Compare commits
8 Commits
peterz_ale
...
peterz_imp
Author | SHA1 | Date | |
---|---|---|---|
|
d1021f5885 | ||
|
6fd15ec92d | ||
|
fab274b9af | ||
|
0392dda802 | ||
|
4dc709faae | ||
|
ea55240732 | ||
|
3d7ed16f1f | ||
|
efb071949e |
@@ -1 +0,0 @@
|
||||
|
2
.gitignore
vendored
2
.gitignore
vendored
@@ -34,3 +34,5 @@ src
|
||||
.cache
|
||||
|
||||
MUJOCO_LOG.TXT
|
||||
|
||||
|
||||
|
@@ -10,5 +10,5 @@ install:
|
||||
- docker build . -t baselines-test
|
||||
|
||||
script:
|
||||
- flake8 --select=F,E999 baselines/common baselines/trpo_mpi baselines/ppo2 baselines/a2c baselines/deepq baselines/acer
|
||||
- docker run baselines-test pytest --runslow
|
||||
- flake8 --select=F baselines/common
|
||||
- docker run baselines-test pytest
|
||||
|
16
Dockerfile
16
Dockerfile
@@ -1,24 +1,20 @@
|
||||
FROM ubuntu:16.04
|
||||
|
||||
RUN apt-get -y update && apt-get -y install git wget python-dev python3-dev libopenmpi-dev python-pip zlib1g-dev cmake python-opencv
|
||||
RUN apt-get -y update && apt-get -y install git wget python-dev python3-dev libopenmpi-dev python-pip zlib1g-dev cmake
|
||||
ENV CODE_DIR /root/code
|
||||
ENV VENV /root/venv
|
||||
|
||||
COPY . $CODE_DIR/baselines
|
||||
RUN \
|
||||
pip install virtualenv && \
|
||||
virtualenv $VENV --python=python3 && \
|
||||
. $VENV/bin/activate && \
|
||||
pip install --upgrade pip
|
||||
cd $CODE_DIR && \
|
||||
pip install --upgrade pip && \
|
||||
pip install -e baselines && \
|
||||
pip install pytest
|
||||
|
||||
ENV PATH=$VENV/bin:$PATH
|
||||
|
||||
COPY . $CODE_DIR/baselines
|
||||
WORKDIR $CODE_DIR/baselines
|
||||
|
||||
# Clean up pycache and pyc files
|
||||
RUN rm -rf __pycache__ && \
|
||||
find . -name "*.pyc" -delete && \
|
||||
pip install -e .[test]
|
||||
|
||||
|
||||
CMD /bin/bash
|
||||
|
64
README.md
64
README.md
@@ -62,56 +62,6 @@ pip install pytest
|
||||
pytest
|
||||
```
|
||||
|
||||
## Subpackages
|
||||
|
||||
## Testing the installation
|
||||
All unit tests in baselines can be run using pytest runner:
|
||||
```
|
||||
pip install pytest
|
||||
pytest
|
||||
```
|
||||
|
||||
## Training models
|
||||
Most of the algorithms in baselines repo are used as follows:
|
||||
```bash
|
||||
python -m baselines.run --alg=<name of the algorithm> --env=<environment_id> [additional arguments]
|
||||
```
|
||||
### Example 1. PPO with MuJoCo Humanoid
|
||||
For instance, to train a fully-connected network controlling MuJoCo humanoid using a2c for 20M timesteps
|
||||
```bash
|
||||
python -m baselines.run --alg=a2c --env=Humanoid-v2 --network=mlp --num_timesteps=2e7
|
||||
```
|
||||
Note that for mujoco environments fully-connected network is default, so we can omit `--network=mlp`
|
||||
The hyperparameters for both network and the learning algorithm can be controlled via the command line, for instance:
|
||||
```bash
|
||||
python -m baselines.run --alg=a2c --env=Humanoid-v2 --network=mlp --num_timesteps=2e7 --ent_coef=0.1 --num_hidden=32 --num_layers=3 --value_network=copy
|
||||
```
|
||||
will set entropy coeffient to 0.1, and construct fully connected network with 3 layers with 32 hidden units in each, and create a separate network for value function estimation (so that its parameters are not shared with the policy network, but the structure is the same)
|
||||
|
||||
See docstrings in [common/models.py](common/models.py) for description of network parameters for each type of model, and
|
||||
docstring for [baselines/ppo2/ppo2.py/learn()](ppo2/ppo2.py) fir the description of the ppo2 hyperparamters.
|
||||
|
||||
### Example 2. DQN on Atari
|
||||
DQN with Atari is at this point a classics of benchmarks. To run the baselines implementation of DQN on Atari Pong:
|
||||
```
|
||||
python -m baselines.run --alg=deepq --env=PongNoFrameskip-v4 --num_timesteps=1e6
|
||||
```
|
||||
|
||||
## Saving, loading and visualizing models
|
||||
The algorithms serialization API is not properly unified yet; however, there is a simple method to save / restore trained models.
|
||||
`--save_path` and `--load_path` command-line option loads the tensorflow state from a given path before training, and saves it after the training, respectively.
|
||||
Let's imagine you'd like to train ppo2 on Atari Pong, save the model and then later visualize what has it learnt.
|
||||
```bash
|
||||
python -m baselines.run --alg=ppo2 --env=PongNoFrameskip-v4 --num-timesteps=2e7 --save_path=~/models/pong_20M_ppo2
|
||||
```
|
||||
This should get to the mean reward per episode about 5k. To load and visualize the model, we'll do the following - load the model, train it for 0 steps, and then visualize:
|
||||
```bash
|
||||
python -m baselines.run --alg=ppo2 --env=PongNoFrameskip-v4 --num-timesteps=0 --load_path=~/models/pong_20M_ppo2 --play
|
||||
```
|
||||
|
||||
*NOTE:* At the moment Mujoco training uses VecNormalize wrapper for the environment which is not being saved correctly; so loading the models trained on Mujoco will not work well if the environment is recreated. If necessary, you can work around that by replacing RunningMeanStd by TfRunningMeanStd in [baselines/common/vec_env/vec_normalize.py](baselines/common/vec_env/vec_normalize.py#L12). This way, mean and std of environment normalizing wrapper will be saved in tensorflow variables and included in the model file; however, training is slower that way - hence not including it by default
|
||||
|
||||
|
||||
## Subpackages
|
||||
|
||||
- [A2C](baselines/a2c)
|
||||
@@ -121,19 +71,10 @@ This should get to the mean reward per episode about 5k. To load and visualize t
|
||||
- [DQN](baselines/deepq)
|
||||
- [GAIL](baselines/gail)
|
||||
- [HER](baselines/her)
|
||||
- [PPO1](baselines/ppo1) (obsolete version, left here temporarily)
|
||||
- [PPO2](baselines/ppo2)
|
||||
- [PPO1](baselines/ppo1) (Multi-CPU using MPI)
|
||||
- [PPO2](baselines/ppo2) (Optimized for GPU)
|
||||
- [TRPO](baselines/trpo_mpi)
|
||||
|
||||
|
||||
|
||||
## Benchmarks
|
||||
Results of benchmarks on Mujoco (1M timesteps) and Atari (10M timesteps) are available
|
||||
[here for Mujoco](https://htmlpreview.github.com/?https://github.com/openai/baselines/blob/master/benchmarks_mujoco1M.htm)
|
||||
and
|
||||
[here for Atari](https://htmlpreview.github.com/?https://github.com/openai/baselines/blob/master/benchmarks_atari10M.htm)
|
||||
respectively. Note that these results may be not on the latest version of the code, particular commit hash with which results were obtained is specified on the benchmarks page.
|
||||
|
||||
To cite this repository in publications:
|
||||
|
||||
@misc{baselines,
|
||||
@@ -144,4 +85,3 @@ To cite this repository in publications:
|
||||
journal = {GitHub repository},
|
||||
howpublished = {\url{https://github.com/openai/baselines}},
|
||||
}
|
||||
|
||||
|
@@ -1,48 +1,42 @@
|
||||
import os.path as osp
|
||||
import time
|
||||
import functools
|
||||
import joblib
|
||||
import numpy as np
|
||||
import tensorflow as tf
|
||||
|
||||
from baselines import logger
|
||||
|
||||
from baselines.common import set_global_seeds, explained_variance
|
||||
from baselines.common.runners import AbstractEnvRunner
|
||||
from baselines.common import tf_util
|
||||
from baselines.common.policies import build_policy
|
||||
|
||||
|
||||
from baselines.a2c.utils import Scheduler, find_trainable_variables
|
||||
from baselines.a2c.runner import Runner
|
||||
|
||||
from tensorflow import losses
|
||||
from baselines.a2c.utils import discount_with_dones
|
||||
from baselines.a2c.utils import Scheduler, make_path, find_trainable_variables
|
||||
from baselines.a2c.utils import cat_entropy, mse
|
||||
|
||||
class Model(object):
|
||||
|
||||
def __init__(self, policy, env, nsteps,
|
||||
def __init__(self, policy, ob_space, ac_space, nenvs, nsteps,
|
||||
ent_coef=0.01, vf_coef=0.5, max_grad_norm=0.5, lr=7e-4,
|
||||
alpha=0.99, epsilon=1e-5, total_timesteps=int(80e6), lrschedule='linear'):
|
||||
|
||||
sess = tf_util.get_session()
|
||||
nenvs = env.num_envs
|
||||
sess = tf_util.make_session()
|
||||
nbatch = nenvs*nsteps
|
||||
|
||||
|
||||
with tf.variable_scope('a2c_model', reuse=tf.AUTO_REUSE):
|
||||
step_model = policy(nenvs, 1, sess)
|
||||
train_model = policy(nbatch, nsteps, sess)
|
||||
|
||||
A = tf.placeholder(train_model.action.dtype, train_model.action.shape)
|
||||
A = tf.placeholder(tf.int32, [nbatch])
|
||||
ADV = tf.placeholder(tf.float32, [nbatch])
|
||||
R = tf.placeholder(tf.float32, [nbatch])
|
||||
LR = tf.placeholder(tf.float32, [])
|
||||
|
||||
neglogpac = train_model.pd.neglogp(A)
|
||||
entropy = tf.reduce_mean(train_model.pd.entropy())
|
||||
step_model = policy(sess, ob_space, ac_space, nenvs, 1, reuse=False)
|
||||
train_model = policy(sess, ob_space, ac_space, nenvs*nsteps, nsteps, reuse=True)
|
||||
|
||||
neglogpac = tf.nn.sparse_softmax_cross_entropy_with_logits(logits=train_model.pi, labels=A)
|
||||
pg_loss = tf.reduce_mean(ADV * neglogpac)
|
||||
vf_loss = losses.mean_squared_error(tf.squeeze(train_model.vf), R)
|
||||
|
||||
vf_loss = tf.reduce_mean(mse(tf.squeeze(train_model.vf), R))
|
||||
entropy = tf.reduce_mean(cat_entropy(train_model.pi))
|
||||
loss = pg_loss - entropy*ent_coef + vf_loss * vf_coef
|
||||
|
||||
params = find_trainable_variables("a2c_model")
|
||||
params = find_trainable_variables("model")
|
||||
grads = tf.gradients(loss, params)
|
||||
if max_grad_norm is not None:
|
||||
grads, grad_norm = tf.clip_by_global_norm(grads, max_grad_norm)
|
||||
@@ -56,7 +50,6 @@ class Model(object):
|
||||
advs = rewards - values
|
||||
for step in range(len(obs)):
|
||||
cur_lr = lr.value()
|
||||
|
||||
td_map = {train_model.X:obs, A:actions, ADV:advs, R:rewards, LR:cur_lr}
|
||||
if states is not None:
|
||||
td_map[train_model.S] = states
|
||||
@@ -67,6 +60,17 @@ class Model(object):
|
||||
)
|
||||
return policy_loss, value_loss, policy_entropy
|
||||
|
||||
def save(save_path):
|
||||
ps = sess.run(params)
|
||||
make_path(osp.dirname(save_path))
|
||||
joblib.dump(ps, save_path)
|
||||
|
||||
def load(load_path):
|
||||
loaded_params = joblib.load(load_path)
|
||||
restores = []
|
||||
for p, loaded_p in zip(params, loaded_params):
|
||||
restores.append(p.assign(loaded_p))
|
||||
sess.run(restores)
|
||||
|
||||
self.train = train
|
||||
self.train_model = train_model
|
||||
@@ -74,87 +78,66 @@ class Model(object):
|
||||
self.step = step_model.step
|
||||
self.value = step_model.value
|
||||
self.initial_state = step_model.initial_state
|
||||
self.save = functools.partial(tf_util.save_variables, sess=sess)
|
||||
self.load = functools.partial(tf_util.load_variables, sess=sess)
|
||||
self.save = save
|
||||
self.load = load
|
||||
tf.global_variables_initializer().run(session=sess)
|
||||
|
||||
class Runner(AbstractEnvRunner):
|
||||
|
||||
def learn(
|
||||
network,
|
||||
env,
|
||||
seed=None,
|
||||
nsteps=5,
|
||||
total_timesteps=int(80e6),
|
||||
vf_coef=0.5,
|
||||
ent_coef=0.01,
|
||||
max_grad_norm=0.5,
|
||||
lr=7e-4,
|
||||
lrschedule='linear',
|
||||
epsilon=1e-5,
|
||||
alpha=0.99,
|
||||
gamma=0.99,
|
||||
log_interval=100,
|
||||
load_path=None,
|
||||
**network_kwargs):
|
||||
|
||||
'''
|
||||
Main entrypoint for A2C algorithm. Train a policy with given network architecture on a given environment using a2c algorithm.
|
||||
|
||||
Parameters:
|
||||
-----------
|
||||
|
||||
network: policy network architecture. Either string (mlp, lstm, lnlstm, cnn_lstm, cnn, cnn_small, conv_only - see baselines.common/models.py for full list)
|
||||
specifying the standard network architecture, or a function that takes tensorflow tensor as input and returns
|
||||
tuple (output_tensor, extra_feed) where output tensor is the last network layer output, extra_feed is None for feed-forward
|
||||
neural nets, and extra_feed is a dictionary describing how to feed state into the network for recurrent neural nets.
|
||||
See baselines.common/policies.py/lstm for more details on using recurrent nets in policies
|
||||
|
||||
|
||||
env: RL environment. Should implement interface similar to VecEnv (baselines.common/vec_env) or be wrapped with DummyVecEnv (baselines.common/vec_env/dummy_vec_env.py)
|
||||
|
||||
|
||||
seed: seed to make random number sequence in the alorightm reproducible. By default is None which means seed from system noise generator (not reproducible)
|
||||
|
||||
nsteps: int, number of steps of the vectorized environment per update (i.e. batch size is nsteps * nenv where
|
||||
nenv is number of environment copies simulated in parallel)
|
||||
|
||||
total_timesteps: int, total number of timesteps to train on (default: 80M)
|
||||
|
||||
vf_coef: float, coefficient in front of value function loss in the total loss function (default: 0.5)
|
||||
|
||||
ent_coef: float, coeffictiant in front of the policy entropy in the total loss function (default: 0.01)
|
||||
|
||||
max_gradient_norm: float, gradient is clipped to have global L2 norm no more than this value (default: 0.5)
|
||||
|
||||
lr: float, learning rate for RMSProp (current implementation has RMSProp hardcoded in) (default: 7e-4)
|
||||
|
||||
lrschedule: schedule of learning rate. Can be 'linear', 'constant', or a function [0..1] -> [0..1] that takes fraction of the training progress as input and
|
||||
returns fraction of the learning rate (specified as lr) as output
|
||||
|
||||
epsilon: float, RMSProp epsilon (stabilizes square root computation in denominator of RMSProp update) (default: 1e-5)
|
||||
|
||||
alpha: float, RMSProp decay parameter (default: 0.99)
|
||||
|
||||
gamma: float, reward discounting parameter (default: 0.99)
|
||||
|
||||
log_interval: int, specifies how frequently the logs are printed out (default: 100)
|
||||
|
||||
**network_kwargs: keyword arguments to the policy / network builder. See baselines.common/policies.py/build_policy and arguments to a particular type of network
|
||||
For instance, 'mlp' network architecture has arguments num_hidden and num_layers.
|
||||
|
||||
'''
|
||||
|
||||
def __init__(self, env, model, nsteps=5, gamma=0.99):
|
||||
super().__init__(env=env, model=model, nsteps=nsteps)
|
||||
self.gamma = gamma
|
||||
|
||||
def run(self):
|
||||
mb_obs, mb_rewards, mb_actions, mb_values, mb_dones = [],[],[],[],[]
|
||||
mb_states = self.states
|
||||
for n in range(self.nsteps):
|
||||
actions, values, states, _ = self.model.step(self.obs, self.states, self.dones)
|
||||
mb_obs.append(np.copy(self.obs))
|
||||
mb_actions.append(actions)
|
||||
mb_values.append(values)
|
||||
mb_dones.append(self.dones)
|
||||
obs, rewards, dones, _ = self.env.step(actions)
|
||||
self.states = states
|
||||
self.dones = dones
|
||||
for n, done in enumerate(dones):
|
||||
if done:
|
||||
self.obs[n] = self.obs[n]*0
|
||||
self.obs = obs
|
||||
mb_rewards.append(rewards)
|
||||
mb_dones.append(self.dones)
|
||||
#batch of steps to batch of rollouts
|
||||
mb_obs = np.asarray(mb_obs, dtype=np.uint8).swapaxes(1, 0).reshape(self.batch_ob_shape)
|
||||
mb_rewards = np.asarray(mb_rewards, dtype=np.float32).swapaxes(1, 0)
|
||||
mb_actions = np.asarray(mb_actions, dtype=np.int32).swapaxes(1, 0)
|
||||
mb_values = np.asarray(mb_values, dtype=np.float32).swapaxes(1, 0)
|
||||
mb_dones = np.asarray(mb_dones, dtype=np.bool).swapaxes(1, 0)
|
||||
mb_masks = mb_dones[:, :-1]
|
||||
mb_dones = mb_dones[:, 1:]
|
||||
last_values = self.model.value(self.obs, self.states, self.dones).tolist()
|
||||
#discount/bootstrap off value fn
|
||||
for n, (rewards, dones, value) in enumerate(zip(mb_rewards, mb_dones, last_values)):
|
||||
rewards = rewards.tolist()
|
||||
dones = dones.tolist()
|
||||
if dones[-1] == 0:
|
||||
rewards = discount_with_dones(rewards+[value], dones+[0], self.gamma)[:-1]
|
||||
else:
|
||||
rewards = discount_with_dones(rewards, dones, self.gamma)
|
||||
mb_rewards[n] = rewards
|
||||
mb_rewards = mb_rewards.flatten()
|
||||
mb_actions = mb_actions.flatten()
|
||||
mb_values = mb_values.flatten()
|
||||
mb_masks = mb_masks.flatten()
|
||||
return mb_obs, mb_states, mb_rewards, mb_masks, mb_actions, mb_values
|
||||
|
||||
def learn(policy, env, seed, nsteps=5, total_timesteps=int(80e6), vf_coef=0.5, ent_coef=0.01, max_grad_norm=0.5, lr=7e-4, lrschedule='linear', epsilon=1e-5, alpha=0.99, gamma=0.99, log_interval=100):
|
||||
set_global_seeds(seed)
|
||||
|
||||
nenvs = env.num_envs
|
||||
policy = build_policy(env, network, **network_kwargs)
|
||||
|
||||
model = Model(policy=policy, env=env, nsteps=nsteps, ent_coef=ent_coef, vf_coef=vf_coef,
|
||||
ob_space = env.observation_space
|
||||
ac_space = env.action_space
|
||||
model = Model(policy=policy, ob_space=ob_space, ac_space=ac_space, nenvs=nenvs, nsteps=nsteps, ent_coef=ent_coef, vf_coef=vf_coef,
|
||||
max_grad_norm=max_grad_norm, lr=lr, alpha=alpha, epsilon=epsilon, total_timesteps=total_timesteps, lrschedule=lrschedule)
|
||||
if load_path is not None:
|
||||
model.load(load_path)
|
||||
runner = Runner(env, model, nsteps=nsteps, gamma=gamma)
|
||||
|
||||
nbatch = nenvs*nsteps
|
||||
@@ -175,4 +158,3 @@ def learn(
|
||||
logger.dump_tabular()
|
||||
env.close()
|
||||
return model
|
||||
|
||||
|
146
baselines/a2c/policies.py
Normal file
146
baselines/a2c/policies.py
Normal file
@@ -0,0 +1,146 @@
|
||||
import numpy as np
|
||||
import tensorflow as tf
|
||||
from baselines.a2c.utils import conv, fc, conv_to_fc, batch_to_seq, seq_to_batch, lstm, lnlstm
|
||||
from baselines.common.distributions import make_pdtype
|
||||
from baselines.common.input import observation_input
|
||||
|
||||
def nature_cnn(unscaled_images, **conv_kwargs):
|
||||
"""
|
||||
CNN from Nature paper.
|
||||
"""
|
||||
scaled_images = tf.cast(unscaled_images, tf.float32) / 255.
|
||||
activ = tf.nn.relu
|
||||
h = activ(conv(scaled_images, 'c1', nf=32, rf=8, stride=4, init_scale=np.sqrt(2),
|
||||
**conv_kwargs))
|
||||
h2 = activ(conv(h, 'c2', nf=64, rf=4, stride=2, init_scale=np.sqrt(2), **conv_kwargs))
|
||||
h3 = activ(conv(h2, 'c3', nf=64, rf=3, stride=1, init_scale=np.sqrt(2), **conv_kwargs))
|
||||
h3 = conv_to_fc(h3)
|
||||
return activ(fc(h3, 'fc1', nh=512, init_scale=np.sqrt(2)))
|
||||
|
||||
class LnLstmPolicy(object):
|
||||
def __init__(self, sess, ob_space, ac_space, nbatch, nsteps, nlstm=256, reuse=False):
|
||||
nenv = nbatch // nsteps
|
||||
X, processed_x = observation_input(ob_space, nbatch)
|
||||
M = tf.placeholder(tf.float32, [nbatch]) #mask (done t-1)
|
||||
S = tf.placeholder(tf.float32, [nenv, nlstm*2]) #states
|
||||
self.pdtype = make_pdtype(ac_space)
|
||||
with tf.variable_scope("model", reuse=reuse):
|
||||
h = nature_cnn(processed_x)
|
||||
xs = batch_to_seq(h, nenv, nsteps)
|
||||
ms = batch_to_seq(M, nenv, nsteps)
|
||||
h5, snew = lnlstm(xs, ms, S, 'lstm1', nh=nlstm)
|
||||
h5 = seq_to_batch(h5)
|
||||
vf = fc(h5, 'v', 1)
|
||||
self.pd, self.pi = self.pdtype.pdfromlatent(h5)
|
||||
|
||||
v0 = vf[:, 0]
|
||||
a0 = self.pd.sample()
|
||||
neglogp0 = self.pd.neglogp(a0)
|
||||
self.initial_state = np.zeros((nenv, nlstm*2), dtype=np.float32)
|
||||
|
||||
def step(ob, state, mask):
|
||||
return sess.run([a0, v0, snew, neglogp0], {X:ob, S:state, M:mask})
|
||||
|
||||
def value(ob, state, mask):
|
||||
return sess.run(v0, {X:ob, S:state, M:mask})
|
||||
|
||||
self.X = X
|
||||
self.M = M
|
||||
self.S = S
|
||||
self.vf = vf
|
||||
self.step = step
|
||||
self.value = value
|
||||
|
||||
class LstmPolicy(object):
|
||||
|
||||
def __init__(self, sess, ob_space, ac_space, nbatch, nsteps, nlstm=256, reuse=False):
|
||||
nenv = nbatch // nsteps
|
||||
self.pdtype = make_pdtype(ac_space)
|
||||
X, processed_x = observation_input(ob_space, nbatch)
|
||||
|
||||
M = tf.placeholder(tf.float32, [nbatch]) #mask (done t-1)
|
||||
S = tf.placeholder(tf.float32, [nenv, nlstm*2]) #states
|
||||
with tf.variable_scope("model", reuse=reuse):
|
||||
h = nature_cnn(X)
|
||||
xs = batch_to_seq(h, nenv, nsteps)
|
||||
ms = batch_to_seq(M, nenv, nsteps)
|
||||
h5, snew = lstm(xs, ms, S, 'lstm1', nh=nlstm)
|
||||
h5 = seq_to_batch(h5)
|
||||
vf = fc(h5, 'v', 1)
|
||||
self.pd, self.pi = self.pdtype.pdfromlatent(h5)
|
||||
|
||||
v0 = vf[:, 0]
|
||||
a0 = self.pd.sample()
|
||||
neglogp0 = self.pd.neglogp(a0)
|
||||
self.initial_state = np.zeros((nenv, nlstm*2), dtype=np.float32)
|
||||
|
||||
def step(ob, state, mask):
|
||||
return sess.run([a0, v0, snew, neglogp0], {X:ob, S:state, M:mask})
|
||||
|
||||
def value(ob, state, mask):
|
||||
return sess.run(v0, {X:ob, S:state, M:mask})
|
||||
|
||||
self.X = X
|
||||
self.M = M
|
||||
self.S = S
|
||||
self.vf = vf
|
||||
self.step = step
|
||||
self.value = value
|
||||
|
||||
class CnnPolicy(object):
|
||||
|
||||
def __init__(self, sess, ob_space, ac_space, nbatch, nsteps, reuse=False, **conv_kwargs): #pylint: disable=W0613
|
||||
self.pdtype = make_pdtype(ac_space)
|
||||
X, processed_x = observation_input(ob_space, nbatch)
|
||||
with tf.variable_scope("model", reuse=reuse):
|
||||
h = nature_cnn(processed_x, **conv_kwargs)
|
||||
vf = fc(h, 'v', 1)[:,0]
|
||||
self.pd, self.pi = self.pdtype.pdfromlatent(h, init_scale=0.01)
|
||||
|
||||
a0 = self.pd.sample()
|
||||
neglogp0 = self.pd.neglogp(a0)
|
||||
self.initial_state = None
|
||||
|
||||
def step(ob, *_args, **_kwargs):
|
||||
a, v, neglogp = sess.run([a0, vf, neglogp0], {X:ob})
|
||||
return a, v, self.initial_state, neglogp
|
||||
|
||||
def value(ob, *_args, **_kwargs):
|
||||
return sess.run(vf, {X:ob})
|
||||
|
||||
self.X = X
|
||||
self.vf = vf
|
||||
self.step = step
|
||||
self.value = value
|
||||
|
||||
class MlpPolicy(object):
|
||||
def __init__(self, sess, ob_space, ac_space, nbatch, nsteps, reuse=False): #pylint: disable=W0613
|
||||
self.pdtype = make_pdtype(ac_space)
|
||||
with tf.variable_scope("model", reuse=reuse):
|
||||
X, processed_x = observation_input(ob_space, nbatch)
|
||||
activ = tf.tanh
|
||||
processed_x = tf.layers.flatten(processed_x)
|
||||
pi_h1 = activ(fc(processed_x, 'pi_fc1', nh=64, init_scale=np.sqrt(2)))
|
||||
pi_h2 = activ(fc(pi_h1, 'pi_fc2', nh=64, init_scale=np.sqrt(2)))
|
||||
vf_h1 = activ(fc(processed_x, 'vf_fc1', nh=64, init_scale=np.sqrt(2)))
|
||||
vf_h2 = activ(fc(vf_h1, 'vf_fc2', nh=64, init_scale=np.sqrt(2)))
|
||||
vf = fc(vf_h2, 'vf', 1)[:,0]
|
||||
|
||||
self.pd, self.pi = self.pdtype.pdfromlatent(pi_h2, init_scale=0.01)
|
||||
|
||||
|
||||
a0 = self.pd.sample()
|
||||
neglogp0 = self.pd.neglogp(a0)
|
||||
self.initial_state = None
|
||||
|
||||
def step(ob, *_args, **_kwargs):
|
||||
a, v, neglogp = sess.run([a0, vf, neglogp0], {X:ob})
|
||||
return a, v, self.initial_state, neglogp
|
||||
|
||||
def value(ob, *_args, **_kwargs):
|
||||
return sess.run(vf, {X:ob})
|
||||
|
||||
self.X = X
|
||||
self.vf = vf
|
||||
self.step = step
|
||||
self.value = value
|
30
baselines/a2c/run_atari.py
Normal file
30
baselines/a2c/run_atari.py
Normal file
@@ -0,0 +1,30 @@
|
||||
#!/usr/bin/env python3
|
||||
|
||||
from baselines import logger
|
||||
from baselines.common.cmd_util import make_atari_env, atari_arg_parser
|
||||
from baselines.common.vec_env.vec_frame_stack import VecFrameStack
|
||||
from baselines.a2c.a2c import learn
|
||||
from baselines.ppo2.policies import CnnPolicy, LstmPolicy, LnLstmPolicy
|
||||
|
||||
def train(env_id, num_timesteps, seed, policy, lrschedule, num_env):
|
||||
if policy == 'cnn':
|
||||
policy_fn = CnnPolicy
|
||||
elif policy == 'lstm':
|
||||
policy_fn = LstmPolicy
|
||||
elif policy == 'lnlstm':
|
||||
policy_fn = LnLstmPolicy
|
||||
env = VecFrameStack(make_atari_env(env_id, num_env, seed), 4)
|
||||
learn(policy_fn, env, seed, total_timesteps=int(num_timesteps * 1.1), lrschedule=lrschedule)
|
||||
env.close()
|
||||
|
||||
def main():
|
||||
parser = atari_arg_parser()
|
||||
parser.add_argument('--policy', help='Policy architecture', choices=['cnn', 'lstm', 'lnlstm'], default='cnn')
|
||||
parser.add_argument('--lrschedule', help='Learning rate schedule', choices=['constant', 'linear'], default='constant')
|
||||
args = parser.parse_args()
|
||||
logger.configure()
|
||||
train(args.env, num_timesteps=args.num_timesteps, seed=args.seed,
|
||||
policy=args.policy, lrschedule=args.lrschedule, num_env=16)
|
||||
|
||||
if __name__ == '__main__':
|
||||
main()
|
@@ -1,60 +0,0 @@
|
||||
import numpy as np
|
||||
from baselines.a2c.utils import discount_with_dones
|
||||
from baselines.common.runners import AbstractEnvRunner
|
||||
|
||||
class Runner(AbstractEnvRunner):
|
||||
|
||||
def __init__(self, env, model, nsteps=5, gamma=0.99):
|
||||
super().__init__(env=env, model=model, nsteps=nsteps)
|
||||
self.gamma = gamma
|
||||
self.batch_action_shape = [x if x is not None else -1 for x in model.train_model.action.shape.as_list()]
|
||||
self.ob_dtype = model.train_model.X.dtype.as_numpy_dtype
|
||||
|
||||
def run(self):
|
||||
mb_obs, mb_rewards, mb_actions, mb_values, mb_dones = [],[],[],[],[]
|
||||
mb_states = self.states
|
||||
for n in range(self.nsteps):
|
||||
actions, values, states, _ = self.model.step(self.obs, S=self.states, M=self.dones)
|
||||
mb_obs.append(np.copy(self.obs))
|
||||
mb_actions.append(actions)
|
||||
mb_values.append(values)
|
||||
mb_dones.append(self.dones)
|
||||
obs, rewards, dones, _ = self.env.step(actions)
|
||||
self.states = states
|
||||
self.dones = dones
|
||||
for n, done in enumerate(dones):
|
||||
if done:
|
||||
self.obs[n] = self.obs[n]*0
|
||||
self.obs = obs
|
||||
mb_rewards.append(rewards)
|
||||
mb_dones.append(self.dones)
|
||||
#batch of steps to batch of rollouts
|
||||
|
||||
mb_obs = np.asarray(mb_obs, dtype=self.ob_dtype).swapaxes(1, 0).reshape(self.batch_ob_shape)
|
||||
mb_rewards = np.asarray(mb_rewards, dtype=np.float32).swapaxes(1, 0)
|
||||
mb_actions = np.asarray(mb_actions, dtype=self.model.train_model.action.dtype.name).swapaxes(1, 0)
|
||||
mb_values = np.asarray(mb_values, dtype=np.float32).swapaxes(1, 0)
|
||||
mb_dones = np.asarray(mb_dones, dtype=np.bool).swapaxes(1, 0)
|
||||
mb_masks = mb_dones[:, :-1]
|
||||
mb_dones = mb_dones[:, 1:]
|
||||
|
||||
|
||||
if self.gamma > 0.0:
|
||||
#discount/bootstrap off value fn
|
||||
last_values = self.model.value(self.obs, S=self.states, M=self.dones).tolist()
|
||||
for n, (rewards, dones, value) in enumerate(zip(mb_rewards, mb_dones, last_values)):
|
||||
rewards = rewards.tolist()
|
||||
dones = dones.tolist()
|
||||
if dones[-1] == 0:
|
||||
rewards = discount_with_dones(rewards+[value], dones+[0], self.gamma)[:-1]
|
||||
else:
|
||||
rewards = discount_with_dones(rewards, dones, self.gamma)
|
||||
|
||||
mb_rewards[n] = rewards
|
||||
|
||||
mb_actions = mb_actions.reshape(self.batch_action_shape)
|
||||
|
||||
mb_rewards = mb_rewards.flatten()
|
||||
mb_values = mb_values.flatten()
|
||||
mb_masks = mb_masks.flatten()
|
||||
return mb_obs, mb_states, mb_rewards, mb_masks, mb_actions, mb_values
|
@@ -1,6 +1,8 @@
|
||||
import os
|
||||
import gym
|
||||
import numpy as np
|
||||
import tensorflow as tf
|
||||
from gym import spaces
|
||||
from collections import deque
|
||||
|
||||
def sample(logits):
|
||||
@@ -8,15 +10,18 @@ def sample(logits):
|
||||
return tf.argmax(logits - tf.log(-tf.log(noise)), 1)
|
||||
|
||||
def cat_entropy(logits):
|
||||
a0 = logits - tf.reduce_max(logits, 1, keepdims=True)
|
||||
a0 = logits - tf.reduce_max(logits, 1, keep_dims=True)
|
||||
ea0 = tf.exp(a0)
|
||||
z0 = tf.reduce_sum(ea0, 1, keepdims=True)
|
||||
z0 = tf.reduce_sum(ea0, 1, keep_dims=True)
|
||||
p0 = ea0 / z0
|
||||
return tf.reduce_sum(p0 * (tf.log(z0) - a0), 1)
|
||||
|
||||
def cat_entropy_softmax(p0):
|
||||
return - tf.reduce_sum(p0 * tf.log(p0 + 1e-6), axis = 1)
|
||||
|
||||
def mse(pred, target):
|
||||
return tf.square(pred-target)/2.
