desc': _game, 'env_id': _game + _ATARI_SUFFIX, 'trials': 2, 'num_timesteps': int(10e6)} for _game in _atari7]
|
||||
'tasks': [{'desc': _game, 'env_id': _game + _ATARI_SUFFIX, 'trials': 6, 'num_timesteps': int(10e6)} for _game in _atari7]
|
||||
})
|
||||
|
||||
register_benchmark({
|
||||
@@ -84,7 +84,7 @@ _mujocosmall = [
|
||||
register_benchmark({
|
||||
'name': 'Mujoco1M',
|
||||
'description': 'Some small 2D MuJoCo tasks, run for 1M timesteps',
|
||||
'tasks': [{'env_id': _envid, 'trials': 3, 'num_timesteps': int(1e6)} for _envid in _mujocosmall]
|
||||
'tasks': [{'env_id': _envid, 'trials': 6, 'num_timesteps': int(1e6)} for _envid in _mujocosmall]
|
||||
})
|
||||
register_benchmark({
|
||||
'name': 'MujocoWalkers',
|
||||
|
@@ -112,6 +112,8 @@ def load_results(dir):
|
||||
with open(fname, 'rt') as fh:
|
||||
if fname.endswith('csv'):
|
||||
firstline = fh.readline()
|
||||
if not firstline:
|
||||
continue
|
||||
assert firstline[0] == '#'
|
||||
header = json.loads(firstline[1:])
|
||||
df = pandas.read_csv(fh, index_col=None)
|
||||
|
@@ -1,4 +1,6 @@
|
||||
import numpy as np
|
||||
import os
|
||||
os.environ.setdefault('PATH', '')
|
||||
from collections import deque
|
||||
import gym
|
||||
from gym import spaces
|
||||
|
@@ -3,7 +3,11 @@ Helpers for scripts like run_atari.py.
|
||||
"""
|
||||
|
||||
import os
|
||||
from mpi4py import MPI
|
||||
try:
|
||||
from mpi4py import MPI
|
||||
except ImportError:
|
||||
MPI = None
|
||||
|
||||
import gym
|
||||
from gym.wrappers import FlattenDictWrapper
|
||||
from baselines import logger
|
||||
@@ -20,22 +24,28 @@ def make_atari_env(env_id, num_env, seed, wrapper_kwargs=None, start_index=0):
|
||||
def make_env(rank): # pylint: disable=C0111
|
||||
def _thunk():
|
||||
env = make_atari(env_id)
|
||||
env.seed(seed + rank)
|
||||
env.seed(seed + rank if seed is not None else None)
|
||||
env = Monitor(env, logger.get_dir() and os.path.join(logger.get_dir(), str(rank)))
|
||||
return wrap_deepmind(env, **wrapper_kwargs)
|
||||
return _thunk
|
||||
set_global_seeds(seed)
|
||||
return SubprocVecEnv([make_env(i + start_index) for i in range(num_env)])
|
||||
|
||||
def make_mujoco_env(env_id, seed):
|
||||
def make_mujoco_env(env_id, seed, reward_scale=1.0):
|
||||
"""
|
||||
Create a wrapped, monitored gym.Env for MuJoCo.
|
||||
"""
|
||||
rank = MPI.COMM_WORLD.Get_rank()
|
||||
set_global_seeds(seed + 10000 * rank)
|
||||
myseed = seed + 1000 * rank if seed is not None else None
|
||||
set_global_seeds(myseed)
|
||||
env = gym.make(env_id)
|
||||
env = Monitor(env, os.path.join(logger.get_dir(), str(rank)))
|
||||
env = Monitor(env, os.path.join(logger.get_dir(), str(rank)), allow_early_resets=True)
|
||||
env.seed(seed)
|
||||
|
||||
if reward_scale != 1.0:
|
||||
from baselines.common.retro_wrappers import RewardScaler
|
||||
env = RewardScaler(env, reward_scale)
|
||||
|
||||
return env
|
||||
|
||||
def make_robotics_env(env_id, seed, rank=0):
|
||||
@@ -64,18 +74,28 @@ def atari_arg_parser():
|
||||
"""
|
||||
parser = arg_parser()
|
||||
parser.add_argument('--env', help='environment ID', default='BreakoutNoFrameskip-v4')
|
||||
parser.add_argument('--seed', help='RNG seed', type=int, default=0)
|
||||
parser.add_argument('--seed', help='RNG seed', type=int, default=None)
|
||||
parser.add_argument('--num-timesteps', type=int, default=int(10e6))
|
||||
return parser
|
||||
|
||||
def mujoco_arg_parser():
|
||||
print('Obsolete - use common_arg_parser instead')
|
||||
return common_arg_parser()
|
||||
|
||||
def common_arg_parser():
|
||||
"""
|
||||
Create an argparse.ArgumentParser for run_mujoco.py.
|
||||
"""
|
||||
parser = arg_parser()
|
||||
parser.add_argument('--env', help='environment ID', type=str, default='Reacher-v2')
|
||||
parser.add_argument('--seed', help='RNG seed', type=int, default=0)
|
||||
parser.add_argument('--num-timesteps', type=int, default=int(1e6))
|
||||
parser.add_argument('--seed', help='RNG seed', type=int, default=None)
|
||||
parser.add_argument('--alg', help='Algorithm', type=str, default='ppo2')
|
||||
parser.add_argument('--num-timesteps', type=float, default=1e6),
|
||||
parser.add_argument('--network', help='network type (mlp, cnn, lstm, cnn_lstm, conv_only)', default=None)
|
||||
parser.add_argument('--gamestate', help='game state to load (so far only used in retro games)', default=None)
|
||||
parser.add_argument('--num-env', help='Number of environment copies being run in parallel. When not specified, set to number of cpus for Atari, and to 1 for Mujoco', default=None, type=int)
|
||||
parser.add_argument('--reward-scale', help='Reward scale factor. Default: 1.0', default=1.0, type=float)
|
||||
parser.add_argument('--model-path', help='Path to save and load trained models from', default=None, type=str)
|
||||
parser.add_argument('--play', default=False, action='store_true')
|
||||
return parser
|
||||
|
||||
@@ -85,6 +105,24 @@ def robotics_arg_parser():
|
||||
"""
|
||||
parser = arg_parser()
|
||||
parser.add_argument('--env', help='environment ID', type=str, default='FetchReach-v0')
|
||||
parser.add_argument('--seed', help='RNG seed', type=int, default=0)
|
||||
parser.add_argument('--seed', help='RNG seed', type=int, default=None)
|
||||
parser.add_argument('--num-timesteps', type=int, default=int(1e6))
|
||||
return parser
|
||||
|
||||
|
||||
def parse_unknown_args(args):
|
||||
"""
|
||||
Parse arguments not consumed by arg parser into a dicitonary
|
||||
"""
|
||||
retval = {}
|
||||
for arg in args:
|
||||
assert arg.startswith('--')
|
||||
assert '=' in arg, 'cannot parse arg {}'.format(arg)
|
||||
key = arg.split('=')[0][2:]
|
||||
value = arg.split('=')[1]
|
||||
retval[key] = value
|
||||
|
||||
return retval
|
||||
|
||||
|
||||
|
||||
|
@@ -85,7 +85,7 @@ class DiagGaussianPdType(PdType):
|
||||
|
||||
def pdfromlatent(self, latent_vector, init_scale=1.0, init_bias=0.0):
|
||||
mean = fc(latent_vector, 'pi', self.size, init_scale=init_scale, init_bias=init_bias)
|
||||
logstd = tf.get_variable(name='logstd', shape=[1, self.size], initializer=tf.zeros_initializer())
|
||||
logstd = tf.get_variable(name='pi/logstd', shape=[1, self.size], initializer=tf.zeros_initializer())
|
||||
pdparam = tf.concat([mean, mean * 0.0 + logstd], axis=1)
|
||||
return self.pdfromflat(pdparam), mean
|
||||
|
||||
@@ -143,26 +143,26 @@ class CategoricalPd(Pd):
|
||||
# Note: we can't use sparse_softmax_cross_entropy_with_logits because
|
||||
# the implementation does not allow second-order derivatives...
|
||||
one_hot_actions = tf.one_hot(x, self.logits.get_shape().as_list()[-1])
|
||||
return tf.nn.softmax_cross_entropy_with_logits(
|
||||
return tf.nn.softmax_cross_entropy_with_logits_v2(
|
||||
logits=self.logits,
|
||||
labels=one_hot_actions)
|
||||
def kl(self, other):
|
||||
a0 = self.logits - tf.reduce_max(self.logits, axis=-1, keep_dims=True)
|
||||
a1 = other.logits - tf.reduce_max(other.logits, axis=-1, keep_dims=True)
|
||||
a0 = self.logits - tf.reduce_max(self.logits, axis=-1, keepdims=True)
|
||||
a1 = other.logits - tf.reduce_max(other.logits, axis=-1, keepdims=True)
|
||||
ea0 = tf.exp(a0)
|
||||
ea1 = tf.exp(a1)
|
||||
z0 = tf.reduce_sum(ea0, axis=-1, keep_dims=True)
|
||||
z1 = tf.reduce_sum(ea1, axis=-1, keep_dims=True)
|
||||
z0 = tf.reduce_sum(ea0, axis=-1, keepdims=True)
|
||||
z1 = tf.reduce_sum(ea1, axis=-1, keepdims=True)
|
||||
p0 = ea0 / z0
|
||||
return tf.reduce_sum(p0 * (a0 - tf.log(z0) - a1 + tf.log(z1)), axis=-1)
|
||||
def entropy(self):
|
||||
a0 = self.logits - tf.reduce_max(self.logits, axis=-1, keep_dims=True)
|
||||
a0 = self.logits - tf.reduce_max(self.logits, axis=-1, keepdims=True)
|
||||
ea0 = tf.exp(a0)
|
||||
z0 = tf.reduce_sum(ea0, axis=-1, keep_dims=True)
|
||||
z0 = tf.reduce_sum(ea0, axis=-1, keepdims=True)
|
||||
p0 = ea0 / z0
|
||||
return tf.reduce_sum(p0 * (tf.log(z0) - a0), axis=-1)
|
||||
def sample(self):
|
||||
u = tf.random_uniform(tf.shape(self.logits))
|
||||
u = tf.random_uniform(tf.shape(self.logits), dtype=self.logits.dtype)
|
||||
return tf.argmax(self.logits - tf.log(-tf.log(u)), axis=-1)
|
||||
@classmethod
|
||||
def fromflat(cls, flat):
|
||||
|
@@ -1,30 +1,56 @@
|
||||
import tensorflow as tf
|
||||
from gym.spaces import Discrete, Box
|
||||
|
||||
def observation_placeholder(ob_space, batch_size=None, name='Ob'):
|
||||
'''
|
||||
Create placeholder to feed observations into of the size appropriate to the observation space
|
||||
|
||||
Parameters:
|
||||
----------
|
||||
|
||||
ob_space: gym.Space observation space
|
||||
|
||||
batch_size: int size of the batch to be fed into input. Can be left None in most cases.
|
||||
|
||||
name: str name of the placeholder
|
||||
|
||||
Returns:
|
||||
-------
|
||||
|
||||
tensorflow placeholder tensor
|
||||
'''
|
||||
|
||||
assert isinstance(ob_space, Discrete) or isinstance(ob_space, Box), \
|
||||
'Can only deal with Discrete and Box observation spaces for now'
|
||||
|
||||
return tf.placeholder(shape=(batch_size,) + ob_space.shape, dtype=ob_space.dtype, name=name)
|
||||
|
||||
|
||||
def observation_input(ob_space, batch_size=None, name='Ob'):
|
||||
'''
|
||||
Build observation input with encoding depending on the
|
||||
observation space type
|
||||
Params:
|
||||
Create placeholder to feed observations into of the size appropriate to the observation space, and add input
|
||||
encoder of the appropriate type.
|
||||
'''
|
||||
|
||||
ob_space: observation space (should be one of gym.spaces)
|
||||
batch_size: batch size for input (default is None, so that resulting input placeholder can take tensors with any batch size)
|
||||
name: tensorflow variable name for input placeholder
|
||||
placeholder = observation_placeholder(ob_space, batch_size, name)
|
||||
return placeholder, encode_observation(ob_space, placeholder)
|
||||
|
||||
returns: tuple (input_placeholder, processed_input_tensor)
|
||||
def encode_observation(ob_space, placeholder):
|
||||
'''
|
||||
Encode input in the way that is appropriate to the observation space
|
||||
|
||||
Parameters:
|
||||
----------
|
||||
|
||||
ob_space: gym.Space observation space
|
||||
|
||||
placeholder: tf.placeholder observation input placeholder
|
||||
'''
|
||||
if isinstance(ob_space, Discrete):
|
||||
input_x = tf.placeholder(shape=(batch_size,), dtype=tf.int32, name=name)
|
||||
processed_x = tf.to_float(tf.one_hot(input_x, ob_space.n))
|
||||
return input_x, processed_x
|
||||
return tf.to_float(tf.one_hot(placeholder, ob_space.n))
|
||||
|
||||
elif isinstance(ob_space, Box):
|
||||
input_shape = (batch_size,) + ob_space.shape
|
||||
input_x = tf.placeholder(shape=input_shape, dtype=ob_space.dtype, name=name)
|
||||
processed_x = tf.to_float(input_x)
|
||||
return input_x, processed_x
|
||||
|
||||
return tf.to_float(placeholder)
|
||||
else:
|
||||
raise NotImplementedError
|
||||
|
||||
|
||||
|
@@ -67,14 +67,21 @@ class EzPickle(object):
|
||||
|
||||
|
||||
def set_global_seeds(i):
|
||||
try:
|
||||
import MPI
|
||||
rank = MPI.COMM_WORLD.Get_rank()
|
||||
except ImportError:
|
||||
rank = 0
|
||||
|
||||
myseed = i + 1000 * rank if i is not None else None
|
||||
try:
|
||||
import tensorflow as tf
|
||||
except ImportError:
|
||||
pass
|
||||
else:
|
||||
tf.set_random_seed(i)
|
||||
np.random.seed(i)
|
||||
random.seed(i)
|
||||
tf.set_random_seed(myseed)
|
||||
np.random.seed(myseed)
|
||||
random.seed(myseed)
|
||||
|
||||
|
||||
def pretty_eta(seconds_left):
|
||||
|
@@ -5,7 +5,7 @@ class AbstractEnvRunner(ABC):
|
||||
def __init__(self, *, env, model, nsteps):
|
||||
self.env = env
|
||||
self.model = model
|
||||
nenv = env.num_envs
|
||||
self.nenv = nenv = env.num_envs if hasattr(env, 'num_envs') else 1
|
||||
self.batch_ob_shape = (nenv*nsteps,) + env.observation_space.shape
|
||||
self.obs = np.zeros((nenv,) + env.observation_space.shape, dtype=env.observation_space.dtype.name)
|
||||
self.obs[:] = env.reset()
|
||||
@@ -16,3 +16,4 @@ class AbstractEnvRunner(ABC):
|
||||
@abstractmethod
|
||||
def run(self):
|
||||
raise NotImplementedError
|
||||
|
||||
|
@@ -1,44 +0,0 @@
|
||||
import pytest
|
||||
import tensorflow as tf
|
||||
import random
|
||||
import numpy as np
|
||||
from gym.spaces import np_random
|
||||
|
||||
from baselines.a2c import a2c
|
||||
from baselines.ppo2 import ppo2
|
||||
from baselines.common.identity_env import IdentityEnv
|
||||
from baselines.common.vec_env.dummy_vec_env import DummyVecEnv
|
||||
from baselines.ppo2.policies import MlpPolicy
|
||||
|
||||
|
||||
learn_func_list = [
|
||||
lambda e: a2c.learn(policy=MlpPolicy, env=e, seed=0, total_timesteps=50000),
|
||||
lambda e: ppo2.learn(policy=MlpPolicy, env=e, total_timesteps=50000, lr=1e-3, nsteps=128, ent_coef=0.01)
|
||||
]
|
||||
|
||||
|
||||
@pytest.mark.slow
|
||||
@pytest.mark.parametrize("learn_func", learn_func_list)
|
||||
def test_identity(learn_func):
|
||||
'''
|
||||
Test if the algorithm (with a given policy)
|
||||
can learn an identity transformation (i.e. return observation as an action)
|
||||
'''
|
||||
np.random.seed(0)
|
||||
np_random.seed(0)
|
||||
random.seed(0)
|
||||
|
||||
env = DummyVecEnv([lambda: IdentityEnv(10)])
|
||||
|
||||
with tf.Graph().as_default(), tf.Session().as_default():
|
||||
tf.set_random_seed(0)
|
||||
model = learn_func(env)
|
||||
|
||||
N_TRIALS = 1000
|
||||
sum_rew = 0
|
||||
obs = env.reset()
|
||||
for i in range(N_TRIALS):
|
||||
obs, rew, done, _ = env.step(model.step(obs)[0])
|
||||
sum_rew += rew
|
||||
|
||||
assert sum_rew > 0.9 * N_TRIALS
|
@@ -48,17 +48,28 @@ def huber_loss(x, delta=1.0):
|
||||
# Global session
|
||||
# ================================================================
|
||||
|
||||
def make_session(num_cpu=None, make_default=False, graph=None):
|
||||
def get_session(config=None):
|
||||
"""Get default session or create one with a given config"""
|
||||
sess = tf.get_default_session()
|
||||
if sess is None:
|
||||
sess = make_session(config=config, make_default=True)
|
||||
return sess
|
||||
|
||||
def make_session(config=None, num_cpu=None, make_default=False, graph=None):
|
||||
"""Returns a session that will use <num_cpu> CPU's only"""
|
||||
if num_cpu is None:
|
||||
num_cpu = int(os.getenv('RCALL_NUM_CPU', multiprocessing.cpu_count()))
|
||||
tf_config = tf.ConfigProto(
|
||||
inter_op_parallelism_threads=num_cpu,
|
||||
intra_op_parallelism_threads=num_cpu)
|
||||
if config is None:
|
||||
config = tf.ConfigProto(
|
||||
allow_soft_placement=True,
|
||||
inter_op_parallelism_threads=num_cpu,
|
||||
intra_op_parallelism_threads=num_cpu)
|
||||
config.gpu_options.allow_growth = True
|
||||
|
||||
if make_default:
|
||||
return tf.InteractiveSession(config=tf_config, graph=graph)
|
||||
return tf.InteractiveSession(config=config, graph=graph)
|
||||
else:
|
||||
return tf.Session(config=tf_config, graph=graph)
|
||||
return tf.Session(config=config, graph=graph)
|
||||
|
||||
def single_threaded_session():
|
||||
"""Returns a session which will only use a single CPU"""
|
||||
@@ -76,7 +87,7 @@ ALREADY_INITIALIZED = set()
|
||||
def initialize():
|
||||
"""Initialize all the uninitialized variables in the global scope."""
|
||||
new_variables = set(tf.global_variables()) - ALREADY_INITIALIZED
|
||||
tf.get_default_session().run(tf.variables_initializer(new_variables))
|
||||
get_session().run(tf.variables_initializer(new_variables))
|
||||
ALREADY_INITIALIZED.update(new_variables)
|
||||
|
||||
# ================================================================
|
||||
@@ -85,7 +96,7 @@ def initialize():
|
||||
|
||||
def normc_initializer(std=1.0, axis=0):
|
||||
def _initializer(shape, dtype=None, partition_info=None): # pylint: disable=W0613
|
||||
out = np.random.randn(*shape).astype(np.float32)
|
||||
out = np.random.randn(*shape).astype(dtype.as_numpy_dtype)
|
||||
out *= std / np.sqrt(np.square(out).sum(axis=axis, keepdims=True))
|
||||
return tf.constant(out)
|
||||
return _initializer
|
||||
@@ -179,7 +190,7 @@ class _Function(object):
|
||||
if hasattr(inpt, 'make_feed_dict'):
|
||||
feed_dict.update(inpt.make_feed_dict(value))
|
||||
else:
|
||||
feed_dict[inpt] = value
|
||||
feed_dict[inpt] = adjust_shape(inpt, value)
|
||||
|
||||
def __call__(self, *args):
|
||||
assert len(args) <= len(self.inputs), "Too many arguments provided"
|
||||
@@ -189,8 +200,8 @@ class _Function(object):
|
||||
self._feed_input(feed_dict, inpt, value)
|
||||
# Update feed dict with givens.
|
||||
for inpt in self.givens:
|
||||
feed_dict[inpt] = feed_dict.get(inpt, self.givens[inpt])
|
||||
results = tf.get_default_session().run(self.outputs_update, feed_dict=feed_dict)[:-1]
|
||||
feed_dict[inpt] = adjust_shape(inpt, feed_dict.get(inpt, self.givens[inpt]))
|
||||
results = get_session().run(self.outputs_update, feed_dict=feed_dict)[:-1]
|
||||
return results
|
||||
|
||||
# ================================================================
|
||||
@@ -243,23 +254,30 @@ class GetFlat(object):
|
||||
def __call__(self):
|
||||
return tf.get_default_session().run(self.op)
|
||||
|
||||
def flattenallbut0(x):
|
||||
return tf.reshape(x, [-1, intprod(x.get_shape().as_list()[1:])])
|
||||
|
||||
# =============================================================
|
||||
# TF placeholders management
|
||||
# ============================================================
|
||||
|
||||
_PLACEHOLDER_CACHE = {} # name -> (placeholder, dtype, shape)
|
||||
|
||||
def get_placeholder(name, dtype, shape):
|
||||
if name in _PLACEHOLDER_CACHE:
|
||||
out, dtype1, shape1 = _PLACEHOLDER_CACHE[name]
|
||||
assert dtype1 == dtype and shape1 == shape
|
||||
return out
|
||||
else:
|
||||
out = tf.placeholder(dtype=dtype, shape=shape, name=name)
|
||||
_PLACEHOLDER_CACHE[name] = (out, dtype, shape)
|
||||
return out
|
||||
if out.graph == tf.get_default_graph():
|
||||
assert dtype1 == dtype and shape1 == shape, \
|
||||
'Placeholder with name {} has already been registered and has shape {}, different from requested {}'.format(name, shape1, shape)
|
||||
return out
|
||||
|
||||
out = tf.placeholder(dtype=dtype, shape=shape, name=name)
|
||||
_PLACEHOLDER_CACHE[name] = (out, dtype, shape)
|
||||
return out
|
||||
|
||||
def get_placeholder_cached(name):
|
||||
return _PLACEHOLDER_CACHE[name][0]
|
||||
|
||||
def flattenallbut0(x):
|
||||
return tf.reshape(x, [-1, intprod(x.get_shape().as_list()[1:])])
|
||||
|
||||
|
||||
# ================================================================
|
||||
@@ -301,4 +319,61 @@ def save_state(fname):
|
||||
saver = tf.train.Saver()
|
||||
saver.save(tf.get_default_session(), fname)
|
||||
|
||||
# ================================================================
|
||||
# Shape adjustment for feeding into tf placeholders
|
||||
# ================================================================
|
||||
def adjust_shape(placeholder, data):
|
||||
'''
|
||||
adjust shape of the data to the shape of the placeholder if possible.