|
||||
|
||||
def ortho_init(scale=1.0):
|
||||
def _ortho_init(shape, dtype, partition_info=None):
|
||||
#lasagne ortho init for tf
|
||||
@@ -53,7 +58,7 @@ def conv(x, scope, *, nf, rf, stride, pad='VALID', init_scale=1.0, data_format='
|
||||
b = tf.get_variable("b", bias_var_shape, initializer=tf.constant_initializer(0.0))
|
||||
if not one_dim_bias and data_format == 'NHWC':
|
||||
b = tf.reshape(b, bshape)
|
||||
return tf.nn.conv2d(x, w, strides=strides, padding=pad, data_format=data_format) + b
|
||||
return b + tf.nn.conv2d(x, w, strides=strides, padding=pad, data_format=data_format)
|
||||
|
||||
def fc(x, scope, nh, *, init_scale=1.0, init_bias=0.0):
|
||||
with tf.variable_scope(scope):
|
||||
@@ -80,6 +85,7 @@ def seq_to_batch(h, flat = False):
|
||||
|
||||
def lstm(xs, ms, s, scope, nh, init_scale=1.0):
|
||||
nbatch, nin = [v.value for v in xs[0].get_shape()]
|
||||
nsteps = len(xs)
|
||||
with tf.variable_scope(scope):
|
||||
wx = tf.get_variable("wx", [nin, nh*4], initializer=ortho_init(init_scale))
|
||||
wh = tf.get_variable("wh", [nh, nh*4], initializer=ortho_init(init_scale))
|
||||
@@ -109,6 +115,7 @@ def _ln(x, g, b, e=1e-5, axes=[1]):
|
||||
|
||||
def lnlstm(xs, ms, s, scope, nh, init_scale=1.0):
|
||||
nbatch, nin = [v.value for v in xs[0].get_shape()]
|
||||
nsteps = len(xs)
|
||||
with tf.variable_scope(scope):
|
||||
wx = tf.get_variable("wx", [nin, nh*4], initializer=ortho_init(init_scale))
|
||||
gx = tf.get_variable("gx", [nh*4], initializer=tf.constant_initializer(1.0))
|
||||
@@ -153,7 +160,8 @@ def discount_with_dones(rewards, dones, gamma):
|
||||
return discounted[::-1]
|
||||
|
||||
def find_trainable_variables(key):
|
||||
return tf.trainable_variables(key)
|
||||
with tf.variable_scope(key):
|
||||
return tf.trainable_variables()
|
||||
|
||||
def make_path(f):
|
||||
return os.makedirs(f, exist_ok=True)
|
||||
|
@@ -1,20 +1,20 @@
|
||||
import time
|
||||
import functools
|
||||
import joblib
|
||||
import numpy as np
|
||||
import tensorflow as tf
|
||||
from baselines import logger
|
||||
|
||||
from baselines.common import set_global_seeds
|
||||
from baselines.common.policies import build_policy
|
||||
from baselines.common.tf_util import get_session, save_variables
|
||||
from baselines.common.runners import AbstractEnvRunner
|
||||
|
||||
from baselines.a2c.utils import batch_to_seq, seq_to_batch
|
||||
from baselines.a2c.utils import Scheduler, make_path, find_trainable_variables
|
||||
from baselines.a2c.utils import cat_entropy_softmax
|
||||
from baselines.a2c.utils import Scheduler, find_trainable_variables
|
||||
from baselines.a2c.utils import EpisodeStats
|
||||
from baselines.a2c.utils import get_by_index, check_shape, avg_norm, gradient_add, q_explained_variance
|
||||
from baselines.acer.buffer import Buffer
|
||||
from baselines.acer.runner import Runner
|
||||
|
||||
import os.path as osp
|
||||
|
||||
# remove last step
|
||||
def strip(var, nenvs, nsteps, flat = False):
|
||||
@@ -59,8 +59,10 @@ class Model(object):
|
||||
ent_coef, q_coef, gamma, max_grad_norm, lr,
|
||||
rprop_alpha, rprop_epsilon, total_timesteps, lrschedule,
|
||||
c, trust_region, alpha, delta):
|
||||
|
||||
sess = get_session()
|
||||
config = tf.ConfigProto(allow_soft_placement=True,
|
||||
intra_op_parallelism_threads=num_procs,
|
||||
inter_op_parallelism_threads=num_procs)
|
||||
sess = tf.Session(config=config)
|
||||
nact = ac_space.n
|
||||
nbatch = nenvs * nsteps
|
||||
|
||||
@@ -70,16 +72,11 @@ class Model(object):
|
||||
MU = tf.placeholder(tf.float32, [nbatch, nact]) # mu's
|
||||
LR = tf.placeholder(tf.float32, [])
|
||||
eps = 1e-6
|
||||
|
||||
step_ob_placeholder = tf.placeholder(dtype=ob_space.dtype, shape=(nenvs,) + ob_space.shape[:-1] + (ob_space.shape[-1] * nstack,))
|
||||
train_ob_placeholder = tf.placeholder(dtype=ob_space.dtype, shape=(nenvs*(nsteps+1),) + ob_space.shape[:-1] + (ob_space.shape[-1] * nstack,))
|
||||
with tf.variable_scope('acer_model', reuse=tf.AUTO_REUSE):
|
||||
|
||||
step_model = policy(observ_placeholder=step_ob_placeholder, sess=sess)
|
||||
train_model = policy(observ_placeholder=train_ob_placeholder, sess=sess)
|
||||
step_model = policy(sess, ob_space, ac_space, nenvs, 1, nstack, reuse=False)
|
||||
train_model = policy(sess, ob_space, ac_space, nenvs, nsteps + 1, nstack, reuse=True)
|
||||
|
||||
|
||||
params = find_trainable_variables("acer_model")
|
||||
params = find_trainable_variables("model")
|
||||
print("Params {}".format(len(params)))
|
||||
for var in params:
|
||||
print(var)
|
||||
@@ -93,20 +90,14 @@ class Model(object):
|
||||
print(v.name)
|
||||
return v
|
||||
|
||||
with tf.variable_scope("acer_model", custom_getter=custom_getter, reuse=True):
|
||||
polyak_model = policy(observ_placeholder=train_ob_placeholder, sess=sess)
|
||||
with tf.variable_scope("", custom_getter=custom_getter, reuse=True):
|
||||
polyak_model = policy(sess, ob_space, ac_space, nenvs, nsteps + 1, nstack, reuse=True)
|
||||
|
||||
# Notation: (var) = batch variable, (var)s = seqeuence variable, (var)_i = variable index by action at step i
|
||||
|
||||
# action probability distributions according to train_model, polyak_model and step_model
|
||||
# poilcy.pi is probability distribution parameters; to obtain distribution that sums to 1 need to take softmax
|
||||
train_model_p = tf.nn.softmax(train_model.pi)
|
||||
polyak_model_p = tf.nn.softmax(polyak_model.pi)
|
||||
step_model_p = tf.nn.softmax(step_model.pi)
|
||||
v = tf.reduce_sum(train_model_p * train_model.q, axis = -1) # shape is [nenvs * (nsteps + 1)]
|
||||
v = tf.reduce_sum(train_model.pi * train_model.q, axis = -1) # shape is [nenvs * (nsteps + 1)]
|
||||
|
||||
# strip off last step
|
||||
f, f_pol, q = map(lambda var: strip(var, nenvs, nsteps), [train_model_p, polyak_model_p, train_model.q])
|
||||
f, f_pol, q = map(lambda var: strip(var, nenvs, nsteps), [train_model.pi, polyak_model.pi, train_model.q])
|
||||
# Get pi and q values for actions taken
|
||||
f_i = get_by_index(f, A)
|
||||
q_i = get_by_index(q, A)
|
||||
@@ -119,8 +110,7 @@ class Model(object):
|
||||
qret = q_retrace(R, D, q_i, v, rho_i, nenvs, nsteps, gamma)
|
||||
|
||||
# Calculate losses
|
||||
# Entropy
|
||||
# entropy = tf.reduce_mean(strip(train_model.pd.entropy(), nenvs, nsteps))
|
||||
# Entropy
|
||||
entropy = tf.reduce_mean(cat_entropy_softmax(f))
|
||||
|
||||
# Policy Graident loss, with truncated importance sampling & bias correction
|
||||
@@ -202,29 +192,80 @@ class Model(object):
|
||||
def train(obs, actions, rewards, dones, mus, states, masks, steps):
|
||||
cur_lr = lr.value_steps(steps)
|
||||
td_map = {train_model.X: obs, polyak_model.X: obs, A: actions, R: rewards, D: dones, MU: mus, LR: cur_lr}
|
||||
if states is not None:
|
||||
if states != []:
|
||||
td_map[train_model.S] = states
|
||||
td_map[train_model.M] = masks
|
||||
td_map[polyak_model.S] = states
|
||||
td_map[polyak_model.M] = masks
|
||||
|
||||
return names_ops, sess.run(run_ops, td_map)[1:] # strip off _train
|
||||
|
||||
def _step(observation, **kwargs):
|
||||
return step_model._evaluate([step_model.action, step_model_p, step_model.state], observation, **kwargs)
|
||||
|
||||
|
||||
def save(save_path):
|
||||
ps = sess.run(params)
|
||||
make_path(osp.dirname(save_path))
|
||||
joblib.dump(ps, save_path)
|
||||
|
||||
self.train = train
|
||||
self.save = functools.partial(save_variables, sess=sess, variables=params)
|
||||
self.save = save
|
||||
self.train_model = train_model
|
||||
self.step_model = step_model
|
||||
self._step = _step
|
||||
self.step = self.step_model.step
|
||||
|
||||
self.step = step_model.step
|
||||
self.initial_state = step_model.initial_state
|
||||
tf.global_variables_initializer().run(session=sess)
|
||||
|
||||
class Runner(AbstractEnvRunner):
|
||||
def __init__(self, env, model, nsteps, nstack):
|
||||
super().__init__(env=env, model=model, nsteps=nsteps)
|
||||
self.nstack = nstack
|
||||
nh, nw, nc = env.observation_space.shape
|
||||
self.nc = nc # nc = 1 for atari, but just in case
|
||||
self.nenv = nenv = env.num_envs
|
||||
self.nact = env.action_space.n
|
||||
self.nbatch = nenv * nsteps
|
||||
self.batch_ob_shape = (nenv*(nsteps+1), nh, nw, nc*nstack)
|
||||
self.obs = np.zeros((nenv, nh, nw, nc * nstack), dtype=np.uint8)
|
||||
obs = env.reset()
|
||||
self.update_obs(obs)
|
||||
|
||||
def update_obs(self, obs, dones=None):
|
||||
if dones is not None:
|
||||
self.obs *= (1 - dones.astype(np.uint8))[:, None, None, None]
|
||||
self.obs = np.roll(self.obs, shift=-self.nc, axis=3)
|
||||
self.obs[:, :, :, -self.nc:] = obs[:, :, :, :]
|
||||
|
||||
def run(self):
|
||||
enc_obs = np.split(self.obs, self.nstack, axis=3) # so now list of obs steps
|
||||
mb_obs, mb_actions, mb_mus, mb_dones, mb_rewards = [], [], [], [], []
|
||||
for _ in range(self.nsteps):
|
||||
actions, mus, states = self.model.step(self.obs, state=self.states, mask=self.dones)
|
||||
mb_obs.append(np.copy(self.obs))
|
||||
mb_actions.append(actions)
|
||||
mb_mus.append(mus)
|
||||
mb_dones.append(self.dones)
|
||||
obs, rewards, dones, _ = self.env.step(actions)
|
||||
# states information for statefull models like LSTM
|
||||
self.states = states
|
||||
self.dones = dones
|
||||
self.update_obs(obs, dones)
|
||||
mb_rewards.append(rewards)
|
||||
enc_obs.append(obs)
|
||||
mb_obs.append(np.copy(self.obs))
|
||||
mb_dones.append(self.dones)
|
||||
|
||||
enc_obs = np.asarray(enc_obs, dtype=np.uint8).swapaxes(1, 0)
|
||||
mb_obs = np.asarray(mb_obs, dtype=np.uint8).swapaxes(1, 0)
|
||||
mb_actions = np.asarray(mb_actions, dtype=np.int32).swapaxes(1, 0)
|
||||
mb_rewards = np.asarray(mb_rewards, dtype=np.float32).swapaxes(1, 0)
|
||||
mb_mus = np.asarray(mb_mus, dtype=np.float32).swapaxes(1, 0)
|
||||
|
||||
mb_dones = np.asarray(mb_dones, dtype=np.bool).swapaxes(1, 0)
|
||||
|
||||
mb_masks = mb_dones # Used for statefull models like LSTM's to mask state when done
|
||||
mb_dones = mb_dones[:, 1:] # Used for calculating returns. The dones array is now aligned with rewards
|
||||
|
||||
# shapes are now [nenv, nsteps, []]
|
||||
# When pulling from buffer, arrays will now be reshaped in place, preventing a deep copy.
|
||||
|
||||
return enc_obs, mb_obs, mb_actions, mb_rewards, mb_mus, mb_dones, mb_masks
|
||||
|
||||
class Acer():
|
||||
def __init__(self, runner, model, buffer, log_interval):
|
||||
@@ -270,84 +311,19 @@ class Acer():
|
||||
logger.dump_tabular()
|
||||
|
||||
|
||||
def learn(network, env, seed=None, nsteps=20, nstack=4, total_timesteps=int(80e6), q_coef=0.5, ent_coef=0.01,
|
||||
def learn(policy, env, seed, nsteps=20, nstack=4, total_timesteps=int(80e6), q_coef=0.5, ent_coef=0.01,
|
||||
max_grad_norm=10, lr=7e-4, lrschedule='linear', rprop_epsilon=1e-5, rprop_alpha=0.99, gamma=0.99,
|
||||
log_interval=100, buffer_size=50000, replay_ratio=4, replay_start=10000, c=10.0,
|
||||
trust_region=True, alpha=0.99, delta=1, load_path=None, **network_kwargs):
|
||||
|
||||
'''
|
||||
Main entrypoint for ACER (Actor-Critic with Experience Replay) algorithm (https://arxiv.org/pdf/1611.01224.pdf)
|
||||
Train an agent with given network architecture on a given environment using ACER.
|
||||
|
||||
Parameters:
|
||||
----------
|
||||
|
||||
network: policy network architecture. Either string (mlp, lstm, lnlstm, cnn_lstm, cnn, cnn_small, conv_only - see baselines.common/models.py for full list)
|
||||
specifying the standard network architecture, or a function that takes tensorflow tensor as input and returns
|
||||
tuple (output_tensor, extra_feed) where output tensor is the last network layer output, extra_feed is None for feed-forward
|
||||
neural nets, and extra_feed is a dictionary describing how to feed state into the network for recurrent neural nets.
|
||||
See baselines.common/policies.py/lstm for more details on using recurrent nets in policies
|
||||
|
||||
env: environment. Needs to be vectorized for parallel environment simulation.
|
||||
The environments produced by gym.make can be wrapped using baselines.common.vec_env.DummyVecEnv class.
|
||||
|
||||
nsteps: int, number of steps of the vectorized environment per update (i.e. batch size is nsteps * nenv where
|
||||
nenv is number of environment copies simulated in parallel) (default: 20)
|
||||
|
||||
nstack: int, size of the frame stack, i.e. number of the frames passed to the step model. Frames are stacked along channel dimension
|
||||
(last image dimension) (default: 4)
|
||||
|
||||
total_timesteps: int, number of timesteps (i.e. number of actions taken in the environment) (default: 80M)
|
||||
|
||||
q_coef: float, value function loss coefficient in the optimization objective (analog of vf_coef for other actor-critic methods)
|
||||
|
||||
ent_coef: float, policy entropy coefficient in the optimization objective (default: 0.01)
|
||||
|
||||
max_grad_norm: float, gradient norm clipping coefficient. If set to None, no clipping. (default: 10),
|
||||
|
||||
lr: float, learning rate for RMSProp (current implementation has RMSProp hardcoded in) (default: 7e-4)
|
||||
|
||||
lrschedule: schedule of learning rate. Can be 'linear', 'constant', or a function [0..1] -> [0..1] that takes fraction of the training progress as input and
|
||||
returns fraction of the learning rate (specified as lr) as output
|
||||
|
||||
rprop_epsilon: float, RMSProp epsilon (stabilizes square root computation in denominator of RMSProp update) (default: 1e-5)
|
||||
|
||||
rprop_alpha: float, RMSProp decay parameter (default: 0.99)
|
||||
|
||||
gamma: float, reward discounting factor (default: 0.99)
|
||||
|
||||
log_interval: int, number of updates between logging events (default: 100)
|
||||
|
||||
buffer_size: int, size of the replay buffer (default: 50k)
|
||||
|
||||
replay_ratio: int, now many (on average) batches of data to sample from the replay buffer take after batch from the environment (default: 4)
|
||||
|
||||
replay_start: int, the sampling from the replay buffer does not start until replay buffer has at least that many samples (default: 10k)
|
||||
|
||||
c: float, importance weight clipping factor (default: 10)
|
||||
|
||||
trust_region bool, whether or not algorithms estimates the gradient KL divergence between the old and updated policy and uses it to determine step size (default: True)
|
||||
|
||||
delta: float, max KL divergence between the old policy and updated policy (default: 1)
|
||||
|
||||
alpha: float, momentum factor in the Polyak (exponential moving average) averaging of the model parameters (default: 0.99)
|
||||
|
||||
load_path: str, path to load the model from (default: None)
|
||||
|
||||
**network_kwargs: keyword arguments to the policy / network builder. See baselines.common/policies.py/build_policy and arguments to a particular type of network
|
||||
For instance, 'mlp' network architecture has arguments num_hidden and num_layers.
|
||||
|
||||
'''
|
||||
|
||||
trust_region=True, alpha=0.99, delta=1):
|
||||
print("Running Acer Simple")
|
||||
print(locals())
|
||||
tf.reset_default_graph()
|
||||
set_global_seeds(seed)
|
||||
policy = build_policy(env, network, estimate_q=True, **network_kwargs)
|
||||
|
||||
nenvs = env.num_envs
|
||||
ob_space = env.observation_space
|
||||
ac_space = env.action_space
|
||||
num_procs = len(env.remotes) if hasattr(env, 'remotes') else 1# HACK
|
||||
num_procs = len(env.remotes) # HACK
|
||||
model = Model(policy=policy, ob_space=ob_space, ac_space=ac_space, nenvs=nenvs, nsteps=nsteps, nstack=nstack,
|
||||
num_procs=num_procs, ent_coef=ent_coef, q_coef=q_coef, gamma=gamma,
|
||||
max_grad_norm=max_grad_norm, lr=lr, rprop_alpha=rprop_alpha, rprop_epsilon=rprop_epsilon,
|
||||
@@ -362,7 +338,6 @@ def learn(network, env, seed=None, nsteps=20, nstack=4, total_timesteps=int(80e6
|
||||
nbatch = nenvs*nsteps
|
||||
acer = Acer(runner, model, buffer, log_interval)
|
||||
acer.tstart = time.time()
|
||||
|
||||
for acer.steps in range(0, total_timesteps, nbatch): #nbatch samples, 1 on_policy call and multiple off-policy calls
|
||||
acer.call(on_policy=True)
|
||||
if replay_ratio > 0 and buffer.has_atleast(replay_start):
|
||||
@@ -371,4 +346,3 @@ def learn(network, env, seed=None, nsteps=20, nstack=4, total_timesteps=int(80e6
|
||||
acer.call(on_policy=False) # no simulation steps in this
|
||||
|
||||
env.close()
|
||||
return model
|
@@ -1,4 +0,0 @@
|
||||
def atari():
|
||||
return dict(
|
||||
lrschedule='constant'
|
||||
)
|
@@ -1,6 +1,6 @@
|
||||
import numpy as np
|
||||
import tensorflow as tf
|
||||
from baselines.common.policies import nature_cnn
|
||||
from baselines.ppo2.policies import nature_cnn
|
||||
from baselines.a2c.utils import fc, batch_to_seq, seq_to_batch, lstm, sample
|
||||
|
||||
|
||||
@@ -18,13 +18,11 @@ class AcerCnnPolicy(object):
|
||||
pi = tf.nn.softmax(pi_logits)
|
||||
q = fc(h, 'q', nact)
|
||||
|
||||
a = sample(tf.nn.softmax(pi_logits)) # could change this to use self.pi instead
|
||||
a = sample(pi_logits) # could change this to use self.pi instead
|
||||
self.initial_state = [] # not stateful
|
||||
self.X = X
|
||||
self.pi = pi # actual policy params now
|
||||
self.pi_logits = pi_logits
|
||||
self.q = q
|
||||
self.vf = q
|
||||
|
||||
def step(ob, *args, **kwargs):
|
||||
# returns actions, mus, states
|
||||
|
30
baselines/acer/run_atari.py
Normal file
30
baselines/acer/run_atari.py
Normal file
@@ -0,0 +1,30 @@
|
||||
#!/usr/bin/env python3
|
||||
from baselines import logger
|
||||
from baselines.acer.acer_simple import learn
|
||||
from baselines.acer.policies import AcerCnnPolicy, AcerLstmPolicy
|
||||
from baselines.common.cmd_util import make_atari_env, atari_arg_parser
|
||||
|
||||
def train(env_id, num_timesteps, seed, policy, lrschedule, num_cpu):
|
||||
env = make_atari_env(env_id, num_cpu, seed)
|
||||
if policy == 'cnn':
|
||||
policy_fn = AcerCnnPolicy
|
||||
elif policy == 'lstm':
|
||||
policy_fn = AcerLstmPolicy
|
||||
else:
|
||||
print("Policy {} not implemented".format(policy))
|
||||
return
|
||||
learn(policy_fn, env, seed, total_timesteps=int(num_timesteps * 1.1), lrschedule=lrschedule)
|
||||
env.close()
|
||||
|
||||
def main():
|
||||
parser = atari_arg_parser()
|
||||
parser.add_argument('--policy', help='Policy architecture', choices=['cnn', 'lstm', 'lnlstm'], default='cnn')
|
||||
parser.add_argument('--lrschedule', help='Learning rate schedule', choices=['constant', 'linear'], default='constant')
|
||||
parser.add_argument('--logdir', help ='Directory for logging')
|
||||
args = parser.parse_args()
|
||||
logger.configure(args.logdir)
|
||||
train(args.env, num_timesteps=args.num_timesteps, seed=args.seed,
|
||||
policy=args.policy, lrschedule=args.lrschedule, num_cpu=16)
|
||||
|
||||
if __name__ == '__main__':
|
||||
main()
|
@@ -1,60 +0,0 @@
|
||||
import numpy as np
|
||||
from baselines.common.runners import AbstractEnvRunner
|
||||
|
||||
class Runner(AbstractEnvRunner):
|
||||
|
||||
def __init__(self, env, model, nsteps, nstack):
|
||||
super().__init__(env=env, model=model, nsteps=nsteps)
|
||||
self.nstack = nstack
|
||||
nh, nw, nc = env.observation_space.shape
|
||||
self.nc = nc # nc = 1 for atari, but just in case
|
||||
self.nact = env.action_space.n
|
||||
nenv = self.nenv
|
||||
self.nbatch = nenv * nsteps
|
||||
self.batch_ob_shape = (nenv*(nsteps+1), nh, nw, nc*nstack)
|
||||
self.obs = np.zeros((nenv, nh, nw, nc * nstack), dtype=np.uint8)
|
||||
obs = env.reset()
|
||||
self.update_obs(obs)
|
||||
|
||||
def update_obs(self, obs, dones=None):
|
||||
#self.obs = obs
|
||||
if dones is not None:
|
||||
self.obs *= (1 - dones.astype(np.uint8))[:, None, None, None]
|
||||
self.obs = np.roll(self.obs, shift=-self.nc, axis=3)
|
||||
self.obs[:, :, :, -self.nc:] = obs[:, :, :, :]
|
||||
|
||||
def run(self):
|
||||
enc_obs = np.split(self.obs, self.nstack, axis=3) # so now list of obs steps
|
||||
mb_obs, mb_actions, mb_mus, mb_dones, mb_rewards = [], [], [], [], []
|
||||
for _ in range(self.nsteps):
|
||||
actions, mus, states = self.model._step(self.obs, S=self.states, M=self.dones)
|
||||
mb_obs.append(np.copy(self.obs))
|
||||
mb_actions.append(actions)
|
||||
mb_mus.append(mus)
|
||||
mb_dones.append(self.dones)
|
||||
obs, rewards, dones, _ = self.env.step(actions)
|
||||
# states information for statefull models like LSTM
|
||||
self.states = states
|
||||
self.dones = dones
|
||||
self.update_obs(obs, dones)
|
||||
mb_rewards.append(rewards)
|
||||
enc_obs.append(obs)
|
||||
mb_obs.append(np.copy(self.obs))
|
||||
mb_dones.append(self.dones)
|
||||
|
||||
enc_obs = np.asarray(enc_obs, dtype=np.uint8).swapaxes(1, 0)
|
||||
mb_obs = np.asarray(mb_obs, dtype=np.uint8).swapaxes(1, 0)
|
||||
mb_actions = np.asarray(mb_actions, dtype=np.int32).swapaxes(1, 0)
|
||||
mb_rewards = np.asarray(mb_rewards, dtype=np.float32).swapaxes(1, 0)
|
||||
mb_mus = np.asarray(mb_mus, dtype=np.float32).swapaxes(1, 0)
|
||||
|
||||
mb_dones = np.asarray(mb_dones, dtype=np.bool).swapaxes(1, 0)
|
||||
|
||||
mb_masks = mb_dones # Used for statefull models like LSTM's to mask state when done
|
||||
mb_dones = mb_dones[:, 1:] # Used for calculating returns. The dones array is now aligned with rewards
|
||||
|
||||
# shapes are now [nenv, nsteps, []]
|
||||
# When pulling from buffer, arrays will now be reshaped in place, preventing a deep copy.
|
||||
|
||||
return enc_obs, mb_obs, mb_actions, mb_rewards, mb_mus, mb_dones, mb_masks
|
||||
|
@@ -1 +0,0 @@
|
||||
from baselines.acktr.acktr_disc import *
|
@@ -1,17 +1,16 @@
|
||||
import os.path as osp
|
||||
import time
|
||||
import functools
|
||||
import joblib
|
||||
import numpy as np
|
||||
import tensorflow as tf
|
||||
from baselines import logger
|
||||
|
||||
from baselines.common import set_global_seeds, explained_variance
|
||||
from baselines.common.policies import build_policy
|
||||
from baselines.common.tf_util import get_session, save_variables, load_variables
|
||||
|
||||
from baselines.a2c.runner import Runner
|
||||
from baselines.a2c.a2c import Runner
|
||||
from baselines.a2c.utils import discount_with_dones
|
||||
from baselines.a2c.utils import Scheduler, find_trainable_variables
|
||||
from baselines.a2c.utils import cat_entropy, mse
|
||||
from baselines.acktr import kfac
|
||||
|
||||
|
||||
@@ -20,8 +19,11 @@ class Model(object):
|
||||
def __init__(self, policy, ob_space, ac_space, nenvs,total_timesteps, nprocs=32, nsteps=20,
|
||||
ent_coef=0.01, vf_coef=0.5, vf_fisher_coef=1.0, lr=0.25, max_grad_norm=0.5,
|
||||
kfac_clip=0.001, lrschedule='linear'):
|
||||
|
||||
self.sess = sess = get_session()
|
||||
config = tf.ConfigProto(allow_soft_placement=True,
|
||||
intra_op_parallelism_threads=nprocs,
|
||||
inter_op_parallelism_threads=nprocs)
|
||||
config.gpu_options.allow_growth = True
|
||||
self.sess = sess = tf.Session(config=config)
|
||||
nact = ac_space.n
|
||||
nbatch = nenvs * nsteps
|
||||
A = tf.placeholder(tf.int32, [nbatch])
|
||||
@@ -30,28 +32,27 @@ class Model(object):
|
||||
PG_LR = tf.placeholder(tf.float32, [])
|
||||
VF_LR = tf.placeholder(tf.float32, [])
|
||||
|
||||
with tf.variable_scope('acktr_model', reuse=tf.AUTO_REUSE):
|
||||
self.model = step_model = policy(nenvs, 1, sess=sess)
|
||||
self.model2 = train_model = policy(nenvs*nsteps, nsteps, sess=sess)
|
||||
self.model = step_model = policy(sess, ob_space, ac_space, nenvs, 1, reuse=False)
|
||||
self.model2 = train_model = policy(sess, ob_space, ac_space, nenvs*nsteps, nsteps, reuse=True)
|
||||
|
||||
neglogpac = train_model.pd.neglogp(A)
|
||||
logpac = tf.nn.sparse_softmax_cross_entropy_with_logits(logits=train_model.pi, labels=A)
|
||||
self.logits = logits = train_model.pi
|
||||
|
||||
##training loss
|
||||
pg_loss = tf.reduce_mean(ADV*neglogpac)
|
||||
entropy = tf.reduce_mean(train_model.pd.entropy())
|
||||
pg_loss = tf.reduce_mean(ADV*logpac)
|
||||
entropy = tf.reduce_mean(cat_entropy(train_model.pi))
|
||||
pg_loss = pg_loss - ent_coef * entropy
|
||||
vf_loss = tf.losses.mean_squared_error(tf.squeeze(train_model.vf), R)
|
||||
vf_loss = tf.reduce_mean(mse(tf.squeeze(train_model.vf), R))
|
||||
train_loss = pg_loss + vf_coef * vf_loss
|
||||
|
||||
|
||||
##Fisher loss construction
|
||||
self.pg_fisher = pg_fisher_loss = -tf.reduce_mean(neglogpac)
|
||||
self.pg_fisher = pg_fisher_loss = -tf.reduce_mean(logpac)
|
||||
sample_net = train_model.vf + tf.random_normal(tf.shape(train_model.vf))
|
||||
self.vf_fisher = vf_fisher_loss = - vf_fisher_coef*tf.reduce_mean(tf.pow(train_model.vf - tf.stop_gradient(sample_net), 2))
|
||||
self.joint_fisher = joint_fisher_loss = pg_fisher_loss + vf_fisher_loss
|
||||
|
||||
self.params=params = find_trainable_variables("acktr_model")
|
||||
self.params=params = find_trainable_variables("model")
|
||||
|
||||
self.grads_check = grads = tf.gradients(train_loss,params)
|
||||
|
||||
@@ -81,10 +82,22 @@ class Model(object):
|
||||
)
|
||||
return policy_loss, value_loss, policy_entropy
|
||||
|
||||
def save(save_path):
|
||||
ps = sess.run(params)
|
||||
joblib.dump(ps, save_path)
|
||||
|
||||
def load(load_path):
|
||||
loaded_params = joblib.load(load_path)
|
||||
restores = []
|
||||
for p, loaded_p in zip(params, loaded_params):
|
||||
restores.append(p.assign(loaded_p))
|
||||
sess.run(restores)
|
||||
|
||||
|
||||
|
||||
self.train = train
|
||||
self.save = functools.partial(save_variables, sess=sess)
|
||||
self.load = functools.partial(load_variables, sess=sess)
|
||||
self.save = save
|
||||
self.load = load
|
||||
self.train_model = train_model
|
||||
self.step_model = step_model
|
||||
self.step = step_model.step
|
||||
@@ -92,17 +105,12 @@ class Model(object):
|
||||
self.initial_state = step_model.initial_state
|
||||
tf.global_variables_initializer().run(session=sess)
|
||||
|
||||
def learn(network, env, seed, total_timesteps=int(40e6), gamma=0.99, log_interval=1, nprocs=32, nsteps=20,
|
||||
def learn(policy, env, seed, total_timesteps=int(40e6), gamma=0.99, log_interval=1, nprocs=32, nsteps=20,
|
||||
ent_coef=0.01, vf_coef=0.5, vf_fisher_coef=1.0, lr=0.25, max_grad_norm=0.5,
|
||||
kfac_clip=0.001, save_interval=None, lrschedule='linear', load_path=None, **network_kwargs):
|
||||
kfac_clip=0.001, save_interval=None, lrschedule='linear'):
|
||||
tf.reset_default_graph()
|
||||
set_global_seeds(seed)
|
||||
|
||||
|
||||
if network == 'cnn':
|
||||
network_kwargs['one_dim_bias'] = True
|
||||
|
||||
policy = build_policy(env, network, **network_kwargs)
|
||||
|
||||
nenvs = env.num_envs
|
||||
ob_space = env.observation_space
|
||||
ac_space = env.action_space
|
||||
@@ -115,9 +123,6 @@ def learn(network, env, seed, total_timesteps=int(40e6), gamma=0.99, log_interva
|
||||
with open(osp.join(logger.get_dir(), 'make_model.pkl'), 'wb') as fh:
|
||||
fh.write(cloudpickle.dumps(make_model))
|
||||
model = make_model()
|
||||
|
||||
if load_path is not None:
|
||||
model.load(load_path)
|
||||
|
||||
runner = Runner(env, model, nsteps=nsteps, gamma=gamma)
|
||||
nbatch = nenvs*nsteps
|
||||
@@ -148,4 +153,3 @@ def learn(network, env, seed, total_timesteps=int(40e6), gamma=0.99, log_interva
|
||||
coord.request_stop()
|
||||
coord.join(enqueue_threads)
|
||||
env.close()
|
||||
return model
|
||||
|
@@ -6,11 +6,11 @@ from baselines import logger
|
||||
from baselines.acktr.acktr_disc import learn
|
||||
from baselines.common.cmd_util import make_atari_env, atari_arg_parser
|
||||
from baselines.common.vec_env.vec_frame_stack import VecFrameStack
|
||||
from baselines.common.policies import cnn
|
||||
from baselines.ppo2.policies import CnnPolicy
|
||||
|
||||
def train(env_id, num_timesteps, seed, num_cpu):
|
||||
env = VecFrameStack(make_atari_env(env_id, num_cpu, seed), 4)
|
||||
policy_fn = cnn(env=env, one_dim_bias=True)
|
||||
policy_fn = partial(CnnPolicy, one_dim_bias=True)
|
||||
learn(policy_fn, env, seed, total_timesteps=int(num_timesteps * 1.1), nprocs=num_cpu)
|
||||
env.close()
|
||||
|
||||
|
@@ -59,7 +59,7 @@ register_benchmark({
|
||||
register_benchmark({
|
||||
'name': 'Atari10M',
|
||||
'description': '7 Atari games from Mnih et al. (2013), with pixel observations, 10M timesteps',
|
||||
'tasks': [{'desc': _game, 'env_id': _game + _ATARI_SUFFIX, 'trials': 6, 'num_timesteps': int(10e6)} for _game in _atari7]
|
||||
'tasks': [{'desc': _game, 'env_id': _game + _ATARI_SUFFIX, 'trials': 2, 'num_timesteps': int(10e6)} for _game in _atari7]
|
||||
})
|
||||
|
||||
register_benchmark({
|
||||
@@ -84,9 +84,8 @@ _mujocosmall = [
|
||||
register_benchmark({
|
||||
'name': 'Mujoco1M',
|
||||
'description': 'Some small 2D MuJoCo tasks, run for 1M timesteps',
|
||||
'tasks': [{'env_id': _envid, 'trials': 6, 'num_timesteps': int(1e6)} for _envid in _mujocosmall]
|
||||
'tasks': [{'env_id': _envid, 'trials': 3, 'num_timesteps': int(1e6)} for _envid in _mujocosmall]
|
||||
})
|
||||
|
||||
register_benchmark({
|
||||
'name': 'MujocoWalkers',
|
||||
'description': 'MuJoCo forward walkers, run for 8M, humanoid 100M',
|
||||
|
@@ -112,8 +112,6 @@ def load_results(dir):
|
||||
with open(fname, 'rt') as fh:
|
||||
if fname.endswith('csv'):
|
||||
firstline = fh.readline()
|
||||
if not firstline:
|
||||
continue
|
||||
assert firstline[0] == '#'
|
||||
header = json.loads(firstline[1:])
|
||||
df = pandas.read_csv(fh, index_col=None)
|
||||
@@ -160,4 +158,4 @@ def test_monitor():
|
||||
last_logline = pandas.read_csv(f, index_col=None)
|
||||
assert set(last_logline.keys()) == {'l', 't', 'r'}, "Incorrect keys in monitor logline"
|
||||
f.close()
|
||||
os.remove(mon_file)
|
||||
os.remove(mon_file)
|
@@ -1,6 +1,4 @@
|
||||
import numpy as np
|
||||
import os
|
||||
os.environ.setdefault('PATH', '')
|
||||
from collections import deque
|
||||
import gym
|
||||
from gym import spaces
|
||||
@@ -156,7 +154,7 @@ class FrameStack(gym.Wrapper):
|
||||
self.k = k
|
||||
self.frames = deque([], maxlen=k)
|
||||
shp = env.observation_space.shape
|
||||
self.observation_space = spaces.Box(low=0, high=255, shape=(shp[0], shp[1], shp[2] * k), dtype=env.observation_space.dtype)
|
||||
self.observation_space = spaces.Box(low=0, high=255, shape=(shp[0], shp[1], shp[2] * k), dtype=np.uint8)
|
||||
|
||||
def reset(self):
|
||||
ob = self.env.reset()
|
||||
@@ -176,7 +174,6 @@ class FrameStack(gym.Wrapper):
|
||||
class ScaledFloatFrame(gym.ObservationWrapper):
|
||||
def __init__(self, env):
|
||||
gym.ObservationWrapper.__init__(self, env)
|
||||
self.observation_space = gym.spaces.Box(low=0, high=1, shape=env.observation_space.shape, dtype=np.float32)
|
||||
|
||||
def observation(self, observation):
|
||||
# careful! This undoes the memory optimization, use
|
||||
|
@@ -3,11 +3,7 @@ Helpers for scripts like run_atari.py.
|
||||
"""
|
||||
|
||||
import os
|
||||
try:
|
||||
from mpi4py import MPI
|
||||
except ImportError:
|
||||
MPI = None
|
||||
|
||||
from mpi4py import MPI
|
||||
import gym
|
||||
from gym.wrappers import FlattenDictWrapper
|
||||
from baselines import logger
|
||||
@@ -21,32 +17,25 @@ def make_atari_env(env_id, num_env, seed, wrapper_kwargs=None, start_index=0):
|
||||
Create a wrapped, monitored SubprocVecEnv for Atari.
|
||||
"""
|
||||
if wrapper_kwargs is None: wrapper_kwargs = {}
|
||||
mpi_rank = MPI.COMM_WORLD.Get_rank() if MPI else 0
|
||||
def make_env(rank): # pylint: disable=C0111
|
||||
def _thunk():
|
||||
env = make_atari(env_id)
|
||||
env.seed(seed + 10000*mpi_rank + rank if seed is not None else None)
|
||||
env = Monitor(env, logger.get_dir() and os.path.join(logger.get_dir(), str(mpi_rank) + '.' + str(rank)))
|
||||
env.seed(seed + rank)
|
||||
env = Monitor(env, logger.get_dir() and os.path.join(logger.get_dir(), str(rank)))
|
||||
return wrap_deepmind(env, **wrapper_kwargs)
|
||||
return _thunk
|
||||
set_global_seeds(seed)
|
||||
return SubprocVecEnv([make_env(i + start_index) for i in range(num_env)])
|
||||
|
||||
def make_mujoco_env(env_id, seed, reward_scale=1.0):
|
||||
def make_mujoco_env(env_id, seed):
|
||||
"""
|
||||
Create a wrapped, monitored gym.Env for MuJoCo.
|
||||
"""
|
||||
rank = MPI.COMM_WORLD.Get_rank()
|
||||
myseed = seed + 1000 * rank if seed is not None else None
|
||||
set_global_seeds(myseed)
|
||||
set_global_seeds(seed + 10000 * rank)
|
||||
env = gym.make(env_id)
|
||||
env = Monitor(env, os.path.join(logger.get_dir(), str(rank)), allow_early_resets=True)
|
||||
env = Monitor(env, os.path.join(logger.get_dir(), str(rank)))
|
||||
env.seed(seed)
|
||||
|
||||
if reward_scale != 1.0:
|
||||
from baselines.common.retro_wrappers import RewardScaler
|
||||
env = RewardScaler(env, reward_scale)
|
||||
|
||||
return env
|
||||
|
||||
def make_robotics_env(env_id, seed, rank=0):
|
||||
@@ -73,27 +62,20 @@ def atari_arg_parser():
|
||||
"""
|
||||
Create an argparse.ArgumentParser for run_atari.py.
|
||||
"""
|
||||
print('Obsolete - use common_arg_parser instead')
|
||||
return common_arg_parser()
|
||||
parser = arg_parser()
|
||||
parser.add_argument('--env', help='environment ID', default='BreakoutNoFrameskip-v4')
|
||||
parser.add_argument('--seed', help='RNG seed', type=int, default=0)
|
||||
parser.add_argument('--num-timesteps', type=int, default=int(10e6))
|
||||
return parser
|
||||
|
||||
def mujoco_arg_parser():
|
||||
print('Obsolete - use common_arg_parser instead')
|
||||
return common_arg_parser()
|
||||
|
||||
def common_arg_parser():
|
||||
"""
|
||||
Create an argparse.ArgumentParser for run_mujoco.py.
|
||||
"""
|
||||
parser = arg_parser()
|
||||
parser.add_argument('--env', help='environment ID', type=str, default='Reacher-v2')
|
||||
parser.add_argument('--seed', help='RNG seed', type=int, default=None)
|
||||
parser.add_argument('--alg', help='Algorithm', type=str, default='ppo2')
|
||||
parser.add_argument('--num_timesteps', type=float, default=1e6),
|
||||
parser.add_argument('--network', help='network type (mlp, cnn, lstm, cnn_lstm, conv_only)', default=None)
|
||||
parser.add_argument('--gamestate', help='game state to load (so far only used in retro games)', default=None)
|
||||
parser.add_argument('--num_env', help='Number of environment copies being run in parallel. When not specified, set to number of cpus for Atari, and to 1 for Mujoco', default=None, type=int)
|
||||
parser.add_argument('--reward_scale', help='Reward scale factor. Default: 1.0', default=1.0, type=float)
|
||||
parser.add_argument('--save_path', help='Path to save trained model to', default=None, type=str)
|
||||
parser.add_argument('--seed', help='RNG seed', type=int, default=0)
|
||||
parser.add_argument('--num-timesteps', type=int, default=int(1e6))
|
||||
parser.add_argument('--play', default=False, action='store_true')
|
||||
return parser
|
||||
|
||||
@@ -103,24 +85,6 @@ def robotics_arg_parser():
|
||||
"""
|
||||
parser = arg_parser()
|
||||
parser.add_argument('--env', help='environment ID', type=str, default='FetchReach-v0')
|
||||
parser.add_argument('--seed', help='RNG seed', type=int, default=None)
|
||||
parser.add_argument('--seed', help='RNG seed', type=int, default=0)
|
||||
parser.add_argument('--num-timesteps', type=int, default=int(1e6))
|
||||
return parser
|
||||
|
||||
|
||||
def parse_unknown_args(args):
|
||||
"""
|
||||
Parse arguments not consumed by arg parser into a dicitonary
|
||||
"""
|
||||
retval = {}
|
||||
for arg in args:
|
||||
assert arg.startswith('--')
|
||||
assert '=' in arg, 'cannot parse arg {}'.format(arg)
|
||||
key = arg.split('=')[0][2:]
|
||||
value = arg.split('=')[1]
|
||||
retval[key] = value
|
||||
|
||||
return retval
|
||||
|
||||
|
||||
|
||||
|
@@ -85,7 +85,7 @@ class DiagGaussianPdType(PdType):
|
||||
|
||||
def pdfromlatent(self, latent_vector, init_scale=1.0, init_bias=0.0):
|
||||
mean = fc(latent_vector, 'pi', self.size, init_scale=init_scale, init_bias=init_bias)
|
||||
logstd = tf.get_variable(name='pi/logstd', shape=[1, self.size], initializer=tf.zeros_initializer())
|
||||
logstd = tf.get_variable(name='logstd', shape=[1, self.size], initializer=tf.zeros_initializer())
|
||||
pdparam = tf.concat([mean, mean * 0.0 + logstd], axis=1)
|
||||
return self.pdfromflat(pdparam), mean
|
||||
|
||||
@@ -143,26 +143,26 @@ class CategoricalPd(Pd):
|
||||
# Note: we can't use sparse_softmax_cross_entropy_with_logits because
|
||||
# the implementation does not allow second-order derivatives...
|
||||
one_hot_actions = tf.one_hot(x, self.logits.get_shape().as_list()[-1])
|
||||
return tf.nn.softmax_cross_entropy_with_logits_v2(
|
||||
return tf.nn.softmax_cross_entropy_with_logits(
|
||||
logits=self.logits,
|
||||
labels=one_hot_actions)
|
||||
def kl(self, other):
|
||||
a0 = self.logits - tf.reduce_max(self.logits, axis=-1, keepdims=True)
|
||||
a1 = other.logits - tf.reduce_max(other.logits, axis=-1, keepdims=True)
|
||||
a0 = self.logits - tf.reduce_max(self.logits, axis=-1, keep_dims=True)
|
||||
a1 = other.logits - tf.reduce_max(other.logits, axis=-1, keep_dims=True)
|
||||
ea0 = tf.exp(a0)
|
||||
ea1 = tf.exp(a1)
|
||||
z0 = tf.reduce_sum(ea0, axis=-1, keepdims=True)
|
||||
z1 = tf.reduce_sum(ea1, axis=-1, keepdims=True)
|
||||
z0 = tf.reduce_sum(ea0, axis=-1, keep_dims=True)
|
||||
z1 = tf.reduce_sum(ea1, axis=-1, keep_dims=True)
|
||||
p0 = ea0 / z0
|
||||
return tf.reduce_sum(p0 * (a0 - tf.log(z0) - a1 + tf.log(z1)), axis=-1)
|
||||
def entropy(self):
|
||||
a0 = self.logits - tf.reduce_max(self.logits, axis=-1, keepdims=True)
|
||||
a0 = self.logits - tf.reduce_max(self.logits, axis=-1, keep_dims=True)
|
||||
ea0 = tf.exp(a0)
|
||||
z0 = tf.reduce_sum(ea0, axis=-1, keepdims=True)
|
||||
z0 = tf.reduce_sum(ea0, axis=-1, keep_dims=True)
|
||||
p0 = ea0 / z0
|
||||
return tf.reduce_sum(p0 * (tf.log(z0) - a0), axis=-1)
|
||||
def sample(self):
|
||||
u = tf.random_uniform(tf.shape(self.logits), dtype=self.logits.dtype)
|
||||
u = tf.random_uniform(tf.shape(self.logits))
|
||||
return tf.argmax(self.logits - tf.log(-tf.log(u)), axis=-1)
|
||||
@classmethod
|
||||
def fromflat(cls, flat):
|
||||
|
@@ -1,56 +1,30 @@
|
||||
import tensorflow as tf
|
||||
from gym.spaces import Discrete, Box
|
||||
|
||||
def observation_placeholder(ob_space, batch_size=None, name='Ob'):
|
||||
'''
|
||||
Create placeholder to feed observations into of the size appropriate to the observation space
|
||||
|
||||
Parameters:
|
||||
----------
|
||||
|
||||
ob_space: gym.Space observation space
|
||||
|
||||
batch_size: int size of the batch to be fed into input. Can be left None in most cases.
|
||||
|
||||
name: str name of the placeholder
|
||||
|
||||
Returns:
|
||||
-------
|
||||
|
||||
tensorflow placeholder tensor
|
||||
'''
|
||||
|
||||
assert isinstance(ob_space, Discrete) or isinstance(ob_space, Box), \
|
||||
'Can only deal with Discrete and Box observation spaces for now'
|
||||
|
||||
return tf.placeholder(shape=(batch_size,) + ob_space.shape, dtype=ob_space.dtype, name=name)
|
||||
|
||||
|
||||
def observation_input(ob_space, batch_size=None, name='Ob'):
|
||||
'''
|
||||
Create placeholder to feed observations into of the size appropriate to the observation space, and add input
|
||||
encoder of the appropriate type.
|
||||
'''
|
||||
|
||||
placeholder = observation_placeholder(ob_space, batch_size, name)
|
||||
return placeholder, encode_observation(ob_space, placeholder)
|
||||
|
||||
def encode_observation(ob_space, placeholder):
|
||||
'''
|
||||
Encode input in the way that is appropriate to the observation space
|
||||
|
||||
Parameters:
|
||||
----------
|
||||
Build observation input with encoding depending on the
|
||||
observation space type
|
||||
Params:
|
||||
|
||||
ob_space: gym.Space observation space
|
||||
|
||||
placeholder: tf.placeholder observation input placeholder
|
||||
ob_space: observation space (should be one of gym.spaces)
|
||||
batch_size: batch size for input (default is None, so that resulting input placeholder can take tensors with any batch size)
|
||||
name: tensorflow variable name for input placeholder
|
||||
|
||||
returns: tuple (input_placeholder, processed_input_tensor)
|
||||
'''
|
||||
if isinstance(ob_space, Discrete):
|
||||
return tf.to_float(tf.one_hot(placeholder, ob_space.n))
|
||||
input_x = tf.placeholder(shape=(batch_size,), dtype=tf.int32, name=name)
|
||||
processed_x = tf.to_float(tf.one_hot(input_x, ob_space.n))
|
||||
return input_x, processed_x
|
||||
|
||||
elif isinstance(ob_space, Box):
|
||||
return tf.to_float(placeholder)
|
||||
input_shape = (batch_size,) + ob_space.shape
|
||||
input_x = tf.placeholder(shape=input_shape, dtype=ob_space.dtype, name=name)
|
||||
processed_x = tf.to_float(input_x)
|
||||
return input_x, processed_x
|
||||
|
||||
else:
|
||||
raise NotImplementedError
|
||||
|
||||
|
||||
|
@@ -67,21 +67,14 @@ class EzPickle(object):
|
||||
|
||||
|
||||
def set_global_seeds(i):
|
||||
try:
|
||||
import MPI
|
||||
rank = MPI.COMM_WORLD.Get_rank()
|
||||
except ImportError:
|
||||
rank = 0
|
||||
|
||||
myseed = i + 1000 * rank if i is not None else None
|
||||
try:
|
||||
import tensorflow as tf
|
||||
except ImportError:
|
||||
pass
|
||||
else:
|
||||
tf.set_random_seed(myseed)
|
||||
np.random.seed(myseed)
|
||||
random.seed(myseed)
|
||||
tf.set_random_seed(i)
|
||||
np.random.seed(i)
|
||||
random.seed(i)
|
||||
|
||||
|
||||
def pretty_eta(seconds_left):
|
||||
|
@@ -1,177 +0,0 @@
|
||||
import numpy as np
|
||||
import tensorflow as tf
|
||||
from baselines.a2c import utils
|
||||
from baselines.a2c.utils import conv, fc, conv_to_fc, batch_to_seq, seq_to_batch
|
||||
from baselines.common.mpi_running_mean_std import RunningMeanStd
|
||||
import tensorflow.contrib.layers as layers
|
||||
|
||||
|
||||
def nature_cnn(unscaled_images, **conv_kwargs):
|
||||
"""
|
||||
CNN from Nature paper.
|
||||
"""
|
||||
scaled_images = tf.cast(unscaled_images, tf.float32) / 255.
|
||||
activ = tf.nn.relu
|
||||
h = activ(conv(scaled_images, 'c1', nf=32, rf=8, stride=4, init_scale=np.sqrt(2),
|
||||
**conv_kwargs))
|
||||
h2 = activ(conv(h, 'c2', nf=64, rf=4, stride=2, init_scale=np.sqrt(2), **conv_kwargs))
|
||||
h3 = activ(conv(h2, 'c3', nf=64, rf=3, stride=1, init_scale=np.sqrt(2), **conv_kwargs))
|
||||
h3 = conv_to_fc(h3)
|
||||
return activ(fc(h3, 'fc1', nh=512, init_scale=np.sqrt(2)))
|
||||
|
||||
|
||||
def mlp(num_layers=2, num_hidden=64, activation=tf.tanh):
|
||||
"""
|
||||
Simple fully connected layer policy. Separate stacks of fully-connected layers are used for policy and value function estimation.
|
||||
More customized fully-connected policies can be obtained by using PolicyWithV class directly.
|
||||
|
||||
Parameters:
|
||||
----------
|
||||
|
||||
num_layers: int number of fully-connected layers (default: 2)
|
||||
|
||||
num_hidden: int size of fully-connected layers (default: 64)
|
||||
|
||||
activation: activation function (default: tf.tanh)
|
||||
|
||||
Returns:
|
||||
-------
|
||||
|
||||
function that builds fully connected network with a given input placeholder
|
||||
"""
|
||||
def network_fn(X):
|
||||
h = tf.layers.flatten(X)
|
||||
for i in range(num_layers):
|
||||
h = activation(fc(h, 'mlp_fc{}'.format(i), nh=num_hidden, init_scale=np.sqrt(2)))
|
||||
return h, None
|
||||
|
||||
return network_fn
|
||||
|
||||
|
||||
def cnn(**conv_kwargs):
|
||||
def network_fn(X):
|
||||
return nature_cnn(X, **conv_kwargs), None
|
||||
return network_fn
|
||||
|
||||
def cnn_small(**conv_kwargs):
|
||||
def network_fn(X):
|
||||
h = tf.cast(X, tf.float32) / 255.
|
||||
|
||||
activ = tf.nn.relu
|
||||
h = activ(conv(h, 'c1', nf=8, rf=8, stride=4, init_scale=np.sqrt(2), **conv_kwargs))
|
||||
h = activ(conv(h, 'c2', nf=16, rf=4, stride=2, init_scale=np.sqrt(2), **conv_kwargs))
|
||||
h = conv_to_fc(h)
|
||||
h = activ(fc(h, 'fc1', nh=128, init_scale=np.sqrt(2)))
|
||||
return h, None
|
||||
return network_fn
|
||||
|
||||
|
||||
|
||||
def lstm(nlstm=128, layer_norm=False):
|
||||
def network_fn(X, nenv=1):
|
||||
nbatch = X.shape[0]
|
||||
nsteps = nbatch // nenv
|
||||
|
||||
h = tf.layers.flatten(X)
|
||||
|
||||
M = tf.placeholder(tf.float32, [nbatch]) #mask (done t-1)
|
||||
S = tf.placeholder(tf.float32, [nenv, 2*nlstm]) #states
|
||||
|
||||
xs = batch_to_seq(h, nenv, nsteps)
|
||||
ms = batch_to_seq(M, nenv, nsteps)
|
||||
|
||||
if layer_norm:
|
||||
h5, snew = utils.lnlstm(xs, ms, S, scope='lnlstm', nh=nlstm)
|
||||
else:
|
||||
h5, snew = utils.lstm(xs, ms, S, scope='lstm', nh=nlstm)
|
||||
|
||||
h = seq_to_batch(h5)
|
||||
initial_state = np.zeros(S.shape.as_list(), dtype=float)
|
||||
|
||||
return h, {'S':S, 'M':M, 'state':snew, 'initial_state':initial_state}
|
||||
|
||||
return network_fn
|
||||
|
||||
|
||||
def cnn_lstm(nlstm=128, layer_norm=False, **conv_kwargs):
|
||||
def network_fn(X, nenv=1):
|
||||
nbatch = X.shape[0]
|
||||
nsteps = nbatch // nenv
|
||||
|
||||
h = nature_cnn(X, **conv_kwargs)
|
||||
|
||||
M = tf.placeholder(tf.float32, [nbatch]) #mask (done t-1)
|
||||
S = tf.placeholder(tf.float32, [nenv, 2*nlstm]) #states
|
||||
|
||||
xs = batch_to_seq(h, nenv, nsteps)
|
||||
ms = batch_to_seq(M, nenv, nsteps)
|
||||
|
||||
if layer_norm:
|
||||
h5, snew = utils.lnlstm(xs, ms, S, scope='lnlstm', nh=nlstm)
|
||||
else:
|
||||
h5, snew = utils.lstm(xs, ms, S, scope='lstm', nh=nlstm)
|
||||
|
||||
h = seq_to_batch(h5)
|
||||
initial_state = np.zeros(S.shape.as_list(), dtype=float)
|
||||
|
||||
return h, {'S':S, 'M':M, 'state':snew, 'initial_state':initial_state}
|
||||
|
||||
return network_fn
|
||||
|
||||
def cnn_lnlstm(nlstm=128, **conv_kwargs):
|
||||
return cnn_lstm(nlstm, layer_norm=True, **conv_kwargs)
|
||||
|
||||
|
||||
def conv_only(convs=[(32, 8, 4), (64, 4, 2), (64, 3, 1)], **conv_kwargs):
|
||||
'''
|
||||
convolutions-only net
|
||||
|
||||
Parameters:
|
||||
----------
|
||||
|
||||
conv: list of triples (filter_number, filter_size, stride) specifying parameters for each layer.
|
||||
|
||||
Returns:
|
||||
|
||||
function that takes tensorflow tensor as input and returns the output of the last convolutional layer
|
||||
|
||||
'''
|
||||
|
||||
def network_fn(X):
|
||||
out = tf.cast(X, tf.float32) / 255.
|
||||
with tf.variable_scope("convnet"):
|
||||
for num_outputs, kernel_size, stride in convs:
|
||||
out = layers.convolution2d(out,
|
||||
num_outputs=num_outputs,
|
||||
kernel_size=kernel_size,
|
||||
stride=stride,
|
||||
activation_fn=tf.nn.relu,
|
||||
**conv_kwargs)
|
||||
|
||||
return out, None
|
||||
return network_fn
|
||||
|
||||
def _normalize_clip_observation(x, clip_range=[-5.0, 5.0]):
|
||||
rms = RunningMeanStd(shape=x.shape[1:])
|
||||
norm_x = tf.clip_by_value((x - rms.mean) / rms.std, min(clip_range), max(clip_range))
|
||||
return norm_x, rms
|
||||
|
||||
|
||||
def get_network_builder(name):
|
||||
# TODO: replace with reflection?
|
||||
if name == 'cnn':
|
||||
return cnn
|
||||
elif name == 'cnn_small':
|
||||
return cnn_small
|
||||
elif name == 'conv_only':
|
||||
return conv_only
|
||||
elif name == 'mlp':
|
||||
return mlp
|
||||
elif name == 'lstm':
|
||||
return lstm
|
||||
elif name == 'cnn_lstm':
|
||||
return cnn_lstm
|
||||
elif name == 'cnn_lnlstm':
|
||||
return cnn_lnlstm
|
||||
else:
|
||||
raise ValueError('Unknown network type: {}'.format(name))
|
@@ -1,31 +0,0 @@
|
||||
import numpy as np
|
||||
import tensorflow as tf
|
||||
from mpi4py import MPI
|
||||
|
||||
class MpiAdamOptimizer(tf.train.AdamOptimizer):
|
||||
"""Adam optimizer that averages gradients across mpi processes."""
|
||||
def __init__(self, comm, **kwargs):
|
||||
self.comm = comm
|
||||
tf.train.AdamOptimizer.__init__(self, **kwargs)
|
||||
def compute_gradients(self, loss, var_list, **kwargs):
|
||||
grads_and_vars = tf.train.AdamOptimizer.compute_gradients(self, loss, var_list, **kwargs)
|
||||
grads_and_vars = [(g, v) for g, v in grads_and_vars if g is not None]
|
||||
flat_grad = tf.concat([tf.reshape(g, (-1,)) for g, v in grads_and_vars], axis=0)
|
||||
shapes = [v.shape.as_list() for g, v in grads_and_vars]
|
||||
sizes = [int(np.prod(s)) for s in shapes]
|
||||
|
||||
num_tasks = self.comm.Get_size()
|
||||
buf = np.zeros(sum(sizes), np.float32)
|
||||
|
||||
def _collect_grads(flat_grad):
|
||||
self.comm.Allreduce(flat_grad, buf, op=MPI.SUM)
|
||||
np.divide(buf, float(num_tasks), out=buf)
|
||||
return buf
|
||||
|
||||
avg_flat_grad = tf.py_func(_collect_grads, [flat_grad], tf.float32)
|
||||
avg_flat_grad.set_shape(flat_grad.shape)
|
||||
avg_grads = tf.split(avg_flat_grad, sizes, axis=0)
|
||||
avg_grads_and_vars = [(tf.reshape(g, v.shape), v)
|
||||
for g, (_, v) in zip(avg_grads, grads_and_vars)]
|
||||
|
||||
return avg_grads_and_vars
|
@@ -1,101 +0,0 @@
|
||||
from collections import defaultdict
|
||||
from mpi4py import MPI
|
||||
import os, numpy as np
|
||||
import platform
|
||||
import shutil
|
||||
import subprocess
|
||||
|
||||
def sync_from_root(sess, variables, comm=None):
|
||||
"""
|
||||
Send the root node's parameters to every worker.
|
||||
Arguments:
|
||||
sess: the TensorFlow session.
|
||||
variables: all parameter variables including optimizer's
|
||||
"""
|
||||
if comm is None: comm = MPI.COMM_WORLD
|
||||
rank = comm.Get_rank()
|
||||
for var in variables:
|
||||
if rank == 0:
|
||||
comm.Bcast(sess.run(var))
|
||||
else:
|
||||
import tensorflow as tf
|
||||
returned_var = np.empty(var.shape, dtype='float32')
|
||||
comm.Bcast(returned_var)
|
||||
sess.run(tf.assign(var, returned_var))
|
||||
|
||||
def gpu_count():
|
||||
"""
|
||||
Count the GPUs on this machine.
|
||||
"""
|
||||
if shutil.which('nvidia-smi') is None:
|
||||
return 0
|
||||
output = subprocess.check_output(['nvidia-smi', '--query-gpu=gpu_name', '--format=csv'])
|
||||
return max(0, len(output.split(b'\n')) - 2)
|
||||
|
||||
def setup_mpi_gpus():
|
||||
"""
|
||||
Set CUDA_VISIBLE_DEVICES using MPI.
|
||||
"""
|
||||
num_gpus = gpu_count()
|
||||
if num_gpus == 0:
|
||||
return
|
||||
local_rank, _ = get_local_rank_size(MPI.COMM_WORLD)
|
||||
os.environ['CUDA_VISIBLE_DEVICES'] = str(local_rank % num_gpus)
|
||||
|
||||
def get_local_rank_size(comm):
|
||||
"""
|
||||
Returns the rank of each process on its machine
|
||||
The processes on a given machine will be assigned ranks
|
||||
0, 1, 2, ..., N-1,
|
||||
where N is the number of processes on this machine.