|
||||
If shape is incompatible, AssertionError is thrown
|
||||
|
||||
Parameters:
|
||||
placeholder tensorflow input placeholder
|
||||
|
||||
data input data to be (potentially) reshaped to be fed into placeholder
|
||||
|
||||
Returns:
|
||||
reshaped data
|
||||
'''
|
||||
|
||||
if not isinstance(data, np.ndarray) and not isinstance(data, list):
|
||||
return data
|
||||
if isinstance(data, list):
|
||||
data = np.array(data)
|
||||
|
||||
placeholder_shape = [x or -1 for x in placeholder.shape.as_list()]
|
||||
|
||||
assert _check_shape(placeholder_shape, data.shape), \
|
||||
'Shape of data {} is not compatible with shape of the placeholder {}'.format(data.shape, placeholder_shape)
|
||||
|
||||
return np.reshape(data, placeholder_shape)
|
||||
|
||||
|
||||
def _check_shape(placeholder_shape, data_shape):
|
||||
''' check if two shapes are compatible (i.e. differ only by dimensions of size 1, or by the batch dimension)'''
|
||||
|
||||
return True
|
||||
squeezed_placeholder_shape = _squeeze_shape(placeholder_shape)
|
||||
squeezed_data_shape = _squeeze_shape(data_shape)
|
||||
|
||||
for i, s_data in enumerate(squeezed_data_shape):
|
||||
s_placeholder = squeezed_placeholder_shape[i]
|
||||
if s_placeholder != -1 and s_data != s_placeholder:
|
||||
return False
|
||||
|
||||
return True
|
||||
|
||||
|
||||
def _squeeze_shape(shape):
|
||||
return [x for x in shape if x != 1]
|
||||
|
||||
# Tensorboard interfacing
|
||||
# ================================================================
|
||||
|
||||
def launch_tensorboard_in_background(log_dir):
|
||||
from tensorboard import main as tb
|
||||
import threading
|
||||
tf.flags.FLAGS.logdir = log_dir
|
||||
t = threading.Thread(target=tb.main, args=([]))
|
||||
t.start()
|
||||
|
||||
|
@@ -30,15 +30,30 @@ class DummyVecEnv(VecEnv):
|
||||
self.actions = None
|
||||
|
||||
def step_async(self, actions):
|
||||
self.actions = actions
|
||||
listify = True
|
||||
try:
|
||||
if len(actions) == self.num_envs:
|
||||
listify = False
|
||||
except TypeError:
|
||||
pass
|
||||
|
||||
if not listify:
|
||||
self.actions = actions
|
||||
else:
|
||||
assert self.num_envs == 1, "actions {} is either not a list or has a wrong size - cannot match to {} environments".format(actions, self.num_envs)
|
||||
self.actions = [actions]
|
||||
|
||||
def step_wait(self):
|
||||
for e in range(self.num_envs):
|
||||
obs, self.buf_rews[e], self.buf_dones[e], self.buf_infos[e] = self.envs[e].step(self.actions[e])
|
||||
action = self.actions[e]
|
||||
if isinstance(self.envs[e].action_space, spaces.Discrete):
|
||||
action = int(action)
|
||||
|
||||
obs, self.buf_rews[e], self.buf_dones[e], self.buf_infos[e] = self.envs[e].step(action)
|
||||
if self.buf_dones[e]:
|
||||
obs = self.envs[e].reset()
|
||||
self._save_obs(e, obs)
|
||||
return (self._obs_from_buf(), np.copy(self.buf_rews), np.copy(self.buf_dones),
|
||||
return (np.copy(self._obs_from_buf()), np.copy(self.buf_rews), np.copy(self.buf_dones),
|
||||
self.buf_infos.copy())
|
||||
|
||||
def reset(self):
|
||||
|
@@ -7,26 +7,30 @@ from baselines.common.tile_images import tile_images
|
||||
def worker(remote, parent_remote, env_fn_wrapper):
|
||||
parent_remote.close()
|
||||
env = env_fn_wrapper.x()
|
||||
while True:
|
||||
cmd, data = remote.recv()
|
||||
if cmd == 'step':
|
||||
ob, reward, done, info = env.step(data)
|
||||
if done:
|
||||
try:
|
||||
while True:
|
||||
cmd, data = remote.recv()
|
||||
if cmd == 'step':
|
||||
ob, reward, done, info = env.step(data)
|
||||
if done:
|
||||
ob = env.reset()
|
||||
remote.send((ob, reward, done, info))
|
||||
elif cmd == 'reset':
|
||||
ob = env.reset()
|
||||
remote.send((ob, reward, done, info))
|
||||
elif cmd == 'reset':
|
||||
ob = env.reset()
|
||||
remote.send(ob)
|
||||
elif cmd == 'render':
|
||||
remote.send(env.render(mode='rgb_array'))
|
||||
elif cmd == 'close':
|
||||
remote.close()
|
||||
break
|
||||
elif cmd == 'get_spaces':
|
||||
remote.send((env.observation_space, env.action_space))
|
||||
else:
|
||||
raise NotImplementedError
|
||||
|
||||
remote.send(ob)
|
||||
elif cmd == 'render':
|
||||
remote.send(env.render(mode='rgb_array'))
|
||||
elif cmd == 'close':
|
||||
remote.close()
|
||||
break
|
||||
elif cmd == 'get_spaces':
|
||||
remote.send((env.observation_space, env.action_space))
|
||||
else:
|
||||
raise NotImplementedError
|
||||
except KeyboardInterrupt:
|
||||
print('SubprocVecEnv worker: got KeyboardInterrupt')
|
||||
finally:
|
||||
env.close()
|
||||
|
||||
class SubprocVecEnv(VecEnv):
|
||||
def __init__(self, env_fns, spaces=None):
|
||||
|
@@ -26,9 +26,9 @@ def reduce_std(x, axis=None, keepdims=False):
|
||||
return tf.sqrt(reduce_var(x, axis=axis, keepdims=keepdims))
|
||||
|
||||
def reduce_var(x, axis=None, keepdims=False):
|
||||
m = tf.reduce_mean(x, axis=axis, keep_dims=True)
|
||||
m = tf.reduce_mean(x, axis=axis, keepdims=True)
|
||||
devs_squared = tf.square(x - m)
|
||||
return tf.reduce_mean(devs_squared, axis=axis, keep_dims=keepdims)
|
||||
return tf.reduce_mean(devs_squared, axis=axis, keepdims=keepdims)
|
||||
|
||||
def get_target_updates(vars, target_vars, tau):
|
||||
logger.info('setting up target updates ...')
|
||||
|
@@ -1,6 +1,6 @@
|
||||
from baselines.deepq import models # noqa
|
||||
from baselines.deepq.build_graph import build_act, build_train # noqa
|
||||
from baselines.deepq.simple import learn, load # noqa
|
||||
from baselines.deepq.deepq import learn, load # noqa
|
||||
from baselines.deepq.replay_buffer import ReplayBuffer, PrioritizedReplayBuffer # noqa
|
||||
|
||||
def wrap_atari_dqn(env):
|
||||
|
@@ -89,3 +89,41 @@ def cnn_to_mlp(convs, hiddens, dueling=False, layer_norm=False):
|
||||
|
||||
return lambda *args, **kwargs: _cnn_to_mlp(convs, hiddens, dueling, layer_norm=layer_norm, *args, **kwargs)
|
||||
|
||||
|
||||
|
||||
def build_q_func(network, hiddens=[256], dueling=True, layer_norm=False, **network_kwargs):
|
||||
if isinstance(network, str):
|
||||
from baselines.common.models import get_network_builder
|
||||
network = get_network_builder(network)(**network_kwargs)
|
||||
|
||||
def q_func_builder(input_placeholder, num_actions, scope, reuse=False):
|
||||
with tf.variable_scope(scope, reuse=reuse):
|
||||
latent, _ = network(input_placeholder)
|
||||
latent = layers.flatten(latent)
|
||||
|
||||
with tf.variable_scope("action_value"):
|
||||
action_out = latent
|
||||
for hidden in hiddens:
|
||||
action_out = layers.fully_connected(action_out, num_outputs=hidden, activation_fn=None)
|
||||
if layer_norm:
|
||||
action_out = layers.layer_norm(action_out, center=True, scale=True)
|
||||
action_out = tf.nn.relu(action_out)
|
||||
action_scores = layers.fully_connected(action_out, num_outputs=num_actions, activation_fn=None)
|
||||
|
||||
if dueling:
|
||||
with tf.variable_scope("state_value"):
|
||||
state_out = latent
|
||||
for hidden in hiddens:
|
||||
state_out = layers.fully_connected(state_out, num_outputs=hidden, activation_fn=None)
|
||||
if layer_norm:
|
||||
state_out = layers.layer_norm(state_out, center=True, scale=True)
|
||||
state_out = tf.nn.relu(state_out)
|
||||
state_score = layers.fully_connected(state_out, num_outputs=1, activation_fn=None)
|
||||
action_scores_mean = tf.reduce_mean(action_scores, 1)
|
||||
action_scores_centered = action_scores - tf.expand_dims(action_scores_mean, 1)
|
||||
q_out = state_score + action_scores_centered
|
||||
else:
|
||||
q_out = action_scores
|
||||
return q_out
|
||||
|
||||
return q_func_builder
|
||||
|
@@ -1,306 +0,0 @@
|
||||
import os
|
||||
import tempfile
|
||||
|
||||
import tensorflow as tf
|
||||
import zipfile
|
||||
import cloudpickle
|
||||
import numpy as np
|
||||
|
||||
import baselines.common.tf_util as U
|
||||
from baselines.common.tf_util import load_state, save_state
|
||||
from baselines import logger
|
||||
from baselines.common.schedules import LinearSchedule
|
||||
from baselines.common.input import observation_input
|
||||
|
||||
from baselines import deepq
|
||||
from baselines.deepq.replay_buffer import ReplayBuffer, PrioritizedReplayBuffer
|
||||
from baselines.deepq.utils import ObservationInput
|
||||
|
||||
|
||||
class ActWrapper(object):
|
||||
def __init__(self, act, act_params):
|
||||
self._act = act
|
||||
self._act_params = act_params
|
||||
|
||||
@staticmethod
|
||||
def load(path):
|
||||
with open(path, "rb") as f:
|
||||
model_data, act_params = cloudpickle.load(f)
|
||||
act = deepq.build_act(**act_params)
|
||||
sess = tf.Session()
|
||||
sess.__enter__()
|
||||
with tempfile.TemporaryDirectory() as td:
|
||||
arc_path = os.path.join(td, "packed.zip")
|
||||
with open(arc_path, "wb") as f:
|
||||
f.write(model_data)
|
||||
|
||||
zipfile.ZipFile(arc_path, 'r', zipfile.ZIP_DEFLATED).extractall(td)
|
||||
load_state(os.path.join(td, "model"))
|
||||
|
||||
return ActWrapper(act, act_params)
|
||||
|
||||
def __call__(self, *args, **kwargs):
|
||||
return self._act(*args, **kwargs)
|
||||
|
||||
def save(self, path=None):
|
||||
"""Save model to a pickle located at `path`"""
|
||||
if path is None:
|
||||
path = os.path.join(logger.get_dir(), "model.pkl")
|
||||
|
||||
with tempfile.TemporaryDirectory() as td:
|
||||
save_state(os.path.join(td, "model"))
|
||||
arc_name = os.path.join(td, "packed.zip")
|
||||
with zipfile.ZipFile(arc_name, 'w') as zipf:
|
||||
for root, dirs, files in os.walk(td):
|
||||
for fname in files:
|
||||
file_path = os.path.join(root, fname)
|
||||
if file_path != arc_name:
|
||||
zipf.write(file_path, os.path.relpath(file_path, td))
|
||||
with open(arc_name, "rb") as f:
|
||||
model_data = f.read()
|
||||
with open(path, "wb") as f:
|
||||
cloudpickle.dump((model_data, self._act_params), f)
|
||||
|
||||
|
||||
def load(path):
|
||||
"""Load act function that was returned by learn function.