|
||||
|
||||
Useful if you want to assign one gpu per machine
|
||||
"""
|
||||
this_node = platform.node()
|
||||
ranks_nodes = comm.allgather((comm.Get_rank(), this_node))
|
||||
node2rankssofar = defaultdict(int)
|
||||
local_rank = None
|
||||
for (rank, node) in ranks_nodes:
|
||||
if rank == comm.Get_rank():
|
||||
local_rank = node2rankssofar[node]
|
||||
node2rankssofar[node] += 1
|
||||
assert local_rank is not None
|
||||
return local_rank, node2rankssofar[this_node]
|
||||
|
||||
def share_file(comm, path):
|
||||
"""
|
||||
Copies the file from rank 0 to all other ranks
|
||||
Puts it in the same place on all machines
|
||||
"""
|
||||
localrank, _ = get_local_rank_size(comm)
|
||||
if comm.Get_rank() == 0:
|
||||
with open(path, 'rb') as fh:
|
||||
data = fh.read()
|
||||
comm.bcast(data)
|
||||
else:
|
||||
data = comm.bcast(None)
|
||||
if localrank == 0:
|
||||
os.makedirs(os.path.dirname(path), exist_ok=True)
|
||||
with open(path, 'wb') as fh:
|
||||
fh.write(data)
|
||||
comm.Barrier()
|
||||
|
||||
def dict_gather(comm, d, op='mean', assert_all_have_data=True):
|
||||
if comm is None: return d
|
||||
alldicts = comm.allgather(d)
|
||||
size = comm.size
|
||||
k2li = defaultdict(list)
|
||||
for d in alldicts:
|
||||
for (k,v) in d.items():
|
||||
k2li[k].append(v)
|
||||
result = {}
|
||||
for (k,li) in k2li.items():
|
||||
if assert_all_have_data:
|
||||
assert len(li)==size, "only %i out of %i MPI workers have sent '%s'" % (len(li), size, k)
|
||||
if op=='mean':
|
||||
result[k] = np.mean(li, axis=0)
|
||||
elif op=='sum':
|
||||
result[k] = np.sum(li, axis=0)
|
||||
else:
|
||||
assert 0, op
|
||||
return result
|
@@ -1,179 +0,0 @@
|
||||
import tensorflow as tf
|
||||
from baselines.common import tf_util
|
||||
from baselines.a2c.utils import fc
|
||||
from baselines.common.distributions import make_pdtype
|
||||
from baselines.common.input import observation_placeholder, encode_observation
|
||||
from baselines.common.tf_util import adjust_shape
|
||||
from baselines.common.mpi_running_mean_std import RunningMeanStd
|
||||
from baselines.common.models import get_network_builder
|
||||
|
||||
import gym
|
||||
|
||||
|
||||
class PolicyWithValue(object):
|
||||
"""
|
||||
Encapsulates fields and methods for RL policy and value function estimation with shared parameters
|
||||
"""
|
||||
|
||||
def __init__(self, env, observations, latent, estimate_q=False, vf_latent=None, sess=None, **tensors):
|
||||
"""
|
||||
Parameters:
|
||||
----------
|
||||
env RL environment
|
||||
|
||||
observations tensorflow placeholder in which the observations will be fed
|
||||
|
||||
latent latent state from which policy distribution parameters should be inferred
|
||||
|
||||
vf_latent latent state from which value function should be inferred (if None, then latent is used)
|
||||
|
||||
sess tensorflow session to run calculations in (if None, default session is used)
|
||||
|
||||
**tensors tensorflow tensors for additional attributes such as state or mask
|
||||
|
||||
"""
|
||||
|
||||
self.X = observations
|
||||
self.state = tf.constant([])
|
||||
self.initial_state = None
|
||||
self.__dict__.update(tensors)
|
||||
|
||||
vf_latent = vf_latent if vf_latent is not None else latent
|
||||
|
||||
vf_latent = tf.layers.flatten(vf_latent)
|
||||
latent = tf.layers.flatten(latent)
|
||||
|
||||
self.pdtype = make_pdtype(env.action_space)
|
||||
|
||||
self.pd, self.pi = self.pdtype.pdfromlatent(latent, init_scale=0.01)
|
||||
|
||||
self.action = self.pd.sample()
|
||||
self.neglogp = self.pd.neglogp(self.action)
|
||||
self.sess = sess
|
||||
|
||||
if estimate_q:
|
||||
assert isinstance(env.action_space, gym.spaces.Discrete)
|
||||
self.q = fc(vf_latent, 'q', env.action_space.n)
|
||||
self.vf = self.q
|
||||
else:
|
||||
self.vf = fc(vf_latent, 'vf', 1)
|
||||
self.vf = self.vf[:,0]
|
||||
|
||||
def _evaluate(self, variables, observation, **extra_feed):
|
||||
sess = self.sess or tf.get_default_session()
|
||||
feed_dict = {self.X: adjust_shape(self.X, observation)}
|
||||
for inpt_name, data in extra_feed.items():
|
||||
if inpt_name in self.__dict__.keys():
|
||||
inpt = self.__dict__[inpt_name]
|
||||
if isinstance(inpt, tf.Tensor) and inpt._op.type == 'Placeholder':
|
||||
feed_dict[inpt] = adjust_shape(inpt, data)
|
||||
|
||||
return sess.run(variables, feed_dict)
|
||||
|
||||
def step(self, observation, **extra_feed):
|
||||
"""
|
||||
Compute next action(s) given the observaion(s)
|
||||
|
||||
Parameters:
|
||||
----------
|
||||
|
||||
observation observation data (either single or a batch)
|
||||
|
||||
**extra_feed additional data such as state or mask (names of the arguments should match the ones in constructor, see __init__)
|
||||
|
||||
Returns:
|
||||
-------
|
||||
(action, value estimate, next state, negative log likelihood of the action under current policy parameters) tuple
|
||||
"""
|
||||
|
||||
a, v, state, neglogp = self._evaluate([self.action, self.vf, self.state, self.neglogp], observation, **extra_feed)
|
||||
if state.size == 0:
|
||||
state = None
|
||||
return a, v, state, neglogp
|
||||
|
||||
def value(self, ob, *args, **kwargs):
|
||||
"""
|
||||
Compute value estimate(s) given the observaion(s)
|
||||
|
||||
Parameters:
|
||||
----------
|
||||
|
||||
observation observation data (either single or a batch)
|
||||
|
||||
**extra_feed additional data such as state or mask (names of the arguments should match the ones in constructor, see __init__)
|
||||
|
||||
Returns:
|
||||
-------
|
||||
value estimate
|
||||
"""
|
||||
return self._evaluate(self.vf, ob, *args, **kwargs)
|
||||
|
||||
def save(self, save_path):
|
||||
tf_util.save_state(save_path, sess=self.sess)
|
||||
|
||||
def load(self, load_path):
|
||||
tf_util.load_state(load_path, sess=self.sess)
|
||||
|
||||
def build_policy(env, policy_network, value_network=None, normalize_observations=False, estimate_q=False, **policy_kwargs):
|
||||
if isinstance(policy_network, str):
|
||||
network_type = policy_network
|
||||
policy_network = get_network_builder(network_type)(**policy_kwargs)
|
||||
|
||||
def policy_fn(nbatch=None, nsteps=None, sess=None, observ_placeholder=None):
|
||||
ob_space = env.observation_space
|
||||
|
||||
X = observ_placeholder if observ_placeholder is not None else observation_placeholder(ob_space, batch_size=nbatch)
|
||||
|
||||
extra_tensors = {}
|
||||
|
||||
if normalize_observations and X.dtype == tf.float32:
|
||||
encoded_x, rms = _normalize_clip_observation(X)
|
||||
extra_tensors['rms'] = rms
|
||||
else:
|
||||
encoded_x = X
|
||||
|
||||
encoded_x = encode_observation(ob_space, encoded_x)
|
||||
|
||||
with tf.variable_scope('pi', reuse=tf.AUTO_REUSE):
|
||||
policy_latent, recurrent_tensors = policy_network(encoded_x)
|
||||
|
||||
if recurrent_tensors is not None:
|
||||
# recurrent architecture, need a few more steps
|
||||
nenv = nbatch // nsteps
|
||||
assert nenv > 0, 'Bad input for recurrent policy: batch size {} smaller than nsteps {}'.format(nbatch, nsteps)
|
||||
policy_latent, recurrent_tensors = policy_network(encoded_x, nenv)
|
||||
extra_tensors.update(recurrent_tensors)
|
||||
|
||||
|
||||
_v_net = value_network
|
||||
|
||||
if _v_net is None or _v_net == 'shared':
|
||||
vf_latent = policy_latent
|
||||
else:
|
||||
if _v_net == 'copy':
|
||||
_v_net = policy_network
|
||||
else:
|
||||
assert callable(_v_net)
|
||||
|
||||
with tf.variable_scope('vf', reuse=tf.AUTO_REUSE):
|
||||
vf_latent, _ = _v_net(encoded_x)
|
||||
|
||||
policy = PolicyWithValue(
|
||||
env=env,
|
||||
observations=X,
|
||||
latent=policy_latent,
|
||||
vf_latent=vf_latent,
|
||||
sess=sess,
|
||||
estimate_q=estimate_q,
|
||||
**extra_tensors
|
||||
)
|
||||
return policy
|
||||
|
||||
return policy_fn
|
||||
|
||||
|
||||
def _normalize_clip_observation(x, clip_range=[-5.0, 5.0]):
|
||||
rms = RunningMeanStd(shape=x.shape[1:])
|
||||
norm_x = tf.clip_by_value((x - rms.mean) / rms.std, min(clip_range), max(clip_range))
|
||||
return norm_x, rms
|
||||
|
@@ -1,293 +0,0 @@
|
||||
# flake8: noqa F403, F405
|
||||
from .atari_wrappers import *
|
||||
import numpy as np
|
||||
import gym
|
||||
|
||||
class TimeLimit(gym.Wrapper):
|
||||
def __init__(self, env, max_episode_steps=None):
|
||||
super(TimeLimit, self).__init__(env)
|
||||
self._max_episode_steps = max_episode_steps
|
||||
self._elapsed_steps = 0
|
||||
|
||||
def step(self, ac):
|
||||
observation, reward, done, info = self.env.step(ac)
|
||||
self._elapsed_steps += 1
|
||||
if self._elapsed_steps >= self._max_episode_steps:
|
||||
done = True
|
||||
info['TimeLimit.truncated'] = True
|
||||
return observation, reward, done, info
|
||||
|
||||
def reset(self, **kwargs):
|
||||
self._elapsed_steps = 0
|
||||
return self.env.reset(**kwargs)
|
||||
|
||||
class StochasticFrameSkip(gym.Wrapper):
|
||||
def __init__(self, env, n, stickprob):
|
||||
gym.Wrapper.__init__(self, env)
|
||||
self.n = n
|
||||
self.stickprob = stickprob
|
||||
self.curac = None
|
||||
self.rng = np.random.RandomState()
|
||||
self.supports_want_render = hasattr(env, "supports_want_render")
|
||||
|
||||
def reset(self, **kwargs):
|
||||
self.curac = None
|
||||
return self.env.reset(**kwargs)
|
||||
|
||||
def step(self, ac):
|
||||
done = False
|
||||
totrew = 0
|
||||
for i in range(self.n):
|
||||
# First step after reset, use action
|
||||
if self.curac is None:
|
||||
self.curac = ac
|
||||
# First substep, delay with probability=stickprob
|
||||
elif i==0:
|
||||
if self.rng.rand() > self.stickprob:
|
||||
self.curac = ac
|
||||
# Second substep, new action definitely kicks in
|
||||
elif i==1:
|
||||
self.curac = ac
|
||||
if self.supports_want_render and i<self.n-1:
|
||||
ob, rew, done, info = self.env.step(self.curac, want_render=False)
|
||||
else:
|
||||
ob, rew, done, info = self.env.step(self.curac)
|
||||
totrew += rew
|
||||
if done: break
|
||||
return ob, totrew, done, info
|
||||
|
||||
def seed(self, s):
|
||||
self.rng.seed(s)
|
||||
|
||||
class PartialFrameStack(gym.Wrapper):
|
||||
def __init__(self, env, k, channel=1):
|
||||
"""
|
||||
Stack one channel (channel keyword) from previous frames
|
||||
"""
|
||||
gym.Wrapper.__init__(self, env)
|
||||
shp = env.observation_space.shape
|
||||
self.channel = channel
|
||||
self.observation_space = gym.spaces.Box(low=0, high=255,
|
||||
shape=(shp[0], shp[1], shp[2] + k - 1),
|
||||
dtype=env.observation_space.dtype)
|
||||
self.k = k
|
||||
self.frames = deque([], maxlen=k)
|
||||
shp = env.observation_space.shape
|
||||
|
||||
def reset(self):
|
||||
ob = self.env.reset()
|
||||
assert ob.shape[2] > self.channel
|
||||
for _ in range(self.k):
|
||||
self.frames.append(ob)
|
||||
return self._get_ob()
|
||||
|
||||
def step(self, ac):
|
||||
ob, reward, done, info = self.env.step(ac)
|
||||
self.frames.append(ob)
|
||||
return self._get_ob(), reward, done, info
|
||||
|
||||
def _get_ob(self):
|
||||
assert len(self.frames) == self.k
|
||||
return np.concatenate([frame if i==self.k-1 else frame[:,:,self.channel:self.channel+1]
|
||||
for (i, frame) in enumerate(self.frames)], axis=2)
|
||||
|
||||
class Downsample(gym.ObservationWrapper):
|
||||
def __init__(self, env, ratio):
|
||||
"""
|
||||
Downsample images by a factor of ratio
|
||||
"""
|
||||
gym.ObservationWrapper.__init__(self, env)
|
||||
(oldh, oldw, oldc) = env.observation_space.shape
|
||||
newshape = (oldh//ratio, oldw//ratio, oldc)
|
||||
self.observation_space = spaces.Box(low=0, high=255,
|
||||
shape=newshape, dtype=np.uint8)
|
||||
|
||||
def observation(self, frame):
|
||||
height, width, _ = self.observation_space.shape
|
||||
frame = cv2.resize(frame, (width, height), interpolation=cv2.INTER_AREA)
|
||||
if frame.ndim == 2:
|
||||
frame = frame[:,:,None]
|
||||
return frame
|
||||
|
||||
class Rgb2gray(gym.ObservationWrapper):
|
||||
def __init__(self, env):
|
||||
"""
|
||||
Downsample images by a factor of ratio
|
||||
"""
|
||||
gym.ObservationWrapper.__init__(self, env)
|
||||
(oldh, oldw, _oldc) = env.observation_space.shape
|
||||
self.observation_space = spaces.Box(low=0, high=255,
|
||||
shape=(oldh, oldw, 1), dtype=np.uint8)
|
||||
|
||||
def observation(self, frame):
|
||||
frame = cv2.cvtColor(frame, cv2.COLOR_RGB2GRAY)
|
||||
return frame[:,:,None]
|
||||
|
||||
|
||||
class MovieRecord(gym.Wrapper):
|
||||
def __init__(self, env, savedir, k):
|
||||
gym.Wrapper.__init__(self, env)
|
||||
self.savedir = savedir
|
||||
self.k = k
|
||||
self.epcount = 0
|
||||
def reset(self):
|
||||
if self.epcount % self.k == 0:
|
||||
print('saving movie this episode', self.savedir)
|
||||
self.env.unwrapped.movie_path = self.savedir
|
||||
else:
|
||||
print('not saving this episode')
|
||||
self.env.unwrapped.movie_path = None
|
||||
self.env.unwrapped.movie = None
|
||||
self.epcount += 1
|
||||
return self.env.reset()
|
||||
|
||||
class AppendTimeout(gym.Wrapper):
|
||||
def __init__(self, env):
|
||||
gym.Wrapper.__init__(self, env)
|
||||
self.action_space = env.action_space
|
||||
self.timeout_space = gym.spaces.Box(low=np.array([0.0]), high=np.array([1.0]), dtype=np.float32)
|
||||
self.original_os = env.observation_space
|
||||
if isinstance(self.original_os, gym.spaces.Dict):
|
||||
import copy
|
||||
ordered_dict = copy.deepcopy(self.original_os.spaces)
|
||||
ordered_dict['value_estimation_timeout'] = self.timeout_space
|
||||
self.observation_space = gym.spaces.Dict(ordered_dict)
|
||||
self.dict_mode = True
|
||||
else:
|
||||
self.observation_space = gym.spaces.Dict({
|
||||
'original': self.original_os,
|
||||
'value_estimation_timeout': self.timeout_space
|
||||
})
|
||||
self.dict_mode = False
|
||||
self.ac_count = None
|
||||
while 1:
|
||||
if not hasattr(env, "_max_episode_steps"): # Looking for TimeLimit wrapper that has this field
|
||||
env = env.env
|
||||
continue
|
||||
break
|
||||
self.timeout = env._max_episode_steps
|
||||
|
||||
def step(self, ac):
|
||||
self.ac_count += 1
|
||||
ob, rew, done, info = self.env.step(ac)
|
||||
return self._process(ob), rew, done, info
|
||||
|
||||
def reset(self):
|
||||
self.ac_count = 0
|
||||
return self._process(self.env.reset())
|
||||
|
||||
def _process(self, ob):
|
||||
fracmissing = 1 - self.ac_count / self.timeout
|
||||
if self.dict_mode:
|
||||
ob['value_estimation_timeout'] = fracmissing
|
||||
else:
|
||||
return { 'original': ob, 'value_estimation_timeout': fracmissing }
|
||||
|
||||
class StartDoingRandomActionsWrapper(gym.Wrapper):
|
||||
"""
|
||||
Warning: can eat info dicts, not good if you depend on them
|
||||
"""
|
||||
def __init__(self, env, max_random_steps, on_startup=True, every_episode=False):
|
||||
gym.Wrapper.__init__(self, env)
|
||||
self.on_startup = on_startup
|
||||
self.every_episode = every_episode
|
||||
self.random_steps = max_random_steps
|
||||
self.last_obs = None
|
||||
if on_startup:
|
||||
self.some_random_steps()
|
||||
|
||||
def some_random_steps(self):
|
||||
self.last_obs = self.env.reset()
|
||||
n = np.random.randint(self.random_steps)
|
||||
#print("running for random %i frames" % n)
|
||||
for _ in range(n):
|
||||
self.last_obs, _, done, _ = self.env.step(self.env.action_space.sample())
|
||||
if done: self.last_obs = self.env.reset()
|
||||
|
||||
def reset(self):
|
||||
return self.last_obs
|
||||
|
||||
def step(self, a):
|
||||
self.last_obs, rew, done, info = self.env.step(a)
|
||||
if done:
|
||||
self.last_obs = self.env.reset()
|
||||
if self.every_episode:
|
||||
self.some_random_steps()
|
||||
return self.last_obs, rew, done, info
|
||||
|
||||
def make_retro(*, game, state, max_episode_steps, **kwargs):
|
||||
import retro
|
||||
env = retro.make(game, state, **kwargs)
|
||||
env = StochasticFrameSkip(env, n=4, stickprob=0.25)
|
||||
if max_episode_steps is not None:
|
||||
env = TimeLimit(env, max_episode_steps=max_episode_steps)
|
||||
return env
|
||||
|
||||
def wrap_deepmind_retro(env, scale=True, frame_stack=4):
|
||||
"""
|
||||
Configure environment for retro games, using config similar to DeepMind-style Atari in wrap_deepmind
|
||||
"""
|
||||
env = WarpFrame(env)
|
||||
env = ClipRewardEnv(env)
|
||||
env = FrameStack(env, frame_stack)
|
||||
if scale:
|
||||
env = ScaledFloatFrame(env)
|
||||
return env
|
||||
|
||||
class SonicDiscretizer(gym.ActionWrapper):
|
||||
"""
|
||||
Wrap a gym-retro environment and make it use discrete
|
||||
actions for the Sonic game.
|
||||
"""
|
||||
def __init__(self, env):
|
||||
super(SonicDiscretizer, self).__init__(env)
|
||||
buttons = ["B", "A", "MODE", "START", "UP", "DOWN", "LEFT", "RIGHT", "C", "Y", "X", "Z"]
|
||||
actions = [['LEFT'], ['RIGHT'], ['LEFT', 'DOWN'], ['RIGHT', 'DOWN'], ['DOWN'],
|
||||
['DOWN', 'B'], ['B']]
|
||||
self._actions = []
|
||||
for action in actions:
|
||||
arr = np.array([False] * 12)
|
||||
for button in action:
|
||||
arr[buttons.index(button)] = True
|
||||
self._actions.append(arr)
|
||||
self.action_space = gym.spaces.Discrete(len(self._actions))
|
||||
|
||||
def action(self, a): # pylint: disable=W0221
|
||||
return self._actions[a].copy()
|
||||
|
||||
class RewardScaler(gym.RewardWrapper):
|
||||
"""
|
||||
Bring rewards to a reasonable scale for PPO.
|
||||
This is incredibly important and effects performance
|
||||
drastically.
|
||||
"""
|
||||
def __init__(self, env, scale=0.01):
|
||||
super(RewardScaler, self).__init__(env)
|
||||
self.scale = scale
|
||||
|
||||
def reward(self, reward):
|
||||
return reward * self.scale
|
||||
|
||||
class AllowBacktracking(gym.Wrapper):
|
||||
"""
|
||||
Use deltas in max(X) as the reward, rather than deltas
|
||||
in X. This way, agents are not discouraged too heavily
|
||||
from exploring backwards if there is no way to advance
|
||||
head-on in the level.
|
||||
"""
|
||||
def __init__(self, env):
|
||||
super(AllowBacktracking, self).__init__(env)
|
||||
self._cur_x = 0
|
||||
self._max_x = 0
|
||||
|
||||
def reset(self, **kwargs): # pylint: disable=E0202
|
||||
self._cur_x = 0
|
||||
self._max_x = 0
|
||||
return self.env.reset(**kwargs)
|
||||
|
||||
def step(self, action): # pylint: disable=E0202
|
||||
obs, rew, done, info = self.env.step(action)
|
||||
self._cur_x += rew
|
||||
rew = max(0, self._cur_x - self._max_x)
|
||||
self._max_x = max(self._max_x, self._cur_x)
|
||||
return obs, rew, done, info
|
@@ -5,7 +5,7 @@ class AbstractEnvRunner(ABC):
|
||||
def __init__(self, *, env, model, nsteps):
|
||||
self.env = env
|
||||
self.model = model
|
||||
self.nenv = nenv = env.num_envs if hasattr(env, 'num_envs') else 1
|
||||
nenv = env.num_envs
|
||||
self.batch_ob_shape = (nenv*nsteps,) + env.observation_space.shape
|
||||
self.obs = np.zeros((nenv,) + env.observation_space.shape, dtype=env.observation_space.dtype.name)
|
||||
self.obs[:] = env.reset()
|
||||
@@ -16,4 +16,3 @@ class AbstractEnvRunner(ABC):
|
||||
@abstractmethod
|
||||
def run(self):
|
||||
raise NotImplementedError
|
||||
|
||||
|
@@ -1,7 +1,4 @@
|
||||
import tensorflow as tf
|
||||
import numpy as np
|
||||
from baselines.common.tf_util import get_session
|
||||
|
||||
class RunningMeanStd(object):
|
||||
# https://en.wikipedia.org/wiki/Algorithms_for_calculating_variance#Parallel_algorithm
|
||||
def __init__(self, epsilon=1e-4, shape=()):
|
||||
@@ -16,71 +13,20 @@ class RunningMeanStd(object):
|
||||
self.update_from_moments(batch_mean, batch_var, batch_count)
|
||||
|
||||
def update_from_moments(self, batch_mean, batch_var, batch_count):
|
||||
self.mean, self.var, self.count = update_mean_var_count_from_moments(
|
||||
self.mean, self.var, self.count, batch_mean, batch_var, batch_count)
|
||||
delta = batch_mean - self.mean
|
||||
tot_count = self.count + batch_count
|
||||
|
||||
def update_mean_var_count_from_moments(mean, var, count, batch_mean, batch_var, batch_count):
|
||||
delta = batch_mean - mean
|
||||
tot_count = count + batch_count
|
||||
new_mean = self.mean + delta * batch_count / tot_count
|
||||
m_a = self.var * (self.count)
|
||||
m_b = batch_var * (batch_count)
|
||||
M2 = m_a + m_b + np.square(delta) * self.count * batch_count / (self.count + batch_count)
|
||||
new_var = M2 / (self.count + batch_count)
|
||||
|
||||
new_mean = mean + delta * batch_count / tot_count
|
||||
m_a = var * count
|
||||
m_b = batch_var * batch_count
|
||||
M2 = m_a + m_b + np.square(delta) * count * batch_count / (count + batch_count)
|
||||
new_var = M2 / (count + batch_count)
|
||||
new_count = batch_count + count
|
||||
|
||||
return new_mean, new_var, new_count
|
||||
|
||||
new_count = batch_count + self.count
|
||||
|
||||
class TfRunningMeanStd(object):
|
||||
# https://en.wikipedia.org/wiki/Algorithms_for_calculating_variance#Parallel_algorithm
|
||||
'''
|
||||
TensorFlow variables-based implmentation of computing running mean and std
|
||||
Benefit of this implementation is that it can be saved / loaded together with the tensorflow model
|
||||
'''
|
||||
def __init__(self, epsilon=1e-4, shape=(), scope=''):
|
||||
sess = get_session()
|
||||
|
||||
self._new_mean = tf.placeholder(shape=shape, dtype=tf.float64)
|
||||
self._new_var = tf.placeholder(shape=shape, dtype=tf.float64)
|
||||
self._new_count = tf.placeholder(shape=(), dtype=tf.float64)
|
||||
|
||||
|
||||
with tf.variable_scope(scope, reuse=tf.AUTO_REUSE):
|
||||
self._mean = tf.get_variable('mean', initializer=np.zeros(shape, 'float64'), dtype=tf.float64)
|
||||
self._var = tf.get_variable('std', initializer=np.ones(shape, 'float64'), dtype=tf.float64)
|
||||
self._count = tf.get_variable('count', initializer=np.full((), epsilon, 'float64'), dtype=tf.float64)
|
||||
|
||||
self.update_ops = tf.group([
|
||||
self._var.assign(self._new_var),
|
||||
self._mean.assign(self._new_mean),
|
||||
self._count.assign(self._new_count)
|
||||
])
|
||||
|
||||
sess.run(tf.variables_initializer([self._mean, self._var, self._count]))
|
||||
self.sess = sess
|
||||
self._set_mean_var_count()
|
||||
|
||||
def _set_mean_var_count(self):
|
||||
self.mean, self.var, self.count = self.sess.run([self._mean, self._var, self._count])
|
||||
|
||||
def update(self, x):
|
||||
batch_mean = np.mean(x, axis=0)
|
||||
batch_var = np.var(x, axis=0)
|
||||
batch_count = x.shape[0]
|
||||
|
||||
new_mean, new_var, new_count = update_mean_var_count_from_moments(self.mean, self.var, self.count, batch_mean, batch_var, batch_count)
|
||||
|
||||
self.sess.run(self.update_ops, feed_dict={
|
||||
self._new_mean: new_mean,
|
||||
self._new_var: new_var,
|
||||
self._new_count: new_count
|
||||
})
|
||||
|
||||
self._set_mean_var_count()
|
||||
|
||||
|
||||
self.mean = new_mean
|
||||
self.var = new_var
|
||||
self.count = new_count
|
||||
|
||||
def test_runningmeanstd():
|
||||
for (x1, x2, x3) in [
|
||||
@@ -97,91 +43,4 @@ def test_runningmeanstd():
|
||||
rms.update(x3)
|
||||
ms2 = [rms.mean, rms.var]
|
||||
|
||||
np.testing.assert_allclose(ms1, ms2)
|
||||
|
||||
def test_tf_runningmeanstd():
|
||||
for (x1, x2, x3) in [
|
||||
(np.random.randn(3), np.random.randn(4), np.random.randn(5)),
|
||||
(np.random.randn(3,2), np.random.randn(4,2), np.random.randn(5,2)),
|
||||
]:
|
||||
|
||||
rms = TfRunningMeanStd(epsilon=0.0, shape=x1.shape[1:], scope='running_mean_std' + str(np.random.randint(0, 128)))
|
||||
|
||||
x = np.concatenate([x1, x2, x3], axis=0)
|
||||
ms1 = [x.mean(axis=0), x.var(axis=0)]
|
||||
rms.update(x1)
|
||||
rms.update(x2)
|
||||
rms.update(x3)
|
||||
ms2 = [rms.mean, rms.var]
|
||||
|
||||
np.testing.assert_allclose(ms1, ms2)
|
||||
|
||||
|
||||
def profile_tf_runningmeanstd():
|
||||
import time
|
||||
from baselines.common import tf_util
|
||||
|
||||
tf_util.get_session( config=tf.ConfigProto(
|
||||
inter_op_parallelism_threads=1,
|
||||
intra_op_parallelism_threads=1,
|
||||
allow_soft_placement=True
|
||||
))
|
||||
|
||||
x = np.random.random((376,))
|
||||
|
||||
n_trials = 10000
|
||||
rms = RunningMeanStd()
|
||||
tfrms = TfRunningMeanStd()
|
||||
|
||||
tic1 = time.time()
|
||||
for _ in range(n_trials):
|
||||
rms.update(x)
|
||||
|
||||
tic2 = time.time()
|
||||
for _ in range(n_trials):
|
||||
tfrms.update(x)
|
||||
|
||||
tic3 = time.time()
|
||||
|
||||
print('rms update time ({} trials): {} s'.format(n_trials, tic2 - tic1))
|
||||
print('tfrms update time ({} trials): {} s'.format(n_trials, tic3 - tic2))
|
||||
|
||||
|
||||
tic1 = time.time()
|
||||
for _ in range(n_trials):
|
||||
z1 = rms.mean
|
||||
|
||||
tic2 = time.time()
|
||||
for _ in range(n_trials):
|
||||
z2 = tfrms.mean
|
||||
|
||||
assert z1 == z2
|
||||
|
||||
tic3 = time.time()
|
||||
|
||||
print('rms get mean time ({} trials): {} s'.format(n_trials, tic2 - tic1))
|
||||
print('tfrms get mean time ({} trials): {} s'.format(n_trials, tic3 - tic2))
|
||||
|
||||
|
||||
|
||||
'''
|
||||
options = tf.RunOptions(trace_level=tf.RunOptions.FULL_TRACE) #pylint: disable=E1101
|
||||
run_metadata = tf.RunMetadata()
|
||||
profile_opts = dict(options=options, run_metadata=run_metadata)
|
||||
|
||||
|
||||
|
||||
from tensorflow.python.client import timeline
|
||||
fetched_timeline = timeline.Timeline(run_metadata.step_stats) #pylint: disable=E1101
|
||||
chrome_trace = fetched_timeline.generate_chrome_trace_format()
|
||||
outfile = '/tmp/timeline.json'
|
||||
with open(outfile, 'wt') as f:
|
||||
f.write(chrome_trace)
|
||||
print(f'Successfully saved profile to {outfile}. Exiting.')
|
||||
exit(0)
|
||||
'''
|
||||
|
||||
|
||||
|
||||
if __name__ == '__main__':
|
||||
profile_tf_runningmeanstd()
|
||||
assert np.allclose(ms1, ms2)
|
||||
|
44
baselines/common/test_identity.py
Normal file
44
baselines/common/test_identity.py
Normal file
@@ -0,0 +1,44 @@
|
||||
import pytest
|
||||
import tensorflow as tf
|
||||
import random
|
||||
import numpy as np
|
||||
from gym.spaces import np_random
|
||||
|
||||
from baselines.a2c import a2c
|
||||
from baselines.ppo2 import ppo2
|
||||
from baselines.common.identity_env import IdentityEnv
|
||||
from baselines.common.vec_env.dummy_vec_env import DummyVecEnv
|
||||
from baselines.ppo2.policies import MlpPolicy
|
||||
|
||||
|
||||
learn_func_list = [
|
||||
lambda e: a2c.learn(policy=MlpPolicy, env=e, seed=0, total_timesteps=50000),
|
||||
lambda e: ppo2.learn(policy=MlpPolicy, env=e, total_timesteps=50000, lr=1e-3, nsteps=128, ent_coef=0.01)
|
||||
]
|
||||
|
||||
|
||||
@pytest.mark.slow
|
||||
@pytest.mark.parametrize("learn_func", learn_func_list)
|
||||
def test_identity(learn_func):
|
||||
'''
|
||||
Test if the algorithm (with a given policy)
|
||||
can learn an identity transformation (i.e. return observation as an action)
|
||||
'''
|
||||
np.random.seed(0)
|
||||
np_random.seed(0)
|
||||
random.seed(0)
|
||||
|
||||
env = DummyVecEnv([lambda: IdentityEnv(10)])
|
||||
|
||||
with tf.Graph().as_default(), tf.Session().as_default():
|
||||
tf.set_random_seed(0)
|
||||
model = learn_func(env)
|
||||
|
||||
N_TRIALS = 1000
|
||||
sum_rew = 0
|
||||
obs = env.reset()
|
||||
for i in range(N_TRIALS):
|
||||
obs, rew, done, _ = env.step(model.step(obs)[0])
|
||||
sum_rew += rew
|
||||
|
||||
assert sum_rew > 0.9 * N_TRIALS
|
@@ -1,44 +0,0 @@
|
||||
import numpy as np
|
||||
from gym import Env
|
||||
from gym.spaces import Discrete
|
||||
|
||||
|
||||
class FixedSequenceEnv(Env):
|
||||
def __init__(
|
||||
self,
|
||||
n_actions=10,
|
||||
seed=0,
|
||||
episode_len=100
|
||||
):
|
||||
self.np_random = np.random.RandomState()
|
||||
self.np_random.seed(seed)
|
||||
self.sequence = [self.np_random.randint(0, n_actions-1) for _ in range(episode_len)]
|
||||
|
||||
self.action_space = Discrete(n_actions)
|
||||
self.observation_space = Discrete(1)
|
||||
|
||||
self.episode_len = episode_len
|
||||
self.time = 0
|
||||
self.reset()
|
||||
|
||||
def reset(self):
|
||||
self.time = 0
|
||||
return 0
|
||||
|
||||
def step(self, actions):
|
||||
rew = self._get_reward(actions)
|
||||
self._choose_next_state()
|
||||
done = False
|
||||
if self.episode_len and self.time >= self.episode_len:
|
||||
rew = 0
|
||||
done = True
|
||||
|
||||
return 0, rew, done, {}
|
||||
|
||||
def _choose_next_state(self):
|
||||
self.time += 1
|
||||
|
||||
def _get_reward(self, actions):
|
||||
return 1 if actions == self.sequence[self.time] else 0
|
||||
|
||||
|
@@ -1,70 +0,0 @@
|
||||
import numpy as np
|
||||
from abc import abstractmethod
|
||||
from gym import Env
|
||||
from gym.spaces import Discrete, Box
|
||||
|
||||
|
||||
class IdentityEnv(Env):
|
||||
def __init__(
|
||||
self,
|
||||
episode_len=None
|
||||
):
|
||||
|
||||
self.episode_len = episode_len
|
||||
self.time = 0
|
||||
self.reset()
|
||||
|
||||
def reset(self):
|
||||
self._choose_next_state()
|
||||
self.time = 0
|
||||
self.observation_space = self.action_space
|
||||
|
||||
return self.state
|
||||
|
||||
def step(self, actions):
|
||||
rew = self._get_reward(actions)
|
||||
self._choose_next_state()
|
||||
done = False
|
||||
if self.episode_len and self.time >= self.episode_len:
|
||||
rew = 0
|
||||
done = True
|
||||
|
||||
return self.state, rew, done, {}
|
||||
|
||||
def _choose_next_state(self):
|
||||
self.state = self.action_space.sample()
|
||||
self.time += 1
|
||||
|
||||
@abstractmethod
|
||||
def _get_reward(self, actions):
|
||||
raise NotImplementedError
|
||||
|
||||
|
||||
class DiscreteIdentityEnv(IdentityEnv):
|
||||
def __init__(
|
||||
self,
|
||||
dim,
|
||||
episode_len=None,
|
||||
):
|
||||
|
||||
self.action_space = Discrete(dim)
|
||||
super().__init__(episode_len=episode_len)
|
||||
|
||||
def _get_reward(self, actions):
|
||||
return 1 if self.state == actions else 0
|
||||
|
||||
|
||||
class BoxIdentityEnv(IdentityEnv):
|
||||
def __init__(
|
||||
self,
|
||||
shape,
|
||||
episode_len=None,
|
||||
):
|
||||
|
||||
self.action_space = Box(low=-1.0, high=1.0, shape=shape)
|
||||
super().__init__(episode_len=episode_len)
|
||||
|
||||
def _get_reward(self, actions):
|
||||
diff = actions - self.state
|
||||
diff = diff[:]
|
||||
return -0.5 * np.dot(diff, diff)
|
@@ -1,70 +0,0 @@
|
||||
import os.path as osp
|
||||
import numpy as np
|
||||
import tempfile
|
||||
import filelock
|
||||
from gym import Env
|
||||
from gym.spaces import Discrete, Box
|
||||
|
||||
|
||||
|
||||
class MnistEnv(Env):
|
||||
def __init__(
|
||||
self,
|
||||
seed=0,
|
||||
episode_len=None,
|
||||
no_images=None
|
||||
):
|
||||
from tensorflow.examples.tutorials.mnist import input_data
|
||||
# we could use temporary directory for this with a context manager and
|
||||
# TemporaryDirecotry, but then each test that uses mnist would re-download the data
|
||||
# this way the data is not cleaned up, but we only download it once per machine
|
||||
mnist_path = osp.join(tempfile.gettempdir(), 'MNIST_data')
|
||||
with filelock.FileLock(mnist_path + '.lock'):
|
||||
self.mnist = input_data.read_data_sets(mnist_path)
|
||||
|
||||
self.np_random = np.random.RandomState()
|
||||
self.np_random.seed(seed)
|
||||
|
||||
self.observation_space = Box(low=0.0, high=1.0, shape=(28,28,1))
|
||||
self.action_space = Discrete(10)
|
||||
self.episode_len = episode_len
|
||||
self.time = 0
|
||||
self.no_images = no_images
|
||||
|
||||
self.train_mode()
|
||||
self.reset()
|
||||
|
||||
def reset(self):
|
||||
self._choose_next_state()
|
||||
self.time = 0
|
||||
|
||||
return self.state[0]
|
||||
|
||||
def step(self, actions):
|
||||
rew = self._get_reward(actions)
|
||||
self._choose_next_state()
|
||||
done = False
|
||||
if self.episode_len and self.time >= self.episode_len:
|
||||
rew = 0
|
||||
done = True
|
||||
|
||||
return self.state[0], rew, done, {}
|
||||
|
||||
def train_mode(self):
|
||||
self.dataset = self.mnist.train
|
||||
|
||||
def test_mode(self):
|
||||
self.dataset = self.mnist.test
|
||||
|
||||
def _choose_next_state(self):
|
||||
max_index = (self.no_images if self.no_images is not None else self.dataset.num_examples) - 1
|
||||
index = self.np_random.randint(0, max_index)
|
||||
image = self.dataset.images[index].reshape(28,28,1)*255
|
||||
label = self.dataset.labels[index]
|
||||
self.state = (image, label)
|
||||
self.time += 1
|
||||
|
||||
def _get_reward(self, actions):
|
||||
return 1 if self.state[1] == actions else 0
|
||||
|
||||
|
@@ -1,40 +0,0 @@
|
||||
import pytest
|
||||
import gym
|
||||
|
||||
from baselines.run import get_learn_function
|
||||
from baselines.common.tests.util import reward_per_episode_test
|
||||
|
||||
common_kwargs = dict(
|
||||
total_timesteps=30000,
|
||||
network='mlp',
|
||||
gamma=1.0,
|
||||
seed=0,
|
||||
)
|
||||
|
||||
learn_kwargs = {
|
||||
'a2c' : dict(nsteps=32, value_network='copy', lr=0.05),
|
||||
'acktr': dict(nsteps=32, value_network='copy'),
|
||||
'deepq': {},
|
||||
'ppo2': dict(value_network='copy'),
|
||||
'trpo_mpi': {}
|
||||
}
|
||||
|
||||
@pytest.mark.slow
|
||||
@pytest.mark.parametrize("alg", learn_kwargs.keys())
|
||||
def test_cartpole(alg):
|
||||
'''
|
||||
Test if the algorithm (with an mlp policy)
|
||||
can learn to balance the cartpole
|
||||
'''
|
||||
|
||||
kwargs = common_kwargs.copy()
|
||||
kwargs.update(learn_kwargs[alg])
|
||||
|
||||
learn_fn = lambda e: get_learn_function(alg)(env=e, **kwargs)
|
||||
def env_fn():
|
||||
|
||||
env = gym.make('CartPole-v0')
|
||||
env.seed(0)
|
||||
return env
|
||||
|
||||
reward_per_episode_test(env_fn, learn_fn, 100)
|
@@ -1,51 +0,0 @@
|
||||
import pytest
|
||||
from baselines.common.tests.envs.fixed_sequence_env import FixedSequenceEnv
|
||||
|
||||
from baselines.common.tests.util import simple_test
|
||||
from baselines.run import get_learn_function
|
||||
|
||||
common_kwargs = dict(
|
||||
seed=0,
|
||||
total_timesteps=50000,
|
||||
)
|
||||
|
||||
learn_kwargs = {
|
||||
'a2c': {},
|
||||
'ppo2': dict(nsteps=10, ent_coef=0.0, nminibatches=1),
|
||||
# TODO enable sequential models for trpo_mpi (proper handling of nbatch and nsteps)
|
||||
# github issue: https://github.com/openai/baselines/issues/188
|
||||
# 'trpo_mpi': lambda e, p: trpo_mpi.learn(policy_fn=p(env=e), env=e, max_timesteps=30000, timesteps_per_batch=100, cg_iters=10, gamma=0.9, lam=1.0, max_kl=0.001)
|
||||
}
|
||||
|
||||
|
||||
alg_list = learn_kwargs.keys()
|
||||
rnn_list = ['lstm']
|
||||
|
||||
@pytest.mark.slow
|
||||
@pytest.mark.parametrize("alg", alg_list)
|
||||
@pytest.mark.parametrize("rnn", rnn_list)
|
||||
def test_fixed_sequence(alg, rnn):
|
||||
'''
|
||||
Test if the algorithm (with a given policy)
|
||||
can learn an identity transformation (i.e. return observation as an action)
|
||||
'''
|
||||
|
||||
kwargs = learn_kwargs[alg]
|
||||
kwargs.update(common_kwargs)
|
||||
|
||||
episode_len = 5
|
||||
env_fn = lambda: FixedSequenceEnv(10, episode_len=episode_len)
|
||||
learn = lambda e: get_learn_function(alg)(
|
||||
env=e,
|
||||
network=rnn,
|
||||
**kwargs
|
||||
)
|
||||
|
||||
simple_test(env_fn, learn, 0.7)
|
||||
|
||||
|
||||
if __name__ == '__main__':
|
||||
test_fixed_sequence('ppo2', 'lstm')
|
||||
|
||||
|
||||
|
@@ -1,55 +0,0 @@
|
||||
import pytest
|
||||
from baselines.common.tests.envs.identity_env import DiscreteIdentityEnv, BoxIdentityEnv
|
||||
from baselines.run import get_learn_function
|
||||
from baselines.common.tests.util import simple_test
|
||||
|
||||
common_kwargs = dict(
|
||||
total_timesteps=30000,
|
||||
network='mlp',
|
||||
gamma=0.9,
|
||||
seed=0,
|
||||
)
|
||||
|
||||
learn_kwargs = {
|
||||
'a2c' : {},
|
||||
'acktr': {},
|
||||
'deepq': {},
|
||||
'ppo2': dict(lr=1e-3, nsteps=64, ent_coef=0.0),
|
||||
'trpo_mpi': dict(timesteps_per_batch=100, cg_iters=10, gamma=0.9, lam=1.0, max_kl=0.01)
|
||||
}
|
||||
|
||||
|
||||
@pytest.mark.slow
|
||||
@pytest.mark.parametrize("alg", learn_kwargs.keys())
|
||||
def test_discrete_identity(alg):
|
||||
'''
|
||||
Test if the algorithm (with an mlp policy)
|
||||
can learn an identity transformation (i.e. return observation as an action)
|
||||
'''
|
||||
|
||||
kwargs = learn_kwargs[alg]
|
||||
kwargs.update(common_kwargs)
|
||||
|
||||
learn_fn = lambda e: get_learn_function(alg)(env=e, **kwargs)
|
||||
env_fn = lambda: DiscreteIdentityEnv(10, episode_len=100)
|
||||
simple_test(env_fn, learn_fn, 0.9)
|
||||
|
||||
@pytest.mark.slow
|
||||
@pytest.mark.parametrize("alg", ['a2c', 'ppo2', 'trpo_mpi'])
|
||||
def test_continuous_identity(alg):
|
||||
'''
|
||||
Test if the algorithm (with an mlp policy)
|
||||
can learn an identity transformation (i.e. return observation as an action)
|
||||
to a required precision
|
||||
'''
|
||||
|
||||
kwargs = learn_kwargs[alg]
|
||||
kwargs.update(common_kwargs)
|
||||
learn_fn = lambda e: get_learn_function(alg)(env=e, **kwargs)
|
||||
|
||||
env_fn = lambda: BoxIdentityEnv((1,), episode_len=100)
|
||||
simple_test(env_fn, learn_fn, -0.1)
|
||||
|
||||
if __name__ == '__main__':
|
||||
test_continuous_identity('a2c')
|
||||
|
@@ -1,50 +0,0 @@
|
||||
import pytest
|
||||
|
||||
# from baselines.acer import acer_simple as acer
|
||||
from baselines.common.tests.envs.mnist_env import MnistEnv
|
||||
from baselines.common.tests.util import simple_test
|
||||
from baselines.run import get_learn_function
|
||||
|
||||
|
||||
# TODO investigate a2c and ppo2 failures - is it due to bad hyperparameters for this problem?
|
||||
# GitHub issue https://github.com/openai/baselines/issues/189
|
||||
common_kwargs = {
|
||||
'seed': 0,
|
||||
'network':'cnn',
|
||||
'gamma':0.9,
|
||||
'pad':'SAME'
|
||||
}
|
||||
|
||||
learn_args = {
|
||||
'a2c': dict(total_timesteps=50000),
|
||||
# TODO need to resolve inference (step) API differences for acer; also slow
|
||||
# 'acer': dict(seed=0, total_timesteps=1000),
|
||||
'deepq': dict(total_timesteps=5000),
|
||||
'acktr': dict(total_timesteps=30000),
|
||||
'ppo2': dict(total_timesteps=50000, lr=1e-3, nsteps=128, ent_coef=0.0),
|
||||
'trpo_mpi': dict(total_timesteps=80000, timesteps_per_batch=100, cg_iters=10, lam=1.0, max_kl=0.001)
|
||||
}
|
||||
|
||||
|
||||
#tests pass, but are too slow on travis. Same algorithms are covered
|
||||
# by other tests with less compute-hungry nn's and by benchmarks
|
||||
@pytest.mark.skip
|
||||
@pytest.mark.slow
|
||||
@pytest.mark.parametrize("alg", learn_args.keys())
|
||||
def test_mnist(alg):
|
||||
'''
|
||||
Test if the algorithm can learn to classify MNIST digits.
|
||||
Uses CNN policy.
|
||||
'''
|
||||
|
||||
learn_kwargs = learn_args[alg]
|
||||
learn_kwargs.update(common_kwargs)
|
||||
|
||||
learn = get_learn_function(alg)
|
||||
learn_fn = lambda e: learn(env=e, **learn_kwargs)
|
||||
env_fn = lambda: MnistEnv(seed=0, episode_len=100)
|
||||
|
||||
simple_test(env_fn, learn_fn, 0.6)
|
||||
|
||||
if __name__ == '__main__':
|
||||
test_mnist('deepq')
|
@@ -1,97 +0,0 @@
|
||||
import os
|
||||
import tempfile
|
||||
import pytest
|
||||
import tensorflow as tf
|
||||
import numpy as np
|
||||
|
||||
from baselines.common.tests.envs.mnist_env import MnistEnv
|
||||
from baselines.common.vec_env.dummy_vec_env import DummyVecEnv
|
||||
from baselines.run import get_learn_function
|
||||
from baselines.common.tf_util import make_session, get_session
|
||||
|
||||
from functools import partial
|
||||
|
||||
|
||||
learn_kwargs = {
|
||||
'deepq': {},
|
||||
'a2c': {},
|
||||
'acktr': {},
|
||||
'ppo2': {'nminibatches': 1, 'nsteps': 10},
|
||||
'trpo_mpi': {},
|
||||
}
|
||||
|
||||
network_kwargs = {
|
||||
'mlp': {},
|
||||
'cnn': {'pad': 'SAME'},
|
||||
'lstm': {},
|
||||
'cnn_lnlstm': {'pad': 'SAME'}
|
||||
}
|
||||
|
||||
|
||||
@pytest.mark.parametrize("learn_fn", learn_kwargs.keys())
|
||||
@pytest.mark.parametrize("network_fn", network_kwargs.keys())
|
||||
def test_serialization(learn_fn, network_fn):
|
||||
'''
|
||||
Test if the trained model can be serialized
|
||||
'''
|
||||
|
||||
|
||||
if network_fn.endswith('lstm') and learn_fn in ['acktr', 'trpo_mpi', 'deepq']:
|
||||
# TODO make acktr work with recurrent policies
|
||||
# and test
|
||||
# github issue: https://github.com/openai/baselines/issues/194
|
||||
return
|
||||
|
||||
env = DummyVecEnv([lambda: MnistEnv(10, episode_len=100)])
|
||||
ob = env.reset().copy()
|
||||
learn = get_learn_function(learn_fn)
|
||||
|
||||
kwargs = {}
|
||||
kwargs.update(network_kwargs[network_fn])
|
||||
kwargs.update(learn_kwargs[learn_fn])
|
||||
|
||||
|
||||
learn = partial(learn, env=env, network=network_fn, seed=0, **kwargs)
|
||||
|
||||
with tempfile.TemporaryDirectory() as td:
|
||||
model_path = os.path.join(td, 'serialization_test_model')
|
||||
|
||||
with tf.Graph().as_default(), make_session().as_default():
|
||||
model = learn(total_timesteps=100)
|
||||
model.save(model_path)
|
||||
mean1, std1 = _get_action_stats(model, ob)
|
||||
variables_dict1 = _serialize_variables()
|
||||
|
||||
with tf.Graph().as_default(), make_session().as_default():
|
||||
model = learn(total_timesteps=0, load_path=model_path)
|
||||
mean2, std2 = _get_action_stats(model, ob)
|
||||
variables_dict2 = _serialize_variables()
|
||||
|
||||
for k, v in variables_dict1.items():
|
||||
np.testing.assert_allclose(v, variables_dict2[k], atol=0.01,
|
||||
err_msg='saved and loaded variable {} value mismatch'.format(k))
|
||||
|
||||
np.testing.assert_allclose(mean1, mean2, atol=0.5)
|
||||
np.testing.assert_allclose(std1, std2, atol=0.5)
|
||||
|
||||
|
||||
|
||||
def _serialize_variables():
|
||||
sess = get_session()
|
||||
variables = tf.trainable_variables()
|
||||
values = sess.run(variables)
|
||||
return {var.name: value for var, value in zip(variables, values)}
|
||||
|
||||
|
||||
def _get_action_stats(model, ob):
|
||||
ntrials = 1000
|
||||
if model.initial_state is None or model.initial_state == []:
|
||||
actions = np.array([model.step(ob)[0] for _ in range(ntrials)])
|
||||
else:
|
||||
actions = np.array([model.step(ob, S=model.initial_state, M=[False])[0] for _ in range(ntrials)])
|
||||
|
||||
mean = np.mean(actions, axis=0)
|
||||
std = np.std(actions, axis=0)
|
||||
|
||||
return mean, std
|
||||
|
@@ -1,91 +0,0 @@
|
||||
import tensorflow as tf
|
||||
import numpy as np
|
||||
from gym.spaces import np_random
|
||||
from baselines.common.vec_env.dummy_vec_env import DummyVecEnv
|
||||
|
||||
N_TRIALS = 10000
|
||||
N_EPISODES = 100
|
||||
|
||||
def simple_test(env_fn, learn_fn, min_reward_fraction, n_trials=N_TRIALS):
|
||||
np.random.seed(0)
|
||||
np_random.seed(0)
|
||||
|
||||
env = DummyVecEnv([env_fn])
|
||||
|
||||
|
||||
with tf.Graph().as_default(), tf.Session(config=tf.ConfigProto(allow_soft_placement=True)).as_default():
|
||||
tf.set_random_seed(0)
|
||||
|
||||
model = learn_fn(env)
|
||||
|
||||
sum_rew = 0
|
||||
done = True
|
||||
|
||||
for i in range(n_trials):
|
||||
if done:
|
||||
obs = env.reset()
|
||||
state = model.initial_state
|
||||
|
||||
if state is not None:
|
||||
a, v, state, _ = model.step(obs, S=state, M=[False])
|
||||
else:
|
||||
a, v, _, _ = model.step(obs)
|
||||
|
||||
obs, rew, done, _ = env.step(a)
|
||||
sum_rew += float(rew)
|
||||
|
||||
print("Reward in {} trials is {}".format(n_trials, sum_rew))
|
||||
assert sum_rew > min_reward_fraction * n_trials, \
|
||||
'sum of rewards {} is less than {} of the total number of trials {}'.format(sum_rew, min_reward_fraction, n_trials)
|
||||
|
||||
|
||||
|
||||
def reward_per_episode_test(env_fn, learn_fn, min_avg_reward, n_trials=N_EPISODES):
|
||||
env = DummyVecEnv([env_fn])
|
||||
|
||||
with tf.Graph().as_default(), tf.Session(config=tf.ConfigProto(allow_soft_placement=True)).as_default():
|
||||
model = learn_fn(env)
|
||||
|
||||
N_TRIALS = 100
|
||||
|
||||
observations, actions, rewards = rollout(env, model, N_TRIALS)
|
||||
rewards = [sum(r) for r in rewards]
|
||||
|
||||
avg_rew = sum(rewards) / N_TRIALS
|
||||
print("Average reward in {} episodes is {}".format(n_trials, avg_rew))
|
||||
assert avg_rew > min_avg_reward, \
|
||||
'average reward in {} episodes ({}) is less than {}'.format(n_trials, avg_rew, min_avg_reward)
|
||||
|
||||
def rollout(env, model, n_trials):
|
||||
rewards = []
|
||||
actions = []
|
||||
observations = []
|
||||
|
||||
for i in range(n_trials):
|
||||
obs = env.reset()
|
||||
state = model.initial_state
|
||||
episode_rew = []
|
||||
episode_actions = []
|
||||
episode_obs = []
|
||||
|
||||
while True:
|
||||
if state is not None:
|
||||
a, v, state, _ = model.step(obs, S=state, M=[False])
|
||||
else:
|
||||
a,v, _, _ = model.step(obs)
|
||||
|
||||
obs, rew, done, _ = env.step(a)
|
||||
|
||||
episode_rew.append(rew)
|
||||
episode_actions.append(a)
|
||||
episode_obs.append(obs)
|
||||
|
||||
if done:
|
||||
break
|
||||
|
||||
rewards.append(episode_rew)
|
||||
actions.append(episode_actions)
|
||||
observations.append(episode_obs)
|
||||
|
||||
return observations, actions, rewards
|
||||
|
@@ -1,4 +1,3 @@
|
||||
import joblib
|
||||
import numpy as np
|
||||
import tensorflow as tf # pylint: ignore-module
|
||||
import copy
|
||||
@@ -49,28 +48,17 @@ def huber_loss(x, delta=1.0):
|
||||
# Global session
|
||||
# ================================================================
|
||||
|
||||
def get_session(config=None):
|
||||
"""Get default session or create one with a given config"""
|
||||
sess = tf.get_default_session()
|
||||
if sess is None:
|
||||
sess = make_session(config=config, make_default=True)
|
||||
return sess
|
||||
|
||||
def make_session(config=None, num_cpu=None, make_default=False, graph=None):
|
||||
def make_session(num_cpu=None, make_default=False, graph=None):
|
||||
"""Returns a session that will use <num_cpu> CPU's only"""
|
||||
if num_cpu is None:
|
||||
num_cpu = int(os.getenv('RCALL_NUM_CPU', multiprocessing.cpu_count()))
|
||||
if config is None:
|
||||
config = tf.ConfigProto(
|
||||
allow_soft_placement=True,
|
||||
inter_op_parallelism_threads=num_cpu,
|
||||
intra_op_parallelism_threads=num_cpu)
|
||||
config.gpu_options.allow_growth = True
|
||||
|
||||
tf_config = tf.ConfigProto(
|
||||
inter_op_parallelism_threads=num_cpu,
|
||||
intra_op_parallelism_threads=num_cpu)
|
||||
if make_default:
|
||||
return tf.InteractiveSession(config=config, graph=graph)
|
||||
return tf.InteractiveSession(config=tf_config, graph=graph)
|
||||
else:
|
||||
return tf.Session(config=config, graph=graph)
|
||||
return tf.Session(config=tf_config, graph=graph)
|
||||
|
||||
def single_threaded_session():
|
||||
"""Returns a session which will only use a single CPU"""
|
||||
@@ -88,7 +76,7 @@ ALREADY_INITIALIZED = set()
|
||||
def initialize():
|
||||
"""Initialize all the uninitialized variables in the global scope."""
|
||||
new_variables = set(tf.global_variables()) - ALREADY_INITIALIZED
|
||||
get_session().run(tf.variables_initializer(new_variables))
|
||||
tf.get_default_session().run(tf.variables_initializer(new_variables))
|
||||
ALREADY_INITIALIZED.update(new_variables)
|
||||
|
||||
# ================================================================
|
||||
@@ -97,7 +85,7 @@ def initialize():
|
||||
|
||||
def normc_initializer(std=1.0, axis=0):
|
||||
def _initializer(shape, dtype=None, partition_info=None): # pylint: disable=W0613
|
||||
out = np.random.randn(*shape).astype(dtype.as_numpy_dtype)
|
||||
out = np.random.randn(*shape).astype(np.float32)
|
||||
out *= std / np.sqrt(np.square(out).sum(axis=axis, keepdims=True))
|
||||
return tf.constant(out)
|
||||
return _initializer
|
||||
@@ -191,7 +179,7 @@ class _Function(object):
|
||||
if hasattr(inpt, 'make_feed_dict'):
|
||||
feed_dict.update(inpt.make_feed_dict(value))
|
||||
else:
|
||||
feed_dict[inpt] = adjust_shape(inpt, value)
|
||||
feed_dict[inpt] = value
|
||||
|
||||
def __call__(self, *args):
|
||||
assert len(args) <= len(self.inputs), "Too many arguments provided"
|
||||
@@ -201,8 +189,8 @@ class _Function(object):
|
||||
self._feed_input(feed_dict, inpt, value)
|
||||
# Update feed dict with givens.
|
||||
for inpt in self.givens:
|
||||
feed_dict[inpt] = adjust_shape(inpt, feed_dict.get(inpt, self.givens[inpt]))
|
||||
results = get_session().run(self.outputs_update, feed_dict=feed_dict)[:-1]
|
||||
feed_dict[inpt] = feed_dict.get(inpt, self.givens[inpt])
|
||||
results = tf.get_default_session().run(self.outputs_update, feed_dict=feed_dict)[:-1]
|
||||
return results
|
||||
|
||||
# ================================================================
|
||||
@@ -255,34 +243,27 @@ class GetFlat(object):
|
||||
def __call__(self):
|
||||
return tf.get_default_session().run(self.op)
|
||||
|
||||
def flattenallbut0(x):
|
||||
return tf.reshape(x, [-1, intprod(x.get_shape().as_list()[1:])])
|
||||
|
||||
# =============================================================
|
||||
# TF placeholders management
|
||||
# ============================================================
|
||||
|
||||
_PLACEHOLDER_CACHE = {} # name -> (placeholder, dtype, shape)
|
||||
|
||||
def get_placeholder(name, dtype, shape):
|
||||
if name in _PLACEHOLDER_CACHE:
|
||||
out, dtype1, shape1 = _PLACEHOLDER_CACHE[name]
|
||||
if out.graph == tf.get_default_graph():
|
||||
assert dtype1 == dtype and shape1 == shape, \
|
||||
'Placeholder with name {} has already been registered and has shape {}, different from requested {}'.format(name, shape1, shape)
|
||||
return out
|
||||
|
||||
out = tf.placeholder(dtype=dtype, shape=shape, name=name)
|
||||
_PLACEHOLDER_CACHE[name] = (out, dtype, shape)
|
||||
return out
|
||||
assert dtype1 == dtype and shape1 == shape
|
||||
return out
|
||||
else:
|
||||
out = tf.placeholder(dtype=dtype, shape=shape, name=name)
|
||||
_PLACEHOLDER_CACHE[name] = (out, dtype, shape)
|
||||
return out
|
||||
|
||||
def get_placeholder_cached(name):
|
||||
return _PLACEHOLDER_CACHE[name][0]
|
||||
|
||||
def flattenallbut0(x):
|
||||
return tf.reshape(x, [-1, intprod(x.get_shape().as_list()[1:])])
|
||||
|
||||
|
||||
# ================================================================
|
||||
# Diagnostics
|
||||
# Diagnostics
|
||||
# ================================================================
|
||||
|
||||
def display_var_info(vars):
|
||||
@@ -302,7 +283,7 @@ def display_var_info(vars):
|
||||
def get_available_gpus():
|
||||
# recipe from here:
|
||||
# https://stackoverflow.com/questions/38559755/how-to-get-current-available-gpus-in-tensorflow?utm_medium=organic&utm_source=google_rich_qa&utm_campaign=google_rich_qa
|
||||
|
||||
|
||||
from tensorflow.python.client import device_lib
|
||||
local_device_protos = device_lib.list_local_devices()
|
||||
return [x.name for x in local_device_protos if x.device_type == 'GPU']
|
||||
@@ -311,95 +292,13 @@ def get_available_gpus():
|
||||
# Saving variables
|
||||
# ================================================================
|
||||
|
||||
def load_state(fname, sess=None):
|
||||
sess = sess or get_session()
|
||||
def load_state(fname):
|
||||
saver = tf.train.Saver()
|
||||
saver.restore(tf.get_default_session(), fname)
|
||||
|
||||
def save_state(fname, sess=None):
|
||||
sess = sess or get_session()
|
||||
def save_state(fname):
|
||||
os.makedirs(os.path.dirname(fname), exist_ok=True)
|
||||
saver = tf.train.Saver()
|
||||
saver.save(tf.get_default_session(), fname)
|
||||
|
||||
# The methods above and below are clearly doing the same thing, and in a rather similar way
|
||||
# TODO: ensure there is no subtle differences and remove one
|
||||
|
||||
def save_variables(save_path, variables=None, sess=None):
|
||||
sess = sess or get_session()
|
||||
variables = variables or tf.trainable_variables()
|
||||
|
||||
ps = sess.run(variables)
|
||||
save_dict = {v.name: value for v, value in zip(variables, ps)}
|
||||
os.makedirs(os.path.dirname(save_path), exist_ok=True)
|
||||
joblib.dump(save_dict, save_path)
|
||||
|
||||
def load_variables(load_path, variables=None, sess=None):
|
||||
sess = sess or get_session()
|
||||
variables = variables or tf.trainable_variables()
|
||||
|
||||
loaded_params = joblib.load(os.path.expanduser(load_path))
|
||||
restores = []
|
||||
for v in variables:
|
||||
restores.append(v.assign(loaded_params[v.name]))
|
||||
sess.run(restores)
|
||||
|
||||
|
||||
# ================================================================
|
||||
# Shape adjustment for feeding into tf placeholders
|
||||
# ================================================================
|
||||
def adjust_shape(placeholder, data):
|
||||
'''
|
||||
adjust shape of the data to the shape of the placeholder if possible.
|
||||
If shape is incompatible, AssertionError is thrown
|
||||
|
||||
Parameters:
|
||||
placeholder tensorflow input placeholder
|
||||
|
||||
data input data to be (potentially) reshaped to be fed into placeholder
|
||||
|
||||
Returns:
|
||||
reshaped data
|
||||
'''
|
||||
|
||||
if not isinstance(data, np.ndarray) and not isinstance(data, list):
|
||||
return data
|
||||
if isinstance(data, list):
|
||||
data = np.array(data)
|
||||
|
||||
placeholder_shape = [x or -1 for x in placeholder.shape.as_list()]
|
||||
|
||||
assert _check_shape(placeholder_shape, data.shape), \
|
||||
'Shape of data {} is not compatible with shape of the placeholder {}'.format(data.shape, placeholder_shape)
|
||||
|
||||
return np.reshape(data, placeholder_shape)
|
||||
|
||||
|
||||
def _check_shape(placeholder_shape, data_shape):
|
||||
''' check if two shapes are compatible (i.e. differ only by dimensions of size 1, or by the batch dimension)'''
|
||||
|
||||
return True
|
||||
squeezed_placeholder_shape = _squeeze_shape(placeholder_shape)
|
||||
squeezed_data_shape = _squeeze_shape(data_shape)
|
||||
|
||||
for i, s_data in enumerate(squeezed_data_shape):
|
||||
s_placeholder = squeezed_placeholder_shape[i]
|
||||
if s_placeholder != -1 and s_data != s_placeholder:
|
||||
return False
|
||||
|
||||
return True
|
||||
|
||||
|
||||
def _squeeze_shape(shape):
|
||||
return [x for x in shape if x != 1]
|
||||
|
||||
# Tensorboard interfacing
|
||||
# ================================================================
|
||||
|
||||
def launch_tensorboard_in_background(log_dir):
|
||||
from tensorboard import main as tb
|
||||
import threading
|
||||
tf.flags.FLAGS.logdir = log_dir
|
||||
t = threading.Thread(target=tb.main, args=([]))
|
||||
t.start()
|
||||
|
||||
|
@@ -1,34 +1,28 @@
|
||||
from abc import ABC, abstractmethod
|
||||
from baselines import logger
|
||||
|
||||
|
||||
class AlreadySteppingError(Exception):
|
||||
"""
|
||||
Raised when an asynchronous step is running while
|
||||
step_async() is called again.
|
||||
"""
|
||||
|
||||
def __init__(self):
|
||||
msg = 'already running an async step'
|
||||
Exception.__init__(self, msg)
|
||||
|
||||
|
||||
class NotSteppingError(Exception):
|
||||
"""
|
||||
Raised when an asynchronous step is not running but
|
||||
step_wait() is called.
|
||||
"""
|
||||
|
||||
def __init__(self):
|
||||
msg = 'not running an async step'
|
||||
Exception.__init__(self, msg)
|
||||
|
||||
|
||||
class VecEnv(ABC):
|
||||
"""
|
||||
An abstract asynchronous, vectorized environment.
|
||||
"""
|
||||
|
||||
def __init__(self, num_envs, observation_space, action_space):
|
||||
self.num_envs = num_envs
|
||||
self.observation_space = observation_space
|
||||
@@ -38,7 +32,7 @@ class VecEnv(ABC):
|
||||
def reset(self):
|
||||
"""
|
||||
Reset all the environments and return an array of
|
||||
observations, or a dict of observation arrays.
|
||||
observations, or a tuple of observation arrays.
|
||||
|
||||
If step_async is still doing work, that work will
|
||||
be cancelled and step_wait() should not be called
|
||||
@@ -64,7 +58,7 @@ class VecEnv(ABC):
|
||||
Wait for the step taken with step_async().
|
||||
|
||||
Returns (obs, rews, dones, infos):
|
||||
- obs: an array of observations, or a dict of
|
||||
- obs: an array of observations, or a tuple of
|
||||
arrays of observations.
|
||||
- rews: an array of rewards
|
||||
- dones: an array of "episode done" booleans
|
||||
@@ -80,16 +74,11 @@ class VecEnv(ABC):
|
||||
pass
|
||||
|
||||
def step(self, actions):
|
||||
"""
|
||||
Step the environments synchronously.
|
||||
|
||||
This is available for backwards compatibility.
|
||||
"""
|
||||
self.step_async(actions)
|
||||
return self.step_wait()
|
||||
|
||||
def render(self, mode='human'):
|
||||
logger.warn('Render not defined for %s' % self)
|
||||
logger.warn('Render not defined for %s'%self)
|
||||
|
||||
@property
|
||||
def unwrapped(self):
|
||||
@@ -98,19 +87,13 @@ class VecEnv(ABC):
|
||||
else:
|
||||
return self
|
||||
|
||||
|
||||
class VecEnvWrapper(VecEnv):
|
||||
"""
|
||||
An environment wrapper that applies to an entire batch
|
||||
of environments at once.