|
||||
|
||||
Parameters
|
||||
----------
|
||||
path: str
|
||||
path to the act function pickle
|
||||
|
||||
Returns
|
||||
-------
|
||||
act: ActWrapper
|
||||
function that takes a batch of observations
|
||||
and returns actions.
|
||||
"""
|
||||
return ActWrapper.load(path)
|
||||
|
||||
|
||||
def learn(env,
|
||||
q_func,
|
||||
lr=5e-4,
|
||||
max_timesteps=100000,
|
||||
buffer_size=50000,
|
||||
exploration_fraction=0.1,
|
||||
exploration_final_eps=0.02,
|
||||
train_freq=1,
|
||||
batch_size=32,
|
||||
print_freq=100,
|
||||
checkpoint_freq=10000,
|
||||
checkpoint_path=None,
|
||||
learning_starts=1000,
|
||||
gamma=1.0,
|
||||
target_network_update_freq=500,
|
||||
prioritized_replay=False,
|
||||
prioritized_replay_alpha=0.6,
|
||||
prioritized_replay_beta0=0.4,
|
||||
prioritized_replay_beta_iters=None,
|
||||
prioritized_replay_eps=1e-6,
|
||||
param_noise=False,
|
||||
callback=None):
|
||||
"""Train a deepq model.
|
||||
|
||||
Parameters
|
||||
-------
|
||||
env: gym.Env
|
||||
environment to train on
|
||||
q_func: (tf.Variable, int, str, bool) -> tf.Variable
|
||||
the model that takes the following inputs:
|
||||
observation_in: object
|
||||
the output of observation placeholder
|
||||
num_actions: int
|
||||
number of actions
|
||||
scope: str
|
||||
reuse: bool
|
||||
should be passed to outer variable scope
|
||||
and returns a tensor of shape (batch_size, num_actions) with values of every action.
|
||||
lr: float
|
||||
learning rate for adam optimizer
|
||||
max_timesteps: int
|
||||
number of env steps to optimizer for
|
||||
buffer_size: int
|
||||
size of the replay buffer
|
||||
exploration_fraction: float
|
||||
fraction of entire training period over which the exploration rate is annealed
|
||||
exploration_final_eps: float
|
||||
final value of random action probability
|
||||
train_freq: int
|
||||
update the model every `train_freq` steps.
|
||||
set to None to disable printing
|
||||
batch_size: int
|
||||
size of a batched sampled from replay buffer for training
|
||||
print_freq: int
|
||||
how often to print out training progress
|
||||
set to None to disable printing
|
||||
checkpoint_freq: int
|
||||
how often to save the model. This is so that the best version is restored
|
||||
at the end of the training. If you do not wish to restore the best version at
|
||||
the end of the training set this variable to None.
|
||||
learning_starts: int
|
||||
how many steps of the model to collect transitions for before learning starts
|
||||
gamma: float
|
||||
discount factor
|
||||
target_network_update_freq: int
|
||||
update the target network every `target_network_update_freq` steps.
|
||||
prioritized_replay: True
|
||||
if True prioritized replay buffer will be used.
|
||||
prioritized_replay_alpha: float
|
||||
alpha parameter for prioritized replay buffer
|
||||
prioritized_replay_beta0: float
|
||||
initial value of beta for prioritized replay buffer
|
||||
prioritized_replay_beta_iters: int
|
||||
number of iterations over which beta will be annealed from initial value
|
||||
to 1.0. If set to None equals to max_timesteps.
|
||||
prioritized_replay_eps: float
|
||||
epsilon to add to the TD errors when updating priorities.
|
||||
callback: (locals, globals) -> None
|
||||
function called at every steps with state of the algorithm.
|
||||
If callback returns true training stops.
|
||||
|
||||
Returns
|
||||
-------
|
||||
act: ActWrapper
|
||||
Wrapper over act function. Adds ability to save it and load it.
|
||||
See header of baselines/deepq/categorical.py for details on the act function.
|
||||
"""
|
||||
# Create all the functions necessary to train the model
|
||||
|
||||
sess = tf.Session()
|
||||
sess.__enter__()
|
||||
|
||||
# capture the shape outside the closure so that the env object is not serialized
|
||||
# by cloudpickle when serializing make_obs_ph
|
||||
|
||||
def make_obs_ph(name):
|
||||
return ObservationInput(env.observation_space, name=name)
|
||||
|
||||
act, train, update_target, debug = deepq.build_train(
|
||||
make_obs_ph=make_obs_ph,
|
||||
q_func=q_func,
|
||||
num_actions=env.action_space.n,
|
||||
optimizer=tf.train.AdamOptimizer(learning_rate=lr),
|
||||
gamma=gamma,
|
||||
grad_norm_clipping=10,
|
||||
param_noise=param_noise
|
||||
)
|
||||
|
||||
act_params = {
|
||||
'make_obs_ph': make_obs_ph,
|
||||
'q_func': q_func,
|
||||
'num_actions': env.action_space.n,
|
||||
}
|
||||
|
||||
act = ActWrapper(act, act_params)
|
||||
|
||||
# Create the replay buffer
|
||||
if prioritized_replay:
|
||||
replay_buffer = PrioritizedReplayBuffer(buffer_size, alpha=prioritized_replay_alpha)
|
||||
if prioritized_replay_beta_iters is None:
|
||||
prioritized_replay_beta_iters = max_timesteps
|
||||
beta_schedule = LinearSchedule(prioritized_replay_beta_iters,
|
||||
initial_p=prioritized_replay_beta0,
|
||||
final_p=1.0)
|
||||
else:
|
||||
replay_buffer = ReplayBuffer(buffer_size)
|
||||
beta_schedule = None
|
||||
# Create the schedule for exploration starting from 1.
|
||||
exploration = LinearSchedule(schedule_timesteps=int(exploration_fraction * max_timesteps),
|
||||
initial_p=1.0,
|
||||
final_p=exploration_final_eps)
|
||||
|
||||
# Initialize the parameters and copy them to the target network.
|
||||
U.initialize()
|
||||
update_target()
|
||||
|
||||
episode_rewards = [0.0]
|
||||
saved_mean_reward = None
|
||||
obs = env.reset()
|
||||
reset = True
|
||||
|
||||
with tempfile.TemporaryDirectory() as td:
|
||||
td = checkpoint_path or td
|
||||
|
||||
model_file = os.path.join(td, "model")
|
||||
model_saved = False
|
||||
if tf.train.latest_checkpoint(td) is not None:
|
||||
load_state(model_file)
|
||||
logger.log('Loaded model from {}'.format(model_file))
|
||||
model_saved = True
|
||||
|
||||
for t in range(max_timesteps):
|
||||
if callback is not None:
|
||||
if callback(locals(), globals()):
|
||||
break
|
||||
# Take action and update exploration to the newest value
|
||||
kwargs = {}
|
||||
if not param_noise:
|
||||
update_eps = exploration.value(t)
|
||||
update_param_noise_threshold = 0.
|
||||
else:
|
||||
update_eps = 0.
|
||||
# Compute the threshold such that the KL divergence between perturbed and non-perturbed
|
||||
# policy is comparable to eps-greedy exploration with eps = exploration.value(t).
|
||||
# See Appendix C.1 in Parameter Space Noise for Exploration, Plappert et al., 2017
|
||||
# for detailed explanation.
|
||||
update_param_noise_threshold = -np.log(1. - exploration.value(t) + exploration.value(t) / float(env.action_space.n))
|
||||
kwargs['reset'] = reset
|
||||
kwargs['update_param_noise_threshold'] = update_param_noise_threshold
|
||||
kwargs['update_param_noise_scale'] = True
|
||||
action = act(np.array(obs)[None], update_eps=update_eps, **kwargs)[0]
|
||||
env_action = action
|
||||
reset = False
|
||||
new_obs, rew, done, _ = env.step(env_action)
|
||||
# Store transition in the replay buffer.
|
||||
replay_buffer.add(obs, action, rew, new_obs, float(done))
|
||||
obs = new_obs
|
||||
|
||||
episode_rewards[-1] += rew
|
||||
if done:
|
||||
obs = env.reset()
|
||||
episode_rewards.append(0.0)
|
||||
reset = True
|
||||
|
||||
if t > learning_starts and t % train_freq == 0:
|
||||
# Minimize the error in Bellman's equation on a batch sampled from replay buffer.
|
||||
if prioritized_replay:
|
||||
experience = replay_buffer.sample(batch_size, beta=beta_schedule.value(t))
|
||||
(obses_t, actions, rewards, obses_tp1, dones, weights, batch_idxes) = experience
|
||||
else:
|
||||
obses_t, actions, rewards, obses_tp1, dones = replay_buffer.sample(batch_size)
|
||||
weights, batch_idxes = np.ones_like(rewards), None
|
||||
td_errors = train(obses_t, actions, rewards, obses_tp1, dones, weights)
|
||||
if prioritized_replay:
|
||||
new_priorities = np.abs(td_errors) + prioritized_replay_eps
|
||||
replay_buffer.update_priorities(batch_idxes, new_priorities)
|
||||
|
||||
if t > learning_starts and t % target_network_update_freq == 0:
|
||||
# Update target network periodically.
|
||||
update_target()
|
||||
|
||||
mean_100ep_reward = round(np.mean(episode_rewards[-101:-1]), 1)
|
||||
num_episodes = len(episode_rewards)
|
||||
if done and print_freq is not None and len(episode_rewards) % print_freq == 0:
|
||||
logger.record_tabular("steps", t)
|
||||
logger.record_tabular("episodes", num_episodes)
|
||||
logger.record_tabular("mean 100 episode reward", mean_100ep_reward)
|
||||
logger.record_tabular("% time spent exploring", int(100 * exploration.value(t)))
|
||||
logger.dump_tabular()
|
||||
|
||||
if (checkpoint_freq is not None and t > learning_starts and
|
||||
num_episodes > 100 and t % checkpoint_freq == 0):
|
||||
if saved_mean_reward is None or mean_100ep_reward > saved_mean_reward:
|
||||
if print_freq is not None:
|
||||
logger.log("Saving model due to mean reward increase: {} -> {}".format(
|
||||
saved_mean_reward, mean_100ep_reward))
|
||||
save_state(model_file)
|
||||
model_saved = True
|
||||
saved_mean_reward = mean_100ep_reward
|
||||
if model_saved:
|
||||
if print_freq is not None:
|
||||
logger.log("Restored model with mean reward: {}".format(saved_mean_reward))
|
||||
load_state(model_file)
|
||||
|
||||
return act
|
@@ -1,43 +0,0 @@
|
||||
import tensorflow as tf
|
||||
import random
|
||||
|
||||
from baselines import deepq
|
||||
from baselines.common.identity_env import IdentityEnv
|
||||
|
||||
|
||||
def test_identity():
|
||||
|
||||
with tf.Graph().as_default():
|
||||
env = IdentityEnv(10)
|
||||
random.seed(0)
|
||||
|
||||
tf.set_random_seed(0)
|
||||
|
||||
param_noise = False
|
||||
model = deepq.models.mlp([32])
|
||||
act = deepq.learn(
|
||||
env,
|
||||
q_func=model,
|
||||
lr=1e-3,
|
||||
max_timesteps=10000,
|
||||
buffer_size=50000,
|
||||
exploration_fraction=0.1,
|
||||
exploration_final_eps=0.02,
|
||||
print_freq=10,
|
||||
param_noise=param_noise,
|
||||
)
|
||||
|
||||
tf.set_random_seed(0)
|
||||
|
||||
N_TRIALS = 1000
|
||||
sum_rew = 0
|
||||
obs = env.reset()
|
||||
for i in range(N_TRIALS):
|
||||
obs, rew, done, _ = env.step(act([obs]))
|
||||
sum_rew += rew
|
||||
|
||||
assert sum_rew > 0.9 * N_TRIALS
|
||||
|
||||
|
||||
if __name__ == '__main__':
|
||||
test_identity()
|
@@ -1,4 +1,5 @@
|
||||
from baselines.common.input import observation_input
|
||||
from baselines.common.tf_util import adjust_shape
|
||||
|
||||
import tensorflow as tf
|
||||
|
||||
@@ -36,7 +37,7 @@ class PlaceholderTfInput(TfInput):
|
||||
return self._placeholder
|
||||
|
||||
def make_feed_dict(self, data):
|
||||
return {self._placeholder: data}
|
||||
return {self._placeholder: adjust_shape(self._placeholder, data)}
|
||||
|
||||
|
||||
class Uint8Input(PlaceholderTfInput):
|
||||
|
@@ -18,7 +18,7 @@ def train(env_id, num_timesteps, seed):
|
||||
logger.configure()
|
||||
else:
|
||||
logger.configure(format_strs=[])
|
||||
workerseed = seed + 10000 * MPI.COMM_WORLD.Get_rank()
|
||||
workerseed = seed + 10000 * MPI.COMM_WORLD.Get_rank() if seed is not None else None
|
||||
set_global_seeds(workerseed)
|
||||
env = make_atari(env_id)
|
||||
def policy_fn(name, ob_space, ac_space): #pylint: disable=W0613
|
||||
|
@@ -1,146 +0,0 @@
|
||||
import numpy as np
|
||||
import tensorflow as tf
|
||||
from baselines.a2c.utils import conv, fc, conv_to_fc, batch_to_seq, seq_to_batch, lstm, lnlstm
|
||||
from baselines.common.distributions import make_pdtype
|
||||
from baselines.common.input import observation_input
|
||||
|
||||
def nature_cnn(unscaled_images, **conv_kwargs):
|
||||
"""
|
||||
CNN from Nature paper.
|
||||
"""
|
||||
scaled_images = tf.cast(unscaled_images, tf.float32) / 255.
|
||||
activ = tf.nn.relu
|
||||
h = activ(conv(scaled_images, 'c1', nf=32, rf=8, stride=4, init_scale=np.sqrt(2),
|
||||
**conv_kwargs))
|
||||
h2 = activ(conv(h, 'c2', nf=64, rf=4, stride=2, init_scale=np.sqrt(2), **conv_kwargs))
|
||||
h3 = activ(conv(h2, 'c3', nf=64, rf=3, stride=1, init_scale=np.sqrt(2), **conv_kwargs))
|
||||
h3 = conv_to_fc(h3)
|
||||
return activ(fc(h3, 'fc1', nh=512, init_scale=np.sqrt(2)))
|
||||
|
||||
class LnLstmPolicy(object):
|
||||
def __init__(self, sess, ob_space, ac_space, nbatch, nsteps, nlstm=256, reuse=False):
|
||||
nenv = nbatch // nsteps
|
||||
X, processed_x = observation_input(ob_space, nbatch)
|
||||
M = tf.placeholder(tf.float32, [nbatch]) #mask (done t-1)
|
||||
S = tf.placeholder(tf.float32, [nenv, nlstm*2]) #states
|
||||
self.pdtype = make_pdtype(ac_space)
|
||||
with tf.variable_scope("model", reuse=reuse):
|
||||
h = nature_cnn(processed_x)
|
||||
xs = batch_to_seq(h, nenv, nsteps)
|
||||
ms = batch_to_seq(M, nenv, nsteps)
|
||||
h5, snew = lnlstm(xs, ms, S, 'lstm1', nh=nlstm)
|
||||
h5 = seq_to_batch(h5)
|
||||
vf = fc(h5, 'v', 1)
|
||||
self.pd, self.pi = self.pdtype.pdfromlatent(h5)
|
||||
|
||||
v0 = vf[:, 0]
|
||||
a0 = self.pd.sample()
|
||||
neglogp0 = self.pd.neglogp(a0)
|
||||
self.initial_state = np.zeros((nenv, nlstm*2), dtype=np.float32)
|
||||
|
||||
def step(ob, state, mask):
|
||||
return sess.run([a0, v0, snew, neglogp0], {X:ob, S:state, M:mask})
|
||||
|
||||
def value(ob, state, mask):
|
||||
return sess.run(v0, {X:ob, S:state, M:mask})
|
||||
|
||||
self.X = X
|
||||
self.M = M
|
||||
self.S = S
|
||||
self.vf = vf
|
||||
self.step = step
|
||||
self.value = value
|
||||
|
||||
class LstmPolicy(object):
|
||||
|
||||
def __init__(self, sess, ob_space, ac_space, nbatch, nsteps, nlstm=256, reuse=False):
|
||||
nenv = nbatch // nsteps
|
||||
self.pdtype = make_pdtype(ac_space)
|
||||
X, processed_x = observation_input(ob_space, nbatch)
|
||||
|
||||
M = tf.placeholder(tf.float32, [nbatch]) #mask (done t-1)
|
||||
S = tf.placeholder(tf.float32, [nenv, nlstm*2]) #states
|
||||
with tf.variable_scope("model", reuse=reuse):
|
||||
h = nature_cnn(X)
|
||||
xs = batch_to_seq(h, nenv, nsteps)
|
||||
ms = batch_to_seq(M, nenv, nsteps)
|
||||
h5, snew = lstm(xs, ms, S, 'lstm1', nh=nlstm)
|
||||
h5 = seq_to_batch(h5)
|
||||
vf = fc(h5, 'v', 1)
|
||||
self.pd, self.pi = self.pdtype.pdfromlatent(h5)
|
||||
|
||||
v0 = vf[:, 0]
|
||||
a0 = self.pd.sample()
|
||||
neglogp0 = self.pd.neglogp(a0)
|
||||
self.initial_state = np.zeros((nenv, nlstm*2), dtype=np.float32)
|
||||
|
||||
def step(ob, state, mask):
|
||||
return sess.run([a0, v0, snew, neglogp0], {X:ob, S:state, M:mask})
|
||||
|
||||
def value(ob, state, mask):
|
||||
return sess.run(v0, {X:ob, S:state, M:mask})
|
||||
|
||||
self.X = X
|
||||
self.M = M
|
||||
self.S = S
|
||||
self.vf = vf
|
||||
self.step = step
|
||||
self.value = value
|
||||
|
||||
class CnnPolicy(object):
|
||||
|
||||
def __init__(self, sess, ob_space, ac_space, nbatch, nsteps, reuse=False, **conv_kwargs): #pylint: disable=W0613
|
||||
self.pdtype = make_pdtype(ac_space)
|
||||
X, processed_x = observation_input(ob_space, nbatch)
|
||||
with tf.variable_scope("model", reuse=reuse):
|
||||
h = nature_cnn(processed_x, **conv_kwargs)
|
||||
vf = fc(h, 'v', 1)[:,0]
|
||||
self.pd, self.pi = self.pdtype.pdfromlatent(h, init_scale=0.01)
|
||||
|
||||
a0 = self.pd.sample()
|
||||
neglogp0 = self.pd.neglogp(a0)
|
||||
self.initial_state = None
|
||||
|
||||
def step(ob, *_args, **_kwargs):
|
||||
a, v, neglogp = sess.run([a0, vf, neglogp0], {X:ob})
|
||||
return a, v, self.initial_state, neglogp
|
||||
|
||||
def value(ob, *_args, **_kwargs):
|
||||
return sess.run(vf, {X:ob})
|
||||
|
||||
self.X = X
|
||||
self.vf = vf
|
||||
self.step = step
|
||||
self.value = value
|
||||
|
||||
class MlpPolicy(object):
|
||||
def __init__(self, sess, ob_space, ac_space, nbatch, nsteps, reuse=False): #pylint: disable=W0613
|
||||
self.pdtype = make_pdtype(ac_space)
|
||||
with tf.variable_scope("model", reuse=reuse):
|
||||
X, processed_x = observation_input(ob_space, nbatch)
|
||||
activ = tf.tanh
|
||||
processed_x = tf.layers.flatten(processed_x)
|
||||
pi_h1 = activ(fc(processed_x, 'pi_fc1', nh=64, init_scale=np.sqrt(2)))
|