|
||||
"""
|
||||
|
||||
def __init__(self, venv, observation_space=None, action_space=None):
|
||||
self.venv = venv
|
||||
VecEnv.__init__(self,
|
||||
num_envs=venv.num_envs,
|
||||
observation_space=observation_space or venv.observation_space,
|
||||
action_space=action_space or venv.action_space)
|
||||
VecEnv.__init__(self,
|
||||
num_envs=venv.num_envs,
|
||||
observation_space=observation_space or venv.observation_space,
|
||||
action_space=action_space or venv.action_space)
|
||||
|
||||
def step_async(self, actions):
|
||||
self.venv.step_async(actions)
|
||||
@@ -129,19 +112,15 @@ class VecEnvWrapper(VecEnv):
|
||||
def render(self):
|
||||
self.venv.render()
|
||||
|
||||
|
||||
class CloudpickleWrapper(object):
|
||||
"""
|
||||
Uses cloudpickle to serialize contents (otherwise multiprocessing tries to use pickle)
|
||||
"""
|
||||
|
||||
def __init__(self, x):
|
||||
self.x = x
|
||||
|
||||
def __getstate__(self):
|
||||
import cloudpickle
|
||||
return cloudpickle.dumps(self.x)
|
||||
|
||||
def __setstate__(self, ob):
|
||||
import pickle
|
||||
self.x = pickle.loads(ob)
|
||||
|
@@ -1,27 +1,31 @@
|
||||
import numpy as np
|
||||
from gym import spaces
|
||||
from collections import OrderedDict
|
||||
from . import VecEnv
|
||||
from .util import copy_obs_dict, dict_to_obs, obs_space_info
|
||||
|
||||
|
||||
class DummyVecEnv(VecEnv):
|
||||
"""
|
||||
A VecEnv that wraps raw gym.Envs.
|
||||
|
||||
This can be used when an algorithm requires a VecEnv
|
||||
but you want to use a vanilla gym.Env instance.
|
||||
It is also useful for avoiding IPC overhead when you
|
||||
don't need to run environments in parallel.
|
||||
"""
|
||||
|
||||
def __init__(self, env_fns):
|
||||
self.envs = [fn() for fn in env_fns]
|
||||
env = self.envs[0]
|
||||
VecEnv.__init__(self, len(env_fns), env.observation_space, env.action_space)
|
||||
shapes, dtypes = {}, {}
|
||||
self.keys = []
|
||||
obs_space = env.observation_space
|
||||
self.keys, shapes, dtypes = obs_space_info(obs_space)
|
||||
self.buf_obs = {k: np.zeros((self.num_envs,) + tuple(shapes[k]), dtype=dtypes[k]) for k in self.keys}
|
||||
|
||||
if isinstance(obs_space, spaces.Dict):
|
||||
assert isinstance(obs_space.spaces, OrderedDict)
|
||||
subspaces = obs_space.spaces
|
||||
else:
|
||||
subspaces = {None: obs_space}
|
||||
|
||||
for key, box in subspaces.items():
|
||||
shapes[key] = box.shape
|
||||
dtypes[key] = box.dtype
|
||||
self.keys.append(key)
|
||||
|
||||
self.buf_obs = { k: np.zeros((self.num_envs,) + tuple(shapes[k]), dtype=dtypes[k]) for k in self.keys }
|
||||
self.buf_dones = np.zeros((self.num_envs,), dtype=np.bool)
|
||||
self.buf_rews = np.zeros((self.num_envs,), dtype=np.float32)
|
||||
self.buf_rews = np.zeros((self.num_envs,), dtype=np.float32)
|
||||
self.buf_infos = [{} for _ in range(self.num_envs)]
|
||||
self.actions = None
|
||||
|
||||
@@ -44,8 +48,7 @@ class DummyVecEnv(VecEnv):
|
||||
return self._obs_from_buf()
|
||||
|
||||
def close(self):
|
||||
for e in self.envs:
|
||||
e.close()
|
||||
return
|
||||
|
||||
def render(self, mode='human'):
|
||||
return [e.render(mode=mode) for e in self.envs]
|
||||
@@ -58,4 +61,7 @@ class DummyVecEnv(VecEnv):
|
||||
self.buf_obs[k][e] = obs[k]
|
||||
|
||||
def _obs_from_buf(self):
|
||||
return dict_to_obs(copy_obs_dict(self.buf_obs))
|
||||
if self.keys==[None]:
|
||||
return self.buf_obs[None]
|
||||
else:
|
||||
return self.buf_obs
|
||||
|
@@ -1,146 +0,0 @@
|
||||
"""
|
||||
An interface for asynchronous vectorized environments.
|
||||
"""
|
||||
|
||||
from multiprocessing import Pipe, Array, Process
|
||||
import numpy as np
|
||||
from . import VecEnv, CloudpickleWrapper
|
||||
import ctypes
|
||||
from baselines import logger
|
||||
from baselines.common.tile_images import tile_images
|
||||
|
||||
from .util import dict_to_obs, obs_space_info, obs_to_dict
|
||||
|
||||
_NP_TO_CT = {np.float32: ctypes.c_float,
|
||||
np.int32: ctypes.c_int32,
|
||||
np.int8: ctypes.c_int8,
|
||||
np.uint8: ctypes.c_char,
|
||||
np.bool: ctypes.c_bool}
|
||||
|
||||
|
||||
class ShmemVecEnv(VecEnv):
|
||||
"""
|
||||
An AsyncEnv that uses multiprocessing to run multiple
|
||||
environments in parallel.
|
||||
"""
|
||||
|
||||
def __init__(self, env_fns, spaces=None):
|
||||
"""
|
||||
If you don't specify observation_space, we'll have to create a dummy
|
||||
environment to get it.
|
||||
"""
|
||||
if spaces:
|
||||
observation_space, action_space = spaces
|
||||
else:
|
||||
logger.log('Creating dummy env object to get spaces')
|
||||
with logger.scoped_configure(format_strs=[]):
|
||||
dummy = env_fns[0]()
|
||||
observation_space, action_space = dummy.observation_space, dummy.action_space
|
||||
dummy.close()
|
||||
del dummy
|
||||
VecEnv.__init__(self, len(env_fns), observation_space, action_space)
|
||||
self.obs_keys, self.obs_shapes, self.obs_dtypes = obs_space_info(observation_space)
|
||||
self.obs_bufs = [
|
||||
{k: Array(_NP_TO_CT[self.obs_dtypes[k].type], int(np.prod(self.obs_shapes[k]))) for k in self.obs_keys}
|
||||
for _ in env_fns]
|
||||
self.parent_pipes = []
|
||||
self.procs = []
|
||||
for env_fn, obs_buf in zip(env_fns, self.obs_bufs):
|
||||
wrapped_fn = CloudpickleWrapper(env_fn)
|
||||
parent_pipe, child_pipe = Pipe()
|
||||
proc = Process(target=_subproc_worker,
|
||||
args=(child_pipe, parent_pipe, wrapped_fn, obs_buf, self.obs_shapes, self.obs_dtypes, self.obs_keys))
|
||||
proc.daemon = True
|
||||
self.procs.append(proc)
|
||||
self.parent_pipes.append(parent_pipe)
|
||||
proc.start()
|
||||
child_pipe.close()
|
||||
self.waiting_step = False
|
||||
|
||||
def reset(self):
|
||||
if self.waiting_step:
|
||||
logger.warn('Called reset() while waiting for the step to complete')
|
||||
self.step_wait()
|
||||
for pipe in self.parent_pipes:
|
||||
pipe.send(('reset', None))
|
||||
return self._decode_obses([pipe.recv() for pipe in self.parent_pipes])
|
||||
|
||||
def step_async(self, actions):
|
||||
assert len(actions) == len(self.parent_pipes)
|
||||
for pipe, act in zip(self.parent_pipes, actions):
|
||||
pipe.send(('step', act))
|
||||
|
||||
def step_wait(self):
|
||||
outs = [pipe.recv() for pipe in self.parent_pipes]
|
||||
obs, rews, dones, infos = zip(*outs)
|
||||
return self._decode_obses(obs), np.array(rews), np.array(dones), infos
|
||||
|
||||
def close(self):
|
||||
if self.waiting_step:
|
||||
self.step_wait()
|
||||
for pipe in self.parent_pipes:
|
||||
pipe.send(('close', None))
|
||||
for pipe in self.parent_pipes:
|
||||
pipe.recv()
|
||||
pipe.close()
|
||||
for proc in self.procs:
|
||||
proc.join()
|
||||
|
||||
def render(self, mode='human'):
|
||||
for pipe in self.parent_pipes:
|
||||
pipe.send(('render', None))
|
||||
imgs = [pipe.recv() for pipe in self.parent_pipes]
|
||||
bigimg = tile_images(imgs)
|
||||
if mode == 'human':
|
||||
import cv2
|
||||
cv2.imshow('vecenv', bigimg[:, :, ::-1])
|
||||
cv2.waitKey(1)
|
||||
elif mode == 'rgb_array':
|
||||
return bigimg
|
||||
else:
|
||||
raise NotImplementedError
|
||||
|
||||
def _decode_obses(self, obs):
|
||||
result = {}
|
||||
for k in self.obs_keys:
|
||||
bufs = [b[k] for b in self.obs_bufs]
|
||||
o = [np.frombuffer(b.get_obj(), dtype=self.obs_dtypes[k]).reshape(self.obs_shapes[k]) for b in bufs]
|
||||
result[k] = np.array(o)
|
||||
return dict_to_obs(result)
|
||||
|
||||
|
||||
def _subproc_worker(pipe, parent_pipe, env_fn_wrapper, obs_bufs, obs_shapes, obs_dtypes, keys):
|
||||
"""
|
||||
Control a single environment instance using IPC and
|
||||
shared memory.
|
||||
"""
|
||||
def _write_obs(maybe_dict_obs):
|
||||
flatdict = obs_to_dict(maybe_dict_obs)
|
||||
for k in keys:
|
||||
dst = obs_bufs[k].get_obj()
|
||||
dst_np = np.frombuffer(dst, dtype=obs_dtypes[k]).reshape(obs_shapes[k]) # pylint: disable=W0212
|
||||
np.copyto(dst_np, flatdict[k])
|
||||
|
||||
env = env_fn_wrapper.x()
|
||||
parent_pipe.close()
|
||||
try:
|
||||
while True:
|
||||
cmd, data = pipe.recv()
|
||||
if cmd == 'reset':
|
||||
pipe.send(_write_obs(env.reset()))
|
||||
elif cmd == 'step':
|
||||
obs, reward, done, info = env.step(data)
|
||||
if done:
|
||||
obs = env.reset()
|
||||
pipe.send((_write_obs(obs), reward, done, info))
|
||||
elif cmd == 'render':
|
||||
pipe.send(env.render(mode='rgb_array'))
|
||||
elif cmd == 'close':
|
||||
pipe.send(None)
|
||||
break
|
||||
else:
|
||||
raise RuntimeError('Got unrecognized cmd %s' % cmd)
|
||||
except KeyboardInterrupt:
|
||||
print('ShmemVecEnv worker: got KeyboardInterrupt')
|
||||
finally:
|
||||
env.close()
|
@@ -1,36 +1,31 @@
|
||||
import numpy as np
|
||||
from multiprocessing import Process, Pipe
|
||||
from . import VecEnv, CloudpickleWrapper
|
||||
from baselines.common.vec_env import VecEnv, CloudpickleWrapper
|
||||
from baselines.common.tile_images import tile_images
|
||||
|
||||
|
||||
def worker(remote, parent_remote, env_fn_wrapper):
|
||||
parent_remote.close()
|
||||
env = env_fn_wrapper.x()
|
||||
try:
|
||||
while True:
|
||||
cmd, data = remote.recv()
|
||||
if cmd == 'step':
|
||||
ob, reward, done, info = env.step(data)
|
||||
if done:
|
||||
ob = env.reset()
|
||||
remote.send((ob, reward, done, info))
|
||||
elif cmd == 'reset':
|
||||
while True:
|
||||
cmd, data = remote.recv()
|
||||
if cmd == 'step':
|
||||
ob, reward, done, info = env.step(data)
|
||||
if done:
|
||||
ob = env.reset()
|
||||
remote.send(ob)
|
||||
elif cmd == 'render':
|
||||
remote.send(env.render(mode='rgb_array'))
|
||||
elif cmd == 'close':
|
||||
remote.close()
|
||||
break
|
||||
elif cmd == 'get_spaces':
|
||||
remote.send((env.observation_space, env.action_space))
|
||||
else:
|
||||
raise NotImplementedError
|
||||
except KeyboardInterrupt:
|
||||
print('SubprocVecEnv worker: got KeyboardInterrupt')
|
||||
finally:
|
||||
env.close()
|
||||
remote.send((ob, reward, done, info))
|
||||
elif cmd == 'reset':
|
||||
ob = env.reset()
|
||||
remote.send(ob)
|
||||
elif cmd == 'render':
|
||||
remote.send(env.render(mode='rgb_array'))
|
||||
elif cmd == 'close':
|
||||
remote.close()
|
||||
break
|
||||
elif cmd == 'get_spaces':
|
||||
remote.send((env.observation_space, env.action_space))
|
||||
else:
|
||||
raise NotImplementedError
|
||||
|
||||
|
||||
class SubprocVecEnv(VecEnv):
|
||||
@@ -43,9 +38,9 @@ class SubprocVecEnv(VecEnv):
|
||||
nenvs = len(env_fns)
|
||||
self.remotes, self.work_remotes = zip(*[Pipe() for _ in range(nenvs)])
|
||||
self.ps = [Process(target=worker, args=(work_remote, remote, CloudpickleWrapper(env_fn)))
|
||||
for (work_remote, remote, env_fn) in zip(self.work_remotes, self.remotes, env_fns)]
|
||||
for (work_remote, remote, env_fn) in zip(self.work_remotes, self.remotes, env_fns)]
|
||||
for p in self.ps:
|
||||
p.daemon = True # if the main process crashes, we should not cause things to hang
|
||||
p.daemon = True # if the main process crashes, we should not cause things to hang
|
||||
p.start()
|
||||
for remote in self.work_remotes:
|
||||
remote.close()
|
||||
@@ -79,7 +74,7 @@ class SubprocVecEnv(VecEnv):
|
||||
if self.closed:
|
||||
return
|
||||
if self.waiting:
|
||||
for remote in self.remotes:
|
||||
for remote in self.remotes:
|
||||
remote.recv()
|
||||
for remote in self.remotes:
|
||||
remote.send(('close', None))
|
||||
@@ -94,9 +89,9 @@ class SubprocVecEnv(VecEnv):
|
||||
bigimg = tile_images(imgs)
|
||||
if mode == 'human':
|
||||
import cv2
|
||||
cv2.imshow('vecenv', bigimg[:, :, ::-1])
|
||||
cv2.imshow('vecenv', bigimg[:,:,::-1])
|
||||
cv2.waitKey(1)
|
||||
elif mode == 'rgb_array':
|
||||
return bigimg
|
||||
else:
|
||||
raise NotImplementedError
|
||||
raise NotImplementedError
|
@@ -1,85 +0,0 @@
|
||||
"""
|
||||
Tests for asynchronous vectorized environments.
|
||||
"""
|
||||
|
||||
import gym
|
||||
import numpy as np
|
||||
import pytest
|
||||
from .dummy_vec_env import DummyVecEnv
|
||||
from .shmem_vec_env import ShmemVecEnv
|
||||
from .subproc_vec_env import SubprocVecEnv
|
||||
|
||||
|
||||
@pytest.mark.parametrize('klass', (ShmemVecEnv, SubprocVecEnv))
|
||||
@pytest.mark.parametrize('dtype', ('uint8', 'float32'))
|
||||
def test_vec_env(klass, dtype): # pylint: disable=R0914
|
||||
"""
|
||||
Test that a vectorized environment is equivalent to
|
||||
DummyVecEnv, since DummyVecEnv is less likely to be
|
||||
error prone.
|
||||
"""
|
||||
num_envs = 3
|
||||
num_steps = 100
|
||||
shape = (3, 8)
|
||||
|
||||
def make_fn(seed):
|
||||
"""
|
||||
Get an environment constructor with a seed.
|
||||
"""
|
||||
return lambda: _SimpleEnv(seed, shape, dtype)
|
||||
fns = [make_fn(i) for i in range(num_envs)]
|
||||
env1 = DummyVecEnv(fns)
|
||||
env2 = klass(fns)
|
||||
try:
|
||||
obs1, obs2 = env1.reset(), env2.reset()
|
||||
assert np.array(obs1).shape == np.array(obs2).shape
|
||||
assert np.allclose(obs1, obs2)
|
||||
np.random.seed(1337)
|
||||
for _ in range(num_steps):
|
||||
joint_shape = (len(fns),) + shape
|
||||
actions = np.array(np.random.randint(0, 0x100, size=joint_shape),
|
||||
dtype=dtype)
|
||||
for env in [env1, env2]:
|
||||
env.step_async(actions)
|
||||
outs1 = env1.step_wait()
|
||||
outs2 = env2.step_wait()
|
||||
for out1, out2 in zip(outs1[:3], outs2[:3]):
|
||||
assert np.array(out1).shape == np.array(out2).shape
|
||||
assert np.allclose(out1, out2)
|
||||
assert list(outs1[3]) == list(outs2[3])
|
||||
finally:
|
||||
env1.close()
|
||||
env2.close()
|
||||
|
||||
|
||||
class _SimpleEnv(gym.Env):
|
||||
"""
|
||||
An environment with a pre-determined observation space
|
||||
and RNG seed.
|
||||
"""
|
||||
|
||||
def __init__(self, seed, shape, dtype):
|
||||
np.random.seed(seed)
|
||||
self._dtype = dtype
|
||||
self._start_obs = np.array(np.random.randint(0, 0x100, size=shape),
|
||||
dtype=dtype)
|
||||
self._max_steps = seed + 1
|
||||
self._cur_obs = None
|
||||
self._cur_step = 0
|
||||
self.action_space = gym.spaces.Box(low=0, high=100, shape=shape, dtype=dtype)
|
||||
self.observation_space = self.action_space
|
||||
|
||||
def step(self, action):
|
||||
self._cur_obs += np.array(action, dtype=self._dtype)
|
||||
self._cur_step += 1
|
||||
done = self._cur_step >= self._max_steps
|
||||
reward = self._cur_step / self._max_steps
|
||||
return self._cur_obs, reward, done, {'foo': 'bar' + str(reward)}
|
||||
|
||||
def reset(self):
|
||||
self._cur_obs = self._start_obs
|
||||
self._cur_step = 0
|
||||
return self._cur_obs
|
||||
|
||||
def render(self, mode=None):
|
||||
raise NotImplementedError
|
@@ -1,59 +0,0 @@
|
||||
"""
|
||||
Helpers for dealing with vectorized environments.
|
||||
"""
|
||||
|
||||
from collections import OrderedDict
|
||||
|
||||
import gym
|
||||
import numpy as np
|
||||
|
||||
|
||||
def copy_obs_dict(obs):
|
||||
"""
|
||||
Deep-copy an observation dict.
|
||||
"""
|
||||
return {k: np.copy(v) for k, v in obs.items()}
|
||||
|
||||
|
||||
def dict_to_obs(obs_dict):
|
||||
"""
|
||||
Convert an observation dict into a raw array if the
|
||||
original observation space was not a Dict space.
|
||||
"""
|
||||
if set(obs_dict.keys()) == {None}:
|
||||
return obs_dict[None]
|
||||
return obs_dict
|
||||
|
||||
|
||||
def obs_space_info(obs_space):
|
||||
"""
|
||||
Get dict-structured information about a gym.Space.
|
||||
|
||||
Returns:
|
||||
A tuple (keys, shapes, dtypes):
|
||||
keys: a list of dict keys.
|
||||
shapes: a dict mapping keys to shapes.
|
||||
dtypes: a dict mapping keys to dtypes.
|
||||
"""
|
||||
if isinstance(obs_space, gym.spaces.Dict):
|
||||
assert isinstance(obs_space.spaces, OrderedDict)
|
||||
subspaces = obs_space.spaces
|
||||
else:
|
||||
subspaces = {None: obs_space}
|
||||
keys = []
|
||||
shapes = {}
|
||||
dtypes = {}
|
||||
for key, box in subspaces.items():
|
||||
keys.append(key)
|
||||
shapes[key] = box.shape
|
||||
dtypes[key] = box.dtype
|
||||
return keys, shapes, dtypes
|
||||
|
||||
|
||||
def obs_to_dict(obs):
|
||||
"""
|
||||
Convert an observation into a dict.
|
||||
"""
|
||||
if isinstance(obs, dict):
|
||||
return obs
|
||||
return {None: obs}
|
@@ -1,16 +1,18 @@
|
||||
from . import VecEnvWrapper
|
||||
from baselines.common.vec_env import VecEnvWrapper
|
||||
import numpy as np
|
||||
from gym import spaces
|
||||
|
||||
|
||||
class VecFrameStack(VecEnvWrapper):
|
||||
"""
|
||||
Vectorized environment base class
|
||||
"""
|
||||
def __init__(self, venv, nstack):
|
||||
self.venv = venv
|
||||
self.nstack = nstack
|
||||
wos = venv.observation_space # wrapped ob space
|
||||
wos = venv.observation_space # wrapped ob space
|
||||
low = np.repeat(wos.low, self.nstack, axis=-1)
|
||||
high = np.repeat(wos.high, self.nstack, axis=-1)
|
||||
self.stackedobs = np.zeros((venv.num_envs,) + low.shape, low.dtype)
|
||||
self.stackedobs = np.zeros((venv.num_envs,)+low.shape, low.dtype)
|
||||
observation_space = spaces.Box(low=low, high=high, dtype=venv.observation_space.dtype)
|
||||
VecEnvWrapper.__init__(self, venv, observation_space=observation_space)
|
||||
|
||||
@@ -24,6 +26,9 @@ class VecFrameStack(VecEnvWrapper):
|
||||
return self.stackedobs, rews, news, infos
|
||||
|
||||
def reset(self):
|
||||
"""
|
||||
Reset all environments
|
||||
"""
|
||||
obs = self.venv.reset()
|
||||
self.stackedobs[...] = 0
|
||||
self.stackedobs[..., -obs.shape[-1]:] = obs
|
||||
|
@@ -1,29 +0,0 @@
|
||||
from . import VecEnvWrapper
|
||||
import numpy as np
|
||||
|
||||
|
||||
class VecMonitor(VecEnvWrapper):
|
||||
def __init__(self, venv):
|
||||
VecEnvWrapper.__init__(self, venv)
|
||||
self.eprets = None
|
||||
self.eplens = None
|
||||
|
||||
def reset(self):
|
||||
obs = self.venv.reset()
|
||||
self.eprets = np.zeros(self.num_envs, 'f')
|
||||
self.eplens = np.zeros(self.num_envs, 'i')
|
||||
return obs
|
||||
|
||||
def step_wait(self):
|
||||
obs, rews, dones, infos = self.venv.step_wait()
|
||||
self.eprets += rews
|
||||
self.eplens += 1
|
||||
newinfos = []
|
||||
for (i, (done, ret, eplen, info)) in enumerate(zip(dones, self.eprets, self.eplens, infos)):
|
||||
info = info.copy()
|
||||
if done:
|
||||
info['episode'] = {'r': ret, 'l': eplen}
|
||||
self.eprets[i] = 0
|
||||
self.eplens[i] = 0
|
||||
newinfos.append(info)
|
||||
return obs, rews, dones, newinfos
|
@@ -1,14 +1,11 @@
|
||||
from . import VecEnvWrapper
|
||||
from baselines.common.vec_env import VecEnvWrapper
|
||||
from baselines.common.running_mean_std import RunningMeanStd
|
||||
import numpy as np
|
||||
|
||||
|
||||
class VecNormalize(VecEnvWrapper):
|
||||
"""
|
||||
A vectorized wrapper that normalizes the observations
|
||||
and returns from an environment.
|
||||
Vectorized environment base class
|
||||
"""
|
||||
|
||||
def __init__(self, venv, ob=True, ret=True, clipob=10., cliprew=10., gamma=0.99, epsilon=1e-8):
|
||||
VecEnvWrapper.__init__(self, venv)
|
||||
self.ob_rms = RunningMeanStd(shape=self.observation_space.shape) if ob else None
|
||||
@@ -20,6 +17,12 @@ class VecNormalize(VecEnvWrapper):
|
||||
self.epsilon = epsilon
|
||||
|
||||
def step_wait(self):
|
||||
"""
|
||||
Apply sequence of actions to sequence of environments
|
||||
actions -> (observations, rewards, news)
|
||||
|
||||
where 'news' is a boolean vector indicating whether each element is new.
|
||||
"""
|
||||
obs, rews, news, infos = self.venv.step_wait()
|
||||
self.ret = self.ret * self.gamma + rews
|
||||
obs = self._obfilt(obs)
|
||||
@@ -37,5 +40,8 @@ class VecNormalize(VecEnvWrapper):
|
||||
return obs
|
||||
|
||||
def reset(self):
|
||||
"""
|
||||
Reset all environments
|
||||
"""
|
||||
obs = self.venv.reset()
|
||||
return self._obfilt(obs)
|
||||
|
@@ -26,9 +26,9 @@ def reduce_std(x, axis=None, keepdims=False):
|
||||
return tf.sqrt(reduce_var(x, axis=axis, keepdims=keepdims))
|
||||
|
||||
def reduce_var(x, axis=None, keepdims=False):
|
||||
m = tf.reduce_mean(x, axis=axis, keepdims=True)
|
||||
m = tf.reduce_mean(x, axis=axis, keep_dims=True)
|
||||
devs_squared = tf.square(x - m)
|
||||
return tf.reduce_mean(devs_squared, axis=axis, keepdims=keepdims)
|
||||
return tf.reduce_mean(devs_squared, axis=axis, keep_dims=keepdims)
|
||||
|
||||
def get_target_updates(vars, target_vars, tau):
|
||||
logger.info('setting up target updates ...')
|
||||
|
@@ -32,7 +32,7 @@ In particular notice that once `deepq.learn` finishes training it returns `act`
|
||||
|
||||
|
||||
- [baselines/deepq/experiments/custom_cartpole.py](experiments/custom_cartpole.py) - Cartpole training with more fine grained control over the internals of DQN algorithm.
|
||||
- [baselines/deepq/experiments/run_atari.py](experiments/run_atari.py) - more robust setup for training at scale.
|
||||
- [baselines/deepq/experiments/atari/train.py](experiments/atari/train.py) - more robust setup for training at scale.
|
||||
|
||||
|
||||
##### Download a pretrained Atari agent
|
||||
|
@@ -1,8 +1,8 @@
|
||||
from baselines.deepq import models # noqa
|
||||
from baselines.deepq.build_graph import build_act, build_train # noqa
|
||||
from baselines.deepq.deepq import learn, load_act # noqa
|
||||
from baselines.deepq.simple import learn, load # noqa
|
||||
from baselines.deepq.replay_buffer import ReplayBuffer, PrioritizedReplayBuffer # noqa
|
||||
|
||||
def wrap_atari_dqn(env):
|
||||
from baselines.common.atari_wrappers import wrap_deepmind
|
||||
return wrap_deepmind(env, frame_stack=True, scale=True)
|
||||
return wrap_deepmind(env, frame_stack=True, scale=True)
|
@@ -1,21 +0,0 @@
|
||||
def atari():
|
||||
return dict(
|
||||
network='conv_only',
|
||||
lr=1e-4,
|
||||
buffer_size=10000,
|
||||
exploration_fraction=0.1,
|
||||
exploration_final_eps=0.01,
|
||||
train_freq=4,
|
||||
learning_starts=10000,
|
||||
target_network_update_freq=1000,
|
||||
gamma=0.99,
|
||||
prioritized_replay=True,
|
||||
prioritized_replay_alpha=0.6,
|
||||
checkpoint_freq=10000,
|
||||
checkpoint_path=None,
|
||||
dueling=True
|
||||
)
|
||||
|
||||
def retro():
|
||||
return atari()
|
||||
|
@@ -1,34 +0,0 @@
|
||||
import argparse
|
||||
|
||||
import numpy as np
|
||||
|
||||
from baselines import deepq
|
||||
from baselines.common import retro_wrappers
|
||||
|
||||
|
||||
def main():
|
||||
parser = argparse.ArgumentParser()
|
||||
parser.add_argument('--env', help='environment ID', default='SuperMarioBros-Nes')
|
||||
parser.add_argument('--gamestate', help='game state to load', default='Level1-1')
|
||||
parser.add_argument('--model', help='model pickle file from ActWrapper.save', default='model.pkl')
|
||||
args = parser.parse_args()
|
||||
|
||||
env = retro_wrappers.make_retro(game=args.env, state=args.gamestate, max_episode_steps=None)
|
||||
env = retro_wrappers.wrap_deepmind_retro(env)
|
||||
act = deepq.load(args.model)
|
||||
|
||||
while True:
|
||||
obs, done = env.reset(), False
|
||||
episode_rew = 0
|
||||
while not done:
|
||||
env.render()
|
||||
action = act(obs[None])[0]
|
||||
env_action = np.zeros(env.action_space.n)
|
||||
env_action[action] = 1
|
||||
obs, rew, done, _ = env.step(env_action)
|
||||
episode_rew += rew
|
||||
print('Episode reward', episode_rew)
|
||||
|
||||
|
||||
if __name__ == '__main__':
|
||||
main()
|
@@ -1,49 +0,0 @@
|
||||
import argparse
|
||||
|
||||
from baselines import deepq
|
||||
from baselines.common import set_global_seeds
|
||||
from baselines import bench
|
||||
from baselines import logger
|
||||
from baselines.common import retro_wrappers
|
||||
import retro
|
||||
|
||||
|
||||
def main():
|
||||
parser = argparse.ArgumentParser(formatter_class=argparse.ArgumentDefaultsHelpFormatter)
|
||||
parser.add_argument('--env', help='environment ID', default='SuperMarioBros-Nes')
|
||||
parser.add_argument('--gamestate', help='game state to load', default='Level1-1')
|
||||
parser.add_argument('--seed', help='seed', type=int, default=0)
|
||||
parser.add_argument('--num-timesteps', type=int, default=int(10e6))
|
||||
args = parser.parse_args()
|
||||
logger.configure()
|
||||
set_global_seeds(args.seed)
|
||||
env = retro_wrappers.make_retro(game=args.env, state=args.gamestate, max_episode_steps=10000, use_restricted_actions=retro.Actions.DISCRETE)
|
||||
env.seed(args.seed)
|
||||
env = bench.Monitor(env, logger.get_dir())
|
||||
env = retro_wrappers.wrap_deepmind_retro(env)
|
||||
|
||||
model = deepq.models.cnn_to_mlp(
|
||||
convs=[(32, 8, 4), (64, 4, 2), (64, 3, 1)],
|
||||
hiddens=[256],
|
||||
dueling=True
|
||||
)
|
||||
act = deepq.learn(
|
||||
env,
|
||||
q_func=model,
|
||||
lr=1e-4,
|
||||
max_timesteps=args.num_timesteps,
|
||||
buffer_size=10000,
|
||||
exploration_fraction=0.1,
|
||||
exploration_final_eps=0.01,
|
||||
train_freq=4,
|
||||
learning_starts=10000,
|
||||
target_network_update_freq=1000,
|
||||
gamma=0.99,
|
||||
prioritized_replay=True
|
||||
)
|
||||
act.save()
|
||||
env.close()
|
||||
|
||||
|
||||
if __name__ == '__main__':
|
||||
main()
|
@@ -89,41 +89,3 @@ def cnn_to_mlp(convs, hiddens, dueling=False, layer_norm=False):
|
||||
|
||||
return lambda *args, **kwargs: _cnn_to_mlp(convs, hiddens, dueling, layer_norm=layer_norm, *args, **kwargs)
|
||||
|
||||
|
||||
|
||||
def build_q_func(network, hiddens=[256], dueling=True, layer_norm=False, **network_kwargs):
|
||||
if isinstance(network, str):
|
||||
from baselines.common.models import get_network_builder
|
||||
network = get_network_builder(network)(**network_kwargs)
|
||||
|
||||
def q_func_builder(input_placeholder, num_actions, scope, reuse=False):
|
||||
with tf.variable_scope(scope, reuse=reuse):
|
||||
latent, _ = network(input_placeholder)
|
||||
latent = layers.flatten(latent)
|
||||
|
||||
with tf.variable_scope("action_value"):
|
||||
action_out = latent
|
||||
for hidden in hiddens:
|
||||
action_out = layers.fully_connected(action_out, num_outputs=hidden, activation_fn=None)
|
||||
if layer_norm:
|
||||
action_out = layers.layer_norm(action_out, center=True, scale=True)
|
||||
action_out = tf.nn.relu(action_out)
|
||||
action_scores = layers.fully_connected(action_out, num_outputs=num_actions, activation_fn=None)
|
||||
|
||||
if dueling:
|
||||
with tf.variable_scope("state_value"):
|
||||
state_out = latent
|
||||
for hidden in hiddens:
|
||||
state_out = layers.fully_connected(state_out, num_outputs=hidden, activation_fn=None)
|
||||
if layer_norm:
|
||||
state_out = layers.layer_norm(state_out, center=True, scale=True)
|
||||
state_out = tf.nn.relu(state_out)
|
||||
state_score = layers.fully_connected(state_out, num_outputs=1, activation_fn=None)
|
||||
action_scores_mean = tf.reduce_mean(action_scores, 1)
|
||||
action_scores_centered = action_scores - tf.expand_dims(action_scores_mean, 1)
|
||||
q_out = state_score + action_scores_centered
|
||||
else:
|
||||
q_out = action_scores
|
||||
return q_out
|
||||
|
||||
return q_func_builder
|
||||
|
@@ -10,24 +10,20 @@ import baselines.common.tf_util as U
|
||||
from baselines.common.tf_util import load_state, save_state
|
||||
from baselines import logger
|
||||
from baselines.common.schedules import LinearSchedule
|
||||
from baselines.common import set_global_seeds
|
||||
from baselines.common.input import observation_input
|
||||
|
||||
from baselines import deepq
|
||||
from baselines.deepq.replay_buffer import ReplayBuffer, PrioritizedReplayBuffer
|
||||
from baselines.deepq.utils import ObservationInput
|
||||
|
||||
from baselines.common.tf_util import get_session
|
||||
from baselines.deepq.models import build_q_func
|
||||
|
||||
|
||||
class ActWrapper(object):
|
||||
def __init__(self, act, act_params):
|
||||
self._act = act
|
||||
self._act_params = act_params
|
||||
self.initial_state = None
|
||||
|
||||
@staticmethod
|
||||
def load_act(self, path):
|
||||
def load(path):
|
||||
with open(path, "rb") as f:
|
||||
model_data, act_params = cloudpickle.load(f)
|
||||
act = deepq.build_act(**act_params)
|
||||
@@ -46,10 +42,7 @@ class ActWrapper(object):
|
||||
def __call__(self, *args, **kwargs):
|
||||
return self._act(*args, **kwargs)
|
||||
|
||||
def step(self, observation, **kwargs):
|
||||
return self._act([observation], **kwargs), None, None, None
|
||||
|
||||
def save_act(self, path=None):
|
||||
def save(self, path=None):
|
||||
"""Save model to a pickle located at `path`"""
|
||||
if path is None:
|
||||
path = os.path.join(logger.get_dir(), "model.pkl")
|
||||
@@ -68,11 +61,8 @@ class ActWrapper(object):
|
||||
with open(path, "wb") as f:
|
||||
cloudpickle.dump((model_data, self._act_params), f)
|
||||
|
||||
def save(self, path):
|
||||
save_state(path)
|
||||
|
||||
|
||||
def load_act(path):
|
||||
def load(path):
|
||||
"""Load act function that was returned by learn function.
|
||||
|
||||
Parameters
|
||||
@@ -86,14 +76,13 @@ def load_act(path):
|
||||
function that takes a batch of observations
|
||||
and returns actions.
|
||||
"""
|
||||
return ActWrapper.load_act(path)
|
||||
return ActWrapper.load(path)
|
||||
|
||||
|
||||
def learn(env,
|
||||
network,
|
||||
seed=None,
|
||||
q_func,
|
||||
lr=5e-4,
|
||||
total_timesteps=100000,
|
||||
max_timesteps=100000,
|
||||
buffer_size=50000,
|
||||
exploration_fraction=0.1,
|
||||
exploration_final_eps=0.02,
|
||||
@@ -111,10 +100,7 @@ def learn(env,
|
||||
prioritized_replay_beta_iters=None,
|
||||
prioritized_replay_eps=1e-6,
|
||||
param_noise=False,
|
||||
callback=None,
|
||||
load_path=None,
|
||||
**network_kwargs
|
||||
):
|
||||
callback=None):
|
||||
"""Train a deepq model.
|
||||
|
||||
Parameters
|
||||
@@ -133,7 +119,7 @@ def learn(env,
|
||||
and returns a tensor of shape (batch_size, num_actions) with values of every action.
|
||||
lr: float
|
||||
learning rate for adam optimizer
|
||||
total_timesteps: int
|
||||
max_timesteps: int
|
||||
number of env steps to optimizer for
|
||||
buffer_size: int
|
||||
size of the replay buffer
|
||||
@@ -167,16 +153,12 @@ def learn(env,
|
||||
initial value of beta for prioritized replay buffer
|
||||
prioritized_replay_beta_iters: int
|
||||
number of iterations over which beta will be annealed from initial value
|
||||
to 1.0. If set to None equals to total_timesteps.
|
||||
to 1.0. If set to None equals to max_timesteps.
|
||||
prioritized_replay_eps: float
|
||||
epsilon to add to the TD errors when updating priorities.
|
||||
callback: (locals, globals) -> None
|
||||
function called at every steps with state of the algorithm.
|
||||
If callback returns true training stops.
|
||||
load_path: str
|
||||
path to load the model from. (default: None)
|
||||
**network_kwargs
|
||||
additional keyword arguments to pass to the network builder.
|
||||
|
||||
Returns
|
||||
-------
|
||||
@@ -186,10 +168,8 @@ def learn(env,
|
||||
"""
|
||||
# Create all the functions necessary to train the model
|
||||
|
||||
sess = get_session()
|
||||
set_global_seeds(seed)
|
||||
|
||||
q_func = build_q_func(network, **network_kwargs)
|
||||
sess = tf.Session()
|
||||
sess.__enter__()
|
||||
|
||||
# capture the shape outside the closure so that the env object is not serialized
|
||||
# by cloudpickle when serializing make_obs_ph
|
||||
@@ -214,12 +194,12 @@ def learn(env,
|
||||
}
|
||||
|
||||
act = ActWrapper(act, act_params)
|
||||
|
||||
|
||||
# Create the replay buffer
|
||||
if prioritized_replay:
|
||||
replay_buffer = PrioritizedReplayBuffer(buffer_size, alpha=prioritized_replay_alpha)
|
||||
if prioritized_replay_beta_iters is None:
|
||||
prioritized_replay_beta_iters = total_timesteps
|
||||
prioritized_replay_beta_iters = max_timesteps
|
||||
beta_schedule = LinearSchedule(prioritized_replay_beta_iters,
|
||||
initial_p=prioritized_replay_beta0,
|
||||
final_p=1.0)
|
||||
@@ -227,7 +207,7 @@ def learn(env,
|
||||
replay_buffer = ReplayBuffer(buffer_size)
|
||||
beta_schedule = None
|
||||
# Create the schedule for exploration starting from 1.
|
||||
exploration = LinearSchedule(schedule_timesteps=int(exploration_fraction * total_timesteps),
|
||||
exploration = LinearSchedule(schedule_timesteps=int(exploration_fraction * max_timesteps),
|
||||
initial_p=1.0,
|
||||
final_p=exploration_final_eps)
|
||||
|
||||
@@ -245,17 +225,12 @@ def learn(env,
|
||||
|
||||
model_file = os.path.join(td, "model")
|
||||
model_saved = False
|
||||
|
||||
if tf.train.latest_checkpoint(td) is not None:
|
||||
load_state(model_file)
|
||||
logger.log('Loaded model from {}'.format(model_file))
|
||||
model_saved = True
|
||||
elif load_path is not None:
|
||||
load_state(load_path)
|
||||
logger.log('Loaded model from {}'.format(load_path))
|
||||
|
||||
|
||||
for t in range(total_timesteps):
|
||||
for t in range(max_timesteps):
|
||||
if callback is not None:
|
||||
if callback(locals(), globals()):
|
||||
break
|
43
baselines/deepq/test_identity.py
Normal file
43
baselines/deepq/test_identity.py
Normal file
@@ -0,0 +1,43 @@
|
||||
import tensorflow as tf
|
||||
import random
|
||||
|
||||
from baselines import deepq
|
||||
from baselines.common.identity_env import IdentityEnv
|
||||
|
||||
|
||||
def test_identity():
|
||||
|
||||
with tf.Graph().as_default():
|
||||
env = IdentityEnv(10)
|
||||
random.seed(0)
|
||||
|
||||
tf.set_random_seed(0)
|
||||
|
||||
param_noise = False
|
||||
model = deepq.models.mlp([32])
|
||||
act = deepq.learn(
|
||||
env,
|
||||
q_func=model,
|
||||
lr=1e-3,
|
||||
max_timesteps=10000,
|
||||
buffer_size=50000,
|
||||
exploration_fraction=0.1,
|
||||
exploration_final_eps=0.02,
|
||||
print_freq=10,
|
||||
param_noise=param_noise,
|
||||
)
|
||||
|
||||
tf.set_random_seed(0)
|
||||
|
||||
N_TRIALS = 1000
|
||||
sum_rew = 0
|
||||
obs = env.reset()
|
||||
for i in range(N_TRIALS):
|
||||
obs, rew, done, _ = env.step(act([obs]))
|
||||
sum_rew += rew
|
||||
|
||||
assert sum_rew > 0.9 * N_TRIALS
|
||||
|
||||
|
||||
if __name__ == '__main__':
|
||||
test_identity()
|
@@ -1,5 +1,4 @@
|
||||
from baselines.common.input import observation_input
|
||||
from baselines.common.tf_util import adjust_shape
|
||||
|
||||
import tensorflow as tf
|
||||
|
||||
@@ -37,7 +36,7 @@ class PlaceholderTfInput(TfInput):
|
||||
return self._placeholder
|
||||
|
||||
def make_feed_dict(self, data):
|
||||
return {self._placeholder: adjust_shape(self._placeholder, data)}
|
||||
return {self._placeholder: data}
|
||||
|
||||
|
||||
class Uint8Input(PlaceholderTfInput):
|
||||
|
@@ -47,12 +47,18 @@ class Mujoco_Dset(object):
|
||||
obs = traj_data['obs'][:traj_limitation]
|
||||
acs = traj_data['acs'][:traj_limitation]
|
||||
|
||||
# obs, acs: shape (N, L, ) + S where N = # episodes, L = episode length
|
||||
# and S is the environment observation/action space.
|
||||
# Flatten to (N * L, prod(S))
|
||||
self.obs = np.reshape(obs, [-1, np.prod(obs.shape[2:])])
|
||||
self.acs = np.reshape(acs, [-1, np.prod(acs.shape[2:])])
|
||||
|
||||
def flatten(x):
|
||||
# x.shape = (E,), or (E, L, D)
|
||||
_, size = x[0].shape
|
||||
episode_length = [len(i) for i in x]
|
||||
y = np.zeros((sum(episode_length), size))
|
||||
start_idx = 0
|
||||
for l, x_i in zip(episode_length, x):
|
||||
y[start_idx:(start_idx+l)] = x_i
|
||||
start_idx += l
|
||||
return y
|
||||
self.obs = np.array(flatten(obs))
|
||||
self.acs = np.array(flatten(acs))
|
||||
self.rets = traj_data['ep_rets'][:traj_limitation]
|
||||
self.avg_ret = sum(self.rets)/len(self.rets)
|
||||
self.std_ret = np.std(np.array(self.rets))
|
||||
|
@@ -18,7 +18,7 @@ def train(env_id, num_timesteps, seed):
|
||||
logger.configure()
|
||||
else:
|
||||
logger.configure(format_strs=[])
|
||||
workerseed = seed + 10000 * MPI.COMM_WORLD.Get_rank() if seed is not None else None
|
||||
workerseed = seed + 10000 * MPI.COMM_WORLD.Get_rank()
|
||||
set_global_seeds(workerseed)
|
||||
env = make_atari(env_id)
|
||||
def policy_fn(name, ob_space, ac_space): #pylint: disable=W0613
|
||||
|
@@ -1,22 +0,0 @@
|
||||
def mujoco():
|
||||
return dict(
|
||||
nsteps=2048,
|
||||
nminibatches=32,
|
||||
lam=0.95,
|
||||
gamma=0.99,
|
||||
noptepochs=10,
|
||||
log_interval=1,
|
||||
ent_coef=0.0,
|
||||
lr=lambda f: 3e-4 * f,
|
||||
cliprange=0.2,
|
||||
value_network='copy'
|
||||
)
|
||||
|
||||
def atari():
|
||||
return dict(
|
||||
nsteps=128, nminibatches=4,
|
||||
lam=0.95, gamma=0.99, noptepochs=4, log_interval=1,
|
||||
ent_coef=.01,
|
||||
lr=lambda f : f * 2.5e-4,
|
||||
cliprange=lambda f : f * 0.1,
|
||||
)
|
146
baselines/ppo2/policies.py
Normal file
146
baselines/ppo2/policies.py
Normal file
@@ -0,0 +1,146 @@
|
||||
import numpy as np
|
||||
import tensorflow as tf
|
||||
from baselines.a2c.utils import conv, fc, conv_to_fc, batch_to_seq, seq_to_batch, lstm, lnlstm
|
||||
from baselines.common.distributions import make_pdtype
|
||||
from baselines.common.input import observation_input
|
||||
|
||||
def nature_cnn(unscaled_images, **conv_kwargs):
|
||||
"""
|
||||
CNN from Nature paper.
|
||||
"""
|
||||
scaled_images = tf.cast(unscaled_images, tf.float32) / 255.
|
||||
activ = tf.nn.relu
|
||||
h = activ(conv(scaled_images, 'c1', nf=32, rf=8, stride=4, init_scale=np.sqrt(2),
|
||||
**conv_kwargs))
|
||||
h2 = activ(conv(h, 'c2', nf=64, rf=4, stride=2, init_scale=np.sqrt(2), **conv_kwargs))
|
||||
h3 = activ(conv(h2, 'c3', nf=64, rf=3, stride=1, init_scale=np.sqrt(2), **conv_kwargs))
|
||||
h3 = conv_to_fc(h3)
|
||||
return activ(fc(h3, 'fc1', nh=512, init_scale=np.sqrt(2)))
|
||||
|
||||
class LnLstmPolicy(object):
|
||||
def __init__(self, sess, ob_space, ac_space, nbatch, nsteps, nlstm=256, reuse=False):
|
||||
nenv = nbatch // nsteps
|
||||
X, processed_x = observation_input(ob_space, nbatch)
|
||||
M = tf.placeholder(tf.float32, [nbatch]) #mask (done t-1)
|
||||
S = tf.placeholder(tf.float32, [nenv, nlstm*2]) #states
|
||||
self.pdtype = make_pdtype(ac_space)
|
||||
with tf.variable_scope("model", reuse=reuse):
|
||||
h = nature_cnn(processed_x)
|
||||
xs = batch_to_seq(h, nenv, nsteps)
|
||||
ms = batch_to_seq(M, nenv, nsteps)
|
||||
h5, snew = lnlstm(xs, ms, S, 'lstm1', nh=nlstm)
|
||||
h5 = seq_to_batch(h5)
|
||||
vf = fc(h5, 'v', 1)
|
||||
self.pd, self.pi = self.pdtype.pdfromlatent(h5)
|
||||
|
||||
v0 = vf[:, 0]
|
||||
a0 = self.pd.sample()
|
||||
neglogp0 = self.pd.neglogp(a0)
|
||||
self.initial_state = np.zeros((nenv, nlstm*2), dtype=np.float32)
|
||||
|
||||
def step(ob, state, mask):
|
||||
return sess.run([a0, v0, snew, neglogp0], {X:ob, S:state, M:mask})
|
||||
|
||||
def value(ob, state, mask):
|
||||
return sess.run(v0, {X:ob, S:state, M:mask})
|
||||
|
||||
self.X = X
|
||||
self.M = M
|
||||
self.S = S
|
||||
self.vf = vf
|
||||
self.step = step
|
||||
self.value = value
|
||||
|
||||
class LstmPolicy(object):
|
||||
|
||||
def __init__(self, sess, ob_space, ac_space, nbatch, nsteps, nlstm=256, reuse=False):
|
||||
nenv = nbatch // nsteps
|
||||
self.pdtype = make_pdtype(ac_space)
|
||||
X, processed_x = observation_input(ob_space, nbatch)
|
||||
|
||||
M = tf.placeholder(tf.float32, [nbatch]) #mask (done t-1)
|
||||
S = tf.placeholder(tf.float32, [nenv, nlstm*2]) #states
|
||||
with tf.variable_scope("model", reuse=reuse):
|
||||
h = nature_cnn(X)
|
||||
xs = batch_to_seq(h, nenv, nsteps)
|
||||
ms = batch_to_seq(M, nenv, nsteps)
|
||||
h5, snew = lstm(xs, ms, S, 'lstm1', nh=nlstm)
|
||||
h5 = seq_to_batch(h5)
|
||||
vf = fc(h5, 'v', 1)
|
||||
self.pd, self.pi = self.pdtype.pdfromlatent(h5)
|
||||
|
||||
v0 = vf[:, 0]
|
||||
a0 = self.pd.sample()
|
||||
neglogp0 = self.pd.neglogp(a0)
|
||||
self.initial_state = np.zeros((nenv, nlstm*2), dtype=np.float32)
|
||||
|
||||
def step(ob, state, mask):
|
||||
return sess.run([a0, v0, snew, neglogp0], {X:ob, S:state, M:mask})
|
||||
|
||||
def value(ob, state, mask):
|
||||
return sess.run(v0, {X:ob, S:state, M:mask})
|
||||
|
||||
self.X = X
|
||||
self.M = M
|
||||
self.S = S
|
||||
self.vf = vf
|
||||
self.step = step
|
||||
self.value = value
|
||||
|
||||
class CnnPolicy(object):
|
||||
|
||||
def __init__(self, sess, ob_space, ac_space, nbatch, nsteps, reuse=False, **conv_kwargs): #pylint: disable=W0613
|
||||
self.pdtype = make_pdtype(ac_space)
|
||||
X, processed_x = observation_input(ob_space, nbatch)
|
||||
with tf.variable_scope("model", reuse=reuse):
|
||||
h = nature_cnn(processed_x, **conv_kwargs)
|
||||
vf = fc(h, 'v', 1)[:,0]
|
||||
self.pd, self.pi = self.pdtype.pdfromlatent(h, init_scale=0.01)
|
||||
|
||||
a0 = self.pd.sample()
|
||||
neglogp0 = self.pd.neglogp(a0)
|
||||
self.initial_state = None
|
||||
|
||||
def step(ob, *_args, **_kwargs):
|
||||
a, v, neglogp = sess.run([a0, vf, neglogp0], {X:ob})
|
||||
return a, v, self.initial_state, neglogp
|
||||
|
||||
def value(ob, *_args, **_kwargs):
|
||||
return sess.run(vf, {X:ob})
|
||||
|
||||
self.X = X
|
||||
self.vf = vf
|
||||
self.step = step
|
||||
self.value = value
|
||||
|
||||
class MlpPolicy(object):
|
||||
def __init__(self, sess, ob_space, ac_space, nbatch, nsteps, reuse=False): #pylint: disable=W0613
|
||||
self.pdtype = make_pdtype(ac_space)
|
||||
with tf.variable_scope("model", reuse=reuse):
|
||||
X, processed_x = observation_input(ob_space, nbatch)
|
||||
activ = tf.tanh
|
||||
processed_x = tf.layers.flatten(processed_x)
|
||||
pi_h1 = activ(fc(processed_x, 'pi_fc1', nh=64, init_scale=np.sqrt(2)))
|
||||
pi_h2 = activ(fc(pi_h1, 'pi_fc2', nh=64, init_scale=np.sqrt(2)))
|
||||
vf_h1 = activ(fc(processed_x, 'vf_fc1', nh=64, init_scale=np.sqrt(2)))
|
||||
vf_h2 = activ(fc(vf_h1, 'vf_fc2', nh=64, init_scale=np.sqrt(2)))
|
||||
vf = fc(vf_h2, 'vf', 1)[:,0]
|
||||
|
||||
self.pd, self.pi = self.pdtype.pdfromlatent(pi_h2, init_scale=0.01)
|
||||
|
||||
|
||||
a0 = self.pd.sample()
|
||||
neglogp0 = self.pd.neglogp(a0)
|
||||
self.initial_state = None
|
||||
|
||||
def step(ob, *_args, **_kwargs):
|
||||
a, v, neglogp = sess.run([a0, vf, neglogp0], {X:ob})
|
||||
return a, v, self.initial_state, neglogp
|
||||
|
||||
def value(ob, *_args, **_kwargs):
|
||||
return sess.run(vf, {X:ob})
|
||||
|
||||
self.X = X
|
||||
self.vf = vf
|
||||
self.step = step
|
||||
self.value = value
|
@@ -1,29 +1,21 @@
|
||||
import os
|
||||
import time
|
||||
import functools
|
||||
import joblib
|
||||
import numpy as np
|
||||
import os.path as osp
|
||||
import tensorflow as tf
|
||||
from baselines import logger
|
||||
from collections import deque
|
||||
from baselines.common import explained_variance, set_global_seeds
|
||||
from baselines.common.policies import build_policy
|
||||
from baselines.common import explained_variance
|
||||
from baselines.common.runners import AbstractEnvRunner
|
||||
from baselines.common.tf_util import get_session, save_variables, load_variables
|
||||
from baselines.common.mpi_adam_optimizer import MpiAdamOptimizer
|
||||
|
||||
from mpi4py import MPI
|
||||
from baselines.common.tf_util import initialize
|
||||
from baselines.common.mpi_util import sync_from_root
|
||||
|
||||
class Model(object):
|
||||
def __init__(self, *, policy, ob_space, ac_space, nbatch_act, nbatch_train,
|
||||
nsteps, ent_coef, vf_coef, max_grad_norm):
|
||||
sess = get_session()
|
||||
sess = tf.get_default_session()
|
||||
|
||||
with tf.variable_scope('ppo2_model', reuse=tf.AUTO_REUSE):
|
||||
act_model = policy(nbatch_act, 1, sess)
|
||||
train_model = policy(nbatch_train, nsteps, sess)
|
||||
act_model = policy(sess, ob_space, ac_space, nbatch_act, 1, reuse=False)
|
||||
train_model = policy(sess, ob_space, ac_space, nbatch_train, nsteps, reuse=True)
|
||||
|
||||
A = train_model.pdtype.sample_placeholder([None])
|
||||
ADV = tf.placeholder(tf.float32, [None])
|
||||
@@ -48,16 +40,14 @@ class Model(object):
|
||||
approxkl = .5 * tf.reduce_mean(tf.square(neglogpac - OLDNEGLOGPAC))
|
||||
clipfrac = tf.reduce_mean(tf.to_float(tf.greater(tf.abs(ratio - 1.0), CLIPRANGE)))
|
||||
loss = pg_loss - entropy * ent_coef + vf_loss * vf_coef
|
||||
params = tf.trainable_variables('ppo2_model')
|
||||
trainer = MpiAdamOptimizer(MPI.COMM_WORLD, learning_rate=LR, epsilon=1e-5)
|
||||
grads_and_var = trainer.compute_gradients(loss, params)
|
||||
grads, var = zip(*grads_and_var)
|
||||
|
||||
with tf.variable_scope('model'):
|
||||
params = tf.trainable_variables()
|
||||
grads = tf.gradients(loss, params)
|
||||
if max_grad_norm is not None:
|
||||
grads, _grad_norm = tf.clip_by_global_norm(grads, max_grad_norm)
|
||||
grads_and_var = list(zip(grads, var))
|
||||
|
||||
_train = trainer.apply_gradients(grads_and_var)
|
||||
grads = list(zip(grads, params))
|
||||
trainer = tf.train.AdamOptimizer(learning_rate=LR, epsilon=1e-5)
|
||||
_train = trainer.apply_gradients(grads)
|
||||
|
||||
def train(lr, cliprange, obs, returns, masks, actions, values, neglogpacs, states=None):
|
||||
advs = returns - values
|
||||
@@ -73,6 +63,17 @@ class Model(object):
|
||||
)[:-1]
|
||||
self.loss_names = ['policy_loss', 'value_loss', 'policy_entropy', 'approxkl', 'clipfrac']
|
||||
|
||||
def save(save_path):
|
||||
ps = sess.run(params)
|
||||
joblib.dump(ps, save_path)
|
||||
|
||||
def load(load_path):
|
||||
loaded_params = joblib.load(load_path)
|
||||
restores = []
|
||||
for p, loaded_p in zip(params, loaded_params):
|
||||
restores.append(p.assign(loaded_p))
|
||||
sess.run(restores)
|
||||
# If you want to load weights, also save/load observation scaling inside VecNormalize
|
||||
|
||||
self.train = train
|
||||
self.train_model = train_model
|
||||
@@ -80,14 +81,9 @@ class Model(object):
|
||||
self.step = act_model.step
|
||||
self.value = act_model.value
|
||||
self.initial_state = act_model.initial_state
|
||||
|
||||
self.save = functools.partial(save_variables, sess=sess)
|
||||
self.load = functools.partial(load_variables, sess=sess)
|
||||
|
||||
if MPI.COMM_WORLD.Get_rank() == 0:
|
||||
initialize()
|
||||
global_variables = tf.get_collection(tf.GraphKeys.GLOBAL_VARIABLES, scope="")
|
||||
sync_from_root(sess, global_variables) #pylint: disable=E1101
|
||||
self.save = save
|
||||
self.load = load
|
||||
tf.global_variables_initializer().run(session=sess) #pylint: disable=E1101
|
||||
|
||||
class Runner(AbstractEnvRunner):
|
||||
|
||||
@@ -101,7 +97,7 @@ class Runner(AbstractEnvRunner):
|
||||
mb_states = self.states
|
||||
epinfos = []
|
||||
for _ in range(self.nsteps):
|
||||
actions, values, self.states, neglogpacs = self.model.step(self.obs, S=self.states, M=self.dones)
|
||||
actions, values, self.states, neglogpacs = self.model.step(self.obs, self.states, self.dones)
|
||||
mb_obs.append(self.obs.copy())
|
||||
mb_actions.append(actions)
|
||||
mb_values.append(values)
|
||||
@@ -119,7 +115,7 @@ class Runner(AbstractEnvRunner):
|
||||
mb_values = np.asarray(mb_values, dtype=np.float32)
|
||||
mb_neglogpacs = np.asarray(mb_neglogpacs, dtype=np.float32)
|
||||
mb_dones = np.asarray(mb_dones, dtype=np.bool)
|
||||
last_values = self.model.value(self.obs, S=self.states, M=self.dones)
|
||||
last_values = self.model.value(self.obs, self.states, self.dones)
|
||||
#discount/bootstrap off value fn
|
||||
mb_returns = np.zeros_like(mb_rewards)
|
||||
mb_advs = np.zeros_like(mb_rewards)
|
||||
@@ -149,65 +145,10 @@ def constfn(val):
|
||||
return val
|
||||
return f
|
||||
|
||||
def learn(*, network, env, total_timesteps, seed=None, nsteps=2048, ent_coef=0.0, lr=3e-4,
|
||||
def learn(*, policy, env, nsteps, total_timesteps, ent_coef, lr,
|
||||
vf_coef=0.5, max_grad_norm=0.5, gamma=0.99, lam=0.95,
|
||||
log_interval=10, nminibatches=4, noptepochs=4, cliprange=0.2,
|
||||
save_interval=0, load_path=None, **network_kwargs):
|
||||
'''
|
||||
Learn policy using PPO algorithm (https://arxiv.org/abs/1707.06347)
|
||||
|
||||
Parameters:
|
||||
----------
|
||||
|
||||
network: policy network architecture. Either string (mlp, lstm, lnlstm, cnn_lstm, cnn, cnn_small, conv_only - see baselines.common/models.py for full list)
|
||||
specifying the standard network architecture, or a function that takes tensorflow tensor as input and returns
|
||||
tuple (output_tensor, extra_feed) where output tensor is the last network layer output, extra_feed is None for feed-forward
|
||||
neural nets, and extra_feed is a dictionary describing how to feed state into the network for recurrent neural nets.
|
||||
See baselines.common/policies.py/lstm for more details on using recurrent nets in policies
|
||||
|
||||
env: baselines.common.vec_env.VecEnv environment. Needs to be vectorized for parallel environment simulation.
|
||||
The environments produced by gym.make can be wrapped using baselines.common.vec_env.DummyVecEnv class.
|
||||
|
||||
|
||||
nsteps: int number of steps of the vectorized environment per update (i.e. batch size is nsteps * nenv where
|
||||
nenv is number of environment copies simulated in parallel)
|
||||
|
||||
total_timesteps: int number of timesteps (i.e. number of actions taken in the environment)
|
||||
|
||||
ent_coef: float policy entropy coefficient in the optimization objective
|
||||
|
||||
lr: float or function learning rate, constant or a schedule function [0,1] -> R+ where 1 is beginning of the
|
||||
training and 0 is the end of the training.
|
||||
|
||||
vf_coef: float value function loss coefficient in the optimization objective
|
||||
|
||||
max_grad_norm: float or None gradient norm clipping coefficient
|
||||
|
||||
gamma: float discounting factor
|
||||
|
||||
lam: float advantage estimation discounting factor (lambda in the paper)
|
||||
|
||||
log_interval: int number of timesteps between logging events
|
||||
|
||||
nminibatches: int number of training minibatches per update
|
||||
|
||||
noptepochs: int number of training epochs per update
|
||||
|
||||
cliprange: float or function clipping range, constant or schedule function [0,1] -> R+ where 1 is beginning of the training
|
||||
and 0 is the end of the training
|
||||
|
||||
save_interval: int number of timesteps between saving events
|
||||
|
||||
load_path: str path to load the model from
|
||||
|
||||
**network_kwargs: keyword arguments to the policy / network builder. See baselines.common/policies.py/build_policy and arguments to a particular type of network
|
||||
For instance, 'mlp' network architecture has arguments num_hidden and num_layers.