||||
pi_h2 = activ(fc(pi_h1, 'pi_fc2', nh=64, init_scale=np.sqrt(2)))
|
||||
vf_h1 = activ(fc(processed_x, 'vf_fc1', nh=64, init_scale=np.sqrt(2)))
|
||||
vf_h2 = activ(fc(vf_h1, 'vf_fc2', nh=64, init_scale=np.sqrt(2)))
|
||||
vf = fc(vf_h2, 'vf', 1)[:,0]
|
||||
|
||||
self.pd, self.pi = self.pdtype.pdfromlatent(pi_h2, init_scale=0.01)
|
||||
|
||||
|
||||
a0 = self.pd.sample()
|
||||
neglogp0 = self.pd.neglogp(a0)
|
||||
self.initial_state = None
|
||||
|
||||
def step(ob, *_args, **_kwargs):
|
||||
a, v, neglogp = sess.run([a0, vf, neglogp0], {X:ob})
|
||||
return a, v, self.initial_state, neglogp
|
||||
|
||||
def value(ob, *_args, **_kwargs):
|
||||
return sess.run(vf, {X:ob})
|
||||
|
||||
self.X = X
|
||||
self.vf = vf
|
||||
self.step = step
|
||||
self.value = value
|
@@ -6,16 +6,24 @@ import os.path as osp
|
||||
import tensorflow as tf
|
||||
from baselines import logger
|
||||
from collections import deque
|
||||
from baselines.common import explained_variance
|
||||
from baselines.common import explained_variance, set_global_seeds
|
||||
from baselines.common.policies import build_policy
|
||||
from baselines.common.runners import AbstractEnvRunner
|
||||
from baselines.common.tf_util import get_session
|
||||
from baselines.common.mpi_adam_optimizer import MpiAdamOptimizer
|
||||
|
||||
from mpi4py import MPI
|
||||
from baselines.common.tf_util import initialize
|
||||
from baselines.common.mpi_util import sync_from_root
|
||||
|
||||
class Model(object):
|
||||
def __init__(self, *, policy, ob_space, ac_space, nbatch_act, nbatch_train,
|
||||
nsteps, ent_coef, vf_coef, max_grad_norm):
|
||||
sess = tf.get_default_session()
|
||||
sess = get_session()
|
||||
|
||||
act_model = policy(sess, ob_space, ac_space, nbatch_act, 1, reuse=False)
|
||||
train_model = policy(sess, ob_space, ac_space, nbatch_train, nsteps, reuse=True)
|
||||
with tf.variable_scope('ppo2_model', reuse=tf.AUTO_REUSE):
|
||||
act_model = policy(nbatch_act, 1, sess)
|
||||
train_model = policy(nbatch_train, nsteps, sess)
|
||||
|
||||
A = train_model.pdtype.sample_placeholder([None])
|
||||
ADV = tf.placeholder(tf.float32, [None])
|
||||
@@ -40,14 +48,16 @@ class Model(object):
|
||||
approxkl = .5 * tf.reduce_mean(tf.square(neglogpac - OLDNEGLOGPAC))
|
||||
clipfrac = tf.reduce_mean(tf.to_float(tf.greater(tf.abs(ratio - 1.0), CLIPRANGE)))
|
||||
loss = pg_loss - entropy * ent_coef + vf_loss * vf_coef
|
||||
with tf.variable_scope('model'):
|
||||
params = tf.trainable_variables()
|
||||
grads = tf.gradients(loss, params)
|
||||
params = tf.trainable_variables('ppo2_model')
|
||||
trainer = MpiAdamOptimizer(MPI.COMM_WORLD, learning_rate=LR, epsilon=1e-5)
|
||||
grads_and_var = trainer.compute_gradients(loss, params)
|
||||
grads, var = zip(*grads_and_var)
|
||||
|
||||
if max_grad_norm is not None:
|
||||
grads, _grad_norm = tf.clip_by_global_norm(grads, max_grad_norm)
|
||||
grads = list(zip(grads, params))
|
||||
trainer = tf.train.AdamOptimizer(learning_rate=LR, epsilon=1e-5)
|
||||
_train = trainer.apply_gradients(grads)
|
||||
grads_and_var = list(zip(grads, var))
|
||||
|
||||
_train = trainer.apply_gradients(grads_and_var)
|
||||
|
||||
def train(lr, cliprange, obs, returns, masks, actions, values, neglogpacs, states=None):
|
||||
advs = returns - values
|
||||
@@ -83,7 +93,11 @@ class Model(object):
|
||||
self.initial_state = act_model.initial_state
|
||||
self.save = save
|
||||
self.load = load
|
||||
tf.global_variables_initializer().run(session=sess) #pylint: disable=E1101
|
||||
|
||||
if MPI.COMM_WORLD.Get_rank() == 0:
|
||||
initialize()
|
||||
global_variables = tf.get_collection(tf.GraphKeys.GLOBAL_VARIABLES, scope="")
|
||||
sync_from_root(sess, global_variables) #pylint: disable=E1101
|
||||
|
||||
class Runner(AbstractEnvRunner):
|
||||
|
||||
@@ -97,7 +111,7 @@ class Runner(AbstractEnvRunner):
|
||||
mb_states = self.states
|
||||
epinfos = []
|
||||
for _ in range(self.nsteps):
|
||||
actions, values, self.states, neglogpacs = self.model.step(self.obs, self.states, self.dones)
|
||||
actions, values, self.states, neglogpacs = self.model.step(self.obs, S=self.states, M=self.dones)
|
||||
mb_obs.append(self.obs.copy())
|
||||
mb_actions.append(actions)
|
||||
mb_values.append(values)
|
||||
@@ -115,7 +129,7 @@ class Runner(AbstractEnvRunner):
|
||||
mb_values = np.asarray(mb_values, dtype=np.float32)
|
||||
mb_neglogpacs = np.asarray(mb_neglogpacs, dtype=np.float32)
|
||||
mb_dones = np.asarray(mb_dones, dtype=np.bool)
|
||||
last_values = self.model.value(self.obs, self.states, self.dones)
|
||||
last_values = self.model.value(self.obs, S=self.states, M=self.dones)
|
||||
#discount/bootstrap off value fn
|
||||
mb_returns = np.zeros_like(mb_rewards)
|
||||
mb_advs = np.zeros_like(mb_rewards)
|
||||
@@ -145,10 +159,65 @@ def constfn(val):
|
||||
return val
|
||||
return f
|
||||
|
||||
def learn(*, policy, env, nsteps, total_timesteps, ent_coef, lr,
|
||||
def learn(*, network, env, total_timesteps, seed=None, nsteps=2048, ent_coef=0.0, lr=3e-4,
|
||||
vf_coef=0.5, max_grad_norm=0.5, gamma=0.99, lam=0.95,
|
||||
log_interval=10, nminibatches=4, noptepochs=4, cliprange=0.2,
|
||||
save_interval=0, load_path=None):
|
||||
save_interval=0, load_path=None, **network_kwargs):
|
||||
'''
|
||||
Learn policy using PPO algorithm (https://arxiv.org/abs/1707.06347)
|
||||
|
||||
Parameters:
|
||||
----------
|
||||
|
||||
network: policy network architecture. Either string (mlp, lstm, lnlstm, cnn_lstm, cnn, cnn_small, conv_only - see baselines.common/models.py for full list)
|
||||
specifying the standard network architecture, or a function that takes tensorflow tensor as input and returns
|
||||
tuple (output_tensor, extra_feed) where output tensor is the last network layer output, extra_feed is None for feed-forward
|
||||
neural nets, and extra_feed is a dictionary describing how to feed state into the network for recurrent neural nets.
|
||||
See baselines.common/policies.py/lstm for more details on using recurrent nets in policies
|
||||
|
||||
env: baselines.common.vec_env.VecEnv environment. Needs to be vectorized for parallel environment simulation.
|
||||
The environments produced by gym.make can be wrapped using baselines.common.vec_env.DummyVecEnv class.
|
||||
|
||||
|
||||
nsteps: int number of steps of the vectorized environment per update (i.e. batch size is nsteps * nenv where
|
||||
nenv is number of environment copies simulated in parallel)
|
||||
|
||||
total_timesteps: int number of timesteps (i.e. number of actions taken in the environment)
|
||||
|
||||
ent_coef: float policy entropy coefficient in the optimization objective
|
||||
|
||||
lr: float or function learning rate, constant or a schedule function [0,1] -> R+ where 1 is beginning of the
|
||||
training and 0 is the end of the training.
|
||||
|
||||
vf_coef: float value function loss coefficient in the optimization objective
|
||||
|
||||
max_grad_norm: float or None gradient norm clipping coefficient
|
||||
|
||||
gamma: float discounting factor
|
||||
|
||||
lam: float advantage estimation discounting factor (lambda in the paper)
|
||||
|
||||
log_interval: int number of timesteps between logging events
|
||||
|
||||
nminibatches: int number of training minibatches per update
|
||||
|
||||
noptepochs: int number of training epochs per update
|
||||
|
||||
cliprange: float or function clipping range, constant or schedule function [0,1] -> R+ where 1 is beginning of the training
|
||||
and 0 is the end of the training
|
||||
|
||||
save_interval: int number of timesteps between saving events
|
||||
|
||||
load_path: str path to load the model from
|
||||
|
||||
**network_kwargs: keyword arguments to the policy / network builder. See baselines.common/policies.py/build_policy and arguments to a particular type of network
|
||||
For instance, 'mlp' network architecture has arguments num_hidden and num_layers.