|
||||
|
||||
|
||||
|
||||
'''
|
||||
|
||||
set_global_seeds(seed)
|
||||
save_interval=0, load_path=None):
|
||||
|
||||
if isinstance(lr, float): lr = constfn(lr)
|
||||
else: assert callable(lr)
|
||||
@@ -215,8 +156,6 @@ def learn(*, network, env, total_timesteps, seed=None, nsteps=2048, ent_coef=0.0
|
||||
else: assert callable(cliprange)
|
||||
total_timesteps = int(total_timesteps)
|
||||
|
||||
policy = build_policy(env, network, **network_kwargs)
|
||||
|
||||
nenvs = env.num_envs
|
||||
ob_space = env.observation_space
|
||||
ac_space = env.action_space
|
||||
@@ -241,6 +180,7 @@ def learn(*, network, env, total_timesteps, seed=None, nsteps=2048, ent_coef=0.0
|
||||
nupdates = total_timesteps//nbatch
|
||||
for update in range(1, nupdates+1):
|
||||
assert nbatch % nminibatches == 0
|
||||
nbatch_train = nbatch // nminibatches
|
||||
tstart = time.time()
|
||||
frac = 1.0 - (update - 1.0) / nupdates
|
||||
lrnow = lr(frac)
|
||||
@@ -288,9 +228,8 @@ def learn(*, network, env, total_timesteps, seed=None, nsteps=2048, ent_coef=0.0
|
||||
logger.logkv('time_elapsed', tnow - tfirststart)
|
||||
for (lossval, lossname) in zip(lossvals, model.loss_names):
|
||||
logger.logkv(lossname, lossval)
|
||||
if MPI.COMM_WORLD.Get_rank() == 0:
|
||||
logger.dumpkvs()
|
||||
if save_interval and (update % save_interval == 0 or update == 1) and logger.get_dir() and MPI.COMM_WORLD.Get_rank() == 0:
|
||||
logger.dumpkvs()
|
||||
if save_interval and (update % save_interval == 0 or update == 1) and logger.get_dir():
|
||||
checkdir = osp.join(logger.get_dir(), 'checkpoints')
|
||||
os.makedirs(checkdir, exist_ok=True)
|
||||
savepath = osp.join(checkdir, '%.5i'%update)
|
||||
@@ -301,6 +240,3 @@ def learn(*, network, env, total_timesteps, seed=None, nsteps=2048, ent_coef=0.0
|
||||
|
||||
def safemean(xs):
|
||||
return np.nan if len(xs) == 0 else np.mean(xs)
|
||||
|
||||
|
||||
|
||||
|
40
baselines/ppo2/run_atari.py
Normal file
40
baselines/ppo2/run_atari.py
Normal file
@@ -0,0 +1,40 @@
|
||||
#!/usr/bin/env python3
|
||||
import sys
|
||||
from baselines import logger
|
||||
from baselines.common.cmd_util import make_atari_env, atari_arg_parser
|
||||
from baselines.common.vec_env.vec_frame_stack import VecFrameStack
|
||||
from baselines.ppo2 import ppo2
|
||||
from baselines.ppo2.policies import CnnPolicy, LstmPolicy, LnLstmPolicy, MlpPolicy
|
||||
import multiprocessing
|
||||
import tensorflow as tf
|
||||
|
||||
|
||||
def train(env_id, num_timesteps, seed, policy):
|
||||
|
||||
ncpu = multiprocessing.cpu_count()
|
||||
if sys.platform == 'darwin': ncpu //= 2
|
||||
config = tf.ConfigProto(allow_soft_placement=True,
|
||||
intra_op_parallelism_threads=ncpu,
|
||||
inter_op_parallelism_threads=ncpu)
|
||||
config.gpu_options.allow_growth = True #pylint: disable=E1101
|
||||
tf.Session(config=config).__enter__()
|
||||
|
||||
env = VecFrameStack(make_atari_env(env_id, 8, seed), 4)
|
||||
policy = {'cnn' : CnnPolicy, 'lstm' : LstmPolicy, 'lnlstm' : LnLstmPolicy, 'mlp': MlpPolicy}[policy]
|
||||
ppo2.learn(policy=policy, env=env, nsteps=128, nminibatches=4,
|
||||
lam=0.95, gamma=0.99, noptepochs=4, log_interval=1,
|
||||
ent_coef=.01,
|
||||
lr=lambda f : f * 2.5e-4,
|
||||
cliprange=lambda f : f * 0.1,
|
||||
total_timesteps=int(num_timesteps * 1.1))
|
||||
|
||||
def main():
|
||||
parser = atari_arg_parser()
|
||||
parser.add_argument('--policy', help='Policy architecture', choices=['cnn', 'lstm', 'lnlstm', 'mlp'], default='cnn')
|
||||
args = parser.parse_args()
|
||||
logger.configure()
|
||||
train(args.env, num_timesteps=args.num_timesteps, seed=args.seed,
|
||||
policy=args.policy)
|
||||
|
||||
if __name__ == '__main__':
|
||||
main()
|
57
baselines/ppo2/run_mujoco.py
Normal file
57
baselines/ppo2/run_mujoco.py
Normal file
@@ -0,0 +1,57 @@
|
||||
#!/usr/bin/env python3
|
||||
import numpy as np
|
||||
from baselines.common.cmd_util import mujoco_arg_parser
|
||||
from baselines import bench, logger
|
||||
|
||||
|
||||
def train(env_id, num_timesteps, seed):
|
||||
from baselines.common import set_global_seeds
|
||||
from baselines.common.vec_env.vec_normalize import VecNormalize
|
||||
from baselines.ppo2 import ppo2
|
||||
from baselines.ppo2.policies import MlpPolicy
|
||||
import gym
|
||||
import tensorflow as tf
|
||||
from baselines.common.vec_env.dummy_vec_env import DummyVecEnv
|
||||
ncpu = 1
|
||||
config = tf.ConfigProto(allow_soft_placement=True,
|
||||
intra_op_parallelism_threads=ncpu,
|
||||
inter_op_parallelism_threads=ncpu)
|
||||
tf.Session(config=config).__enter__()
|
||||
|
||||
def make_env():
|
||||
env = gym.make(env_id)
|
||||
env = bench.Monitor(env, logger.get_dir(), allow_early_resets=True)
|
||||
return env
|
||||
|
||||
env = DummyVecEnv([make_env])
|
||||
env = VecNormalize(env)
|
||||
|
||||
set_global_seeds(seed)
|
||||
policy = MlpPolicy
|
||||
model = ppo2.learn(policy=policy, env=env, nsteps=2048, nminibatches=32,
|
||||
lam=0.95, gamma=0.99, noptepochs=10, log_interval=1,
|
||||
ent_coef=0.0,
|
||||
lr=3e-4,
|
||||
cliprange=0.2,
|
||||
total_timesteps=num_timesteps)
|
||||
|
||||
return model, env
|
||||
|
||||
|
||||
def main():
|
||||
args = mujoco_arg_parser().parse_args()
|
||||
logger.configure()
|
||||
model, env = train(args.env, num_timesteps=args.num_timesteps, seed=args.seed)
|
||||
|
||||
if args.play:
|
||||
logger.log("Running trained model")
|
||||
obs = np.zeros((env.num_envs,) + env.observation_space.shape)
|
||||
obs[:] = env.reset()
|
||||
while True:
|
||||
actions = model.step(obs)[0]
|
||||
obs[:] = env.step(actions)[0]
|
||||
env.render()
|
||||
|
||||
|
||||
if __name__ == '__main__':
|
||||
main()
|
230
baselines/run.py
230
baselines/run.py
@@ -1,230 +0,0 @@
|
||||
import sys
|
||||
import multiprocessing
|
||||
import os
|
||||
import os.path as osp
|
||||
import gym
|
||||
from collections import defaultdict
|
||||
import tensorflow as tf
|
||||
|
||||
from baselines.common.vec_env.vec_frame_stack import VecFrameStack
|
||||
from baselines.common.cmd_util import common_arg_parser, parse_unknown_args, make_mujoco_env, make_atari_env
|
||||
from baselines.common.tf_util import save_state, load_state, get_session
|
||||
from baselines import bench, logger
|
||||
from importlib import import_module
|
||||
|
||||
from baselines.common.vec_env.vec_normalize import VecNormalize
|
||||
from baselines.common.vec_env.dummy_vec_env import DummyVecEnv
|
||||
from baselines.common.vec_env.subproc_vec_env import SubprocVecEnv
|
||||
from baselines.common import atari_wrappers, retro_wrappers
|
||||
|
||||
try:
|
||||
from mpi4py import MPI
|
||||
except ImportError:
|
||||
MPI = None
|
||||
|
||||
_game_envs = defaultdict(set)
|
||||
for env in gym.envs.registry.all():
|
||||
# solve this with regexes
|
||||
env_type = env._entry_point.split(':')[0].split('.')[-1]
|
||||
_game_envs[env_type].add(env.id)
|
||||
|
||||
# reading benchmark names directly from retro requires
|
||||
# importing retro here, and for some reason that crashes tensorflow
|
||||
# in ubuntu
|
||||
_game_envs['retro'] = set([
|
||||
'BubbleBobble-Nes',
|
||||
'SuperMarioBros-Nes',
|
||||
'TwinBee3PokoPokoDaimaou-Nes',
|
||||
'SpaceHarrier-Nes',
|
||||
'SonicTheHedgehog-Genesis',
|
||||
'Vectorman-Genesis',
|
||||
'FinalFight-Snes',
|
||||
'SpaceInvaders-Snes',
|
||||
])
|
||||
|
||||
|
||||
def train(args, extra_args):
|
||||
env_type, env_id = get_env_type(args.env)
|
||||
|
||||
total_timesteps = int(args.num_timesteps)
|
||||
seed = args.seed
|
||||
|
||||
learn = get_learn_function(args.alg)
|
||||
alg_kwargs = get_learn_function_defaults(args.alg, env_type)
|
||||
alg_kwargs.update(extra_args)
|
||||
|
||||
env = build_env(args)
|
||||
|
||||
if args.network:
|
||||
alg_kwargs['network'] = args.network
|
||||
else:
|
||||
if alg_kwargs.get('network') is None:
|
||||
alg_kwargs['network'] = get_default_network(env_type)
|
||||
|
||||
|
||||
|
||||
print('Training {} on {}:{} with arguments \n{}'.format(args.alg, env_type, env_id, alg_kwargs))
|
||||
|
||||
model = learn(
|
||||
env=env,
|
||||
seed=seed,
|
||||
total_timesteps=total_timesteps,
|
||||
**alg_kwargs
|
||||
)
|
||||
|
||||
return model, env
|
||||
|
||||
|
||||
def build_env(args, render=False):
|
||||
ncpu = multiprocessing.cpu_count()
|
||||
if sys.platform == 'darwin': ncpu //= 2
|
||||
nenv = args.num_env or ncpu if not render else 1
|
||||
alg = args.alg
|
||||
rank = MPI.COMM_WORLD.Get_rank() if MPI else 0
|
||||
seed = args.seed
|
||||
|
||||
env_type, env_id = get_env_type(args.env)
|
||||
if env_type == 'mujoco':
|
||||
get_session(tf.ConfigProto(allow_soft_placement=True,
|
||||
intra_op_parallelism_threads=1,
|
||||
inter_op_parallelism_threads=1))
|
||||
|
||||
if args.num_env:
|
||||
env = SubprocVecEnv([lambda: make_mujoco_env(env_id, seed + i if seed is not None else None, args.reward_scale) for i in range(args.num_env)])
|
||||
else:
|
||||
env = DummyVecEnv([lambda: make_mujoco_env(env_id, seed, args.reward_scale)])
|
||||
|
||||
env = VecNormalize(env)
|
||||
|
||||
elif env_type == 'atari':
|
||||
if alg == 'acer':
|
||||
env = make_atari_env(env_id, nenv, seed)
|
||||
elif alg == 'deepq':
|
||||
env = atari_wrappers.make_atari(env_id)
|
||||
env.seed(seed)
|
||||
env = bench.Monitor(env, logger.get_dir())
|
||||
env = atari_wrappers.wrap_deepmind(env, frame_stack=True, scale=True)
|
||||
elif alg == 'trpo_mpi':
|
||||
env = atari_wrappers.make_atari(env_id)
|
||||
env.seed(seed)
|
||||
env = bench.Monitor(env, logger.get_dir() and osp.join(logger.get_dir(), str(rank)))
|
||||
env = atari_wrappers.wrap_deepmind(env)
|
||||
# TODO check if the second seeding is necessary, and eventually remove
|
||||
env.seed(seed)
|
||||
else:
|
||||
frame_stack_size = 4
|
||||
env = VecFrameStack(make_atari_env(env_id, nenv, seed), frame_stack_size)
|
||||
|
||||
elif env_type == 'retro':
|
||||
import retro
|
||||
gamestate = args.gamestate or 'Level1-1'
|
||||
env = retro_wrappers.make_retro(game=args.env, state=gamestate, max_episode_steps=10000, use_restricted_actions=retro.Actions.DISCRETE)
|
||||
env.seed(args.seed)
|
||||
env = bench.Monitor(env, logger.get_dir())
|
||||
env = retro_wrappers.wrap_deepmind_retro(env)
|
||||
|
||||
elif env_type == 'classic':
|
||||
def make_env():
|
||||
e = gym.make(env_id)
|
||||
e.seed(seed)
|
||||
return e
|
||||
|
||||
env = DummyVecEnv([make_env])
|
||||
|
||||
return env
|
||||
|
||||
|
||||
def get_env_type(env_id):
|
||||
if env_id in _game_envs.keys():
|
||||
env_type = env_id
|
||||
env_id = [g for g in _game_envs[env_type]][0]
|
||||
else:
|
||||
env_type = None
|
||||
for g, e in _game_envs.items():
|
||||
if env_id in e:
|
||||
env_type = g
|
||||
break
|
||||
assert env_type is not None, 'env_id {} is not recognized in env types'.format(env_id, _game_envs.keys())
|
||||
|
||||
return env_type, env_id
|
||||
|
||||
def get_default_network(env_type):
|
||||
if env_type == 'mujoco' or env_type=='classic':
|
||||
return 'mlp'
|
||||
if env_type == 'atari':
|
||||
return 'cnn'
|
||||
|
||||
raise ValueError('Unknown env_type {}'.format(env_type))
|
||||
|
||||
def get_alg_module(alg, submodule=None):
|
||||
submodule = submodule or alg
|
||||
try:
|
||||
# first try to import the alg module from baselines
|
||||
alg_module = import_module('.'.join(['baselines', alg, submodule]))
|
||||
except ImportError:
|
||||
# then from rl_algs
|
||||
alg_module = import_module('.'.join(['rl_' + 'algs', alg, submodule]))
|
||||
|
||||
return alg_module
|
||||
|
||||
|
||||
def get_learn_function(alg):
|
||||
return get_alg_module(alg).learn
|
||||
|
||||
def get_learn_function_defaults(alg, env_type):
|
||||
try:
|
||||
alg_defaults = get_alg_module(alg, 'defaults')
|
||||
kwargs = getattr(alg_defaults, env_type)()
|
||||
except (ImportError, AttributeError):
|
||||
kwargs = {}
|
||||
return kwargs
|
||||
|
||||
def parse(v):
|
||||
'''
|
||||
convert value of a command-line arg to a python object if possible, othewise, keep as string
|
||||
'''
|
||||
|
||||
assert isinstance(v, str)
|
||||
try:
|
||||
return eval(v)
|
||||
except (NameError, SyntaxError):
|
||||
return v
|
||||
|
||||
|
||||
def main():
|
||||
# configure logger, disable logging in child MPI processes (with rank > 0)
|
||||
|
||||
arg_parser = common_arg_parser()
|
||||
args, unknown_args = arg_parser.parse_known_args()
|
||||
extra_args = {k: parse(v) for k,v in parse_unknown_args(unknown_args).items()}
|
||||
|
||||
|
||||
if MPI is None or MPI.COMM_WORLD.Get_rank() == 0:
|
||||
rank = 0
|
||||
logger.configure()
|
||||
else:
|
||||
logger.configure(format_strs = [])
|
||||
rank = MPI.COMM_WORLD.Get_rank()
|
||||
|
||||
model, _ = train(args, extra_args)
|
||||
|
||||
if args.save_path is not None and rank == 0:
|
||||
save_path = osp.expanduser(args.save_path)
|
||||
model.save(save_path)
|
||||
|
||||
|
||||
if args.play:
|
||||
logger.log("Running trained model")
|
||||
env = build_env(args, render=True)
|
||||
obs = env.reset()
|
||||
while True:
|
||||
actions = model.step(obs)[0]
|
||||
obs, _, done, _ = env.step(actions)
|
||||
env.render()
|
||||
if done:
|
||||
obs = env.reset()
|
||||
|
||||
|
||||
|
||||
if __name__ == '__main__':
|
||||
main()
|
@@ -1,30 +0,0 @@
|
||||
from rl_common.models import mlp, cnn_small
|
||||
|
||||
|
||||
def atari():
|
||||
return dict(
|
||||
network = cnn_small(),
|
||||
timesteps_per_batch=512,
|
||||
max_kl=0.001,
|
||||
cg_iters=10,
|
||||
cg_damping=1e-3,
|
||||
gamma=0.98,
|
||||
lam=1.0,
|
||||
vf_iters=3,
|
||||
vf_stepsize=1e-4,
|
||||
entcoeff=0.00,
|
||||
)
|
||||
|
||||
def mujoco():
|
||||
return dict(
|
||||
network = mlp(num_hidden=32, num_layers=2),
|
||||
timesteps_per_batch=1024,
|
||||
max_kl=0.01,
|
||||
cg_iters=10,
|
||||
cg_damping=0.1,
|
||||
gamma=0.99,
|
||||
lam=0.98,
|
||||
vf_iters=5,
|
||||
vf_stepsize=1e-3,
|
||||
normalize_observations=True,
|
||||
)
|
56
baselines/trpo_mpi/nosharing_cnn_policy.py
Normal file
56
baselines/trpo_mpi/nosharing_cnn_policy.py
Normal file
@@ -0,0 +1,56 @@
|
||||
import baselines.common.tf_util as U
|
||||
import tensorflow as tf
|
||||
import gym
|
||||
from baselines.common.distributions import make_pdtype
|
||||
|
||||
class CnnPolicy(object):
|
||||
recurrent = False
|
||||
def __init__(self, name, ob_space, ac_space):
|
||||
with tf.variable_scope(name):
|
||||
self._init(ob_space, ac_space)
|
||||
self.scope = tf.get_variable_scope().name
|
||||
|
||||
def _init(self, ob_space, ac_space):
|
||||
assert isinstance(ob_space, gym.spaces.Box)
|
||||
|
||||
self.pdtype = pdtype = make_pdtype(ac_space)
|
||||
sequence_length = None
|
||||
|
||||
ob = U.get_placeholder(name="ob", dtype=tf.float32, shape=[sequence_length] + list(ob_space.shape))
|
||||
|
||||
obscaled = ob / 255.0
|
||||
|
||||
with tf.variable_scope("pol"):
|
||||
x = obscaled
|
||||
x = tf.nn.relu(U.conv2d(x, 8, "l1", [8, 8], [4, 4], pad="VALID"))
|
||||
x = tf.nn.relu(U.conv2d(x, 16, "l2", [4, 4], [2, 2], pad="VALID"))
|
||||
x = U.flattenallbut0(x)
|
||||
x = tf.nn.relu(tf.layers.dense(x, 128, name='lin', kernel_initializer=U.normc_initializer(1.0)))
|
||||
logits = tf.layers.dense(x, pdtype.param_shape()[0], name='logits', kernel_initializer=U.normc_initializer(0.01))
|
||||
self.pd = pdtype.pdfromflat(logits)
|
||||
with tf.variable_scope("vf"):
|
||||
x = obscaled
|
||||
x = tf.nn.relu(U.conv2d(x, 8, "l1", [8, 8], [4, 4], pad="VALID"))
|
||||
x = tf.nn.relu(U.conv2d(x, 16, "l2", [4, 4], [2, 2], pad="VALID"))
|
||||
x = U.flattenallbut0(x)
|
||||
x = tf.nn.relu(tf.layers.dense(x, 128, name='lin', kernel_initializer=U.normc_initializer(1.0)))
|
||||
self.vpred = tf.layers.dense(x, 1, name='value', kernel_initializer=U.normc_initializer(1.0))
|
||||
self.vpredz = self.vpred
|
||||
|
||||
self.state_in = []
|
||||
self.state_out = []
|
||||
|
||||
stochastic = tf.placeholder(dtype=tf.bool, shape=())
|
||||
ac = self.pd.sample()
|
||||
self._act = U.function([stochastic, ob], [ac, self.vpred])
|
||||
|
||||
def act(self, stochastic, ob):
|
||||
ac1, vpred1 = self._act(stochastic, ob[None])
|
||||
return ac1[0], vpred1[0]
|
||||
def get_variables(self):
|
||||
return tf.get_collection(tf.GraphKeys.GLOBAL_VARIABLES, self.scope)
|
||||
def get_trainable_variables(self):
|
||||
return tf.get_collection(tf.GraphKeys.TRAINABLE_VARIABLES, self.scope)
|
||||
def get_initial_state(self):
|
||||
return []
|
||||
|
43
baselines/trpo_mpi/run_atari.py
Normal file
43
baselines/trpo_mpi/run_atari.py
Normal file
@@ -0,0 +1,43 @@
|
||||
#!/usr/bin/env python3
|
||||
from mpi4py import MPI
|
||||
from baselines.common import set_global_seeds
|
||||
import os.path as osp
|
||||
import gym, logging
|
||||
from baselines import logger
|
||||
from baselines import bench
|
||||
from baselines.common.atari_wrappers import make_atari, wrap_deepmind
|
||||
from baselines.common.cmd_util import atari_arg_parser
|
||||
|
||||
def train(env_id, num_timesteps, seed):
|
||||
from baselines.trpo_mpi.nosharing_cnn_policy import CnnPolicy
|
||||
from baselines.trpo_mpi import trpo_mpi
|
||||
import baselines.common.tf_util as U
|
||||
rank = MPI.COMM_WORLD.Get_rank()
|
||||
sess = U.single_threaded_session()
|
||||
sess.__enter__()
|
||||
if rank == 0:
|
||||
logger.configure()
|
||||
else:
|
||||
logger.configure(format_strs=[])
|
||||
|
||||
workerseed = seed + 10000 * MPI.COMM_WORLD.Get_rank()
|
||||
set_global_seeds(workerseed)
|
||||
env = make_atari(env_id)
|
||||
def policy_fn(name, ob_space, ac_space): #pylint: disable=W0613
|
||||
return CnnPolicy(name=name, ob_space=env.observation_space, ac_space=env.action_space)
|
||||
env = bench.Monitor(env, logger.get_dir() and osp.join(logger.get_dir(), str(rank)))
|
||||
env.seed(workerseed)
|
||||
|
||||
env = wrap_deepmind(env)
|
||||
env.seed(workerseed)
|
||||
|
||||
trpo_mpi.learn(env, policy_fn, timesteps_per_batch=512, max_kl=0.001, cg_iters=10, cg_damping=1e-3,
|
||||
max_timesteps=int(num_timesteps * 1.1), gamma=0.98, lam=1.0, vf_iters=3, vf_stepsize=1e-4, entcoeff=0.00)
|
||||
env.close()
|
||||
|
||||
def main():
|
||||
args = atari_arg_parser().parse_args()
|
||||
train(args.env, num_timesteps=args.num_timesteps, seed=args.seed)
|
||||
|
||||
if __name__ == "__main__":
|
||||
main()
|
36
baselines/trpo_mpi/run_mujoco.py
Normal file
36
baselines/trpo_mpi/run_mujoco.py
Normal file
@@ -0,0 +1,36 @@
|
||||
#!/usr/bin/env python3
|
||||
# noinspection PyUnresolvedReferences
|
||||
from mpi4py import MPI
|
||||
from baselines.common.cmd_util import make_mujoco_env, mujoco_arg_parser
|
||||
from baselines import logger
|
||||
from baselines.ppo1.mlp_policy import MlpPolicy
|
||||
from baselines.trpo_mpi import trpo_mpi
|
||||
|
||||
def train(env_id, num_timesteps, seed):
|
||||
import baselines.common.tf_util as U
|
||||
sess = U.single_threaded_session()
|
||||
sess.__enter__()
|
||||
|
||||
rank = MPI.COMM_WORLD.Get_rank()
|
||||
if rank == 0:
|
||||
logger.configure()
|
||||
else:
|
||||
logger.configure(format_strs=[])
|
||||
logger.set_level(logger.DISABLED)
|
||||
workerseed = seed + 10000 * MPI.COMM_WORLD.Get_rank()
|
||||
def policy_fn(name, ob_space, ac_space):
|
||||
return MlpPolicy(name=name, ob_space=ob_space, ac_space=ac_space,
|
||||
hid_size=32, num_hid_layers=2)
|
||||
env = make_mujoco_env(env_id, workerseed)
|
||||
trpo_mpi.learn(env, policy_fn, timesteps_per_batch=1024, max_kl=0.01, cg_iters=10, cg_damping=0.1,
|
||||
max_timesteps=num_timesteps, gamma=0.99, lam=0.98, vf_iters=5, vf_stepsize=1e-3)
|
||||
env.close()
|
||||
|
||||
def main():
|
||||
args = mujoco_arg_parser().parse_args()
|
||||
train(args.env, num_timesteps=args.num_timesteps, seed=args.seed)
|
||||
|
||||
|
||||
if __name__ == '__main__':
|
||||
main()
|
||||
|
@@ -6,11 +6,8 @@ import time
|
||||
from baselines.common import colorize
|
||||
from mpi4py import MPI
|
||||
from collections import deque
|
||||
from baselines.common import set_global_seeds
|
||||
from baselines.common.mpi_adam import MpiAdam
|
||||
from baselines.common.cg import cg
|
||||
from baselines.common.input import observation_placeholder
|
||||
from baselines.common.policies import build_policy
|
||||
from contextlib import contextmanager
|
||||
|
||||
def traj_segment_generator(pi, env, horizon, stochastic):
|
||||
@@ -36,7 +33,7 @@ def traj_segment_generator(pi, env, horizon, stochastic):
|
||||
|
||||
while True:
|
||||
prevac = ac
|
||||
ac, vpred, _, _ = pi.step(ob, stochastic=stochastic)
|
||||
ac, vpred = pi.act(stochastic, ob)
|
||||
# Slight weirdness here because we need value function at time T
|
||||
# before returning segment [0, T-1] so we get the correct
|
||||
# terminal value
|
||||
@@ -44,7 +41,7 @@ def traj_segment_generator(pi, env, horizon, stochastic):
|
||||
yield {"ob" : obs, "rew" : rews, "vpred" : vpreds, "new" : news,
|
||||
"ac" : acs, "prevac" : prevacs, "nextvpred": vpred * (1 - new),
|
||||
"ep_rets" : ep_rets, "ep_lens" : ep_lens}
|
||||
_, vpred, _, _ = pi.step(ob, stochastic=stochastic)
|
||||
_, vpred = pi.act(stochastic, ob)
|
||||
# Be careful!!! if you change the downstream algorithm to aggregate
|
||||
# several of these batches, then be sure to do a deepcopy
|
||||
ep_rets = []
|
||||
@@ -82,100 +79,30 @@ def add_vtarg_and_adv(seg, gamma, lam):
|
||||
gaelam[t] = lastgaelam = delta + gamma * lam * nonterminal * lastgaelam
|
||||
seg["tdlamret"] = seg["adv"] + seg["vpred"]
|
||||
|
||||
def learn(*,
|
||||
network,
|
||||
env,
|
||||
total_timesteps,
|
||||
timesteps_per_batch=1024, # what to train on
|
||||
max_kl=0.001,
|
||||
cg_iters=10,
|
||||
gamma=0.99,
|
||||
lam=1.0, # advantage estimation
|
||||
seed=None,
|
||||
def learn(env, policy_fn, *,
|
||||
timesteps_per_batch, # what to train on
|
||||
max_kl, cg_iters,
|
||||
gamma, lam, # advantage estimation
|
||||
entcoeff=0.0,
|
||||
cg_damping=1e-2,
|
||||
vf_stepsize=3e-4,
|
||||
vf_iters =3,
|
||||
max_episodes=0, max_iters=0, # time constraint
|
||||
callback=None,
|
||||
load_path=None,
|
||||
**network_kwargs
|
||||
max_timesteps=0, max_episodes=0, max_iters=0, # time constraint
|
||||
callback=None
|
||||
):
|
||||
'''
|
||||
learn a policy function with TRPO algorithm
|
||||
|
||||
Parameters:
|
||||
----------
|
||||
|
||||
network neural network to learn. Can be either string ('mlp', 'cnn', 'lstm', 'lnlstm' for basic types)
|
||||
or function that takes input placeholder and returns tuple (output, None) for feedforward nets
|
||||
or (output, (state_placeholder, state_output, mask_placeholder)) for recurrent nets
|
||||
|
||||
env environment (one of the gym environments or wrapped via baselines.common.vec_env.VecEnv-type class
|
||||
|
||||
timesteps_per_batch timesteps per gradient estimation batch
|
||||
|
||||
max_kl max KL divergence between old policy and new policy ( KL(pi_old || pi) )
|
||||
|
||||
entcoeff coefficient of policy entropy term in the optimization objective
|
||||
|
||||
cg_iters number of iterations of conjugate gradient algorithm
|
||||
|
||||
cg_damping conjugate gradient damping
|
||||
|
||||
vf_stepsize learning rate for adam optimizer used to optimie value function loss
|
||||
|
||||
vf_iters number of iterations of value function optimization iterations per each policy optimization step
|
||||
|
||||
total_timesteps max number of timesteps
|
||||
|
||||
max_episodes max number of episodes
|
||||
|
||||
max_iters maximum number of policy optimization iterations
|
||||
|
||||
callback function to be called with (locals(), globals()) each policy optimization step
|
||||
|
||||
load_path str, path to load the model from (default: None, i.e. no model is loaded)
|
||||
|
||||
**network_kwargs keyword arguments to the policy / network builder. See baselines.common/policies.py/build_policy and arguments to a particular type of network
|
||||
|
||||
Returns:
|
||||
-------
|
||||
|
||||
learnt model
|
||||
|
||||
'''
|
||||
|
||||
|
||||
nworkers = MPI.COMM_WORLD.Get_size()
|
||||
rank = MPI.COMM_WORLD.Get_rank()
|
||||
|
||||
cpus_per_worker = 1
|
||||
U.get_session(config=tf.ConfigProto(
|
||||
allow_soft_placement=True,
|
||||
inter_op_parallelism_threads=cpus_per_worker,
|
||||
intra_op_parallelism_threads=cpus_per_worker
|
||||
))
|
||||
|
||||
|
||||
policy = build_policy(env, network, value_network='copy', **network_kwargs)
|
||||
set_global_seeds(seed)
|
||||
|
||||
np.set_printoptions(precision=3)
|
||||
# Setup losses and stuff
|
||||
# ----------------------------------------
|
||||
ob_space = env.observation_space
|
||||
ac_space = env.action_space
|
||||
|
||||
ob = observation_placeholder(ob_space)
|
||||
with tf.variable_scope("pi"):
|
||||
pi = policy(observ_placeholder=ob)
|
||||
with tf.variable_scope("oldpi"):
|
||||
oldpi = policy(observ_placeholder=ob)
|
||||
|
||||
pi = policy_fn("pi", ob_space, ac_space)
|
||||
oldpi = policy_fn("oldpi", ob_space, ac_space)
|
||||
atarg = tf.placeholder(dtype=tf.float32, shape=[None]) # Target advantage function (if applicable)
|
||||
ret = tf.placeholder(dtype=tf.float32, shape=[None]) # Empirical return
|
||||
|
||||
ob = U.get_placeholder_cached(name="ob")
|
||||
ac = pi.pdtype.sample_placeholder([None])
|
||||
|
||||
kloldnew = oldpi.pd.kl(pi.pd)
|
||||
@@ -184,7 +111,7 @@ def learn(*,
|
||||
meanent = tf.reduce_mean(ent)
|
||||
entbonus = entcoeff * meanent
|
||||
|
||||
vferr = tf.reduce_mean(tf.square(pi.vf - ret))
|
||||
vferr = tf.reduce_mean(tf.square(pi.vpred - ret))
|
||||
|
||||
ratio = tf.exp(pi.pd.logp(ac) - oldpi.pd.logp(ac)) # advantage * pnew / pold
|
||||
surrgain = tf.reduce_mean(ratio * atarg)
|
||||
@@ -195,12 +122,9 @@ def learn(*,
|
||||
|
||||
dist = meankl
|
||||
|
||||
all_var_list = get_trainable_variables("pi")
|
||||
# var_list = [v for v in all_var_list if v.name.split("/")[1].startswith("pol")]
|
||||
# vf_var_list = [v for v in all_var_list if v.name.split("/")[1].startswith("vf")]
|
||||
var_list = get_pi_trainable_variables("pi")
|
||||
vf_var_list = get_vf_trainable_variables("pi")
|
||||
|
||||
all_var_list = pi.get_trainable_variables()
|
||||
var_list = [v for v in all_var_list if v.name.split("/")[1].startswith("pol")]
|
||||
vf_var_list = [v for v in all_var_list if v.name.split("/")[1].startswith("vf")]
|
||||
vfadam = MpiAdam(vf_var_list)
|
||||
|
||||
get_flat = U.GetFlat(var_list)
|
||||
@@ -218,8 +142,7 @@ def learn(*,
|
||||
fvp = U.flatgrad(gvp, var_list)
|
||||
|
||||
assign_old_eq_new = U.function([],[], updates=[tf.assign(oldv, newv)
|
||||
for (oldv, newv) in zipsame(get_variables("oldpi"), get_variables("pi"))])
|
||||
|
||||
for (oldv, newv) in zipsame(oldpi.get_variables(), pi.get_variables())])
|
||||
compute_losses = U.function([ob, ac, atarg], losses)
|
||||
compute_lossandgrad = U.function([ob, ac, atarg], losses + [U.flatgrad(optimgain, var_list)])
|
||||
compute_fvp = U.function([flat_tangent, ob, ac, atarg], fvp)
|
||||
@@ -243,9 +166,6 @@ def learn(*,
|
||||
return out
|
||||
|
||||
U.initialize()
|
||||
if load_path is not None:
|
||||
pi.load(load_path)
|
||||
|
||||
th_init = get_flat()
|
||||
MPI.COMM_WORLD.Bcast(th_init, root=0)
|
||||
set_from_flat(th_init)
|
||||
@@ -263,16 +183,11 @@ def learn(*,
|
||||
lenbuffer = deque(maxlen=40) # rolling buffer for episode lengths
|
||||
rewbuffer = deque(maxlen=40) # rolling buffer for episode rewards
|
||||
|
||||
if sum([max_iters>0, total_timesteps>0, max_episodes>0])==0:
|
||||
# noththing to be done
|
||||
return pi
|
||||
|
||||
assert sum([max_iters>0, total_timesteps>0, max_episodes>0]) < 2, \
|
||||
'out of max_iters, total_timesteps, and max_episodes only one should be specified'
|
||||
assert sum([max_iters>0, max_timesteps>0, max_episodes>0])==1
|
||||
|
||||
while True:
|
||||
if callback: callback(locals(), globals())
|
||||
if total_timesteps and timesteps_so_far >= total_timesteps:
|
||||
if max_timesteps and timesteps_so_far >= max_timesteps:
|
||||
break
|
||||
elif max_episodes and episodes_so_far >= max_episodes:
|
||||
break
|
||||
@@ -372,20 +287,5 @@ def learn(*,
|
||||
if rank==0:
|
||||
logger.dump_tabular()
|
||||
|
||||
return pi
|
||||
|
||||
def flatten_lists(listoflists):
|
||||
return [el for list_ in listoflists for el in list_]
|
||||
|
||||
def get_variables(scope):
|
||||
return tf.get_collection(tf.GraphKeys.GLOBAL_VARIABLES, scope)
|
||||
|
||||
def get_trainable_variables(scope):
|
||||
return tf.get_collection(tf.GraphKeys.TRAINABLE_VARIABLES, scope)
|
||||
|
||||
def get_vf_trainable_variables(scope):
|
||||
return [v for v in get_trainable_variables(scope) if 'vf' in v.name[len(scope):].split('/')]
|
||||
|
||||
def get_pi_trainable_variables(scope):
|
||||
return [v for v in get_trainable_variables(scope) if 'pi' in v.name[len(scope):].split('/')]
|
||||
|
||||
return [el for list_ in listoflists for el in list_]
|
12351
benchmarks_atari10M.htm
12351
benchmarks_atari10M.htm
File diff suppressed because it is too large
Load Diff
File diff suppressed because it is too large
Load Diff
19
conftest.py
19
conftest.py
@@ -1,19 +0,0 @@
|
||||
import pytest
|
||||
|
||||
|
||||
def pytest_addoption(parser):
|
||||
parser.addoption('--runslow', action='store_true', default=False, help='run slow tests')
|
||||
|
||||
|
||||
def pytest_collection_modifyitems(config, items):
|
||||
if config.getoption('--runslow'):
|
||||
# --runslow given in cli: do not skip slow tests
|
||||
return
|
||||
skip_slow = pytest.mark.skip(reason='need --runslow option to run')
|
||||
slow_tests = []
|
||||
for item in items:
|
||||
if 'slow' in item.keywords:
|
||||
slow_tests.append(item.name)
|
||||
item.add_marker(skip_slow)
|
||||
|
||||
print('skipping slow tests', ' '.join(slow_tests), 'use --runslow to run this')
|
7
setup.py
7
setup.py
@@ -14,6 +14,7 @@ setup(name='baselines',
|
||||
'scipy',
|
||||
'tqdm',
|
||||
'joblib',
|
||||
'zmq',
|
||||
'dill',
|
||||
'progressbar2',
|
||||
'mpi4py',
|
||||
@@ -22,12 +23,6 @@ setup(name='baselines',
|
||||
'click',
|
||||
'opencv-python'
|
||||
],
|
||||
extras_require={
|
||||
'test': [
|
||||
'filelock',
|
||||
'pytest'
|
||||
]
|
||||
},
|
||||
description='OpenAI baselines: high quality implementations of reinforcement learning algorithms',
|
||||
author='OpenAI',
|
||||
url='https://github.com/openai/baselines',
|
||||
|
Reference in New Issue
Block a user