|
||||
|
||||
|
||||
|
||||
'''
|
||||
|
||||
set_global_seeds(seed)
|
||||
|
||||
if isinstance(lr, float): lr = constfn(lr)
|
||||
else: assert callable(lr)
|
||||
@@ -156,6 +225,8 @@ def learn(*, policy, env, nsteps, total_timesteps, ent_coef, lr,
|
||||
else: assert callable(cliprange)
|
||||
total_timesteps = int(total_timesteps)
|
||||
|
||||
policy = build_policy(env, network, **network_kwargs)
|
||||
|
||||
nenvs = env.num_envs
|
||||
ob_space = env.observation_space
|
||||
ac_space = env.action_space
|
||||
@@ -180,7 +251,6 @@ def learn(*, policy, env, nsteps, total_timesteps, ent_coef, lr,
|
||||
nupdates = total_timesteps//nbatch
|
||||
for update in range(1, nupdates+1):
|
||||
assert nbatch % nminibatches == 0
|
||||
nbatch_train = nbatch // nminibatches
|
||||
tstart = time.time()
|
||||
frac = 1.0 - (update - 1.0) / nupdates
|
||||
lrnow = lr(frac)
|
||||
@@ -228,8 +298,9 @@ def learn(*, policy, env, nsteps, total_timesteps, ent_coef, lr,
|
||||
logger.logkv('time_elapsed', tnow - tfirststart)
|
||||
for (lossval, lossname) in zip(lossvals, model.loss_names):
|
||||
logger.logkv(lossname, lossval)
|
||||
logger.dumpkvs()
|
||||
if save_interval and (update % save_interval == 0 or update == 1) and logger.get_dir():
|
||||
if MPI.COMM_WORLD.Get_rank() == 0:
|
||||
logger.dumpkvs()
|
||||
if save_interval and (update % save_interval == 0 or update == 1) and logger.get_dir() and MPI.COMM_WORLD.Get_rank() == 0:
|
||||
checkdir = osp.join(logger.get_dir(), 'checkpoints')
|
||||
os.makedirs(checkdir, exist_ok=True)
|
||||
savepath = osp.join(checkdir, '%.5i'%update)
|
||||
@@ -240,3 +311,6 @@ def learn(*, policy, env, nsteps, total_timesteps, ent_coef, lr,
|
||||
|
||||
def safemean(xs):
|
||||
return np.nan if len(xs) == 0 else np.mean(xs)
|
||||
|
||||
|
||||
|
||||
|
@@ -1,40 +0,0 @@
|
||||
#!/usr/bin/env python3
|
||||
import sys
|
||||
from baselines import logger
|
||||
from baselines.common.cmd_util import make_atari_env, atari_arg_parser
|
||||
from baselines.common.vec_env.vec_frame_stack import VecFrameStack
|
||||
from baselines.ppo2 import ppo2
|
||||
from baselines.ppo2.policies import CnnPolicy, LstmPolicy, LnLstmPolicy, MlpPolicy
|
||||
import multiprocessing
|
||||
import tensorflow as tf
|
||||
|
||||
|
||||
def train(env_id, num_timesteps, seed, policy):
|
||||
|
||||
ncpu = multiprocessing.cpu_count()
|
||||
if sys.platform == 'darwin': ncpu //= 2
|
||||
config = tf.ConfigProto(allow_soft_placement=True,
|
||||
intra_op_parallelism_threads=ncpu,
|
||||
inter_op_parallelism_threads=ncpu)
|
||||
config.gpu_options.allow_growth = True #pylint: disable=E1101
|
||||
tf.Session(config=config).__enter__()
|
||||
|
||||
env = VecFrameStack(make_atari_env(env_id, 8, seed), 4)
|
||||
policy = {'cnn' : CnnPolicy, 'lstm' : LstmPolicy, 'lnlstm' : LnLstmPolicy, 'mlp': MlpPolicy}[policy]
|
||||
ppo2.learn(policy=policy, env=env, nsteps=128, nminibatches=4,
|
||||
lam=0.95, gamma=0.99, noptepochs=4, log_interval=1,
|
||||
ent_coef=.01,
|
||||
lr=lambda f : f * 2.5e-4,
|
||||
cliprange=lambda f : f * 0.1,
|
||||
total_timesteps=int(num_timesteps * 1.1))
|
||||
|
||||
def main():
|
||||
parser = atari_arg_parser()
|
||||
parser.add_argument('--policy', help='Policy architecture', choices=['cnn', 'lstm', 'lnlstm', 'mlp'], default='cnn')
|
||||
args = parser.parse_args()
|
||||
logger.configure()
|
||||
train(args.env, num_timesteps=args.num_timesteps, seed=args.seed,
|
||||
policy=args.policy)
|
||||
|
||||
if __name__ == '__main__':
|
||||
main()
|
@@ -1,57 +0,0 @@
|
||||
#!/usr/bin/env python3
|
||||
import numpy as np
|
||||
from baselines.common.cmd_util import mujoco_arg_parser
|
||||
from baselines import bench, logger
|
||||
|
||||
|
||||
def train(env_id, num_timesteps, seed):
|
||||
from baselines.common import set_global_seeds
|
||||
from baselines.common.vec_env.vec_normalize import VecNormalize
|
||||
from baselines.ppo2 import ppo2
|
||||
from baselines.ppo2.policies import MlpPolicy
|
||||
import gym
|
||||
import tensorflow as tf
|
||||
from baselines.common.vec_env.dummy_vec_env import DummyVecEnv
|
||||
ncpu = 1
|
||||
config = tf.ConfigProto(allow_soft_placement=True,
|
||||
intra_op_parallelism_threads=ncpu,
|
||||
inter_op_parallelism_threads=ncpu)
|
||||
tf.Session(config=config).__enter__()
|
||||
|
||||
def make_env():
|
||||
env = gym.make(env_id)
|
||||
env = bench.Monitor(env, logger.get_dir(), allow_early_resets=True)
|
||||
return env
|
||||
|
||||
env = DummyVecEnv([make_env])
|
||||
env = VecNormalize(env)
|
||||
|
||||
set_global_seeds(seed)
|
||||
policy = MlpPolicy
|
||||
model = ppo2.learn(policy=policy, env=env, nsteps=2048, nminibatches=32,
|
||||
lam=0.95, gamma=0.99, noptepochs=10, log_interval=1,
|
||||
ent_coef=0.0,
|
||||
lr=3e-4,
|
||||
cliprange=0.2,
|
||||
total_timesteps=num_timesteps)
|
||||
|
||||
return model, env
|
||||
|
||||
|
||||
def main():
|
||||
args = mujoco_arg_parser().parse_args()
|
||||
logger.configure()
|
||||
model, env = train(args.env, num_timesteps=args.num_timesteps, seed=args.seed)
|
||||
|
||||
if args.play:
|
||||
logger.log("Running trained model")
|
||||
obs = np.zeros((env.num_envs,) + env.observation_space.shape)
|
||||
obs[:] = env.reset()
|
||||
while True:
|
||||
actions = model.step(obs)[0]
|
||||
obs[:] = env.step(actions)[0]
|
||||
env.render()
|
||||
|
||||
|
||||
if __name__ == '__main__':
|
||||
main()
|
@@ -1,56 +0,0 @@
|
||||
import baselines.common.tf_util as U
|
||||
import tensorflow as tf
|
||||
import gym
|
||||
from baselines.common.distributions import make_pdtype
|
||||
|
||||
class CnnPolicy(object):
|
||||
recurrent = False
|
||||
def __init__(self, name, ob_space, ac_space):
|
||||
with tf.variable_scope(name):
|
||||
self._init(ob_space, ac_space)
|
||||
self.scope = tf.get_variable_scope().name
|
||||
|
||||
def _init(self, ob_space, ac_space):
|
||||
assert isinstance(ob_space, gym.spaces.Box)
|
||||
|
||||
self.pdtype = pdtype = make_pdtype(ac_space)
|
||||
sequence_length = None
|
||||
|
||||
ob = U.get_placeholder(name="ob", dtype=tf.float32, shape=[sequence_length] + list(ob_space.shape))
|
||||
|
||||
obscaled = ob / 255.0
|
||||
|
||||
with tf.variable_scope("pol"):
|
||||
x = obscaled
|
||||
x = tf.nn.relu(U.conv2d(x, 8, "l1", [8, 8], [4, 4], pad="VALID"))
|
||||
x = tf.nn.relu(U.conv2d(x, 16, "l2", [4, 4], [2, 2], pad="VALID"))
|
||||
x = U.flattenallbut0(x)
|
||||
x = tf.nn.relu(tf.layers.dense(x, 128, name='lin', kernel_initializer=U.normc_initializer(1.0)))
|
||||
logits = tf.layers.dense(x, pdtype.param_shape()[0], name='logits', kernel_initializer=U.normc_initializer(0.01))
|
||||
self.pd = pdtype.pdfromflat(logits)
|
||||
with tf.variable_scope("vf"):
|
||||
x = obscaled
|
||||
x = tf.nn.relu(U.conv2d(x, 8, "l1", [8, 8], [4, 4], pad="VALID"))
|
||||
x = tf.nn.relu(U.conv2d(x, 16, "l2", [4, 4], [2, 2], pad="VALID"))
|
||||
x = U.flattenallbut0(x)
|
||||
x = tf.nn.relu(tf.layers.dense(x, 128, name='lin', kernel_initializer=U.normc_initializer(1.0)))
|
||||
self.vpred = tf.layers.dense(x, 1, name='value', kernel_initializer=U.normc_initializer(1.0))
|
||||
self.vpredz = self.vpred
|
||||
|
||||
self.state_in = []
|
||||
self.state_out = []
|
||||
|
||||
stochastic = tf.placeholder(dtype=tf.bool, shape=())
|
||||
ac = self.pd.sample()
|
||||
self._act = U.function([stochastic, ob], [ac, self.vpred])
|
||||
|
||||
def act(self, stochastic, ob):
|
||||
ac1, vpred1 = self._act(stochastic, ob[None])
|
||||
return ac1[0], vpred1[0]
|
||||
def get_variables(self):
|
||||
return tf.get_collection(tf.GraphKeys.GLOBAL_VARIABLES, self.scope)
|
||||
def get_trainable_variables(self):
|
||||
return tf.get_collection(tf.GraphKeys.TRAINABLE_VARIABLES, self.scope)
|
||||
def get_initial_state(self):
|
||||
return []
|
||||
|
@@ -1,43 +0,0 @@
|
||||
#!/usr/bin/env python3
|
||||
from mpi4py import MPI
|
||||
from baselines.common import set_global_seeds
|
||||
import os.path as osp
|
||||
import gym, logging
|
||||
from baselines import logger
|
||||
from baselines import bench
|
||||
from baselines.common.atari_wrappers import make_atari, wrap_deepmind
|
||||
from baselines.common.cmd_util import atari_arg_parser
|
||||
|
||||
def train(env_id, num_timesteps, seed):
|
||||
from baselines.trpo_mpi.nosharing_cnn_policy import CnnPolicy
|
||||
from baselines.trpo_mpi import trpo_mpi
|
||||
import baselines.common.tf_util as U
|
||||
rank = MPI.COMM_WORLD.Get_rank()
|
||||
sess = U.single_threaded_session()
|
||||
sess.__enter__()
|
||||
if rank == 0:
|
||||
logger.configure()
|
||||
else:
|
||||
logger.configure(format_strs=[])
|
||||
|
||||
workerseed = seed + 10000 * MPI.COMM_WORLD.Get_rank()
|
||||
set_global_seeds(workerseed)
|
||||
env = make_atari(env_id)
|
||||
def policy_fn(name, ob_space, ac_space): #pylint: disable=W0613
|
||||
return CnnPolicy(name=name, ob_space=env.observation_space, ac_space=env.action_space)
|
||||
env = bench.Monitor(env, logger.get_dir() and osp.join(logger.get_dir(), str(rank)))
|
||||
env.seed(workerseed)
|
||||
|
||||
env = wrap_deepmind(env)
|
||||
env.seed(workerseed)
|
||||
|
||||
trpo_mpi.learn(env, policy_fn, timesteps_per_batch=512, max_kl=0.001, cg_iters=10, cg_damping=1e-3,
|
||||
max_timesteps=int(num_timesteps * 1.1), gamma=0.98, lam=1.0, vf_iters=3, vf_stepsize=1e-4, entcoeff=0.00)
|
||||
env.close()
|
||||
|
||||
def main():
|
||||
args = atari_arg_parser().parse_args()
|
||||
train(args.env, num_timesteps=args.num_timesteps, seed=args.seed)
|
||||
|
||||
if __name__ == "__main__":
|
||||
main()
|
@@ -1,36 +0,0 @@
|
||||
#!/usr/bin/env python3
|
||||
# noinspection PyUnresolvedReferences
|
||||
from mpi4py import MPI
|
||||
from baselines.common.cmd_util import make_mujoco_env, mujoco_arg_parser
|
||||
from baselines import logger
|
||||
from baselines.ppo1.mlp_policy import MlpPolicy
|
||||
from baselines.trpo_mpi import trpo_mpi
|
||||
|
||||
def train(env_id, num_timesteps, seed):
|
||||
import baselines.common.tf_util as U
|
||||
sess = U.single_threaded_session()
|
||||
sess.__enter__()
|
||||
|
||||
rank = MPI.COMM_WORLD.Get_rank()
|
||||
if rank == 0:
|
||||
logger.configure()
|
||||
else:
|
||||
logger.configure(format_strs=[])
|
||||
logger.set_level(logger.DISABLED)
|
||||
workerseed = seed + 10000 * MPI.COMM_WORLD.Get_rank()
|
||||
def policy_fn(name, ob_space, ac_space):
|
||||
return MlpPolicy(name=name, ob_space=ob_space, ac_space=ac_space,
|
||||
hid_size=32, num_hid_layers=2)
|
||||
env = make_mujoco_env(env_id, workerseed)
|
||||
trpo_mpi.learn(env, policy_fn, timesteps_per_batch=1024, max_kl=0.01, cg_iters=10, cg_damping=0.1,
|
||||
max_timesteps=num_timesteps, gamma=0.99, lam=0.98, vf_iters=5, vf_stepsize=1e-3)
|
||||
env.close()
|
||||
|
||||
def main():
|
||||
args = mujoco_arg_parser().parse_args()
|
||||
train(args.env, num_timesteps=args.num_timesteps, seed=args.seed)
|
||||
|
||||
|
||||
if __name__ == '__main__':
|
||||
main()
|
||||
|
@@ -6,8 +6,11 @@ import time
|
||||
from baselines.common import colorize
|
||||
from mpi4py import MPI
|
||||
from collections import deque
|
||||
from baselines.common import set_global_seeds
|
||||
from baselines.common.mpi_adam import MpiAdam
|
||||
from baselines.common.cg import cg
|
||||
from baselines.common.input import observation_placeholder
|
||||
from baselines.common.policies import build_policy
|
||||
from contextlib import contextmanager
|
||||
|
||||
def traj_segment_generator(pi, env, horizon, stochastic):
|
||||
@@ -33,7 +36,7 @@ def traj_segment_generator(pi, env, horizon, stochastic):
|
||||
|
||||
while True:
|
||||
prevac = ac
|
||||
ac, vpred = pi.act(stochastic, ob)
|
||||
ac, vpred, _, _ = pi.step(ob, stochastic=stochastic)
|
||||
# Slight weirdness here because we need value function at time T
|
||||
# before returning segment [0, T-1] so we get the correct
|
||||
# terminal value
|
||||
@@ -41,7 +44,7 @@ def traj_segment_generator(pi, env, horizon, stochastic):
|
||||
yield {"ob" : obs, "rew" : rews, "vpred" : vpreds, "new" : news,
|
||||
"ac" : acs, "prevac" : prevacs, "nextvpred": vpred * (1 - new),
|
||||
"ep_rets" : ep_rets, "ep_lens" : ep_lens}
|
||||
_, vpred = pi.act(stochastic, ob)
|
||||
_, vpred, _, _ = pi.step(ob, stochastic=stochastic)
|
||||
# Be careful!!! if you change the downstream algorithm to aggregate
|
||||
# several of these batches, then be sure to do a deepcopy
|
||||
ep_rets = []
|
||||
@@ -79,30 +82,95 @@ def add_vtarg_and_adv(seg, gamma, lam):
|
||||
gaelam[t] = lastgaelam = delta + gamma * lam * nonterminal * lastgaelam
|
||||
seg["tdlamret"] = seg["adv"] + seg["vpred"]
|
||||
|
||||
def learn(env, policy_fn, *,
|
||||
timesteps_per_batch, # what to train on
|
||||
max_kl, cg_iters,
|
||||
gamma, lam, # advantage estimation
|
||||
def learn(*,
|
||||
network,
|
||||
env,
|
||||
total_timesteps,
|
||||
timesteps_per_batch=1024, # what to train on
|
||||
max_kl=0.001,
|
||||
cg_iters=10,
|
||||
gamma=0.99,
|
||||
lam=1.0, # advantage estimation
|
||||
seed=None,
|
||||
entcoeff=0.0,
|
||||
cg_damping=1e-2,
|
||||
vf_stepsize=3e-4,
|
||||
vf_iters =3,
|
||||
max_timesteps=0, max_episodes=0, max_iters=0, # time constraint
|
||||
callback=None
|
||||
max_episodes=0, max_iters=0, # time constraint
|
||||
callback=None,
|
||||
**network_kwargs
|
||||
):
|
||||
'''
|
||||
learn a policy function with TRPO algorithm
|
||||
|
||||
Parameters:
|
||||
----------
|
||||
|
||||
network neural network to learn. Can be either string ('mlp', 'cnn', 'lstm', 'lnlstm' for basic types)
|
||||
or function that takes input placeholder and returns tuple (output, None) for feedforward nets
|
||||
or (output, (state_placeholder, state_output, mask_placeholder)) for recurrent nets
|
||||
|
||||
env environment (one of the gym environments or wrapped via baselines.common.vec_env.VecEnv-type class
|
||||
|
||||
timesteps_per_batch timesteps per gradient estimation batch
|
||||
|
||||
max_kl max KL divergence between old policy and new policy ( KL(pi_old || pi) )
|
||||
|
||||
entcoeff coefficient of policy entropy term in the optimization objective
|
||||
|
||||
cg_iters number of iterations of conjugate gradient algorithm
|
||||
|
||||
cg_damping conjugate gradient damping
|
||||
|
||||
vf_stepsize learning rate for adam optimizer used to optimie value function loss
|
||||
|
||||
vf_iters number of iterations of value function optimization iterations per each policy optimization step
|
||||
|
||||
total_timesteps max number of timesteps
|
||||
|
||||
max_episodes max number of episodes
|
||||
|
||||
max_iters maximum number of policy optimization iterations
|
||||
|
||||
callback function to be called with (locals(), globals()) each policy optimization step
|
||||
|
||||
Returns:
|
||||
-------
|
||||
|
||||
learnt model
|
||||
|
||||
'''
|
||||
|
||||
|
||||
nworkers = MPI.COMM_WORLD.Get_size()
|
||||
rank = MPI.COMM_WORLD.Get_rank()
|
||||
|
||||
cpus_per_worker = 1
|
||||
U.get_session(config=tf.ConfigProto(
|
||||
allow_soft_placement=True,
|
||||
inter_op_parallelism_threads=cpus_per_worker,
|
||||
intra_op_parallelism_threads=cpus_per_worker
|
||||
))
|
||||
|
||||
|
||||
policy = build_policy(env, network, value_network='copy', **network_kwargs)
|
||||
set_global_seeds(seed)
|
||||
|
||||
np.set_printoptions(precision=3)
|
||||
# Setup losses and stuff
|
||||
# ----------------------------------------
|
||||
ob_space = env.observation_space
|
||||
ac_space = env.action_space
|
||||
pi = policy_fn("pi", ob_space, ac_space)
|
||||
oldpi = policy_fn("oldpi", ob_space, ac_space)
|
||||
|
||||
ob = observation_placeholder(ob_space)
|
||||
with tf.variable_scope("pi"):
|
||||
pi = policy(observ_placeholder=ob)
|
||||
with tf.variable_scope("oldpi"):
|
||||
oldpi = policy(observ_placeholder=ob)
|
||||
|
||||
atarg = tf.placeholder(dtype=tf.float32, shape=[None]) # Target advantage function (if applicable)
|
||||
ret = tf.placeholder(dtype=tf.float32, shape=[None]) # Empirical return
|
||||
|
||||
ob = U.get_placeholder_cached(name="ob")
|
||||
ac = pi.pdtype.sample_placeholder([None])
|
||||
|
||||
kloldnew = oldpi.pd.kl(pi.pd)
|
||||
@@ -111,7 +179,7 @@ def learn(env, policy_fn, *,
|
||||
meanent = tf.reduce_mean(ent)
|
||||
entbonus = entcoeff * meanent
|
||||
|
||||
vferr = tf.reduce_mean(tf.square(pi.vpred - ret))
|
||||
vferr = tf.reduce_mean(tf.square(pi.vf - ret))
|
||||
|
||||
ratio = tf.exp(pi.pd.logp(ac) - oldpi.pd.logp(ac)) # advantage * pnew / pold
|
||||
surrgain = tf.reduce_mean(ratio * atarg)
|
||||
@@ -122,9 +190,12 @@ def learn(env, policy_fn, *,
|
||||
|
||||
dist = meankl
|
||||
|
||||
all_var_list = pi.get_trainable_variables()
|
||||
var_list = [v for v in all_var_list if v.name.split("/")[1].startswith("pol")]
|
||||
vf_var_list = [v for v in all_var_list if v.name.split("/")[1].startswith("vf")]
|
||||
all_var_list = get_trainable_variables("pi")
|
||||
# var_list = [v for v in all_var_list if v.name.split("/")[1].startswith("pol")]
|
||||
# vf_var_list = [v for v in all_var_list if v.name.split("/")[1].startswith("vf")]
|
||||
var_list = get_pi_trainable_variables("pi")
|
||||
vf_var_list = get_vf_trainable_variables("pi")
|
||||
|
||||
vfadam = MpiAdam(vf_var_list)
|
||||
|
||||
get_flat = U.GetFlat(var_list)
|
||||
@@ -142,7 +213,8 @@ def learn(env, policy_fn, *,
|
||||
fvp = U.flatgrad(gvp, var_list)
|
||||
|
||||
assign_old_eq_new = U.function([],[], updates=[tf.assign(oldv, newv)
|
||||
for (oldv, newv) in zipsame(oldpi.get_variables(), pi.get_variables())])
|
||||
for (oldv, newv) in zipsame(get_variables("oldpi"), get_variables("pi"))])
|
||||
|
||||
compute_losses = U.function([ob, ac, atarg], losses)
|
||||
compute_lossandgrad = U.function([ob, ac, atarg], losses + [U.flatgrad(optimgain, var_list)])
|
||||
compute_fvp = U.function([flat_tangent, ob, ac, atarg], fvp)
|
||||
@@ -183,11 +255,11 @@ def learn(env, policy_fn, *,
|
||||
lenbuffer = deque(maxlen=40) # rolling buffer for episode lengths
|
||||
rewbuffer = deque(maxlen=40) # rolling buffer for episode rewards
|
||||
|
||||
assert sum([max_iters>0, max_timesteps>0, max_episodes>0])==1
|
||||
assert sum([max_iters>0, total_timesteps>0, max_episodes>0])==1
|
||||
|
||||
while True:
|
||||
if callback: callback(locals(), globals())
|
||||
if max_timesteps and timesteps_so_far >= max_timesteps:
|
||||
if total_timesteps and timesteps_so_far >= total_timesteps:
|
||||
break
|
||||
elif max_episodes and episodes_so_far >= max_episodes:
|
||||
break
|
||||
@@ -287,5 +359,20 @@ def learn(env, policy_fn, *,
|
||||
if rank==0:
|
||||
logger.dump_tabular()
|
||||
|
||||
return pi
|
||||
|
||||
def flatten_lists(listoflists):
|
||||
return [el for list_ in listoflists for el in list_]
|
||||
|
||||
def get_variables(scope):
|
||||
return tf.get_collection(tf.GraphKeys.GLOBAL_VARIABLES, scope)
|
||||
|
||||
def get_trainable_variables(scope):
|
||||
return tf.get_collection(tf.GraphKeys.TRAINABLE_VARIABLES, scope)
|
||||
|
||||
def get_vf_trainable_variables(scope):
|
||||
return [v for v in get_trainable_variables(scope) if 'vf' in v.name[len(scope):].split('/')]
|
||||
|
||||
def get_pi_trainable_variables(scope):
|
||||
return [v for v in get_trainable_variables(scope) if 'pi' in v.name[len(scope):].split('/')]
|
||||
|
||||
|
7
setup.py
7
setup.py
@@ -14,7 +14,6 @@ setup(name='baselines',
|
||||
'scipy',
|
||||
'tqdm',
|
||||
'joblib',
|
||||
'zmq',
|
||||
'dill',
|
||||
'progressbar2',
|
||||
'mpi4py',
|
||||
@@ -23,6 +22,12 @@ setup(name='baselines',
|
||||
'click',
|
||||
'opencv-python'
|
||||
],
|
||||
extras_require={
|
||||
'test': [
|
||||
'filelock',
|
||||
'pytest'
|
||||
]
|
||||
},
|
||||
description='OpenAI baselines: high quality implementations of reinforcement learning algorithms',
|
||||
author='OpenAI',
|
||||
url='https://github.com/openai/baselines',
|
||||
|
Reference in New Issue
Block a user